SK282126B6 - Spôsob stabilizácie organického fosfitu alebo fosfonitu alebo ich zmesi proti hydrolýze a kompozícia obsahujúca organický fosfit alebo fosfonit a stericky bránený amín - Google Patents
Spôsob stabilizácie organického fosfitu alebo fosfonitu alebo ich zmesi proti hydrolýze a kompozícia obsahujúca organický fosfit alebo fosfonit a stericky bránený amín Download PDFInfo
- Publication number
- SK282126B6 SK282126B6 SK1064-93A SK106493A SK282126B6 SK 282126 B6 SK282126 B6 SK 282126B6 SK 106493 A SK106493 A SK 106493A SK 282126 B6 SK282126 B6 SK 282126B6
- Authority
- SK
- Slovakia
- Prior art keywords
- group
- phosphonite
- phosphite
- carbon atoms
- weight
- Prior art date
Links
- 150000001412 amines Chemical class 0.000 title claims abstract description 86
- XRBCRPZXSCBRTK-UHFFFAOYSA-N phosphonous acid Chemical compound OPO XRBCRPZXSCBRTK-UHFFFAOYSA-N 0.000 title claims abstract description 55
- 238000000034 method Methods 0.000 title claims abstract description 37
- 230000007062 hydrolysis Effects 0.000 title claims abstract description 27
- 238000006460 hydrolysis reaction Methods 0.000 title claims abstract description 27
- 239000000203 mixture Substances 0.000 title claims abstract description 24
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 title claims abstract 12
- 230000006641 stabilisation Effects 0.000 title abstract description 6
- 238000011105 stabilization Methods 0.000 title description 5
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 claims abstract description 24
- 239000003381 stabilizer Substances 0.000 claims abstract description 13
- 229920000620 organic polymer Polymers 0.000 claims abstract description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 230000000087 stabilizing effect Effects 0.000 claims description 5
- 238000002425 crystallisation Methods 0.000 claims description 4
- 230000008025 crystallization Effects 0.000 claims description 4
- 239000012467 final product Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 65
- 239000007787 solid Substances 0.000 abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 abstract description 3
- 239000001301 oxygen Substances 0.000 abstract description 3
- 229920001059 synthetic polymer Polymers 0.000 abstract description 3
- 230000009931 harmful effect Effects 0.000 abstract description 2
- 239000011368 organic material Substances 0.000 abstract description 2
- 239000000463 material Substances 0.000 abstract 1
- -1 2,2,6,6-tetramethylpiperidyl groups Chemical group 0.000 description 87
- 125000004432 carbon atom Chemical group C* 0.000 description 87
- 125000000217 alkyl group Chemical group 0.000 description 42
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 38
- 150000003254 radicals Chemical class 0.000 description 38
- 229910052739 hydrogen Inorganic materials 0.000 description 34
- 239000001257 hydrogen Substances 0.000 description 34
- 125000002947 alkylene group Chemical group 0.000 description 23
- 239000000047 product Substances 0.000 description 20
- 125000001424 substituent group Chemical group 0.000 description 18
- 150000002431 hydrogen Chemical class 0.000 description 17
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 12
- 125000001931 aliphatic group Chemical group 0.000 description 11
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 11
