SE440916B - Pulverformigt textiltvettmedel for koktvett - Google Patents
Pulverformigt textiltvettmedel for koktvettInfo
- Publication number
- SE440916B SE440916B SE7803802A SE7803802A SE440916B SE 440916 B SE440916 B SE 440916B SE 7803802 A SE7803802 A SE 7803802A SE 7803802 A SE7803802 A SE 7803802A SE 440916 B SE440916 B SE 440916B
- Authority
- SE
- Sweden
- Prior art keywords
- weight
- water
- sodium
- surfactant
- group
- Prior art date
Links
- 239000003599 detergent Substances 0.000 title claims description 87
- 238000009835 boiling Methods 0.000 title claims description 14
- 239000004753 textile Substances 0.000 title claims description 10
- 239000000203 mixture Substances 0.000 claims description 65
- -1 alkali metal salts Chemical class 0.000 claims description 60
- 239000004094 surface-active agent Substances 0.000 claims description 45
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 36
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical group O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 34
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 33
- 239000003795 chemical substances by application Substances 0.000 claims description 33
- 239000002245 particle Substances 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 20
- 239000008139 complexing agent Substances 0.000 claims description 19
- 239000003112 inhibitor Substances 0.000 claims description 17
- 235000012239 silicon dioxide Nutrition 0.000 claims description 17
- 239000011734 sodium Substances 0.000 claims description 17
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 claims description 16
- 229910052681 coesite Inorganic materials 0.000 claims description 16
- 229910052906 cristobalite Inorganic materials 0.000 claims description 16
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 16
- 239000000194 fatty acid Substances 0.000 claims description 16
- 229930195729 fatty acid Natural products 0.000 claims description 16
- 239000000377 silicon dioxide Substances 0.000 claims description 16
- 239000000344 soap Substances 0.000 claims description 16
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 16
- 229910052682 stishovite Inorganic materials 0.000 claims description 16
- 229910052905 tridymite Inorganic materials 0.000 claims description 16
- 229910019142 PO4 Inorganic materials 0.000 claims description 15
- 239000003945 anionic surfactant Substances 0.000 claims description 15
- 239000002736 nonionic surfactant Substances 0.000 claims description 15
- 238000007046 ethoxylation reaction Methods 0.000 claims description 14
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 claims description 13
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 13
- 239000000654 additive Substances 0.000 claims description 13
- 235000021317 phosphate Nutrition 0.000 claims description 13
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 claims description 12
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 12
- 229910052593 corundum Inorganic materials 0.000 claims description 12
- 239000006260 foam Substances 0.000 claims description 12
- 229910001845 yogo sapphire Inorganic materials 0.000 claims description 12
- 239000003513 alkali Substances 0.000 claims description 11
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 11
- 102000005701 Calcium-Binding Proteins Human genes 0.000 claims description 10
- 108010045403 Calcium-Binding Proteins Proteins 0.000 claims description 10
- 239000004115 Sodium Silicate Substances 0.000 claims description 10
- 125000001931 aliphatic group Chemical group 0.000 claims description 10
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 9
- 229910021536 Zeolite Inorganic materials 0.000 claims description 9
