SE437846B - Tryckferg med viskositetsokande tillsats och forfarande for framstellning derav - Google Patents
Tryckferg med viskositetsokande tillsats och forfarande for framstellning deravInfo
- Publication number
- SE437846B SE437846B SE7807227A SE7807227A SE437846B SE 437846 B SE437846 B SE 437846B SE 7807227 A SE7807227 A SE 7807227A SE 7807227 A SE7807227 A SE 7807227A SE 437846 B SE437846 B SE 437846B
- Authority
- SE
- Sweden
- Prior art keywords
- clay
- ink
- ammonium compound
- carbon atoms
- dialkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- 239000004927 clay Substances 0.000 claims description 57
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 239000003349 gelling agent Substances 0.000 claims description 17
- 239000000203 mixture Chemical group 0.000 claims description 17
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 16
- 239000003760 tallow Substances 0.000 claims description 11
- 239000007795 chemical reaction product Substances 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 235000019270 ammonium chloride Nutrition 0.000 claims description 8
- 239000006185 dispersion Substances 0.000 claims description 6
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 claims description 6
- 229910000271 hectorite Inorganic materials 0.000 claims description 6
- 239000000463 material Substances 0.000 claims description 6
- 125000006178 methyl benzyl group Chemical group 0.000 claims description 6
- 150000003868 ammonium compounds Chemical class 0.000 claims description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical group CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical group [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical group [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 4
- 238000005341 cation exchange Methods 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 229910021647 smectite Inorganic materials 0.000 claims description 2
- ONCZQWJXONKSMM-UHFFFAOYSA-N dialuminum;disodium;oxygen(2-);silicon(4+);hydrate Chemical compound O.[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Na+].[Na+].[Al+3].[Al+3].[Si+4].[Si+4].[Si+4].[Si+4] ONCZQWJXONKSMM-UHFFFAOYSA-N 0.000 claims 4
- 229940080314 sodium bentonite Drugs 0.000 claims 4
- 229910000280 sodium bentonite Inorganic materials 0.000 claims 4
- 150000001805 chlorine compounds Chemical group 0.000 claims 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical group COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 238000004040 coloring Methods 0.000 claims 1
- 238000010008 shearing Methods 0.000 claims 1
- 239000000976 ink Substances 0.000 description 60
- 238000002474 experimental method Methods 0.000 description 30
- 230000000052 comparative effect Effects 0.000 description 19
- -1 alkyl radicals Chemical class 0.000 description 10
- 235000012216 bentonite Nutrition 0.000 description 8
- 239000000440 bentonite Substances 0.000 description 7
- 229910000278 bentonite Inorganic materials 0.000 description 7
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 7
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 7
- 239000002002 slurry Substances 0.000 description 7
- 239000000654 additive Substances 0.000 description 6