- 125000003118 aryl group Chemical group 0.000 description 10
- 229910052799 carbon Inorganic materials 0.000 description 10
- 125000000753 cycloalkyl group Chemical group 0.000 description 10
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 9
- 125000003710 aryl alkyl group Chemical group 0.000 description 8
- 125000000732 arylene group Chemical group 0.000 description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical class CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000001589 carboacyl group Chemical group 0.000 description 4
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 4
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- 125000003884 phenylalkyl group Chemical group 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 230000007704 transition Effects 0.000 description 4
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 4
- 125000006024 2-pentenyl group Chemical group 0.000 description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- PIGFYZPCRLYGLF-UHFFFAOYSA-N Aluminum nitride Chemical compound [Al]#N PIGFYZPCRLYGLF-UHFFFAOYSA-N 0.000 description 3
- JWUXJYZVKZKLTJ-UHFFFAOYSA-N Triacetonamine Chemical compound CC1(C)CC(=O)CC(C)(C)N1 JWUXJYZVKZKLTJ-UHFFFAOYSA-N 0.000 description 3
- 125000004450 alkenylene group Chemical group 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- GGAUUQHSCNMCAU-UHFFFAOYSA-N butane-1,2,3,4-tetracarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(C(O)=O)CC(O)=O GGAUUQHSCNMCAU-UHFFFAOYSA-N 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000002993 cycloalkylene group Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 3
- OLRJXMHANKMLTD-UHFFFAOYSA-N silyl Chemical compound [SiH3] OLRJXMHANKMLTD-UHFFFAOYSA-N 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- 125000004958 1,4-naphthylene group Chemical group 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 2
- 125000006017 1-propenyl group Chemical group 0.000 description 2
- 125000004825 2,2-dimethylpropylene group Chemical group [H]C([H])([H])C(C([H])([H])[H])(C([H])([H])[*:1])C([H])([H])[*:2] 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- 125000006040 2-hexenyl group Chemical group 0.000 description 2
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SLINHMUFWFWBMU-UHFFFAOYSA-N Triisopropanolamine Chemical compound CC(O)CN(CC(C)O)CC(C)O SLINHMUFWFWBMU-UHFFFAOYSA-N 0.000 description 2
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000000000 tetracarboxylic acids Chemical class 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- 125000006839 xylylene group Chemical group 0.000 description 2
- VNELDJOPKWLCJV-UHFFFAOYSA-N (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) carbamate Chemical compound CCCCN1C(C)(C)CC(OC(N)=O)CC1(C)C VNELDJOPKWLCJV-UHFFFAOYSA-N 0.000 description 1
- NWGGWLUOMBGXFI-UHFFFAOYSA-N (2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) carbamate Chemical compound CCCN1C(C)(C)CC(OC(N)=O)CC1(C)C NWGGWLUOMBGXFI-UHFFFAOYSA-N 0.000 description 1
- QGWZSQSEJMBWAF-UHFFFAOYSA-N (9-acetyl-3-ethyl-8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl)methyl acetate Chemical compound O1CC(CC)(COC(C)=O)COC11CC(C)(C)N(C(C)=O)C(C)(C)C1 QGWZSQSEJMBWAF-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- NWHNXXMYEICZAT-UHFFFAOYSA-N 1,2,2,6,6-pentamethylpiperidin-4-ol Chemical compound CN1C(C)(C)CC(O)CC1(C)C NWHNXXMYEICZAT-UHFFFAOYSA-N 0.000 description 1