- 159000000000 sodium salts Chemical class 0.000 claims description 9
- 229910052911 sodium silicate Inorganic materials 0.000 claims description 9
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 9
- 239000010457 zeolite Substances 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 150000002191 fatty alcohols Chemical class 0.000 claims description 8
- 102000004190 Enzymes Human genes 0.000 claims description 7
- 108090000790 Enzymes Proteins 0.000 claims description 7
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 7
- 230000003287 optical effect Effects 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 150000001335 aliphatic alkanes Chemical group 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 6
- 239000000975 dye Substances 0.000 claims description 6
- 230000002401 inhibitory effect Effects 0.000 claims description 6
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 6
- 229960001922 sodium perborate Drugs 0.000 claims description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 claims description 6
- 235000011152 sodium sulphate Nutrition 0.000 claims description 6
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 6
- RUPZRJCPTQGQRU-UHFFFAOYSA-N (1-hydroxy-1-phosphonobutyl)phosphonic acid Chemical compound CCCC(O)(P(O)(O)=O)P(O)(O)=O RUPZRJCPTQGQRU-UHFFFAOYSA-N 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 5
- 229910052782 aluminium Inorganic materials 0.000 claims description 5
- 239000004615 ingredient Substances 0.000 claims description 5
- 239000004435 Oxo alcohol Substances 0.000 claims description 4
- 239000013543 active substance Substances 0.000 claims description 4
- 239000002280 amphoteric surfactant Substances 0.000 claims description 4
- 239000004599 antimicrobial Substances 0.000 claims description 4
- 239000004014 plasticizer Substances 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 150000001447 alkali salts Chemical class 0.000 claims description 3
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 claims description 3
- 239000003205 fragrance Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 235000019645 odor Nutrition 0.000 claims description 3
- 229920000151 polyglycol Polymers 0.000 claims description 3
- 239000010695 polyglycol Substances 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 239000000429 sodium aluminium silicate Substances 0.000 claims description 3
- 235000012217 sodium aluminium silicate Nutrition 0.000 claims description 3
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 claims description 3
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 3
- ZCOMURCDMLBWOR-UHFFFAOYSA-N (hydroxy-phenyl-phosphonomethyl)phosphonic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)C1=CC=CC=C1 ZCOMURCDMLBWOR-UHFFFAOYSA-N 0.000 claims description 2
- PWQSPBJUQIQAAY-UHFFFAOYSA-N [(4-chlorophenyl)-hydroxy-phosphonomethyl]phosphonic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(O)C1=CC=C(Cl)C=C1 PWQSPBJUQIQAAY-UHFFFAOYSA-N 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 150000004685 tetrahydrates Chemical class 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims 1
- WRUUGTRCQOWXEG-UHFFFAOYSA-N pamidronate Chemical compound NCCC(O)(P(O)(O)=O)P(O)(O)=O WRUUGTRCQOWXEG-UHFFFAOYSA-N 0.000 claims 1
- 238000009304 pastoral farming Methods 0.000 claims 1
- 238000005406 washing Methods 0.000 description 42
- 239000000047 product Substances 0.000 description 32
- 238000002360 preparation method Methods 0.000 description 26
- 150000003839 salts Chemical class 0.000 description 19
- 239000007788 liquid Substances 0.000 description 15
- 239000003760 tallow Substances 0.000 description 14
- 239000010452 phosphate Substances 0.000 description 13
- 238000001035 drying Methods 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 11
