SE443780B - Nytt forfarande for framstellning av 2-acetamidokanelsyra - Google Patents
Nytt forfarande for framstellning av 2-acetamidokanelsyraInfo
- Publication number
- SE443780B SE443780B SE7812936A SE7812936A SE443780B SE 443780 B SE443780 B SE 443780B SE 7812936 A SE7812936 A SE 7812936A SE 7812936 A SE7812936 A SE 7812936A SE 443780 B SE443780 B SE 443780B
- Authority
- SE
- Sweden
- Prior art keywords
- carbon atoms
- glycine
- mol
- acid
- water
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- 239000002253 acid Substances 0.000 title 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 34
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 24
- 239000004471 Glycine Substances 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- ANVZQEASRUZEQM-UHFFFAOYSA-N 3-(2-acetamidophenyl)prop-2-enoic acid Chemical class CC(=O)NC1=CC=CC=C1C=CC(O)=O ANVZQEASRUZEQM-UHFFFAOYSA-N 0.000 claims description 8
- 150000001299 aldehydes Chemical class 0.000 claims description 6
- 150000003512 tertiary amines Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- -1 alkyl radicals Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 6
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 5
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- OPHQOIGEOHXOGX-UHFFFAOYSA-N 3,4,5-trimethoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(OC)=C1OC OPHQOIGEOHXOGX-UHFFFAOYSA-N 0.000 description 2
- XMMJGBIZQXGGMH-UHFFFAOYSA-N 3-(6-acetamido-6-acetyloxycyclohexa-2,4-dien-1-yl)prop-2-enoic acid Chemical compound CC(=O)NC1(OC(C)=O)C=CC=CC1C=CC(O)=O XMMJGBIZQXGGMH-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- SEVSMVUOKAMPDO-UHFFFAOYSA-N 4-acetoxy benzaldehyde Chemical compound CC(=O)OC1=CC=C(C=O)C=C1 SEVSMVUOKAMPDO-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 2
- ISDBWOPVZKNQDW-UHFFFAOYSA-N 4-phenylbenzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CC=CC=C1 ISDBWOPVZKNQDW-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- WTWBUQJHJGUZCY-UHFFFAOYSA-N cuminaldehyde Chemical compound CC(C)C1=CC=C(C=O)C=C1 WTWBUQJHJGUZCY-UHFFFAOYSA-N 0.000 description 2
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- SATCULPHIDQDRE-UHFFFAOYSA-N piperonal Chemical compound O=CC1=CC=C2OCOC2=C1 SATCULPHIDQDRE-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- XJSUFFJXWJOWBY-UHFFFAOYSA-N 2,5-dioxobicyclo[4.1.0]hepta-1(6),3-diene-3-carbaldehyde Chemical compound C1C=2C(C(C=O)=CC(C=21)=O)=O XJSUFFJXWJOWBY-UHFFFAOYSA-N 0.000 description 1
- NDOPHXWIAZIXPR-UHFFFAOYSA-N 2-bromobenzaldehyde Chemical compound BrC1=CC=CC=C1C=O NDOPHXWIAZIXPR-UHFFFAOYSA-N 0.000 description 1
- DTPMMUVCBIWOTO-UHFFFAOYSA-N 3-(2-acetamido-4-nitrophenyl)prop-2-enoic acid Chemical compound CC(=O)NC1=CC([N+]([O-])=O)=CC=C1C=CC(O)=O DTPMMUVCBIWOTO-UHFFFAOYSA-N 0.000 description 1
- YWSPWKXREVSQCA-UHFFFAOYSA-N 4,5-dimethoxy-2-nitrobenzaldehyde Chemical compound COC1=CC(C=O)=C([N+]([O-])=O)C=C1OC YWSPWKXREVSQCA-UHFFFAOYSA-N 0.000 description 1
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 1
- SKLUWKYNZNXSLX-UHFFFAOYSA-N 4-Acetamidobenzaldehyde Chemical compound CC(=O)NC1=CC=C(C=O)C=C1 SKLUWKYNZNXSLX-UHFFFAOYSA-N 0.000 description 1
