SK4122002A3 - 7-Acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof - Google Patents
7-Acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof Download PDFInfo
- Publication number
- SK4122002A3 SK4122002A3 SK412-2002A SK4122002A SK4122002A3 SK 4122002 A3 SK4122002 A3 SK 4122002A3 SK 4122002 A SK4122002 A SK 4122002A SK 4122002 A3 SK4122002 A3 SK 4122002A3
- Authority
- SK
- Slovakia
- Prior art keywords
- cephem
- amino
- carboxylic acid
- acetamido
- ylthio
- Prior art date
Links
- 239000000651 prodrug Substances 0.000 title abstract description 26
- 229940002612 prodrug Drugs 0.000 title abstract description 26
- 239000003242 anti bacterial agent Substances 0.000 title abstract description 13
- 239000002253 acid Substances 0.000 title description 19
- 229940088710 antibiotic agent Drugs 0.000 title description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 294
- 150000003839 salts Chemical class 0.000 claims abstract description 48
- -1 2-amino-5-chlorothiazol-4-yl Chemical group 0.000 claims description 640
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 192
- 239000000203 mixture Substances 0.000 claims description 96
- 125000001424 substituent group Chemical group 0.000 claims description 70
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 52
- 229910052757 nitrogen Inorganic materials 0.000 claims description 45
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 39
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 34
- 241000894006 Bacteria Species 0.000 claims description 28
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 25
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 24
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 22
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims description 17
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 16
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 16
- 239000000460 chlorine Chemical group 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 241000124008 Mammalia Species 0.000 claims description 14
- 229960003085 meticillin Drugs 0.000 claims description 14
- RJQXTJLFIWVMTO-TYNCELHUSA-N Methicillin Chemical compound COC1=CC=CC(OC)=C1C(=O)N[C@@H]1C(=O)N2[C@@H](C(O)=O)C(C)(C)S[C@@H]21 RJQXTJLFIWVMTO-TYNCELHUSA-N 0.000 claims description 13
- 229910052801 chlorine Chemical group 0.000 claims description 13
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 10
- 230000000844 anti-bacterial effect Effects 0.000 claims description 9
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 claims description 8
- 125000002103 4,4'-dimethoxytriphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)(C1=C([H])C([H])=C(OC([H])([H])[H])C([H])=C1[H])C1=C([H])C([H])=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 8
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 8
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 8
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 8
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 8
- 125000002927 2-methoxybenzyl group Chemical group [H]C1=C([H])C([H])=C(C(OC([H])([H])[H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 7
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 7
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 7
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 6
- 108090000790 Enzymes Proteins 0.000 claims description 6
- 102000004190 Enzymes Human genes 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 239000003937 drug carrier Substances 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 4
- LHBXOUDOBYWKFJ-XXWSSQRBSA-N (6R,7R)-7-[[(2Z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[2-[2-(diaminomethylideneamino)ethylsulfanylmethyl]pyridin-3-yl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC=1SC(=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C(=NC=CC=2)CSCCNC(=N)N)C(=O)O)C1=O)=N/O)Cl LHBXOUDOBYWKFJ-XXWSSQRBSA-N 0.000 claims description 3
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 claims description 3
- 241000344863 Staphylococcus aureus subsp. aureus COL Species 0.000 claims description 3
- 241000191984 Staphylococcus haemolyticus Species 0.000 claims description 3
- YMBOKCFFCGMUBS-VFYRPSQSSA-N NC1=NC(=CC=C1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C=NC=CC=2CSCCN)C(=O)O)C1=O)=N/O Chemical compound NC1=NC(=CC=C1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C=NC=CC=2CSCCN)C(=O)O)C1=O)=N/O YMBOKCFFCGMUBS-VFYRPSQSSA-N 0.000 claims description 2
- 206010041925 Staphylococcal infections Diseases 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 2
- SCSMAWFISUMSTO-ZTJYIHJESA-N (6R,7R)-3-[2-(2-aminoethylsulfanylmethyl)pyridin-3-yl]sulfanyl-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C(=NC=CC=2)CSCCN)C(=O)O)C1=O)=N/O SCSMAWFISUMSTO-ZTJYIHJESA-N 0.000 claims 1
- SBUOHGKIOVRDKY-UHFFFAOYSA-N 4-methyl-1,3-dioxolane Chemical compound CC1COCO1 SBUOHGKIOVRDKY-UHFFFAOYSA-N 0.000 claims 1
- SWQWTDAWUSBMGA-UHFFFAOYSA-N 5-chloro-1,3-thiazol-2-amine Chemical compound NC1=NC=C(Cl)S1 SWQWTDAWUSBMGA-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 46
- 239000003782 beta lactam antibiotic agent Substances 0.000 abstract description 15
- 239000002132 β-lactam antibiotic Substances 0.000 abstract description 14
- 229940124586 β-lactam antibiotics Drugs 0.000 abstract description 14
- 230000003115 biocidal effect Effects 0.000 abstract description 4
- 239000000543 intermediate Substances 0.000 abstract description 4
- 238000001228 spectrum Methods 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 389
- 239000000243 solution Substances 0.000 description 227
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 219
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 207
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 150
- 235000019439 ethyl acetate Nutrition 0.000 description 129
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 128
- 239000011541 reaction mixture Substances 0.000 description 115
- 238000005481 NMR spectroscopy Methods 0.000 description 107
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 97
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 67
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 64
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 58
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 57
- 238000006243 chemical reaction Methods 0.000 description 56
- 239000007787 solid Substances 0.000 description 55
- 239000012074 organic phase Substances 0.000 description 52
- 210000002966 serum Anatomy 0.000 description 52
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 51
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 50
- 229910052938 sodium sulfate Inorganic materials 0.000 description 50
- 235000011152 sodium sulphate Nutrition 0.000 description 50
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- 239000002904 solvent Substances 0.000 description 46
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 46
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 45
- 239000000741 silica gel Substances 0.000 description 44
- 229910002027 silica gel Inorganic materials 0.000 description 44
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 43
- 230000002829 reductive effect Effects 0.000 description 41
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- 238000003756 stirring Methods 0.000 description 38
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 35
- 239000012267 brine Substances 0.000 description 35
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 35
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- 229930186147 Cephalosporin Natural products 0.000 description 31
- 229940124587 cephalosporin Drugs 0.000 description 31