- 239000011777 magnesium Substances 0.000 description 11
- 239000007795 chemical reaction product Substances 0.000 description 10
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- 229920000742 Cotton Polymers 0.000 description 9
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 9
- 239000011575 calcium Substances 0.000 description 9
- FSBVERYRVPGNGG-UHFFFAOYSA-N dimagnesium dioxido-bis[[oxido(oxo)silyl]oxy]silane hydrate Chemical compound O.[Mg+2].[Mg+2].[O-][Si](=O)O[Si]([O-])([O-])O[Si]([O-])=O FSBVERYRVPGNGG-UHFFFAOYSA-N 0.000 description 9
- 229910052749 magnesium Inorganic materials 0.000 description 9
- 239000000391 magnesium silicate Substances 0.000 description 9
- 235000019792 magnesium silicate Nutrition 0.000 description 9
- 229910052919 magnesium silicate Inorganic materials 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 8
- 150000001336 alkenes Chemical class 0.000 description 8
- 238000005187 foaming Methods 0.000 description 8
- 229920002472 Starch Polymers 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 7
- 239000007844 bleaching agent Substances 0.000 description 7
- 229910052791 calcium Inorganic materials 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 239000000470 constituent Substances 0.000 description 7
- 150000004665 fatty acids Chemical class 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 235000019353 potassium silicate Nutrition 0.000 description 7
- 239000008107 starch Substances 0.000 description 7
- 235000019698 starch Nutrition 0.000 description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 6
- 244000060011 Cocos nucifera Species 0.000 description 6
- 235000013162 Cocos nucifera Nutrition 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 6
- 239000002270 dispersing agent Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000003860 storage Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 5
- 239000004952 Polyamide Substances 0.000 description 5
- 230000000996 additive effect Effects 0.000 description 5
- 150000004645 aluminates Chemical class 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 5
- 229920002647 polyamide Polymers 0.000 description 5
- 238000001556 precipitation Methods 0.000 description 5
- 235000019832 sodium triphosphate Nutrition 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000002518 antifoaming agent Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000004061 bleaching Methods 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229910001425 magnesium ion Inorganic materials 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical class [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 4
- 229920001451 polypropylene glycol Polymers 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000006277 sulfonation reaction Methods 0.000 description 4
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229940096386 coconut alcohol Drugs 0.000 description 3
- 230000000536 complexating effect Effects 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000003333 secondary alcohols Chemical class 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000002351 wastewater Substances 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 239000004593 Epoxy Substances 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 2
- 235000019484 Rapeseed oil Nutrition 0.000 description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- DMCJFWXGXUEHFD-UHFFFAOYSA-N pentatriacontan-18-one Chemical compound CCCCCCCCCCCCCCCCCC(=O)CCCCCCCCCCCCCCCCC DMCJFWXGXUEHFD-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000004062 sedimentation Methods 0.000 description 2