- 239000000049 pigment Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 230000035515 penetration Effects 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- HNNQYHFROJDYHQ-UHFFFAOYSA-N 3-(4-ethylcyclohexyl)propanoic acid 3-(3-ethylcyclopentyl)propanoic acid Chemical compound CCC1CCC(CCC(O)=O)C1.CCC1CCC(CCC(O)=O)CC1 HNNQYHFROJDYHQ-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003373 anti-fouling effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- VNSBYDPZHCQWNB-UHFFFAOYSA-N calcium;aluminum;dioxido(oxo)silane;sodium;hydrate Chemical compound O.[Na].[Al].[Ca+2].[O-][Si]([O-])=O VNSBYDPZHCQWNB-UHFFFAOYSA-N 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- IPGANOYOHAODGA-UHFFFAOYSA-N dilithium;dimagnesium;dioxido(oxo)silane Chemical compound [Li+].[Li+].[Mg+2].[Mg+2].[O-][Si]([O-])=O.[O-][Si]([O-])=O.[O-][Si]([O-])=O IPGANOYOHAODGA-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000003958 fumigation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000001027 hydrothermal synthesis Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910000275 saponite Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 150000003388 sodium compounds Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09D—COATING COMPOSITIONS, e.g. PAINTS, VARNISHES OR LACQUERS; FILLING PASTES; CHEMICAL PAINT OR INK REMOVERS; INKS; CORRECTING FLUIDS; WOODSTAINS; PASTES OR SOLIDS FOR COLOURING OR PRINTING; USE OF MATERIALS THEREFOR
- C09D11/00—Inks
- C09D11/02—Printing inks
- C09D11/03—Printing inks characterised by features other than the chemical nature of the binder
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Coloring (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/810,403 US4193806A (en) | 1977-06-27 | 1977-06-27 | Viscosity increasing additive for printing inks |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7807227L SE7807227L (sv) | 1978-12-28 |
| SE437846B true SE437846B (sv) | 1985-03-18 |
Family
ID=25203779
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7807227A SE437846B (sv) | 1977-06-27 | 1978-06-26 | Tryckferg med viskositetsokande tillsats och forfarande for framstellning derav |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4193806A (enExample) |
| JP (1) | JPS5418308A (enExample) |
| AU (1) | AU504277B1 (enExample) |
| BR (1) | BR7804048A (enExample) |
| CA (1) | CA1101607A (enExample) |
| DE (1) | DE2827288C2 (enExample) |
| DK (1) | DK150801C (enExample) |
| FR (1) | FR2396057A1 (enExample) |
| GB (1) | GB2001090B (enExample) |
| IT (1) | IT1096579B (enExample) |
| MX (1) | MX5468E (enExample) |
| NO (1) | NO153929C (enExample) |
| NZ (1) | NZ187605A (enExample) |
| SE (1) | SE437846B (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5110501A (en) * | 1980-10-03 | 1992-05-05 | Southern Clay Products, Inc. | Process for manufacturing organoclays having enhanced gelling properties |
| US4402881A (en) * | 1980-11-12 | 1983-09-06 | International Minerals & Chem. Corp. | Method of making organophilic clays |
| GB2087899B (en) * | 1980-11-17 | 1984-12-19 | Nl Industries Inc | Printing ink compositions |
| US4410364A (en) * | 1980-11-17 | 1983-10-18 | Nl Industries, Inc. | Printing ink compositions |
| US4475950A (en) * | 1980-11-17 | 1984-10-09 | Nl Industries, Inc. | Printing ink compositions containing organophilic clay gellant |
| US4391637A (en) * | 1981-10-19 | 1983-07-05 | Nl Industries, Inc. | Rheological additive for non-aqueous fluid systems |
| US4412018A (en) * | 1980-11-17 | 1983-10-25 | Nl Industries, Inc. | Organophilic clay complexes, their preparation and compositions comprising said complexes |
| DE3276471D1 (en) * | 1981-10-10 | 1987-07-09 | Basf Lacke & Farben | Flat-bed printing method |
| JPS5876473A (ja) * | 1981-10-19 | 1983-05-09 | エヌ・エル・ケミカルス・インコ−ポレイテッド | 改良された印刷インキ組成物 |