- HETBKLHJEWXWBM-UHFFFAOYSA-N 4-chloro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(C=O)=CC=C1Cl HETBKLHJEWXWBM-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- UOQXIWFBQSVDPP-UHFFFAOYSA-N 4-fluorobenzaldehyde Chemical compound FC1=CC=C(C=O)C=C1 UOQXIWFBQSVDPP-UHFFFAOYSA-N 0.000 description 1
- AHJUZYZFZSQIMM-UHFFFAOYSA-N C[S+]1CCNCC1 Chemical compound C[S+]1CCNCC1 AHJUZYZFZSQIMM-UHFFFAOYSA-N 0.000 description 1
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 125000005035 acylthio group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- YNKMHABLMGIIFX-UHFFFAOYSA-N benzaldehyde;methane Chemical compound C.O=CC1=CC=CC=C1 YNKMHABLMGIIFX-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 1
- CIXSDMKDSYXUMJ-UHFFFAOYSA-N n,n-diethylcyclohexanamine Chemical compound CCN(CC)C1CCCCC1 CIXSDMKDSYXUMJ-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19772756129 DE2756129A1 (de) | 1977-12-16 | 1977-12-16 | Verfahren zur herstellung von 2-acetamidozimtsaeure |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7812936L SE7812936L (sv) | 1979-06-17 |
| SE443780B true SE443780B (sv) | 1986-03-10 |
Family
ID=6026311
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7812936A SE443780B (sv) | 1977-12-16 | 1978-12-15 | Nytt forfarande for framstellning av 2-acetamidokanelsyra |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4254035A (cs) |
| JP (1) | JPS5488237A (cs) |
| AT (1) | AT362771B (cs) |
| BE (1) | BE872825A (cs) |
| CA (1) | CA1124734A (cs) |
| CH (1) | CH639642A5 (cs) |
| DE (1) | DE2756129A1 (cs) |
| DK (1) | DK149042C (cs) |
| FR (1) | FR2411826A1 (cs) |
| GB (1) | GB2010255B (cs) |
| HU (1) | HU179446B (cs) |
| IT (1) | IT1157741B (cs) |
| NL (1) | NL7811104A (cs) |
| SE (1) | SE443780B (cs) |
| SU (1) | SU990081A3 (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0218728A1 (en) * | 1985-04-03 | 1987-04-22 | Yamanouchi Pharmaceutical Co. Ltd. | Phenylene derivatives |
| CN104311446A (zh) * | 2014-09-23 | 2015-01-28 | 河南省科学院化学研究所有限公司 | Dcc/dmap催化合成(z)-2-乙酰氨基肉桂酸甲酯方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3347928A (en) * | 1963-02-01 | 1967-10-17 | Merck & Co Inc | Process of oxidizing hydroxy phenyl alanines to hydroxy benzyl alkyl ketones |
| US4124533A (en) * | 1971-03-08 | 1978-11-07 | Monsanto Company | Metal coordination complexes containing optically active phosphine or arsine ligands |
| US3878043A (en) * | 1973-01-02 | 1975-04-15 | Univ Southern Illinois | Method for preparing L-dopa and novels compounds useful therein |
-
1977
- 1977-12-16 DE DE19772756129 patent/DE2756129A1/de active Granted
-
1978
- 1978-11-08 NL NL7811104A patent/NL7811104A/xx not_active Application Discontinuation
- 1978-11-10 SU SU782684453A patent/SU990081A3/ru active
- 1978-12-07 FR FR7834533A patent/FR2411826A1/fr active Granted
- 1978-12-12 DK DK557678A patent/DK149042C/da not_active IP Right Cessation
- 1978-12-13 US US05/968,923 patent/US4254035A/en not_active Expired - Lifetime
- 1978-12-14 JP JP15376278A patent/JPS5488237A/ja active Granted
- 1978-12-14 GB GB7848524A patent/GB2010255B/en not_active Expired
- 1978-12-14 IT IT52294/78A patent/IT1157741B/it active
- 1978-12-15 HU HU78DE986A patent/HU179446B/hu unknown
- 1978-12-15 CH CH1280878A patent/CH639642A5/de not_active IP Right Cessation