- 229920002545 silicone oil Polymers 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 230000002087 whitening effect Effects 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N 2-(2-butoxyethoxy)ethanol Chemical compound CCCCOCCOCCO OAYXUHPQHDHDDZ-UHFFFAOYSA-N 0.000 description 1
- WJYAJBDKANFOID-UHFFFAOYSA-N 2-(dodecylamino)propanoic acid Chemical class CCCCCCCCCCCCNC(C)C(O)=O WJYAJBDKANFOID-UHFFFAOYSA-N 0.000 description 1
- JDSQBDGCMUXRBM-UHFFFAOYSA-N 2-[2-(2-butoxypropoxy)propoxy]propan-1-ol Chemical group CCCCOC(C)COC(C)COC(C)CO JDSQBDGCMUXRBM-UHFFFAOYSA-N 0.000 description 1
- NSMMFSKPGXCMOE-UHFFFAOYSA-N 2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=CC1=CC=CC=C1S(O)(=O)=O NSMMFSKPGXCMOE-UHFFFAOYSA-N 0.000 description 1
- UGFSLKRMHPGLFU-UHFFFAOYSA-N 2-[5-(1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole Chemical compound C1=CC=C2OC(C3=CC=C(S3)C=3OC4=CC=CC=C4N=3)=NC2=C1 UGFSLKRMHPGLFU-UHFFFAOYSA-N 0.000 description 1
- RXCBVZHUEDNRPD-UHFFFAOYSA-N 2-[bis(2,3-dihydroxypropyl)-hexadecylazaniumyl]acetate Chemical compound CCCCCCCCCCCCCCCC[N+](CC(O)CO)(CC(O)CO)CC([O-])=O RXCBVZHUEDNRPD-UHFFFAOYSA-N 0.000 description 1
- KKMIHKCGXQMFEU-UHFFFAOYSA-N 2-[dimethyl(tetradecyl)azaniumyl]acetate Chemical compound CCCCCCCCCCCCCC[N+](C)(C)CC([O-])=O KKMIHKCGXQMFEU-UHFFFAOYSA-N 0.000 description 1
- NJWSNNWLBMSXQR-UHFFFAOYSA-N 2-hexyloxirane Chemical compound CCCCCCC1CO1 NJWSNNWLBMSXQR-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical group COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- ONDJNAKJCWJYSX-UHFFFAOYSA-N 3-(dodecylamino)propane-1-sulfonic acid Chemical class CCCCCCCCCCCC[NH2+]CCCS([O-])(=O)=O ONDJNAKJCWJYSX-UHFFFAOYSA-N 0.000 description 1
- VZTHUHAJEZPWNC-UHFFFAOYSA-N 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)N)=CC=C1N1N=C(C=2C=CC(Cl)=CC=2)CC1 VZTHUHAJEZPWNC-UHFFFAOYSA-N 0.000 description 1
- YGUMVDWOQQJBGA-UHFFFAOYSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(C=CC=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-UHFFFAOYSA-N 0.000 description 1
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical class OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 description 1
- CTXYANVWMZDVLZ-UHFFFAOYSA-N 7-(diethylamino)-1-ethyl-3-phenylquinolin-2-one Chemical compound O=C1N(CC)C2=CC(N(CC)CC)=CC=C2C=C1C1=CC=CC=C1 CTXYANVWMZDVLZ-UHFFFAOYSA-N 0.000 description 1
- GZEYLLPOQRZUDF-UHFFFAOYSA-N 7-(dimethylamino)-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(N(C)C)=CC=C21 GZEYLLPOQRZUDF-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 241000428352 Amma Species 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RZXLPPRPEOUENN-UHFFFAOYSA-N Chlorfenson Chemical compound C1=CC(Cl)=CC=C1OS(=O)(=O)C1=CC=C(Cl)C=C1 RZXLPPRPEOUENN-UHFFFAOYSA-N 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- 102000020897 Formins Human genes 0.000 description 1
- 108091022623 Formins Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- QZXSMBBFBXPQHI-UHFFFAOYSA-N N-(dodecanoyl)ethanolamine Chemical compound CCCCCCCCCCCC(=O)NCCO QZXSMBBFBXPQHI-UHFFFAOYSA-N 0.000 description 1
- 229910004835 Na2B4O7 Inorganic materials 0.000 description 1
- 244000304393 Phlox paniculata Species 0.000 description 1
- 241000218657 Picea Species 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- MUXFZBHBYYYLTH-UHFFFAOYSA-N Zaltoprofen Chemical compound O=C1CC2=CC(C(C(O)=O)C)=CC=C2SC2=CC=CC=C21 MUXFZBHBYYYLTH-UHFFFAOYSA-N 0.000 description 1
- QUOPYLMWOHLNLL-UHFFFAOYSA-N [3-[hexadecyl-bis(2-hydroxyethyl)azaniumyl]-2-hydroxypropyl] sulfate Chemical compound CCCCCCCCCCCCCCCC[N+](CCO)(CCO)CC(O)COS([O-])(=O)=O QUOPYLMWOHLNLL-UHFFFAOYSA-N 0.000 description 1