- GHJUORCGZFHNKG-UHFFFAOYSA-N 1,2,2,6,6-pentamethylpiperidin-4-one Chemical compound CN1C(C)(C)CC(=O)CC1(C)C GHJUORCGZFHNKG-UHFFFAOYSA-N 0.000 description 1
- STQGDAATELZKHO-UHFFFAOYSA-N 1,3,7,7,8,9,9-heptamethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(C)C(=O)N(C)C11CC(C)(C)N(C)C(C)(C)C1 STQGDAATELZKHO-UHFFFAOYSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- YLNHMDBXZAIRGL-UHFFFAOYSA-N 1-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)prop-2-en-1-one Chemical compound C1C(C)(C)N(C(=O)C=C)C(C)(C)CC1OCC1=CC=CC=C1 YLNHMDBXZAIRGL-UHFFFAOYSA-N 0.000 description 1
- QGMHWTYLWNSJKO-UHFFFAOYSA-N 1-(5,5-dimethylhex-2-enyl)-2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC(C)(C)CC=CCN1C(C)(C)CC(O)CC1(C)C QGMHWTYLWNSJKO-UHFFFAOYSA-N 0.000 description 1
- KMEUSKGEUADGET-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-one Chemical group CC1(C)CC(=O)CC(C)(C)N1O KMEUSKGEUADGET-UHFFFAOYSA-N 0.000 description 1
- GOWWQRAEWBATLK-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-(oxiran-2-ylmethyl)piperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1CC1OC1 GOWWQRAEWBATLK-UHFFFAOYSA-N 0.000 description 1
- IOCLFIGHHOKNTE-UHFFFAOYSA-N 2,2,6,6-tetramethyl-n-(2,2,6,6-tetramethylpiperidin-4-yl)piperidin-4-amine Chemical compound C1C(C)(C)NC(C)(C)CC1NC1CC(C)(C)NC(C)(C)C1 IOCLFIGHHOKNTE-UHFFFAOYSA-N 0.000 description 1
- RYRJTUANWYZSIH-UHFFFAOYSA-N 2,2,6,6-tetramethyl-n-[[4-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]phenyl]methyl]piperidin-4-amine Chemical compound C1C(C)(C)NC(C)(C)CC1NCC(C=C1)=CC=C1CNC1CC(C)(C)NC(C)(C)C1 RYRJTUANWYZSIH-UHFFFAOYSA-N 0.000 description 1
- LZNCZMSWGKUJRV-UHFFFAOYSA-N 2,2-dibutyl-7,7,9,9-tetramethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one Chemical compound O1C(CCCC)(CCCC)NC(=O)C11CC(C)(C)NC(C)(C)C1 LZNCZMSWGKUJRV-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- VKPPIWPNISESCO-UHFFFAOYSA-N 2-[(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)oxymethyl]phenol Chemical compound C(C)N1C(CC(CC1(C)C)OCC=1C(O)=CC=CC=1)(C)C VKPPIWPNISESCO-UHFFFAOYSA-N 0.000 description 1
- DOTYDHBOKPPXRB-UHFFFAOYSA-N 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioic acid Chemical compound CCCCC(C(O)=O)(C(O)=O)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 DOTYDHBOKPPXRB-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- BYDRTKVGBRTTIT-UHFFFAOYSA-N 2-methylprop-2-en-1-ol Chemical group CC(=C)CO BYDRTKVGBRTTIT-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- OWTCCRCIUNUOOM-UHFFFAOYSA-N 3,7,7,8,9,9-hexamethyl-1,4-dioxa-8-azaspiro[4.5]decane Chemical compound O1C(C)COC11CC(C)(C)N(C)C(C)(C)C1 OWTCCRCIUNUOOM-UHFFFAOYSA-N 0.000 description 1
- HTQOIDQIAPZYNA-UHFFFAOYSA-N 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxypropanenitrile Chemical compound CC1(C)CC(OCCC#N)CC(C)(C)N1O HTQOIDQIAPZYNA-UHFFFAOYSA-N 0.000 description 1
- WPMYUUITDBHVQZ-UHFFFAOYSA-N 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoic acid Chemical compound CC(C)(C)C1=CC(CCC(O)=O)=CC(C(C)(C)C)=C1O WPMYUUITDBHVQZ-UHFFFAOYSA-N 0.000 description 1