- 1978-12-15 SE SE7812936A patent/SE443780B/sv not_active IP Right Cessation
- 1978-12-15 AT AT0897178A patent/AT362771B/de not_active IP Right Cessation
- 1978-12-15 BE BE6046698A patent/BE872825A/xx not_active IP Right Cessation
- 1978-12-15 CA CA318,018A patent/CA1124734A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2411826B1 (cs) | 1984-04-27 |
| JPS5488237A (en) | 1979-07-13 |
| SU990081A3 (ru) | 1983-01-15 |
| CA1124734A (en) | 1982-06-01 |
| IT7852294A0 (it) | 1978-12-14 |
| US4254035A (en) | 1981-03-03 |
| NL7811104A (nl) | 1979-06-19 |
| DK557678A (da) | 1979-06-17 |
| FR2411826A1 (fr) | 1979-07-13 |
| AT362771B (de) | 1981-06-10 |
| JPS6159623B2 (cs) | 1986-12-17 |
| GB2010255B (en) | 1982-06-16 |
| DK149042C (da) | 1986-05-26 |
| GB2010255A (en) | 1979-06-27 |
| CH639642A5 (de) | 1983-11-30 |
| DE2756129A1 (de) | 1979-06-21 |
| HU179446B (en) | 1982-10-28 |
| SE7812936L (sv) | 1979-06-17 |
| DE2756129C2 (cs) | 1987-06-19 |
| BE872825A (fr) | 1979-06-15 |
| IT1157741B (it) | 1987-02-18 |
| ATA897178A (de) | 1980-11-15 |
| DK149042B (da) | 1985-12-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU188044B (en) | Process for preparing alapha, beta-unsaturated ketones | |
| HU212195B (en) | Process for the preparation of l-5-(2-acetoxy-propionylamino)-2,4,6,-triiodo-isophtalic acid dichloride | |
| US2552538A (en) | Diamidothiophosphates | |
| JPH0428711B2 (cs) | ||
| SE443780B (sv) | Nytt forfarande for framstellning av 2-acetamidokanelsyra | |
| GB2078748A (en) | Preparation of 2-methylenealdehydes | |
| EP0196708B1 (en) | Process for the preparation of 2-(hydroxyalkyl)acrylic compounds | |
| US3822306A (en) | Production of alpha-n-formylamino acid compounds | |
| US3499024A (en) | 2-hydroxy-hydrocarbyl acrylonitriles and preparation thereof by condensation of acrylonitrile and aldehydes | |
| HU204803B (en) | Process for producing isothiazolones | |
| US3004969A (en) | 3(salicylideneamino) coumarins and their preparation | |
| EP0547092B1 (en) | Process for preparing 2-methyl-3,5-dialkylpyridines by dealkylation with sulfur | |
| US3282832A (en) | Production of ketones, acids and esters from olefines | |
| JPH10324670A (ja) | 環状カルバメートを用いるクロロケトアミンの製造方法 | |
| US2662098A (en) | Haloalkyl substituted cycloheptatrien-1-ol-2-one ring compounds and methods for their preparation | |
| US2580494A (en) | N-disubstituted-amino t-hydroxy ketones | |
| HU182673B (en) | Process for preparing esters of 2-formyl-3,3-dimethyl-cyclopropane-1-carboxylic acid | |
| US4477674A (en) | Preparation of dihydrothiazoles | |
| US2692283A (en) | Method for preparing imines | |
| SU414787A3 (ru) | Способ получения замещенных бис-(бензилиденамино)-гуанидинов | |
| SU721416A1 (ru) | Способ получени диоксади- (аминофенил) алканов | |
| US2759968A (en) | Method of preparing esters from chloretone | |
| US4376871A (en) | Method for purification of cyclopentenolones | |
| SU449055A1 (ru) | Способ получени производных 2-( -оксибензил)-бензимидазола | |
| SU455972A1 (ru) | Способ получени дитиоокси тетраметилендифосфина |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7812936-8 Effective date: 19890301 Format of ref document f/p: F |