- ITKIRQXZTYRTPL-UHFFFAOYSA-N [amino-(4-chlorophenyl)-phosphonomethyl]phosphonic acid Chemical compound OP(=O)(O)C(P(O)(O)=O)(N)C1=CC=C(Cl)C=C1 ITKIRQXZTYRTPL-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N benzo-alpha-pyrone Natural products C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 238000006065 biodegradation reaction Methods 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000005341 cation exchange Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 235000001671 coumarin Nutrition 0.000 description 1
- AFYCEAFSNDLKSX-UHFFFAOYSA-N coumarin 460 Chemical compound CC1=CC(=O)OC2=CC(N(CC)CC)=CC=C21 AFYCEAFSNDLKSX-UHFFFAOYSA-N 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 1
- 229940043276 diisopropanolamine Drugs 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- MFLMBWASGCAJGO-UHFFFAOYSA-L disodium;hydrogen peroxide;carbonate Chemical compound [Na+].[Na+].OO.[O-]C([O-])=O MFLMBWASGCAJGO-UHFFFAOYSA-L 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 235000019387 fatty acid methyl ester Nutrition 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 150000002462 imidazolines Chemical class 0.000 description 1
- 125000003010 ionic group Chemical group 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical compound NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 description 1
- 229940087646 methanolamine Drugs 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000004492 methyl ester group Chemical group 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000005673 monoalkenes Chemical class 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LRJJKCPUTLVGMR-UHFFFAOYSA-N n,n-bis(2,3-dihydroxypropyl)hexadecan-1-amine oxide Chemical compound CCCCCCCCCCCCCCCC[N+]([O-])(CC(O)CO)CC(O)CO LRJJKCPUTLVGMR-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000011164 primary particle Substances 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 239000011163 secondary particle Substances 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- YALHCTUQSQRCSX-UHFFFAOYSA-N sulfane sulfuric acid Chemical compound S.OS(O)(=O)=O YALHCTUQSQRCSX-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000003470 sulfuric acid monoesters Chemical class 0.000 description 1
- 235000010692 trans-unsaturated fatty acids Nutrition 0.000 description 1
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical class N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-N triphosphoric acid Chemical compound OP(O)(=O)OP(O)(=O)OP(O)(O)=O UNXRWKVEANCORM-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000004711 α-olefin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3942—Inorganic per-compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/36—Organic compounds containing phosphorus
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT283977A AT352241B (de) | 1977-04-22 | 1977-04-22 | Pulverfoermiges, phosphatfreies textil- waschmittel |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7803802L SE7803802L (sv) | 1978-10-23 |
| SE440916B true SE440916B (sv) | 1985-08-26 |
Family
ID=3541108
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7803802A SE440916B (sv) | 1977-04-22 | 1978-04-04 | Pulverformigt textiltvettmedel for koktvett |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4179391A (de) |
| JP (1) | JPS6028879B2 (de) |
| AT (1) | AT352241B (de) |
| BE (1) | BE866238A (de) |
| BR (1) | BR7802460A (de) |
| CH (1) | CH639691A5 (de) |
| DE (1) | DE2814083A1 (de) |
| FR (1) | FR2388044A1 (de) |
| GB (1) | GB1579505A (de) |
| IT (1) | IT1111461B (de) |
| NL (1) | NL7803594A (de) |
| SE (1) | SE440916B (de) |
| ZA (1) | ZA782296B (de) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0006268B2 (de) * | 1978-06-20 | 1988-08-24 | THE PROCTER & GAMBLE COMPANY | Zusammensetzungen zum Waschen und Weichmachen und Verfahren zu deren Herstellung |