- IZXWGXJYQKWVOU-UHFFFAOYSA-N 3-ethyl-8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecane Chemical compound O1CC(CC)COC11CC(C)(C)NC(C)(C)C1 IZXWGXJYQKWVOU-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- APKFLZGRWMXNNV-UHFFFAOYSA-N 6-(carboxyamino)hexylcarbamic acid Chemical compound OC(=O)NCCCCCCNC(O)=O APKFLZGRWMXNNV-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YQJVAPGBVMMAJF-UHFFFAOYSA-N 8,8,10,10-tetramethyl-1,5-dioxa-9-azaspiro[5.5]undecane Chemical compound C1C(C)(C)NC(C)(C)CC21OCCCO2 YQJVAPGBVMMAJF-UHFFFAOYSA-N 0.000 description 1
- RAZWNFJQEZAVOT-UHFFFAOYSA-N 8-acetyl-3-dodecyl-7,7,9,9-tetramethyl-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound O=C1N(CCCCCCCCCCCC)C(=O)NC11CC(C)(C)N(C(C)=O)C(C)(C)C1 RAZWNFJQEZAVOT-UHFFFAOYSA-N 0.000 description 1
- 101150043850 Amtn gene Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- JJLKTTCRRLHVGL-UHFFFAOYSA-L [acetyloxy(dibutyl)stannyl] acetate Chemical compound CC([O-])=O.CC([O-])=O.CCCC[Sn+2]CCCC JJLKTTCRRLHVGL-UHFFFAOYSA-L 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- NEWLGVSEDBKVNS-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-dibutylpropanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)C(CCCC)(CCCC)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 NEWLGVSEDBKVNS-UHFFFAOYSA-N 0.000 description 1
- FLPKSBDJMLUTEX-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)C(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)(CCCC)CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 FLPKSBDJMLUTEX-UHFFFAOYSA-N 0.000 description 1
- RSOILICUEWXSLA-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 RSOILICUEWXSLA-UHFFFAOYSA-N 0.000 description 1
- CYDGPOYMFXUKLB-VXPUYCOJSA-N bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) (z)-but-2-enedioate Chemical compound CC1(C)CC(OC(=O)\C=C/C(=O)OC2CC(C)(C)N(CC=3C=CC=CC=3)C(C)(C)C2)CC(C)(C)N1CC1=CC=CC=C1 CYDGPOYMFXUKLB-VXPUYCOJSA-N 0.000 description 1
- DLHNOZQXRABONJ-UHFFFAOYSA-N bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)CC(C)(C)N1OC1CCCCC1 DLHNOZQXRABONJ-UHFFFAOYSA-N 0.000 description 1
- OSIVCXJNIBEGCL-UHFFFAOYSA-N bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) decanedioate Chemical compound C1C(C)(C)N(OCCCCCCCC)C(C)(C)CC1OC(=O)CCCCCCCCC(=O)OC1CC(C)(C)N(OCCCCCCCC)C(C)(C)C1 OSIVCXJNIBEGCL-UHFFFAOYSA-N 0.000 description 1
- PVWAWSAAXMQJSA-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-ethylpropanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C(CC)C(=O)OC1CC(C)(C)NC(C)(C)C1 PVWAWSAAXMQJSA-UHFFFAOYSA-N 0.000 description 1
- GOJOVSYIGHASEI-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) butanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCC(=O)OC1CC(C)(C)NC(C)(C)C1 GOJOVSYIGHASEI-UHFFFAOYSA-N 0.000 description 1
- UROGBLCMTWAODF-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) hexanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 UROGBLCMTWAODF-UHFFFAOYSA-N 0.000 description 1
- YTCAGGVGRNNAHU-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) pentanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)CCCC(=O)OC1CC(C)(C)NC(C)(C)C1 YTCAGGVGRNNAHU-UHFFFAOYSA-N 0.000 description 1
- WRMAIUJBSHAUIB-UHFFFAOYSA-N bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) decanedioate Chemical compound CC1C(C)(CC)N(C)C(CC)(C)CC1OC(=O)CCCCCCCCC(=O)OC1C(C)C(C)(CC)N(C)C(C)(CC)C1 WRMAIUJBSHAUIB-UHFFFAOYSA-N 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- DDTBPAQBQHZRDW-UHFFFAOYSA-N cyclododecane Chemical group C1CCCCCCCCCCC1 DDTBPAQBQHZRDW-UHFFFAOYSA-N 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- BOBNOXCLPCOMIK-UHFFFAOYSA-N dimethyl-bis[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]silane Chemical compound C1C(C)(C)NC(C)(C)CC1O[Si](C)(C)OC1CC(C)(C)NC(C)(C)C1 BOBNOXCLPCOMIK-UHFFFAOYSA-N 0.000 description 1