- 239000000047 product Substances 0.000 description 29
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 26
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 25
- 125000000623 heterocyclic group Chemical group 0.000 description 24
- 235000017557 sodium bicarbonate Nutrition 0.000 description 24
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 24
- 239000000725 suspension Substances 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- 150000001780 cephalosporins Chemical class 0.000 description 22
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 20
- 239000000284 extract Substances 0.000 description 20
- 239000012071 phase Substances 0.000 description 20
- 239000002244 precipitate Substances 0.000 description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 19
- 125000003118 aryl group Chemical group 0.000 description 19
- 229940098779 methanesulfonic acid Drugs 0.000 description 19
- 238000000746 purification Methods 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 17
- 229910052794 bromium Inorganic materials 0.000 description 17
- 208000015181 infectious disease Diseases 0.000 description 16
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 15
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 15
- 229940126657 Compound 17 Drugs 0.000 description 15
- 241000700159 Rattus Species 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- 235000019198 oils Nutrition 0.000 description 15
- 239000008346 aqueous phase Substances 0.000 description 14
- 230000001580 bacterial effect Effects 0.000 description 14
- 239000002585 base Substances 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 125000006239 protecting group Chemical group 0.000 description 14
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 14
- 241000282414 Homo sapiens Species 0.000 description 13
- 125000003342 alkenyl group Chemical group 0.000 description 13
- 125000003545 alkoxy group Chemical group 0.000 description 13
- 238000004587 chromatography analysis Methods 0.000 description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 13
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 12
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 12
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 11
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 11
- 241000191967 Staphylococcus aureus Species 0.000 description 11
- 125000004414 alkyl thio group Chemical group 0.000 description 11
- 239000012043 crude product Substances 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 10
- 108010059993 Vancomycin Proteins 0.000 description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 125000004093 cyano group Chemical group *C#N 0.000 description 10
- 239000002054 inoculum Substances 0.000 description 10
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 9
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 235000010633 broth Nutrition 0.000 description 9
- 239000011737 fluorine Substances 0.000 description 9
- 229910052731 fluorine Inorganic materials 0.000 description 9
- 125000001072 heteroaryl group Chemical group 0.000 description 9
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 9
- MYPYJXKWCTUITO-LYRMYLQWSA-N vancomycin Chemical compound O([C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C2C=C3C=C1OC1=CC=C(C=C1Cl)[C@@H](O)[C@H](C(N[C@@H](CC(N)=O)C(=O)N[C@H]3C(=O)N[C@H]1C(=O)N[C@H](C(N[C@@H](C3=CC(O)=CC(O)=C3C=3C(O)=CC=C1C=3)C(O)=O)=O)[C@H](O)C1=CC=C(C(=C1)Cl)O2)=O)NC(=O)[C@@H](CC(C)C)NC)[C@H]1C[C@](C)(N)[C@H](O)[C@H](C)O1 MYPYJXKWCTUITO-LYRMYLQWSA-N 0.000 description 9
- MYPYJXKWCTUITO-UHFFFAOYSA-N vancomycin Natural products O1C(C(=C2)Cl)=CC=C2C(O)C(C(NC(C2=CC(O)=CC(O)=C2C=2C(O)=CC=C3C=2)C(O)=O)=O)NC(=O)C3NC(=O)C2NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(CC(C)C)NC)C(O)C(C=C3Cl)=CC=C3OC3=CC2=CC1=C3OC1OC(CO)C(O)C(O)C1OC1CC(C)(N)C(O)C(C)O1 MYPYJXKWCTUITO-UHFFFAOYSA-N 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 8
- 238000010511 deprotection reaction Methods 0.000 description 8
- 230000001976 improved effect Effects 0.000 description 8
- 125000004076 pyridyl group Chemical group 0.000 description 8
- 229920006395 saturated elastomer Polymers 0.000 description 8
- 238000010898 silica gel chromatography Methods 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229960003165 vancomycin Drugs 0.000 description 8
- 208000035143 Bacterial infection Diseases 0.000 description 7
- 241001465754 Metazoa Species 0.000 description 7
- BHIIGRBMZRSDRI-UHFFFAOYSA-N [chloro(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(Cl)OC1=CC=CC=C1 BHIIGRBMZRSDRI-UHFFFAOYSA-N 0.000 description 7
- 208000022362 bacterial infectious disease Diseases 0.000 description 7
- 238000010790 dilution Methods 0.000 description 7
- 239000012895 dilution Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 239000006260 foam Substances 0.000 description 7
- 239000007924 injection Substances 0.000 description 7
- 238000002347 injection Methods 0.000 description 7
- 239000011777 magnesium Substances 0.000 description 7
- 125000004043 oxo group Chemical group O=* 0.000 description 7
- 230000028327 secretion Effects 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- 238000004809 thin layer chromatography Methods 0.000 description 7
- 238000011282 treatment Methods 0.000 description 7
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 6
- LEOWNGVPERFABF-UHFFFAOYSA-N 2-[[3-[[2-(2-aminoethylsulfanylmethyl)pyridin-3-yl]disulfanyl]pyridin-2-yl]methylsulfanyl]ethanamine Chemical compound NCCSCC1=NC=CC=C1SSC1=CC=CN=C1CSCCN LEOWNGVPERFABF-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 125000005518 carboxamido group Chemical group 0.000 description 6
- 238000004090 dissolution Methods 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000011156 evaluation Methods 0.000 description 6
- 238000003818 flash chromatography Methods 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- 150000007529 inorganic bases Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- QFGYIYPFJRWSNR-UHFFFAOYSA-M sodium;2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-2-yl]-2-trityloxyiminoacetate Chemical compound [Na+].CC(C)(C)OC(=O)NC1=CC=CC(C(=NOC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C([O-])=O)=N1 QFGYIYPFJRWSNR-UHFFFAOYSA-M 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 150000003573 thiols Chemical class 0.000 description 6
- MWKYKRCFPMNVEX-UHFFFAOYSA-N 2-[(3-tritylsulfanylpyridin-2-yl)methylsulfanyl]ethanamine Chemical compound NCCSCC1=NC=CC=C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 MWKYKRCFPMNVEX-UHFFFAOYSA-N 0.000 description 5
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 5
- 102000004506 Blood Proteins Human genes 0.000 description 5
- 108010017384 Blood Proteins Proteins 0.000 description 5
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 241000282553 Macaca Species 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 5
- WKDDRNSBRWANNC-UHFFFAOYSA-N Thienamycin Natural products C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 description 5
- 125000002947 alkylene group Chemical group 0.000 description 5
- 230000000845 anti-microbial effect Effects 0.000 description 5
- BKABXCICWBLURM-OXQOHEQNSA-N benzhydryl (6r,7r)-7-amino-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@H]1N2C([C@H]1N)=O)CC(OS(=O)(=O)C)=C2C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 BKABXCICWBLURM-OXQOHEQNSA-N 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 229940125851 compound 27 Drugs 0.000 description 5
- 229940126214 compound 3 Drugs 0.000 description 5
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 5
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 5
