SE7910232L - Konstfiberlinor - Google Patents
KonstfiberlinorInfo
- Publication number
- SE7910232L SE7910232L SE7910232A SE7910232A SE7910232L SE 7910232 L SE7910232 L SE 7910232L SE 7910232 A SE7910232 A SE 7910232A SE 7910232 A SE7910232 A SE 7910232A SE 7910232 L SE7910232 L SE 7910232L
- Authority
- SE
- Sweden
- Prior art keywords
- layers
- rope
- synthetic rope
- fibres
- phenyleneterephthalamide
- Prior art date
Links
- WRDNCFQZLUCIRH-UHFFFAOYSA-N 4-(7-azabicyclo[2.2.1]hepta-1,3,5-triene-7-carbonyl)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1C(=O)N1C2=CC=C1C=C2 WRDNCFQZLUCIRH-UHFFFAOYSA-N 0.000 abstract 1
- 239000004760 aramid Substances 0.000 abstract 1
- 229920003235 aromatic polyamide Polymers 0.000 abstract 1
- 229920002994 synthetic fiber Polymers 0.000 abstract 1
Classifications
-
- D—TEXTILES; PAPER
- D07—ROPES; CABLES OTHER THAN ELECTRIC
- D07B—ROPES OR CABLES IN GENERAL
- D07B1/00—Constructional features of ropes or cables
- D07B1/02—Ropes built-up from fibrous or filamentary material, e.g. of vegetable origin, of animal origin, regenerated cellulose, plastics
- D07B1/025—Ropes built-up from fibrous or filamentary material, e.g. of vegetable origin, of animal origin, regenerated cellulose, plastics comprising high modulus, or high tenacity, polymer filaments or fibres, e.g. liquid-crystal polymers
-
- D—TEXTILES; PAPER
- D07—ROPES; CABLES OTHER THAN ELECTRIC
- D07B—ROPES OR CABLES IN GENERAL
- D07B2201/00—Ropes or cables
- D07B2201/10—Rope or cable structures
- D07B2201/1028—Rope or cable structures characterised by the number of strands
- D07B2201/1036—Rope or cable structures characterised by the number of strands nine or more strands respectively forming multiple layers
-
- D—TEXTILES; PAPER
- D07—ROPES; CABLES OTHER THAN ELECTRIC
- D07B—ROPES OR CABLES IN GENERAL
- D07B2205/00—Rope or cable materials
- D07B2205/20—Organic high polymers
- D07B2205/2046—Polyamides, e.g. nylons
- D07B2205/205—Aramides
Landscapes
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Ropes Or Cables (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2853661A DE2853661C2 (de) | 1978-12-13 | 1978-12-13 | Kunstfaserseil |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE7910232L true SE7910232L (sv) | 1980-06-14 |
Family
ID=6056953
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7910232A SE7910232L (sv) | 1978-12-13 | 1979-12-12 | Konstfiberlinor |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT367112B (it) |
| BE (1) | BE880279A (it) |
| BR (1) | BR7908024A (it) |
| CH (1) | CH643901A5 (it) |
| DE (1) | DE2853661C2 (it) |
| DK (1) | DK471679A (it) |
| ES (1) | ES246896Y (it) |
| FR (1) | FR2468684A1 (it) |
| GB (1) | GB2036825B (it) |
| GR (1) | GR74098B (it) |
| IT (1) | IT1126501B (it) |
| LU (1) | LU81965A1 (it) |
| NL (1) | NL7908898A (it) |
| NO (1) | NO793420L (it) |
| PT (1) | PT70453A (it) |
| SE (1) | SE7910232L (it) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3246945A1 (de) * | 1982-12-18 | 1984-06-20 | Fa. Alfred Herbert Ziller, 4230 Wesel | Sicherheitsseil |