- 238000009837 dry grinding Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 125000006232 ethoxy propyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- GWNFQAKCJYEJEW-UHFFFAOYSA-N ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate Chemical compound CCOC(=O)C1=CC(NC(=O)CCCCCCCSC2=NN=C(CC3=NN(C)C(=O)C4=CC=CC=C34)N2C)=CC=C1 GWNFQAKCJYEJEW-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- NPLSRXKOUBVHTB-UHFFFAOYSA-N phenyl-tris[(2,2,6,6-tetramethylpiperidin-4-yl)oxy]silane Chemical compound C1C(C)(C)NC(C)(C)CC1O[Si](C=1C=CC=CC=1)(OC1CC(C)(C)NC(C)(C)C1)OC1CC(C)(C)NC(C)(C)C1 NPLSRXKOUBVHTB-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 125000006233 propoxy propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 1
- 150000003628 tricarboxylic acids Chemical class 0.000 description 1
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 1
- TZCXWPBSZLCVFR-UHFFFAOYSA-N tris(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) phosphate Chemical compound C1C(C)(C)N(CCC)C(C)(C)CC1OP(=O)(OC1CC(C)(C)N(CCC)C(C)(C)C1)OC1CC(C)(C)N(CCC)C(C)(C)C1 TZCXWPBSZLCVFR-UHFFFAOYSA-N 0.000 description 1
- GPRWRDWHHCQROU-UHFFFAOYSA-N tris(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) phosphite Chemical compound C1C(C)(C)N(CCC)C(C)(C)CC1OP(OC1CC(C)(C)N(CCC)C(C)(C)C1)OC1CC(C)(C)N(CCC)C(C)(C)C1 GPRWRDWHHCQROU-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/025—Purification; Separation; Stabilisation; Desodorisation of organo-phosphorus compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5393—Phosphonous compounds, e.g. R—P(OR')2
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/52—Phosphorus bound to oxygen only
- C08K5/524—Esters of phosphorous acids, e.g. of H3PO3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- General Health & Medical Sciences (AREA)
- Biochemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Molecular Biology (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Anti-Oxidant Or Stabilizer Compositions (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH310592 | 1992-10-05 |
Publications (2)
Publication Number | Publication Date |
---|---|
SK106493A3 SK106493A3 (en) | 1994-08-10 |
SK282126B6 true SK282126B6 (sk) | 2001-11-06 |
Family
ID=4248731
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
SK1064-93A SK282126B6 (sk) | 1992-10-05 | 1993-10-04 | Spôsob stabilizácie organického fosfitu alebo fosfonitu alebo ich zmesi proti hydrolýze a kompozícia obsahujúca organický fosfit alebo fosfonit a stericky bránený amín |
Country Status (16)
Country | Link |
---|---|
US (1) | US5840954A (no) |
EP (1) | EP0592363B1 (no) |
JP (1) | JPH06199877A (no) |
KR (1) | KR100292983B1 (no) |
CN (1) | CN1066168C (no) |
AT (1) | ATE192769T1 (no) |
BR (1) | BR9304116A (no) |
CA (1) | CA2107528A1 (no) |
CZ (1) | CZ287083B6 (no) |
DE (1) | DE59310036D1 (no) |
ES (1) | ES2146222T3 (no) |
MX (1) | MX9306059A (no) |
RU (1) | RU2119493C1 (no) |
SK (1) | SK282126B6 (no) |
TW (1) | TW251307B (no) |
ZA (1) | ZA937341B (no) |
Families Citing this family (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