| EP0010247B1 (de) * | 1978-10-12 | 1983-03-23 | Henkel Kommanditgesellschaft auf Aktien | Phosphatfreies Waschmittel und Verfahren zu dessen Herstellung |
| US4261941A (en) * | 1979-06-26 | 1981-04-14 | Union Carbide Corporation | Process for preparing zeolite-containing detergent agglomerates |
| ATE5896T1 (de) * | 1979-11-03 | 1984-02-15 | The Procter & Gamble Company | Granulare waschmittelzusammensetzungen. |
| DE3248022A1 (de) * | 1982-12-24 | 1984-06-28 | Henkel KGaA, 4000 Düsseldorf | Spruehgetrocknetes mehrkomponenten-waschmittel |
| GB8414407D0 (en) * | 1984-06-06 | 1984-07-11 | Monsanto Europe Sa | Detergent compositions |
| FR2568790B1 (fr) * | 1984-08-10 | 1990-01-12 | Rhone Poulenc Chim Base | Procede d'obtention d'une suspension aqueuse stable et pompable de zeolite et suspension ainsi obtenue |
| US4935065A (en) * | 1986-08-22 | 1990-06-19 | Ecolab Inc. | Phosphate-free alkaline detergent for cleaning-in-place of food processing equipment |
| DE3717227A1 (de) * | 1987-05-21 | 1988-12-01 | Henkel Kgaa | Phosphatfreies waschmittel mit reduzierter inkrustierungstendenz |
| GB8728386D0 (en) * | 1987-12-04 | 1988-01-13 | Unilever Plc | Phosphate-free detergent bleach compositions |
| DE3812693A1 (de) * | 1988-03-19 | 1989-09-28 | Reckitt Gmbh | Reinigungstablette fuer zahnprothesen |
| GB8904007D0 (en) * | 1989-02-22 | 1989-04-05 | Procter & Gamble | Stabilized,bleach containing,liquid detergent compositions |
| NL8900539A (nl) * | 1989-03-04 | 1990-10-01 | Stamicarbon | Geamideerde vetzuurmengsels en toepassing daarvan als verdikkingsmiddelen. |
| GB9000833D0 (en) * | 1990-01-15 | 1990-03-14 | S B Chemicals Limited | Detergent and production thereof |
| US5529710A (en) * | 1992-07-15 | 1996-06-25 | The Procter & Gamble Company | Production of detergent granules with excellent white appearance |
| CN1102954C (zh) * | 1993-07-14 | 2003-03-12 | 普罗格特-甘布尔公司 | 用部分水合的结晶硅铝酸盐流动性助剂涂层的过碳酸盐漂白剂颗粒 |
| US5849648A (en) * | 1997-04-24 | 1998-12-15 | Basf Corporation | Comfort melamine fabrics and process for making them |
| MX349265B (es) | 2010-05-20 | 2017-07-20 | Ecolab Usa Inc | Composiciones antimicrobianas liquidas de baja formacion de espuma, modificadas reologicamente, y sus metodos de uso. |
| JP5780843B2 (ja) * | 2011-06-09 | 2015-09-16 | 花王株式会社 | 粉末洗剤組成物 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL130828C (de) * | 1959-06-03 | |||
| US3234140A (en) * | 1964-06-05 | 1966-02-08 | Monsanto Co | Stabilization of peroxy solutions |
| US3766078A (en) * | 1971-06-03 | 1973-10-16 | Monsanto Co | Processes for stabilizing peroxy solutions |
| DE2243306A1 (de) * | 1972-09-02 | 1974-03-21 | Henkel & Cie Gmbh | Schaumregulierte waschmittel, insbesondere fuer trommelwaschmaschinen |
| DE2325829C2 (de) * | 1973-05-22 | 1982-04-01 | Henkel KGaA, 4000 Düsseldorf | Sequestrierungsmittel |
| US4083793A (en) * | 1973-05-23 | 1978-04-11 | Henkel Kommanditgesellschaft Auf Aktien | Washing compositions containing aluminosilicates and nonionics and method of washing textiles |
| US4055505A (en) * | 1974-07-12 | 1977-10-25 | Colgate-Palmolive Company | Activated percompound bleaching compositions |
| AT375392B (de) * | 1974-10-04 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| AT375395B (de) * | 1974-10-04 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| AT335035B (de) * | 1974-10-10 | 1977-02-25 | Henkel & Cie Gmbh | Stabile suspensionen wasserunloslicher, zum binden von calciumionen befahigter silikate und deren verwendung zur herstellung von wasch- und reinigungsmitteln |
| DE2531942A1 (de) * | 1975-07-17 | 1977-01-20 | Faulhaber & Truttenbach Ohg Ma | Kugelhahn mit abdichtung |
| US4064062A (en) * | 1975-12-15 | 1977-12-20 | Colgate-Palmolive | Stabilized activated percompound bleaching compositions and methods for manufacture thereof |
-
1977