- ZSKVGTPCRGIANV-ZXFLCMHBSA-N imipenem Chemical compound C1C(SCC\N=C\N)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 ZSKVGTPCRGIANV-ZXFLCMHBSA-N 0.000 description 5
- 229960002182 imipenem Drugs 0.000 description 5
- 238000000338 in vitro Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 150000007530 organic bases Chemical class 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 125000003107 substituted aryl group Chemical group 0.000 description 5
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 5
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 5
- 230000004083 survival effect Effects 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- 150000007944 thiolates Chemical class 0.000 description 5
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 4
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 4
- MEAPLJSPMZRBNH-UHFFFAOYSA-N (3-tritylsulfanylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC=C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 MEAPLJSPMZRBNH-UHFFFAOYSA-N 0.000 description 4
- PLGHIBUZZRUYHE-RUQIKYNFSA-N (6r)-4-acetamido-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=C(Cl)C(NC(=O)C)S[C@@H]2CC(=O)N21 PLGHIBUZZRUYHE-RUQIKYNFSA-N 0.000 description 4
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- UPUWMQZUXFAUCJ-UHFFFAOYSA-N 2,5-dihydro-1,2-thiazole Chemical compound C1SNC=C1 UPUWMQZUXFAUCJ-UHFFFAOYSA-N 0.000 description 4
- URWVYLBLTMCEJD-UHFFFAOYSA-N 2-(chloromethyl)-3-tritylsulfanylpyridine;hydrochloride Chemical compound Cl.ClCC1=NC=CC=C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 URWVYLBLTMCEJD-UHFFFAOYSA-N 0.000 description 4
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 4
- 101100313763 Arabidopsis thaliana TIM22-2 gene Proteins 0.000 description 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 206010040047 Sepsis Diseases 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- 125000003368 amide group Chemical group 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 125000002091 cationic group Chemical group 0.000 description 4
- 238000005119 centrifugation Methods 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- 229940126543 compound 14 Drugs 0.000 description 4
- 229940125758 compound 15 Drugs 0.000 description 4
- 229940126086 compound 21 Drugs 0.000 description 4
- 229940125833 compound 23 Drugs 0.000 description 4
- 229940125846 compound 25 Drugs 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 238000006731 degradation reaction Methods 0.000 description 4
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 238000004108 freeze drying Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 230000012010 growth Effects 0.000 description 4
- 150000004679 hydroxides Chemical class 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 238000011534 incubation Methods 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachloro-phenol Natural products OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 230000002441 reversible effect Effects 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- 208000013223 septicemia Diseases 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 235000009518 sodium iodide Nutrition 0.000 description 4
- 239000006228 supernatant Substances 0.000 description 4
- 208000024891 symptom Diseases 0.000 description 4
- GSJJCZSHYJNRPN-UHFFFAOYSA-N tert-butyl n-(2-sulfanylethyl)carbamate Chemical compound CC(C)(C)OC(=O)NCCS GSJJCZSHYJNRPN-UHFFFAOYSA-N 0.000 description 4
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 description 4
- 125000000335 thiazolyl group Chemical group 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 4
- DIUMJILQVJWZRI-XHPQRKPJSA-N (2z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetic acid Chemical compound S1C(N)=NC(C(=N\OC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)\C(O)=O)=N1 DIUMJILQVJWZRI-XHPQRKPJSA-N 0.000 description 3
- FHTMZRQLDGUHNU-UHFFFAOYSA-N 2-(2-aminoethylsulfanylmethyl)pyridine-3-thiol;dihydrochloride Chemical compound Cl.Cl.NCCSCC1=NC=CC=C1S FHTMZRQLDGUHNU-UHFFFAOYSA-N 0.000 description 3
- GPYVSYAHJNHLFL-UHFFFAOYSA-N 2-(pyridin-4-ylmethylsulfanyl)ethanamine Chemical compound NCCSCC1=CC=NC=C1 GPYVSYAHJNHLFL-UHFFFAOYSA-N 0.000 description 3
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 3
- GRMSGHRDAQHBEV-UHFFFAOYSA-N 5-[2-(benzenesulfonyl)ethylsulfanyl]-4-(chloromethyl)-1,3-thiazole Chemical compound N1=CSC(SCCS(=O)(=O)C=2C=CC=CC=2)=C1CCl GRMSGHRDAQHBEV-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- XJBZYIVFYRSGCK-LPNHBSBCSA-N CC1=CC=C(C=C1)S(=O)(=O)O.N[C@H]1[C@@H]2N(C(=C(CS2)OS(=O)(=O)C)C(=O)O)C1=O Chemical compound CC1=CC=C(C=C1)S(=O)(=O)O.N[C@H]1[C@@H]2N(C(=C(CS2)OS(=O)(=O)C)C(=O)O)C1=O XJBZYIVFYRSGCK-LPNHBSBCSA-N 0.000 description 3
- 241000194031 Enterococcus faecium Species 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 235000019270 ammonium chloride Nutrition 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 3
- 229960000723 ampicillin Drugs 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000002051 biphasic effect Effects 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- JOXAVGLMHKTDEC-DWVKKRMSSA-N chembl284923 Chemical compound N1=CSC(SC=2CS[C@H]3N(C([C@H]3NC(=O)C(=N/O)\C=3N=C(N)C=CC=3)=O)C=2C(O)=O)=C1CSCCN JOXAVGLMHKTDEC-DWVKKRMSSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229940125810 compound 20 Drugs 0.000 description 3
- 238000007865 diluting Methods 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- UZUODNWWWUQRIR-UHFFFAOYSA-L disodium;3-aminonaphthalene-1,5-disulfonate Chemical compound [Na+].[Na+].C1=CC=C(S([O-])(=O)=O)C2=CC(N)=CC(S([O-])(=O)=O)=C21 UZUODNWWWUQRIR-UHFFFAOYSA-L 0.000 description 3
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 230000036541 health Effects 0.000 description 3
- 239000012456 homogeneous solution Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 238000007918 intramuscular administration Methods 0.000 description 3
- 238000007912 intraperitoneal administration Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 101150018609 pbp2a gene Proteins 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000003444 phase transfer catalyst Substances 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 159000000001 potassium salts Chemical class 0.000 description 3
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 3
- 229940116357 potassium thiocyanate Drugs 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 108010033419 somatotropin-binding protein Proteins 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- YKEDJDFUCSATBS-IOJJLOCKSA-N tert-butyl (6r)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound CC(C)(C)OC(=O)C1=C(Cl)CS[C@@H]2C(N)C(=O)N12 YKEDJDFUCSATBS-IOJJLOCKSA-N 0.000 description 3
- KJNQLYWIOYXBCE-UHFFFAOYSA-N tert-butyl n-[2-[[3-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanylmethyl]pyridin-3-yl]disulfanyl]pyridin-2-yl]methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=NC=CC=C1SSC1=CC=CN=C1CSCCNC(=O)OC(C)(C)C KJNQLYWIOYXBCE-UHFFFAOYSA-N 0.000 description 3
- 125000004665 trialkylsilyl group Chemical group 0.000 description 3
- 150000003952 β-lactams Chemical class 0.000 description 3
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 2
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 2
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 2
- GQSMESDOZUWEBT-UHFFFAOYSA-N (3-sulfanylpyridin-4-yl)methanol Chemical compound OCC1=CC=NC=C1S GQSMESDOZUWEBT-UHFFFAOYSA-N 0.000 description 2
- UIZPNPAYZGIEPC-UHFFFAOYSA-N (3-tert-butylsulfanylpyridin-2-yl)methanol Chemical compound CC(C)(C)SC1=CC=CN=C1CO UIZPNPAYZGIEPC-UHFFFAOYSA-N 0.000 description 2