| US4474705A (en) * | 1981-12-17 | 1984-10-02 | The Sherwin-Williams Company | Process for the preparation of organophilic clays |
| US4474706A (en) * | 1982-08-30 | 1984-10-02 | The Sherwin-Williams Company | Process for the preparation of organophilic clays |
| IT1173914B (it) * | 1983-04-20 | 1987-06-24 | Sun Chemical Corp | Inchiostri per stampa rotocalco |
| US4742098A (en) * | 1985-08-20 | 1988-05-03 | Nl Chemicals, Inc. | Organophilic clay gellants and process for preparation |
| US4695402A (en) * | 1985-08-20 | 1987-09-22 | Nl Chemicals, Inc. | Organophilic clay gellants and process for preparation |
| US4664820A (en) * | 1985-10-28 | 1987-05-12 | Nl Industries, Inc. | Preactivated organophilic clay gellant lubricating grease thickened with preactivated organophilic clay gellant and process for preparing preactivated organophilic clay gellants |
| US4929644A (en) * | 1986-10-24 | 1990-05-29 | Rheox, Inc. | Thickened organic composition having biocidal activity and an additive for thickening and imparting biocidal activity to an organic composition |
| US5296284A (en) * | 1988-04-05 | 1994-03-22 | J. M. Huber Corporation | Dyed hectorite pigments and applications |
| AU3449789A (en) * | 1988-04-05 | 1989-11-03 | J.M. Huber Corporation | Dyed mineral pigments and applications |
| DE3812699C2 (de) * | 1988-04-16 | 1994-09-08 | Friedrich Wolff | Trainingsgerät |
| US5137568A (en) * | 1989-05-02 | 1992-08-11 | J.M. Huber Corporation | Organokaolin pigments in ink formulations |
| US6130256A (en) * | 1993-05-07 | 2000-10-10 | Rheox, Inc. | Organoclay thickener compatible with system to be thickened |
| US5700319A (en) * | 1995-09-28 | 1997-12-23 | Southern Clay Products, Inc. | Method for extending pigments |
| US20010056132A1 (en) * | 2000-05-09 | 2001-12-27 | Riso Kagaku Corporation | Ultraviolet curable ink for stencil printing |
| US6607591B1 (en) * | 2000-06-02 | 2003-08-19 | Milliken & Company | Low-viscosity nonaqueous liquid pigment dispersions and methods of utilizing such compositions |
| CN102076791B (zh) * | 2008-06-25 | 2015-04-29 | 惠普开发有限公司 | 喷墨油墨及其制造方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2531427A (en) * | 1946-05-03 | 1950-11-28 | Ernst A Hauser | Modified gel-forming clay and process of producing same |
| US2750296A (en) * | 1952-02-13 | 1956-06-12 | Sun Chemical Corp | Printing ink |
| US2739067A (en) * | 1952-11-12 | 1956-03-20 | Nat Lead Co | Printing inks |
| US2754219A (en) * | 1953-03-09 | 1956-07-10 | Huber Corp J M | Anti-misting printing inks |
| BE522809A (enExample) * | 1953-03-13 | |||
| US3537994A (en) * | 1967-07-25 | 1970-11-03 | Nat Lead Co | Organophilic clay greases |
| US3864294A (en) * | 1972-11-02 | 1975-02-04 | Chesebrough Ponds | Gelled coating compositions and method of making same |
| US3977894A (en) * | 1975-09-19 | 1976-08-31 | Nl Industries, Inc. | Rheological agent for non-aqueous fluid systems |
| US4105578A (en) * | 1976-12-10 | 1978-08-08 | N L Industries, Inc. | Organophilic clay having enhanced dispersibility |
| US4081496A (en) * | 1977-06-27 | 1978-03-28 | N L Industries, Inc. | Thixotropic polyester compositions containing an organophilic clay gellant |
-
1977
- 1977-06-27 US US05/810,403 patent/US4193806A/en not_active Expired - Lifetime
-
1978
- 1978-06-13 CA CA305,305A patent/CA1101607A/en not_active Expired
- 1978-06-14 NO NO782059A patent/NO153929C/no unknown
- 1978-06-16 NZ NZ187605A patent/NZ187605A/xx unknown
- 1978-06-20 AU AU37277/78A patent/AU504277B1/en not_active Expired
- 1978-06-21 DE DE2827288A patent/DE2827288C2/de not_active Expired