- 1977-04-22 AT AT283977A patent/AT352241B/de not_active IP Right Cessation
-
1978
- 1978-04-01 DE DE19782814083 patent/DE2814083A1/de not_active Withdrawn
- 1978-04-04 SE SE7803802A patent/SE440916B/sv unknown
- 1978-04-04 NL NL7803594A patent/NL7803594A/xx not_active Application Discontinuation
- 1978-04-17 US US05/896,691 patent/US4179391A/en not_active Expired - Lifetime
- 1978-04-19 GB GB15421/78A patent/GB1579505A/en not_active Expired
- 1978-04-20 BR BR787802460A patent/BR7802460A/pt unknown
- 1978-04-21 IT IT67913/78A patent/IT1111461B/it active
- 1978-04-21 FR FR7811922A patent/FR2388044A1/fr active Granted
- 1978-04-21 CH CH433878A patent/CH639691A5/de not_active IP Right Cessation
- 1978-04-21 JP JP53048305A patent/JPS6028879B2/ja not_active Expired
- 1978-04-21 ZA ZA00782296A patent/ZA782296B/xx unknown
- 1978-04-21 BE BE186996A patent/BE866238A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7803802L (sv) | 1978-10-23 |
| NL7803594A (nl) | 1978-10-24 |
| BE866238A (fr) | 1978-10-23 |
| US4179391A (en) | 1979-12-18 |
| CH639691A5 (de) | 1983-11-30 |
| JPS6028879B2 (ja) | 1985-07-06 |
| ZA782296B (en) | 1979-04-25 |
| GB1579505A (en) | 1980-11-19 |
| JPS53133205A (en) | 1978-11-20 |
| BR7802460A (pt) | 1979-01-16 |
| AT352241B (de) | 1979-09-10 |
| DE2814083A1 (de) | 1978-11-02 |
| IT1111461B (it) | 1986-01-13 |
| FR2388044A1 (fr) | 1978-11-17 |
| IT7867913A0 (it) | 1978-04-21 |
| ATA283977A (de) | 1979-02-15 |
| FR2388044B1 (de) | 1980-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE440916B (sv) | Pulverformigt textiltvettmedel for koktvett | |
| US4737306A (en) | Layered silicates of limited swelling power, a process for their production and their use in detergents and cleaning preparations | |
| CA1036455A (en) | Washing compositions containing inorganic silicates and method of washing textiles | |
| US4820436A (en) | Detergents for low laundering temperatures | |
| US4919845A (en) | Phosphate-free detergent having a reduced tendency towards incrustation | |
| US5456850A (en) | Fluid to pasty washing agent containing bleach | |
| DE3832589A1 (de) | Waschmittel fuer niedrige temperaturen | |
| CA1084802A (en) | Stable aqueous suspension of water-insoluble, calcium- binding aluminosilicates and organic suspending agents | |
| US4846990A (en) | Fabric-softening detergent | |
| EP0010247B1 (de) | Phosphatfreies Waschmittel und Verfahren zu dessen Herstellung | |
| CA1052658A (en) | Method of washing textiles and composition containing inorganic silicates and polycarboxylates and/or polyphosphonates | |
| DK156175B (da) | Rensemiddel | |
| CA1058046A (en) | Washing agent compositions including aluminosilicates and nta and processes of washing | |
| CA1039607A (en) | Washing compositions containing aluminosilicates and specific tensides and method of washing textiles | |
| US4839075A (en) | Fabric-softening detergent | |
| DE2752658A1 (de) | Verwendung der umsetzungsprodukte von epsilon-caprolactam und vicinalen hydroxyalkylaminen oder deren addukte mit epoxyalkanen als bestandteil von tensidgemischen in waschmitteln | |
| US4392974A (en) | Low-phosphate detergent builder salt mixture and process of washing | |
| JPH0129839B2 (de) | ||
| DE3632107A1 (de) | Phosphatreduziertes waschmittel enthaltend n-alkoxylierte fettsaeureamide | |
| JPS62218499A (ja) | アルミノシリケ−ト含有粒状洗剤組成物 | |
| NO880248L (no) | Tekstilmykningsgjoerende vaskemiddel. | |
| DE3839016A1 (de) | Wasch- und reinigungsmittel mit einem gehalt an sek. dialkylethersulfaten | |
| CA1052221A (en) | Detergent composition | |
| KR100322629B1 (ko) | 액체세제조성물 | |
| DE2558593A1 (de) | Pulverfoermige, in ihrem benetzungsverhalten verbesserte wasch- und reinigungsmittel, sowie verfahren zu deren herstellung |