- UXMOTLHQEVCPLJ-UHFFFAOYSA-N (3-tritylsulfanylpyridin-4-yl)methanol Chemical compound OCC1=CC=NC=C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 UXMOTLHQEVCPLJ-UHFFFAOYSA-N 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 2
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 2
- KHLXFYVESBGCJT-GRNXRMRJSA-N (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-hydroxyiminoacetyl]amino]-3-[2-[2-(diaminomethylideneamino)ethylsulfanylmethyl]pyridin-3-yl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C(=NC=CC=2)CSCCNC(=N)N)C(=O)O)C1=O)=N/O KHLXFYVESBGCJT-GRNXRMRJSA-N 0.000 description 2
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 2
- WGDPTJCVARVGSO-BANRFUHISA-N (6r,7r)-7-[[(2z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[[2-(2-aminoethylamino)-4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-5-yl]sulfanyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(NCCN)=NC(CSCCN)=C1SC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)C(=N/O)\C3=C(SC(N)=N3)Cl)[C@H]2SC1 WGDPTJCVARVGSO-BANRFUHISA-N 0.000 description 2
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 2
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 2
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 2
- LMZMOBDCCKAQMU-UHFFFAOYSA-N 2-(2-aminoethylsulfanylmethyl)pyridine-3-thiol;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.NCCSCC1=NC=CC=C1S LMZMOBDCCKAQMU-UHFFFAOYSA-N 0.000 description 2
- LAGDTVXMWKMYSS-UHFFFAOYSA-N 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetic acid Chemical compound CCOC(=O)NC1=NC(CC(O)=O)=NS1 LAGDTVXMWKMYSS-UHFFFAOYSA-N 0.000 description 2
- OKCKAVVNNLNMBE-UHFFFAOYSA-N 2-[[3-[[2-(2-aminoethylsulfanylmethyl)pyridin-3-yl]disulfanyl]pyridin-2-yl]methylsulfanyl]ethanamine tetrahydrochloride Chemical compound Cl.Cl.Cl.Cl.NCCSCc1ncccc1SSc1cccnc1CSCCN OKCKAVVNNLNMBE-UHFFFAOYSA-N 0.000 description 2
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 2
- QYKUGBMFPFOPNE-UHFFFAOYSA-N 4-(chloromethyl)-1,3-thiazol-2-amine Chemical compound NC1=NC(CCl)=CS1 QYKUGBMFPFOPNE-UHFFFAOYSA-N 0.000 description 2
- BAKRLXXGKFJLGF-UHFFFAOYSA-N 5-[2-(benzenesulfonyl)ethylsulfanyl]-2-chloro-4-(chloromethyl)-1,3-thiazole Chemical compound N1=C(Cl)SC(SCCS(=O)(=O)C=2C=CC=CC=2)=C1CCl BAKRLXXGKFJLGF-UHFFFAOYSA-N 0.000 description 2
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 241000194033 Enterococcus Species 0.000 description 2
- 241000194032 Enterococcus faecalis Species 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 108090000144 Human Proteins Proteins 0.000 description 2
- 102000003839 Human Proteins Human genes 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 2
- NZWHEGZNJJRXOG-GRNXRMRJSA-N NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(C=NC=C2)CSCCNC(=N)N)C(=O)O)C1=O)=N/O Chemical compound NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(C=NC=C2)CSCCNC(=N)N)C(=O)O)C1=O)=N/O NZWHEGZNJJRXOG-GRNXRMRJSA-N 0.000 description 2
- JIHSMGCFJYLXNW-FSUQAKICSA-N NC=1SC(=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(N=C(S2)SCCN)CSCCN)C(=O)O)C1=O)=N/O)Cl Chemical compound NC=1SC(=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(N=C(S2)SCCN)CSCCN)C(=O)O)C1=O)=N/O)Cl JIHSMGCFJYLXNW-FSUQAKICSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- 108700020474 Penicillin-Binding Proteins Proteins 0.000 description 2
- 101710202686 Penicillin-sensitive transpeptidase Proteins 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 2
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 2
- JDVMRPYHXVRMSE-XDUZALLESA-M [Na+].S1C(N)=NC(C(=N\OC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)\C([O-])=O)=N1 Chemical compound [Na+].S1C(N)=NC(C(=N\OC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)\C([O-])=O)=N1 JDVMRPYHXVRMSE-XDUZALLESA-M 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 229960005261 aspartic acid Drugs 0.000 description 2
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000003857 carboxamides Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 229960004261 cefotaxime Drugs 0.000 description 2
- AZZMGZXNTDTSME-JUZDKLSSSA-M cefotaxime sodium Chemical compound [Na+].N([C@@H]1C(N2C(=C(COC(C)=O)CS[C@@H]21)C([O-])=O)=O)C(=O)\C(=N/OC)C1=CSC(N)=N1 AZZMGZXNTDTSME-JUZDKLSSSA-M 0.000 description 2
- 210000002421 cell wall Anatomy 0.000 description 2
- SNFBKZNBHQDMFE-VFYRPSQSSA-N chembl31193 Chemical compound NCCSCC1=CN=CC=C1SC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)C(=N/O)\C=3N=C(N)C=CC=3)[C@H]2SC1 SNFBKZNBHQDMFE-VFYRPSQSSA-N 0.000 description 2
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 2
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 2
- 229960002023 chloroprocaine Drugs 0.000 description 2
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 2
- 229960001231 choline Drugs 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940125773 compound 10 Drugs 0.000 description 2
- 229940125797 compound 12 Drugs 0.000 description 2
- 229940126142 compound 16 Drugs 0.000 description 2
- 229940125782 compound 2 Drugs 0.000 description 2
- 229940126208 compound 22 Drugs 0.000 description 2
- 229940125961 compound 24 Drugs 0.000 description 2
- 229940127204 compound 29 Drugs 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 239000013256 coordination polymer Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 229960005215 dichloroacetic acid Drugs 0.000 description 2
- YFAGHNZHGGCZAX-JKIFEVAISA-N dicloxacillin Chemical compound N([C@@H]1C(N2[C@H](C(C)(C)S[C@@H]21)C(O)=O)=O)C(=O)C1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl YFAGHNZHGGCZAX-JKIFEVAISA-N 0.000 description 2
- 229960001585 dicloxacillin Drugs 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 229940043237 diethanolamine Drugs 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 229940012017 ethylenediamine Drugs 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- UQSQSQZYBQSBJZ-UHFFFAOYSA-M fluorosulfonate Chemical group [O-]S(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-M 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229960003194 meglumine Drugs 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- SHIXYLPEFYFKLM-SWKFRHMKSA-N methyl (2z)-2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]-2-trityloxyiminoacetate Chemical compound S1C(NC(=O)OCC)=NC(C(=N\OC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)\C(=O)OC)=N1 SHIXYLPEFYFKLM-SWKFRHMKSA-N 0.000 description 2
- SSXZSQHXBWITRI-UHFFFAOYSA-N methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylate Chemical compound COC(=O)C1=CC=CC(NC(=O)OC(C)(C)C)=N1 SSXZSQHXBWITRI-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 2
- 229960004919 procaine Drugs 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- ZNUYUZGQGPYOIT-UHFFFAOYSA-N s-[(5-acetylsulfanyl-2-methyl-1,3-thiazol-4-yl)methyl] ethanethioate Chemical compound CC(=O)SCC=1N=C(C)SC=1SC(C)=O ZNUYUZGQGPYOIT-UHFFFAOYSA-N 0.000 description 2
- LANNVWQGIVIORL-UHFFFAOYSA-N s-[[5-[2-(benzenesulfonyl)ethylsulfanyl]-2-methyl-1,3-thiazol-4-yl]methyl] ethanethioate Chemical compound N1=C(C)SC(SCCS(=O)(=O)C=2C=CC=CC=2)=C1CSC(=O)C LANNVWQGIVIORL-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 239000008223 sterile water Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 125000005017 substituted alkenyl group Chemical group 0.000 description 2
- 125000005415 substituted alkoxy group Chemical group 0.000 description 2
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 2
- TVVMATARHBWFIG-UHFFFAOYSA-N tert-butyl n-[2-(benzoylcarbamothioylamino)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCNC(=S)NC(=O)C1=CC=CC=C1 TVVMATARHBWFIG-UHFFFAOYSA-N 0.000 description 2
- DOOZXVIPVZDJLE-UHFFFAOYSA-N tert-butyl n-[2-(carbamothioylamino)ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCNC(N)=S DOOZXVIPVZDJLE-UHFFFAOYSA-N 0.000 description 2