FR2705679B1 (fr) * | 1993-05-24 | 1998-07-10 | Sandoz Sa | Nouvelles compositions stabilisantes des matières polymères, à base de phosphonites ou phosphites et d'un stabilisant contre l'hydrolyse. |
US5856550A (en) * | 1994-04-05 | 1999-01-05 | Ciba Specialty Chemicals Corporation | Enhancement of the storage stability of organic phosphites and phosphonites |
US5468895A (en) * | 1994-10-19 | 1995-11-21 | General Electric Company | Amine stabilized amorphous phosphite |
US6046304A (en) * | 1995-12-04 | 2000-04-04 | Ciba Specialty Chemicals Corporation | Block oligomers containing 2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials |
JP3835169B2 (ja) * | 1999-01-06 | 2006-10-18 | 株式会社エーピーアイ コーポレーション | ホスホナイト化合物の製造方法 |
DE19917070A1 (de) * | 1999-04-15 | 2000-10-19 | Basf Ag | Stabilisierte Phosphorverbindungen beinhaltende Zusammensetzung |
US20050277713A1 (en) * | 2003-03-05 | 2005-12-15 | Pearson Jason C | Polymer blends |
JP5319092B2 (ja) * | 2007-09-03 | 2013-10-16 | スパンション エルエルシー | 半導体装置およびその製造方法 |
TW201109342A (en) * | 2009-07-31 | 2011-03-16 | Chemtura Corp | Processes for forming alkylated aryl phosphite compositions from complex hydrocarbon streams |
GB2592952B (en) | 2020-03-11 | 2023-12-13 | Si Group Switzerland Gmbh | Composition |
Family Cites Families (17)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
NL109902C (no) * | 1958-08-11 | |||
US3553298A (en) * | 1967-10-20 | 1971-01-05 | Hooker Chemical Corp | Hydrolytic stabilized phosphite esters |
FR2101275A5 (no) * | 1970-07-17 | 1972-03-31 | Ugine Kuhlmann | |
JPS5029455B2 (no) * | 1972-02-25 | 1975-09-23 | ||
CA1068893A (en) * | 1975-08-11 | 1980-01-01 | James F. York | Stabilizer for vinyl polymers |
NL7613982A (nl) * | 1975-12-19 | 1977-06-21 | Ciba Geigy | Nieuwe fosfieten. |
CA1116339A (en) * | 1978-02-15 | 1982-01-12 | Ingenuin Hechenbleikner | Stabilization of propylene polymers |
GB2046273B (en) * | 1979-03-27 | 1983-02-09 | Borg Warner | Stabiliser for polymers |
JPS5930173B2 (ja) * | 1979-05-01 | 1984-07-25 | ボルグ−ワ−ナ−・ケミカルス・インコ−ポレ−テッド | 重合体のための安定剤 |
JPS5826917B2 (ja) * | 1980-02-13 | 1983-06-06 | アデカ・ア−ガス化学株式会社 | 改良された有機ホスフアイト組成物 |
EP0143464B1 (en) * | 1983-11-28 | 1987-07-08 | Argus Chemical Corporation | Pentaerythritol-spiro-bis-phosphite compositions having improved hydrolytic stability |
EP0158300B1 (en) * | 1984-04-09 | 1990-01-31 | Borg-Warner Chemicals, Inc. | Preparation of 2,6-dialkyl phenoxydihalophosphites |
JPH0613539B2 (ja) * | 1984-07-04 | 1994-02-23 | 旭電化工業株式会社 | 有機ホスファイト組成物 |
US4650894A (en) * | 1984-07-05 | 1987-03-17 | Argus Chemical Corporation | Tris-organophosphite compositions having improved hydrolytic stability |
JPS61140589A (ja) * | 1984-12-10 | 1986-06-27 | ア−ガス・ケミカル・コ−ポレ−シヨン | 耐加水分解性の改良されたペンタエリトリト−ル−スピロ−ビス−ホスフアイト組成物及び該組成物を含む組成物 |
ATE203044T1 (de) * | 1992-10-05 | 2001-07-15 | Ciba Sc Holding Ag | Verfahren zur stabilisierung dreiwertiger phosphorverbindungen mit aminen |
US5342978A (en) * | 1993-05-24 | 1994-08-30 | General Electric Company | Organic phosphite ester compositions containing hindered piperdinyl light stabilizers |
-
1993
- 1993-09-10 TW TW082107435A patent/TW251307B/zh active
- 1993-09-27 ES ES93810683T patent/ES2146222T3/es not_active Expired - Lifetime
- 1993-09-27 EP EP93810683A patent/EP0592363B1/de not_active Expired - Lifetime
- 1993-09-27 AT AT93810683T patent/ATE192769T1/de not_active IP Right Cessation