- 1978-06-21 IT IT24800/78A patent/IT1096579B/it active
- 1978-06-26 DK DK286778A patent/DK150801C/da not_active IP Right Cessation
- 1978-06-26 JP JP7660578A patent/JPS5418308A/ja active Granted
- 1978-06-26 BR BR7804048A patent/BR7804048A/pt unknown
- 1978-06-26 MX MX787177U patent/MX5468E/es unknown
- 1978-06-26 GB GB7827908A patent/GB2001090B/en not_active Expired
- 1978-06-26 SE SE7807227A patent/SE437846B/sv not_active IP Right Cessation
- 1978-06-27 FR FR7819217A patent/FR2396057A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IT1096579B (it) | 1985-08-26 |
| FR2396057B1 (enExample) | 1980-07-18 |
| DE2827288A1 (de) | 1979-01-04 |
| NZ187605A (en) | 1979-10-25 |
| BR7804048A (pt) | 1979-04-03 |
| NO153929C (no) | 1986-06-18 |
| DE2827288C2 (de) | 1982-07-15 |
| FR2396057A1 (fr) | 1979-01-26 |
| GB2001090A (en) | 1979-01-24 |
| JPS5423284B2 (enExample) | 1979-08-13 |
| NO782059L (no) | 1978-12-28 |
| SE7807227L (sv) | 1978-12-28 |
| DK286778A (da) | 1978-12-28 |
| JPS5418308A (en) | 1979-02-10 |
| NO153929B (no) | 1986-03-10 |
| AU504277B1 (en) | 1979-10-11 |
| DK150801C (da) | 1988-01-11 |
| GB2001090B (en) | 1982-04-07 |
| DK150801B (da) | 1987-06-22 |
| CA1101607A (en) | 1981-05-26 |
| US4193806A (en) | 1980-03-18 |
| MX5468E (es) | 1983-08-16 |
| IT7824800A0 (it) | 1978-06-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE437846B (sv) | Tryckferg med viskositetsokande tillsats och forfarande for framstellning derav | |
| NL192042C (nl) | Toevoegmiddel ter verhoging van de viscositeit van vloeibare niet-waterige systemen. | |
| US4743305A (en) | Organoclays | |
| DE69534009T2 (de) | Wässrige tinten und beschichtungen enthaltend kohlenstoffprodukte | |
| DE69425986T2 (de) | Tintenstrahldruckverfahren | |
| SE454700B (sv) | System med icke vattenhaltigt fluidum innefattande reaktionsprodukten av en organisk katjonisk forening och en lera av smektittyp | |
| US4475950A (en) | Printing ink compositions containing organophilic clay gellant | |
| EP0264751A2 (de) | Hydroxycarbonsäurederivate und ihre Verwendung in Aufzeichnungsmaterialien | |
| DE69923884T2 (de) | Emulsionstinte für den Schablonendruck | |
| DE2430568C3 (de) | Spirodipyrane und deren Verwendung als Farbbildner für druckempfindliche Aufzeichnungsmaterialien | |
| US1906962A (en) | Emulsified ink and paint | |
| US3954495A (en) | Process for the production of pigments useful for waxless carbon paper | |
| DE2157553A1 (de) | Neue Zubereitungen auf Phthalocyaninbasis | |
| CA1142708A (en) | Printing ink compositions | |
| DE2547967A1 (de) | Verwendung einer dispersion eines oxidierten polyaethylenwachses als zusatz zu druckfarben | |
| DE2144283C3 (de) | Hektographisches Farbblatt | |
| US2752255A (en) | Crystal violet composition | |
| DE2110518C3 (de) | Hektographisches Farbblatt | |
| US3774539A (en) | Color-forming duplicating method | |
| DE1761495A1 (de) | Verfahren zur Herstellung von selbstkopierendem Papier und nach diesem Verfahren hergestelltes Papier | |
| DE2229032C3 (de) | Hektographisches Farbblatt | |
| JPS5876473A (ja) | 改良された印刷インキ組成物 | |
| SU612945A1 (ru) | Печатна краска дл высокой и офсетной печати | |
| DE1469782C3 (de) | Verfahren zur Herstellung leicht dispergierbarer Pigmente | |
| DE2151034C3 (de) | Verwendung von Leucauraminverbindungen für hektographische Farbblätter |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7807227-9 Effective date: 19950110 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7807227-9 Format of ref document f/p: F |