- BUWHLKPDQKFWFU-UHFFFAOYSA-N tert-butyl n-[2-[(2-amino-1,3-thiazol-4-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=CSC(N)=N1 BUWHLKPDQKFWFU-UHFFFAOYSA-N 0.000 description 2
- VNNLCRWMEAFONV-UHFFFAOYSA-N tert-butyl n-[2-[(2-amino-5-sulfanyl-1,3-thiazol-4-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC=1N=C(N)SC=1S VNNLCRWMEAFONV-UHFFFAOYSA-N 0.000 description 2
- KIQCMYLZJRCIKQ-UHFFFAOYSA-N tert-butyl n-[2-[(2-amino-5-thiocyanato-1,3-thiazol-4-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC=1N=C(N)SC=1SC#N KIQCMYLZJRCIKQ-UHFFFAOYSA-N 0.000 description 2
- UWWLQKHQZLUVAM-UHFFFAOYSA-N tert-butyl n-[2-[(2-bromo-1,3-thiazol-4-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=CSC(Br)=N1 UWWLQKHQZLUVAM-UHFFFAOYSA-N 0.000 description 2
- YLPFZJGWWMRTDL-UHFFFAOYSA-N tert-butyl n-[2-[(3-tert-butylsulfanylpyridin-2-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=NC=CC=C1SC(C)(C)C YLPFZJGWWMRTDL-UHFFFAOYSA-N 0.000 description 2
- FMHRNKHUWPOSJG-UHFFFAOYSA-N tert-butyl n-[2-[(3-tritylsulfanylpyridin-2-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=NC=CC=C1SC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 FMHRNKHUWPOSJG-UHFFFAOYSA-N 0.000 description 2
- VBDPFPLLLKZRLZ-UHFFFAOYSA-N tert-butyl n-[2-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-sulfanyl-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCNC1=NC(CSCCNC(=O)OC(C)(C)C)=C(S)S1 VBDPFPLLLKZRLZ-UHFFFAOYSA-N 0.000 description 2
- AXNOGNGLTHMCBT-UHFFFAOYSA-N tert-butyl n-[2-[[5-[2-(benzenesulfonyl)ethylsulfanyl]-2-methyl-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamate Chemical compound S1C(C)=NC(CSCCNC(=O)OC(C)(C)C)=C1SCCS(=O)(=O)C1=CC=CC=C1 AXNOGNGLTHMCBT-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- QYYZXEPEVBXNNA-QGZVFWFLSA-N (1R)-2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide Chemical compound C(C)(=O)N1[C@H](C2=CC=C(C=C2C1)S(=O)(=O)C)C(=O)NC1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)O QYYZXEPEVBXNNA-QGZVFWFLSA-N 0.000 description 1
- DIUMJILQVJWZRI-LGUFXXKBSA-N (2e)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetic acid Chemical compound S1C(N)=NC(C(=N/OC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)\C(O)=O)=N1 DIUMJILQVJWZRI-LGUFXXKBSA-N 0.000 description 1
- JWLMCEGFIJBZQH-UHFFFAOYSA-N (3-sulfanylpyridin-2-yl)methanol Chemical compound OCC1=NC=CC=C1S JWLMCEGFIJBZQH-UHFFFAOYSA-N 0.000 description 1
- YZSYSTNDBYXMRF-UHFFFAOYSA-N (3-sulfanylpyridin-2-yl)methanol;hydrochloride Chemical compound Cl.OCC1=NC=CC=C1S YZSYSTNDBYXMRF-UHFFFAOYSA-N 0.000 description 1
- HJTRHLSZFYXPRB-BXUZGUMPSA-N (6R,7R)-7-amino-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]sulfanyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)NCCSCC1=CSC(SC=2CS[C@H]3N(C([C@H]3N)=O)C=2C(O)=O)=N1 HJTRHLSZFYXPRB-BXUZGUMPSA-N 0.000 description 1
- MDTNTKLGRUURFT-RXMQYKEDSA-N (6r)-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=C(Cl)CS[C@@H]2CC(=O)N12 MDTNTKLGRUURFT-RXMQYKEDSA-N 0.000 description 1
- OQSAFIZCBAZPMY-PUOGSPQQSA-N (6r)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(Cl)=C(C(O)=O)N2C(=O)C(N)[C@H]21 OQSAFIZCBAZPMY-PUOGSPQQSA-N 0.000 description 1
- RFLSCADVOLSQPE-FYZOBXCZSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C1=CCS[C@@H]2CC(=O)N12 RFLSCADVOLSQPE-FYZOBXCZSA-N 0.000 description 1
- HMIQGOFWKIIGDS-RLQAYIIJSA-N (6r,7r)-7-[[(2z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[2-(2-aminoethylsulfanylmethyl)pyridin-3-yl]sulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NCCSCC1=NC=CC=C1SC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)C(=N/O)\C3=C(SC(N)=N3)Cl)[C@H]2SC1 HMIQGOFWKIIGDS-RLQAYIIJSA-N 0.000 description 1
- RNBGYYWIMVVJLC-VIBJSBDJSA-N (6r,7r)-7-[[(2z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[[3-(2-aminoethylsulfanylmethyl)-1,2,4-thiadiazol-5-yl]sulfanyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NCCSCC1=NSC(SC=2CS[C@H]3N(C([C@H]3NC(=O)C(=N/O)\C3=C(SC(N)=N3)Cl)=O)C=2C(O)=O)=N1 RNBGYYWIMVVJLC-VIBJSBDJSA-N 0.000 description 1
- FBNGHHHDADSBIU-YJNBQFBBSA-N (6r,7r)-7-[[(2z)-2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1C(N)=NC(\C(=N\OC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(=O)N[C@@H]2C(N3C(=C(Cl)CS[C@@H]32)C(O)=O)=O)=C1Cl FBNGHHHDADSBIU-YJNBQFBBSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- VJHTZTZXOKVQRN-UHFFFAOYSA-N 1,2,4-thiadiazol-5-amine Chemical compound NC1=NC=NS1 VJHTZTZXOKVQRN-UHFFFAOYSA-N 0.000 description 1
- BIGYLAKFCGVRAN-UHFFFAOYSA-N 1,3,4-thiadiazolidine-2,5-dithione Chemical compound S=C1NNC(=S)S1 BIGYLAKFCGVRAN-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- QFUYDAGNUJWBSM-UHFFFAOYSA-N 1-iodo-2-phenylbenzene Chemical group IC1=CC=CC=C1C1=CC=CC=C1 QFUYDAGNUJWBSM-UHFFFAOYSA-N 0.000 description 1
- NLWCWEGVNJVLAX-UHFFFAOYSA-N 1-methoxy-2-phenylbenzene Chemical group COC1=CC=CC=C1C1=CC=CC=C1 NLWCWEGVNJVLAX-UHFFFAOYSA-N 0.000 description 1
- OALRKTRDVLNQAZ-UHFFFAOYSA-N 1-methylsulfinyl-1-(1-methylsulfinylethylsulfanyl)ethane Chemical compound CS(=O)C(C)SC(C)S(C)=O OALRKTRDVLNQAZ-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- XBNGYFFABRKICK-UHFFFAOYSA-N 2,3,4,5,6-pentafluorophenol Chemical compound OC1=C(F)C(F)=C(F)C(F)=C1F XBNGYFFABRKICK-UHFFFAOYSA-N 0.000 description 1
- MLCNOCRGSBCAGH-UHFFFAOYSA-N 2,3-dichloropyrazine Chemical compound ClC1=NC=CN=C1Cl MLCNOCRGSBCAGH-UHFFFAOYSA-N 0.000 description 1
- XGBWXISUZXYULS-UHFFFAOYSA-N 2,3-ditert-butylpyridine Chemical compound CC(C)(C)C1=CC=CN=C1C(C)(C)C XGBWXISUZXYULS-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-Lutidine Substances CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 1
- LSEAAPGIZCDEEH-UHFFFAOYSA-N 2,6-dichloropyrazine Chemical compound ClC1=CN=CC(Cl)=N1 LSEAAPGIZCDEEH-UHFFFAOYSA-N 0.000 description 1
- TXOYOISKZSFGBX-UHFFFAOYSA-N 2-(1,3-thiazol-4-ylmethylsulfanyl)ethanamine Chemical compound NCCSCC1=CSC=N1 TXOYOISKZSFGBX-UHFFFAOYSA-N 0.000 description 1
- VJTZHYSGMIXELN-UHFFFAOYSA-N 2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-trityloxyiminoacetic acid Chemical compound S1C(N)=NC(C(=NOC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(O)=O)=C1Cl VJTZHYSGMIXELN-UHFFFAOYSA-N 0.000 description 1
- YTYPGZFQPRLRKE-UHFFFAOYSA-N 2-(2-aminoethylsulfanylmethyl)pyridine-3-thiol Chemical compound NCCSCC1=NC=CC=C1S YTYPGZFQPRLRKE-UHFFFAOYSA-N 0.000 description 1
- RNAMYOYQYRYFQY-UHFFFAOYSA-N 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-n-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine Chemical compound N1=C(N2CCC(F)(F)CC2)N=C2C=C(OCCCN3CCCC3)C(OC)=CC2=C1NC1CCN(C(C)C)CC1 RNAMYOYQYRYFQY-UHFFFAOYSA-N 0.000 description 1
- ANDVEUKOOBWYKC-UHFFFAOYSA-N 2-(Biaryl)carbapenems Chemical compound OC(=O)C=1N2C(=O)C(C(O)C)C2CC=1C(C=C1)=CC=C1C1=CC=CC=C1 ANDVEUKOOBWYKC-UHFFFAOYSA-N 0.000 description 1
- CABMTIJINOIHOD-UHFFFAOYSA-N 2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]quinoline-3-carboxylic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC2=CC=CC=C2C=C1C(O)=O CABMTIJINOIHOD-UHFFFAOYSA-N 0.000 description 1
- WXLKWWYNUHUSIB-UHFFFAOYSA-N 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-2-yl]-2-trityloxyiminoacetic acid Chemical compound CC(C)(C)OC(=O)NC1=CC=CC(C(=NOC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)C(O)=O)=N1 WXLKWWYNUHUSIB-UHFFFAOYSA-N 0.000 description 1
- LAHYQHMKJIRRPK-UHFFFAOYSA-N 2-bromo-4-(chloromethyl)-1,3-thiazole Chemical compound ClCC1=CSC(Br)=N1 LAHYQHMKJIRRPK-UHFFFAOYSA-N 0.000 description 1
- OLYBTQCLJOBELT-UHFFFAOYSA-N 2-bromoethanamine;hydrochloride Chemical compound Cl.NCCBr OLYBTQCLJOBELT-UHFFFAOYSA-N 0.000 description 1
- ONRREFWJTRBDRA-UHFFFAOYSA-N 2-chloroethanamine;hydron;chloride Chemical compound [Cl-].[NH3+]CCCl ONRREFWJTRBDRA-UHFFFAOYSA-N 0.000 description 1