- 1993-09-27 DE DE59310036T patent/DE59310036D1/de not_active Expired - Fee Related
- 1993-09-30 US US08/129,704 patent/US5840954A/en not_active Expired - Fee Related
- 1993-09-30 MX MX9306059A patent/MX9306059A/es unknown
- 1993-10-01 CA CA002107528A patent/CA2107528A1/en not_active Abandoned
- 1993-10-04 ZA ZA937341A patent/ZA937341B/xx unknown
- 1993-10-04 CN CN93118257A patent/CN1066168C/zh not_active Expired - Fee Related
- 1993-10-04 BR BR9304116A patent/BR9304116A/pt not_active IP Right Cessation
- 1993-10-04 SK SK1064-93A patent/SK282126B6/sk unknown
- 1993-10-04 CZ CZ19932065A patent/CZ287083B6/cs not_active IP Right Cessation
- 1993-10-05 RU RU93056162A patent/RU2119493C1/ru active
- 1993-10-05 JP JP5274955A patent/JPH06199877A/ja active Pending
- 1993-10-05 KR KR1019930020737A patent/KR100292983B1/ko not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
CZ287083B6 (en) | 2000-09-13 |
ZA937341B (en) | 1994-04-25 |
TW251307B (no) | 1995-07-11 |
DE59310036D1 (de) | 2000-06-15 |
US5840954A (en) | 1998-11-24 |
MX9306059A (es) | 1994-04-29 |
BR9304116A (pt) | 1994-05-31 |
EP0592363B1 (de) | 2000-05-10 |
CA2107528A1 (en) | 1994-04-06 |
CN1090299A (zh) | 1994-08-03 |
KR100292983B1 (ko) | 2001-06-15 |
SK106493A3 (en) | 1994-08-10 |
ATE192769T1 (de) | 2000-05-15 |
EP0592363A1 (de) | 1994-04-13 |
CN1066168C (zh) | 2001-05-23 |
CZ206593A3 (en) | 1994-04-13 |
KR940009202A (ko) | 1994-05-20 |
JPH06199877A (ja) | 1994-07-19 |
ES2146222T3 (es) | 2000-08-01 |
RU2119493C1 (ru) | 1998-09-27 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US5977218A (en) | Polyolefin or olefin copolymer films having improved light stability and pesticide resistance | |
SK106593A3 (en) | Method of stabilization of trivalent phosphorus compounds with amines | |
EP0716123B1 (de) | Stabilisiertes Polyvinylchlorid | |
JP3720428B2 (ja) | 安定剤組成物 | |
DD297831A5 (de) | Verfahren zur herstellung von thermisch und oxidativ stabilen olefinpolymeren | |
SK282126B6 (sk) | Spôsob stabilizácie organického fosfitu alebo fosfonitu alebo ich zmesi proti hydrolýze a kompozícia obsahujúca organický fosfit alebo fosfonit a stericky bránený amín | |
KR100383189B1 (ko) | 안정화된유기포스파이트및포스포나이트의조성물 | |
EP0710677A2 (de) | Verfahren zur Herstellung von stabilisierten Olefinpolymeren | |
US5302497A (en) | Photosensitive organic polymeric material containing UV absorbers | |
RU2126011C1 (ru) | Способ стабилизации кристаллического органического фосфита или фосфонита от воздействия гидролиза и стабилизированный от воздействия гидролиза органический фосфит или фосфонит | |
US5856550A (en) | Enhancement of the storage stability of organic phosphites and phosphonites | |
DE3118962A1 (de) | Durch piperidylgruppen substituierte phophazene, verfahren zu ihrer herstellung, ihre verwendung als stabilisatoren und die mit ihnen stabilisierten polymermassen | |
DE3503136A1 (de) | Verfahren zur erhoehung des weissgrades bei optisch aufgehellten polyolefinen und polystyrol | |
CH688878GA3 (de) | Handelsformen von sterisch gehindertem Amin und deren Verwendung. | |
US6620867B1 (en) | Crystalline modification of mixtures of a nickel-quencher and a benzophenone and process for its preparation | |
US6403679B1 (en) | Granular form of a mixture of a nickel-quencher and a benzophenone and process for its preparation | |
CA2032692A1 (en) | Photosensitive organic material containing uv absorbers |