| GB8333845D0 (en) * | 1983-12-20 | 1984-02-01 | British Ropes Ltd | Flexible tension members |
| ATE44395T1 (de) * | 1984-02-01 | 1989-07-15 | Teufelberger Gmbh | Seil aus faeden, garnen oder litzen aus textilem fasermaterial. |
| US4624097A (en) * | 1984-03-23 | 1986-11-25 | Greening Donald Co. Ltd. | Rope |
| US4813630A (en) * | 1987-08-14 | 1989-03-21 | Conn Sidney H | Electrically non-conductive suspension cables for hot air balloons |
| DE4001118A1 (de) * | 1990-01-17 | 1991-07-18 | Bayer Ag | Seile aus faserverbundprofilen |
| DE4136915A1 (de) * | 1990-11-13 | 1992-05-14 | Wilhelm Suetterlin | Seil, herstellungsverfahren dafuer und maschine zum durchfuehren des verseilverfahrens |
| BR9500779A (pt) | 1994-03-02 | 1995-10-24 | Inventio Ag | Cabo como meio de suporte para elevadores |
| CA2169431C (en) * | 1995-03-06 | 2005-07-12 | Claudio De Angelis | Equipment for recognising when synthetic fibre cables are ripe for being discarded |
| DE29608971U1 (de) * | 1996-05-20 | 1996-08-22 | Teufelberger Ges.M.B.H., Wels | Seil für die Mitnahme und Weitergabe von Papierbahnen bei der Herstellung von Papier und Kartonagen auf Papiermaschinen |
| US5881843A (en) * | 1996-10-15 | 1999-03-16 | Otis Elevator Company | Synthetic non-metallic rope for an elevator |
| IL132299A (en) * | 1998-10-23 | 2003-10-31 | Inventio Ag | Stranded synthetic fiber rope |
| ZA996983B (en) * | 1998-11-25 | 2000-05-18 | Inventio Ag | Sheathless synthetic fiber rope. |
| DE102005008087B4 (de) | 2004-11-15 | 2023-10-05 | Liebherr-Werk Biberach Gmbh | Kran |
| DE502006006459D1 (de) * | 2005-07-21 | 2010-04-29 | Cortex Huembelin Ag | Hochsicherheitsseil |
| US8256200B2 (en) | 2005-07-21 | 2012-09-04 | Cortex Humbelin Ag | High-security cable |
| AT516444B1 (de) * | 2014-11-05 | 2016-09-15 | Teufelberger Fiber Rope Gmbh | Seil aus textilem Fasermaterial |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1733661U (de) * | 1956-09-07 | 1956-11-08 | Basf Ag | Abschleppseil, bergseil, schiffstau, foerderseil aus linearen polymerisaten von olefinkohlenwasserstoffen. |
| US3055167A (en) * | 1958-05-23 | 1962-09-25 | Wall Rope Works Inc | Rope |
| BE655593A (it) * | 1964-11-12 | 1965-03-01 | ||
| DE1803316B2 (de) * | 1968-10-16 | 1972-02-17 | Zweilagige litze oder zweilagiges seil | |
| DE2231968C3 (de) * | 1972-06-29 | 1980-11-13 | Bayer Ag, 5090 Leverkusen | Litze für ein Drahtseil aus synthetischen Drähten und synthetischen Fasern |
| US3911785A (en) * | 1974-01-18 | 1975-10-14 | Wall Ind Inc | Parallel yarn rope |
| DE2455273C3 (de) * | 1974-11-22 | 1978-01-19 | Feiten & Guilleaume Carlswerk AG, 5000 Köln | Kranseil aus Kunststoff |
| US4202164A (en) * | 1978-11-06 | 1980-05-13 | Amsted Industries Incorporated | Lubricated plastic impregnated aramid fiber rope |
-
1978
- 1978-12-13 DE DE2853661A patent/DE2853661C2/de not_active Expired
-
1979
- 1979-10-25 NO NO793420A patent/NO793420L/no unknown
- 1979-11-07 DK DK471679A patent/DK471679A/da not_active Application Discontinuation
- 1979-11-08 GR GR60455A patent/GR74098B/el unknown
- 1979-11-14 PT PT70453A patent/PT70453A/pt unknown