- 125000004791 2-fluoroethoxy group Chemical group FCCO* 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- XZEWTRJHEGMAHM-UHFFFAOYSA-N 2-iodoethylsulfonylbenzene Chemical compound ICCS(=O)(=O)C1=CC=CC=C1 XZEWTRJHEGMAHM-UHFFFAOYSA-N 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 1
- FRRCVAYPJRENEV-UHFFFAOYSA-N 3-sulfanylpyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC=C1S FRRCVAYPJRENEV-UHFFFAOYSA-N 0.000 description 1
- UAUIAQFRHBUKPY-UHFFFAOYSA-N 3-tert-butylsulfanylpyridine-2-carboxylic acid Chemical compound CC(C)(C)SC1=CC=CN=C1C(O)=O UAUIAQFRHBUKPY-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- FFFMIFUBJZBTCG-UHFFFAOYSA-N 5-chloro-3-(chloromethyl)-1,2,4-thiadiazole Chemical compound ClCC1=NSC(Cl)=N1 FFFMIFUBJZBTCG-UHFFFAOYSA-N 0.000 description 1
- FPVUWZFFEGYCGB-UHFFFAOYSA-N 5-methyl-3h-1,3,4-thiadiazole-2-thione Chemical compound CC1=NN=C(S)S1 FPVUWZFFEGYCGB-UHFFFAOYSA-N 0.000 description 1
- GNGCSXRLPFHKIO-UHFFFAOYSA-N 6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)NC1=CC=CC(C(O)=O)=N1 GNGCSXRLPFHKIO-UHFFFAOYSA-N 0.000 description 1
- OQSAFIZCBAZPMY-UHFFFAOYSA-N 7-azaniumyl-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(Cl)=C(C(O)=O)N2C(=O)C(N)C21 OQSAFIZCBAZPMY-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 208000031729 Bacteremia Diseases 0.000 description 1
- 108020004256 Beta-lactamase Proteins 0.000 description 1
- GPFBTXORRQOWSJ-MDISMMIGSA-N C(C1=CC=CC=C1)(C1=CC=CC=C1)OS(=O)(=O)C1=CC=C(C)C=C1.N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(N=CS2)CSCCNC(=O)OC(C)(C)C)C(=O)O)C1=O Chemical compound C(C1=CC=CC=C1)(C1=CC=CC=C1)OS(=O)(=O)C1=CC=C(C)C=C1.N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(N=CS2)CSCCNC(=O)OC(C)(C)C)C(=O)O)C1=O GPFBTXORRQOWSJ-MDISMMIGSA-N 0.000 description 1
- YAZCEAGQUDSHCG-YIXXDRMTSA-N C1(=CC=CC=C1)C(C1=CC=CC=C1)OC(=O)C1=C(CS[C@H]2N1C([C@H]2N)=O)SC=2SC=C(N2)CSCCNC(=O)OC(C)(C)C Chemical compound C1(=CC=CC=C1)C(C1=CC=CC=C1)OC(=O)C1=C(CS[C@H]2N1C([C@H]2N)=O)SC=2SC=C(N2)CSCCNC(=O)OC(C)(C)C YAZCEAGQUDSHCG-YIXXDRMTSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N Dipicolinic acid Natural products OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- 241000588921 Enterobacteriaceae Species 0.000 description 1
- 241000943303 Enterococcus faecalis ATCC 29212 Species 0.000 description 1
- 241001360526 Escherichia coli ATCC 25922 Species 0.000 description 1
- UPADRKHAIMTUCC-JBNGTWNESA-N Everninomycin Chemical compound O([C@@H]1CO[C@]2([C@@H]3OCO[C@H]31)O[C@H]1CO[C@H]([C@@H]([C@@H]1O2)O)O[C@@H]1O[C@@H](C([C@H](O)C1OC)O[C@H]1[C@@H]([C@H](O[C@H]2[C@H]([C@@]3(C)OC4(O[C@H](C)[C@@H](O[C@@H]5O[C@H](C)[C@@H](OC(=O)C=6C(=C(Cl)C(O)=C(Cl)C=6C)OC)[C@H](O[C@H]6O[C@@H](C)[C@H](OC)[C@](C)(C6)[N+]([O-])=O)C5)[C@H](O)C4)O[C@@H]3[C@@H](C)O2)O)[C@@H](OC)[C@@H](C)O1)O)COC)C(=O)C1=C(C)C=C(O)C=C1O UPADRKHAIMTUCC-JBNGTWNESA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 102000009338 Gastric Mucins Human genes 0.000 description 1
- 108010009066 Gastric Mucins Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 101000891579 Homo sapiens Microtubule-associated protein tau Proteins 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241000282560 Macaca mulatta Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- PQMWYJDJHJQZDE-UHFFFAOYSA-M Methantheline bromide Chemical compound [Br-].C1=CC=C2C(C(=O)OCC[N+](C)(CC)CC)C3=CC=CC=C3OC2=C1 PQMWYJDJHJQZDE-UHFFFAOYSA-M 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 102100040243 Microtubule-associated protein tau Human genes 0.000 description 1
- MSFSPUZXLOGKHJ-UHFFFAOYSA-N Muraminsaeure Natural products OC(=O)C(C)OC1C(N)C(O)OC(CO)C1O MSFSPUZXLOGKHJ-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- LFTLOKWAGJYHHR-UHFFFAOYSA-N N-methylmorpholine N-oxide Chemical compound CN1(=O)CCOCC1 LFTLOKWAGJYHHR-UHFFFAOYSA-N 0.000 description 1
- YMSSTZZCLXYIQX-IUXRQTNCSA-N NC1=NC(=CC=C1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=NN=C(S2)SCCN)C(=O)O)C1=O)=N/O Chemical compound NC1=NC(=CC=C1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=NN=C(S2)SCCN)C(=O)O)C1=O)=N/O YMSSTZZCLXYIQX-IUXRQTNCSA-N 0.000 description 1
- ANEFBENCNWFZLW-ZTJYIHJESA-N NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C=NC=CC=2CSCCN)C(=O)O)C1=O)=N/O Chemical compound NC1=NC(=NS1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2C=NC=CC=2CSCCN)C(=O)O)C1=O)=N/O ANEFBENCNWFZLW-ZTJYIHJESA-N 0.000 description 1
- FMKPZHRSVBVSGY-NHPLERODSA-N NC=1SC(=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(N=C(S2)N)CSCCNC(=N)N)C(=O)O)C1=O)=N/O)Cl Chemical compound NC=1SC(=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC2=C(N=C(S2)N)CSCCNC(=N)N)C(=O)O)C1=O)=N/O)Cl FMKPZHRSVBVSGY-NHPLERODSA-N 0.000 description 1
- YCFJSGUDVYLTNF-BGZQYGJUSA-N NC=1SC=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2N(NC=CC=2)CSCCN)C(=O)O)C1=O)=N/O Chemical compound NC=1SC=C(N=1)/C(/C(=O)N[C@H]1[C@@H]2N(C(=C(CS2)SC=2N(NC=CC=2)CSCCN)C(=O)O)C1=O)=N/O YCFJSGUDVYLTNF-BGZQYGJUSA-N 0.000 description 1
- VNZDYMFSWBFFKY-KVRCMFBHSA-N N[C@H]1[C@@H]2N(C(=C(CS2)OS(=O)(=O)C)C(=O)O)C1=O.S(=O)(=O)(OC(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=C(C)C=C1 Chemical compound N[C@H]1[C@@H]2N(C(=C(CS2)OS(=O)(=O)C)C(=O)O)C1=O.S(=O)(=O)(OC(C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=C(C)C=C1 VNZDYMFSWBFFKY-KVRCMFBHSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 206010034133 Pathogen resistance Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 101710173835 Penton protein Proteins 0.000 description 1
- 108010013639 Peptidoglycan Proteins 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 108010053950 Teicoplanin Proteins 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- LUTHLVWBPBLUOC-UHFFFAOYSA-N [5-[2-(benzenesulfonyl)ethylsulfanyl]-1,3-thiazol-4-yl]methanol Chemical compound N1=CSC(SCCS(=O)(=O)C=2C=CC=CC=2)=C1CO LUTHLVWBPBLUOC-UHFFFAOYSA-N 0.000 description 1
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- FJMNNXLGOUYVHO-UHFFFAOYSA-N aluminum zinc Chemical compound [Al].[Zn] FJMNNXLGOUYVHO-UHFFFAOYSA-N 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- YNNGZCVDIREDDK-UHFFFAOYSA-N aminocarbamodithioic acid Chemical compound NNC(S)=S YNNGZCVDIREDDK-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 238000009635 antibiotic susceptibility testing Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- MKKYBZZTJQGVCD-XTCKQBCOSA-N arbekacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)CC[C@H]1N MKKYBZZTJQGVCD-XTCKQBCOSA-N 0.000 description 1
- 229960005397 arbekacin Drugs 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- RBTFHBFVMVXXCZ-DGAOFQHCSA-N benzhydryl (6R,7R)-7-[[(2Z)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-trityloxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)OS(=O)(=O)C)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)C(=O)C(\C=1N=C(N)SN=1)=N/OC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 RBTFHBFVMVXXCZ-DGAOFQHCSA-N 0.000 description 1
- CPEKAXYCDKETEN-UHFFFAOYSA-N benzoyl isothiocyanate Chemical compound S=C=NC(=O)C1=CC=CC=C1 CPEKAXYCDKETEN-UHFFFAOYSA-N 0.000 description 1
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 1
- 102000006635 beta-lactamase Human genes 0.000 description 1
- 125000003460 beta-lactamyl group Chemical group 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 230000000975 bioactive effect Effects 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 238000002815 broth microdilution Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000004648 butanoic acid derivatives Chemical class 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 238000011088 calibration curve Methods 0.000 description 1
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 1
- 229940041011 carbapenems Drugs 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- LZOLCSVRFKCSEM-ZQCAECPKSA-N cefoselis sulfate Chemical compound OS(O)(=O)=O.S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)\C(=N/OC)C=2N=C(N)SC=2)CC=1CN1C=CC(=N)N1CCO LZOLCSVRFKCSEM-ZQCAECPKSA-N 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 125000001550 cephem group Chemical group 0.000 description 1
- 150000001782 cephems Chemical group 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- DDTDNCYHLGRFBM-YZEKDTGTSA-N chembl2367892 Chemical compound CC(=O)N[C@H]1[C@@H](O)[C@H](O)[C@H](CO)O[C@H]1O[C@@H]([C@H]1C(N[C@@H](C2=CC(O)=CC(O[C@@H]3[C@H]([C@H](O)[C@H](O)[C@@H](CO)O3)O)=C2C=2C(O)=CC=C(C=2)[C@@H](NC(=O)[C@@H]2NC(=O)[C@@H]3C=4C=C(O)C=C(C=4)OC=4C(O)=CC=C(C=4)[C@@H](N)C(=O)N[C@H](CC=4C=C(Cl)C(O5)=CC=4)C(=O)N3)C(=O)N1)C(O)=O)=O)C(C=C1Cl)=CC=C1OC1=C(O[C@H]3[C@H]([C@@H](O)[C@H](O)[C@H](CO)O3)NC(C)=O)C5=CC2=C1 DDTDNCYHLGRFBM-YZEKDTGTSA-N 0.000 description 1
- HPEOGSLDVHROSH-CDOVDWRASA-N chembl31228 Chemical compound S1C(C)=NC(CSCCN)=C1SC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)C(=N/O)\C=3N=C(N)C=CC=3)[C@H]2SC1 HPEOGSLDVHROSH-CDOVDWRASA-N 0.000 description 1
- 125000003636 chemical group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- DHSUYTOATWAVLW-WFVMDLQDSA-N cilastatin Chemical compound CC1(C)C[C@@H]1C(=O)N\C(=C/CCCCSC[C@H](N)C(O)=O)C(O)=O DHSUYTOATWAVLW-WFVMDLQDSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 229940097265 cysteamine hydrochloride Drugs 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- OKKJLVBELUTLKV-MICDWDOJSA-N deuteriomethanol Chemical compound [2H]CO OKKJLVBELUTLKV-MICDWDOJSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 229940032049 enterococcus faecalis Drugs 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- RXBAHQNHMIDTBC-UHFFFAOYSA-N ethyl n-[3-(2-oxoethyl)-1,2,4-thiadiazol-5-yl]carbamate Chemical compound CCOC(=O)NC1=NC(CC=O)=NS1 RXBAHQNHMIDTBC-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000010685 fatty oil Substances 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 238000007913 intrathecal administration Methods 0.000 description 1
- 238000007914 intraventricular administration Methods 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000006303 iodophenyl group Chemical group 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical class OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000004731 jugular vein Anatomy 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000008297 liquid dosage form Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- COTNUBDHGSIOTA-UHFFFAOYSA-N meoh methanol Chemical compound OC.OC COTNUBDHGSIOTA-UHFFFAOYSA-N 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- YWOITFUKFOYODT-UHFFFAOYSA-N methanol;sodium Chemical compound [Na].OC YWOITFUKFOYODT-UHFFFAOYSA-N 0.000 description 1
- 208000015688 methicillin-resistant staphylococcus aureus infectious disease Diseases 0.000 description 1
- RJLHMOBYDFOGDK-UHFFFAOYSA-N methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]-2-oxoacetate Chemical compound CCOC(=O)NC1=NC(C(=O)C(=O)OC)=NS1 RJLHMOBYDFOGDK-UHFFFAOYSA-N 0.000 description 1
- WRUIUWMHBQJODA-UHFFFAOYSA-N methyl 2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate Chemical compound CCOC(=O)NC1=NC(CC(=O)OC)=NS1 WRUIUWMHBQJODA-UHFFFAOYSA-N 0.000 description 1
- DJGHJWKOYLBRSV-UHFFFAOYSA-N methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonylamino]pyridin-2-yl]-2-oxoacetate Chemical compound COC(=O)C(=O)C1=CC=CC(NC(=O)OC(C)(C)C)=N1 DJGHJWKOYLBRSV-UHFFFAOYSA-N 0.000 description 1
- NIOAVNXVFOIRSG-UHFFFAOYSA-N methyl 2-bromo-2-[5-(ethoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetate Chemical compound CCOC(=O)NC1=NC(C(Br)C(=O)OC)=NS1 NIOAVNXVFOIRSG-UHFFFAOYSA-N 0.000 description 1
- KFKXSMSQHIOMSO-UHFFFAOYSA-N methyl 2-oxoacetate Chemical compound COC(=O)C=O KFKXSMSQHIOMSO-UHFFFAOYSA-N 0.000 description 1
- SNWKNPMDQONHKK-UHFFFAOYSA-N methyl 2-sulfanylpropanoate Chemical compound COC(=O)C(C)S SNWKNPMDQONHKK-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 238000010172 mouse model Methods 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 206010034674 peritonitis Diseases 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 230000008092 positive effect Effects 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 229940027836 primaxin Drugs 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical class CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- HNDXKIMMSFCCFW-UHFFFAOYSA-N propane-2-sulphonic acid Chemical class CC(C)S(O)(=O)=O HNDXKIMMSFCCFW-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000018102 proteins Nutrition 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 229940072132 quinolone antibacterials Drugs 0.000 description 1
- ZAHRKKWIAAJSAO-UHFFFAOYSA-N rapamycin Natural products COCC(O)C(=C/C(C)C(=O)CC(OC(=O)C1CCCCN1C(=O)C(=O)C2(O)OC(CC(OC)C(=CC=CC=CC(C)CC(C)C(=O)C)C)CCC2C)C(C)CC3CCC(O)C(C3)OC)C ZAHRKKWIAAJSAO-UHFFFAOYSA-N 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008299 semisolid dosage form Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229960001153 serine Drugs 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229960002930 sirolimus Drugs 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007909 solid dosage form Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229940037649 staphylococcus haemolyticus Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229960001608 teicoplanin Drugs 0.000 description 1
- IQMJLFDBESLLKK-UHFFFAOYSA-N tert-butyl n-[2-(3-chloro-2-oxopropyl)sulfanylethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC(=O)CCl IQMJLFDBESLLKK-UHFFFAOYSA-N 0.000 description 1
- IPERFVVUIWKCGR-UHFFFAOYSA-N tert-butyl n-[2-[(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=NN=C(S)S1 IPERFVVUIWKCGR-UHFFFAOYSA-N 0.000 description 1
- FNUQSPVELVLUPT-UHFFFAOYSA-N tert-butyl n-[2-[(2-sulfanylidene-3h-1,3-thiazol-4-yl)methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSCC1=CSC(S)=N1 FNUQSPVELVLUPT-UHFFFAOYSA-N 0.000 description 1
- HBTMWZADMHBLMY-UHFFFAOYSA-N tert-butyl n-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyldisulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCSSCCNC(=O)OC(C)(C)C HBTMWZADMHBLMY-UHFFFAOYSA-N 0.000 description 1
- BJOKJBJSXUBNQU-UHFFFAOYSA-N tert-butyl n-[2-[[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCNC1=NC(CSCCNC(=O)OC(C)(C)C)=CS1 BJOKJBJSXUBNQU-UHFFFAOYSA-N 0.000 description 1
- HIRRRKQBYKNFCX-UHFFFAOYSA-N tert-butyl n-[2-[[4-(chloromethyl)-1,3-thiazol-2-yl]amino]ethyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCNC1=NC(CCl)=CS1 HIRRRKQBYKNFCX-UHFFFAOYSA-N 0.000 description 1
- QFNFDHNZVTWZED-UHFFFAOYSA-N tert-butyl n-[[(2-methylpropan-2-yl)oxycarbonylamino]-pyrazol-1-ylmethylidene]carbamate Chemical group CC(C)(C)OC(=O)NC(=NC(=O)OC(C)(C)C)N1C=CC=N1 QFNFDHNZVTWZED-UHFFFAOYSA-N 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 150000004867 thiadiazoles Chemical group 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- FPZLLRFZJZRHSY-HJYUBDRYSA-N tigecycline Chemical class C([C@H]1C2)C3=C(N(C)C)C=C(NC(=O)CNC(C)(C)C)C(O)=C3C(=O)C1=C(O)[C@@]1(O)[C@@H]2[C@H](N(C)C)C(O)=C(C(N)=O)C1=O FPZLLRFZJZRHSY-HJYUBDRYSA-N 0.000 description 1
- 229960004089 tigecycline Drugs 0.000 description 1
- 238000005891 transamination reaction Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000005208 trialkylammonium group Chemical group 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000000169 tricyclic heterocycle group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical group [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- UYPYRKYUKCHHIB-UHFFFAOYSA-N trimethylamine N-oxide Chemical group C[N+](C)(C)[O-] UYPYRKYUKCHHIB-UHFFFAOYSA-N 0.000 description 1
- FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000000108 ultra-filtration Methods 0.000 description 1
- 229940072335 vancocin Drugs 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6503—Five-membered rings
- C07F9/6506—Five-membered rings having the nitrogen atoms in positions 1 and 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Oncology (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Communicable Diseases (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US15549699P | 1999-09-22 | 1999-09-22 | |
| PCT/US2000/026069 WO2001021623A1 (en) | 1999-09-22 | 2000-09-21 | 7-acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SK4122002A3 true SK4122002A3 (en) | 2003-03-04 |
Family
ID=22555673
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK412-2002A SK4122002A3 (en) | 1999-09-22 | 2000-09-21 | 7-Acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof |
Country Status (24)
| Country | Link |
|---|---|
| EP (1) | EP1222194B1 (de) |
| JP (1) | JP2003509512A (de) |
| KR (1) | KR20020068508A (de) |
| CN (1) | CN1206231C (de) |
| AR (1) | AR029004A1 (de) |
| AT (1) | ATE297934T1 (de) |
| AU (1) | AU784077B2 (de) |
| BR (1) | BR0014230A (de) |
| CA (1) | CA2385479A1 (de) |
| CZ (1) | CZ2002993A3 (de) |
| DE (1) | DE60020862D1 (de) |
| HK (1) | HK1048121B (de) |
| HU (1) | HUP0202663A3 (de) |
| IL (2) | IL148669A0 (de) |
| MX (1) | MXPA02003024A (de) |
| MY (1) | MY136038A (de) |
| NO (1) | NO20021416L (de) |
| NZ (1) | NZ517761A (de) |
| PL (1) | PL354919A1 (de) |
| RU (1) | RU2225868C2 (de) |
| SK (1) | SK4122002A3 (de) |
| TW (1) | TWI283682B (de) |
| WO (1) | WO2001021623A1 (de) |
| ZA (1) | ZA200202065B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6534656B2 (en) | 2001-05-31 | 2003-03-18 | North Carolina State University | Short synthesis of pyridine-based pharmaceutical intermediates |
| DK1618106T3 (da) * | 2003-04-30 | 2010-03-15 | Trine Pharmaceuticals Inc | Carbacephem beta-lactam antibiotika |
| CN111187281B (zh) * | 2020-02-11 | 2023-03-14 | 广西科技大学 | 含胍基的头孢菌素衍生物及其制备方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MA18891A1 (fr) * | 1979-07-05 | 1981-04-01 | Ciba Geigy Ag | Composes d'amino-thiadiazolyle,procede pour leur preparation |
| EP0025017A1 (de) * | 1979-08-28 | 1981-03-11 | Ciba-Geigy Ag | Polyazathiaverbindungen, Verfahren zu ihrer Herstellung, pharmazeutische Präparate enthaltend solche Verbindungen und Verwendung von letzteren |
| KR930702304A (ko) * | 1990-09-13 | 1993-09-08 | 스튜어트 알. 슈터 | 피리딜티오 또는 피리딜옥시 알칸산 |
| PL316633A1 (en) * | 1994-04-01 | 1997-02-03 | Microcide Pharmaceuticals | Cephalosporin antibiotics |
| US5498777A (en) * | 1994-07-20 | 1996-03-12 | Merck & Co., Inc. | 3-thioheteroaryl cephalosporin compounds, compositions and methods of use |
| AU5985596A (en) * | 1995-05-31 | 1996-12-18 | Microcide Pharmaceuticals, Inc. | Cephalosporin antibiotics |
| MY127641A (en) * | 1995-10-12 | 2006-12-29 | Essential Therapeutics Inc | Cephalosporin antibiotics |
| JP4174093B2 (ja) * | 1998-01-09 | 2008-10-29 | 富士フイルムファインケミカルズ株式会社 | トリアゾール誘導体ハロゲン化合物の製造方法 |
| BR9910370A (pt) * | 1998-05-13 | 2001-09-25 | Lg Chemical Ltd | Compostos de cefalosporina, processo para preparar compostos de cefalosporina, e, composições antimicrobianas |
-
2000
- 2000-09-19 AR ARP000104904A patent/AR029004A1/es not_active Application Discontinuation
- 2000-09-21 AU AU77095/00A patent/AU784077B2/en not_active Ceased
- 2000-09-21 SK SK412-2002A patent/SK4122002A3/sk unknown
- 2000-09-21 HK HK03100320.8A patent/HK1048121B/en not_active IP Right Cessation
- 2000-09-21 HU HU0202663A patent/HUP0202663A3/hu unknown
- 2000-09-21 DE DE60020862T patent/DE60020862D1/de not_active Expired - Lifetime
- 2000-09-21 MY MYPI20004413A patent/MY136038A/en unknown
- 2000-09-21 NZ NZ517761A patent/NZ517761A/en unknown
- 2000-09-21 CZ CZ2002993A patent/CZ2002993A3/cs unknown
- 2000-09-21 PL PL00354919A patent/PL354919A1/xx not_active Application Discontinuation
- 2000-09-21 CN CNB008157464A patent/CN1206231C/zh not_active Expired - Fee Related
- 2000-09-21 WO PCT/US2000/026069 patent/WO2001021623A1/en not_active Ceased
- 2000-09-21 MX MXPA02003024A patent/MXPA02003024A/es active IP Right Grant
- 2000-09-21 RU RU2002110444/04A patent/RU2225868C2/ru not_active IP Right Cessation
- 2000-09-21 BR BR0014230-1A patent/BR0014230A/pt not_active IP Right Cessation
- 2000-09-21 IL IL14866900A patent/IL148669A0/xx active IP Right Grant
- 2000-09-21 KR KR1020027003755A patent/KR20020068508A/ko not_active Ceased
- 2000-09-21 EP EP00966807A patent/EP1222194B1/de not_active Expired - Lifetime
- 2000-09-21 JP JP2001524998A patent/JP2003509512A/ja active Pending
- 2000-09-21 CA CA002385479A patent/CA2385479A1/en not_active Abandoned
- 2000-09-21 AT AT00966807T patent/ATE297934T1/de not_active IP Right Cessation
-
2001
- 2001-03-19 TW TW089119608A patent/TWI283682B/zh not_active IP Right Cessation
-
2002
- 2002-03-13 ZA ZA200202065A patent/ZA200202065B/en unknown
- 2002-03-13 IL IL148669A patent/IL148669A/en not_active IP Right Cessation
- 2002-03-21 NO NO20021416A patent/NO20021416L/no not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| HUP0202663A3 (en) | 2003-10-28 |
| MY136038A (en) | 2008-08-29 |
| KR20020068508A (ko) | 2002-08-27 |
| AR029004A1 (es) | 2003-06-04 |
| EP1222194A1 (de) | 2002-07-17 |
| HK1048121B (en) | 2005-11-04 |
| NZ517761A (en) | 2003-10-31 |
| WO2001021623A1 (en) | 2001-03-29 |
| AU7709500A (en) | 2001-04-24 |
| NO20021416L (no) | 2002-05-22 |
| HK1048121A1 (en) | 2003-03-21 |
| HUP0202663A2 (hu) | 2002-12-28 |
| EP1222194B1 (de) | 2005-06-15 |
| JP2003509512A (ja) | 2003-03-11 |
| CZ2002993A3 (cs) | 2002-07-17 |
| ZA200202065B (en) | 2007-11-28 |
| IL148669A (en) | 2006-04-10 |
| PL354919A1 (en) | 2004-03-22 |
| NO20021416D0 (no) | 2002-03-21 |
| CA2385479A1 (en) | 2001-03-29 |
| DE60020862D1 (de) | 2005-07-21 |
| MXPA02003024A (es) | 2003-09-25 |
| TWI283682B (en) | 2007-07-11 |
| RU2225868C2 (ru) | 2004-03-20 |
| AU784077B2 (en) | 2006-02-02 |
| CN1451011A (zh) | 2003-10-22 |
| BR0014230A (pt) | 2002-05-21 |
| CN1206231C (zh) | 2005-06-15 |
| IL148669A0 (en) | 2002-09-12 |
| ATE297934T1 (de) | 2005-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI715595B (zh) | 金屬-β-內醯胺酶抑制劑 | |
| FI78702B (fi) | Foerfarande foer framstaellning av -laktamantibioter och vid framstaellningen anvaendbara mellanprodukter. | |
| KR20140114390A (ko) | 아미딘 치환된 베타 - 락탐 화합물, 그의 제조법 및 항박테리아제로서의 용도 | |
| EP0874854B1 (de) | Cephalosporinantibiotika | |
| SK126696A3 (en) | Cephalosporin antibiotics and antibacterial agents containing them | |
| PT1965798E (pt) | Antibióticos de monobactama úteis | |
| RU2281948C2 (ru) | Цефалоспориновые антибиотики, фармацевтическая композиция на их основе и способ лечения инфекции | |
| US6025352A (en) | Cephalosporin antibiotics | |
| EP0376724A2 (de) | Caphalosporinverbindungen | |
| SK4122002A3 (en) | 7-Acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof | |
| KR20000057283A (ko) | 세팔로스포린 유도체 | |
| US6723716B1 (en) | 7-acylamino-3-heteroarylthio-3-cephem carboxylic acid antibiotics and prodrugs thereof | |
| US6030965A (en) | Cephalosporin antibiotics | |
| RU2172317C2 (ru) | Производные цефалоспорина, содержащая их антибактериальная композиция, производные 2-аминотиазолов в качестве промежуточных соединений и способ их получения | |
| EP1059293A1 (de) | Amino-chlorthiazolverbindungen | |
| NZ500512A (en) | Cephalosporin for treating beta-lactam antibiotic resistant bacteria (such as S. aureus, E. faecium or E. faecalis) or PBP2a-producing bacteria | |
| HK1029988A (en) | Novel amino chlorothiazole compounds |