- 1979-11-16 AT AT0731279A patent/AT367112B/de not_active IP Right Cessation
- 1979-11-20 ES ES1979246896U patent/ES246896Y/es not_active Expired
- 1979-11-21 CH CH1040379A patent/CH643901A5/de not_active IP Right Cessation
- 1979-11-21 GB GB7940231A patent/GB2036825B/en not_active Expired
- 1979-11-27 BE BE0/198304A patent/BE880279A/fr not_active IP Right Cessation
- 1979-11-27 FR FR7929128A patent/FR2468684A1/fr active Granted
- 1979-12-07 IT IT27910/79A patent/IT1126501B/it active
- 1979-12-07 LU LU81965A patent/LU81965A1/de unknown
- 1979-12-10 BR BR7908024A patent/BR7908024A/pt unknown
- 1979-12-11 NL NL7908898A patent/NL7908898A/nl not_active Application Discontinuation
- 1979-12-12 SE SE7910232A patent/SE7910232L/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| NO793420L (no) | 1980-06-16 |
| GR74098B (it) | 1984-06-06 |
| IT7927910A0 (it) | 1979-12-07 |
| BR7908024A (pt) | 1980-09-09 |
| IT1126501B (it) | 1986-05-21 |
| CH643901A5 (de) | 1984-06-29 |
| GB2036825B (en) | 1983-05-25 |
| ES246896U (es) | 1980-03-01 |
| ES246896Y (es) | 1980-09-16 |
| FR2468684B1 (it) | 1983-12-02 |
| LU81965A1 (de) | 1980-04-22 |
| AT367112B (de) | 1982-06-11 |
| DK471679A (da) | 1980-06-14 |
| GB2036825A (en) | 1980-07-02 |
| FR2468684A1 (fr) | 1981-05-08 |
| DE2853661A1 (de) | 1980-07-03 |
| BE880279A (fr) | 1980-03-17 |
| NL7908898A (nl) | 1980-06-17 |
| DE2853661C2 (de) | 1983-12-01 |
| PT70453A (de) | 1979-12-01 |
| ATA731279A (de) | 1981-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE7910232L (sv) | Konstfiberlinor | |
| FI814065L (fi) | Luftkabel utrustad med medel foer avlastning av dragbelastning | |
| SE8501922L (sv) | Submarin telekabel | |
| ES458736A1 (es) | Linea de transmision por fibras opticas mejorada. | |
| KR870011034A (ko) | 둥근물체를 달아올리는 기구 | |
| MY112274A (en) | Floating line or rope | |
| ES344707A1 (es) | Un dispositivo terminal optico de fibras. | |
| DE3484911D1 (de) | Optisches kabel. | |
| ATE12700T1 (de) | Selbsttragendes optisches nachrichtenkabel. | |
| DE3483323D1 (de) | Vorrichtung mit zwei konzentrisch angeordneten rohrspeichern. | |
| JPS56105135A (en) | Power transmission belt | |
| JPS52113230A (en) | Manufacture of tip end tapered light transmitting fiber and its mutual ly combined part | |
| JPS6438910A (en) | Flat type composite cable | |
| KR870700249A (ko) | 코드 부착코일 및 그 제조방법 | |
| ATE1251T1 (de) | Rundseil aus einer geraden zahl von litzen mit schlaufe. | |
| SU783072A1 (ru) | Звеньева струна дл контактной сети железных дорог | |
| GB974776A (en) | Composite metal-synthetic polymer rope | |
| JPS52108831A (en) | Optical fiber cable | |
| JPS52108830A (en) | Optical fiber cable | |
| JPS5297748A (en) | Connection of optical fiber cables | |
| DK26285D0 (da) | Brandslukningsapparat | |
| GB530303A (en) | Improvements in power transmission belting | |
| JPS56154708A (en) | Terminal part of optical fiber cable | |
| JPS5328726A (en) | Drawing of multicomponent fibers | |
| JPH0218215U (it) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAV | Patent application has lapsed |
Ref document number: 7910232-3 Format of ref document f/p: F |