SE424551B - Sett for kontinuerlig framstellning av propylenoxid - Google Patents
Sett for kontinuerlig framstellning av propylenoxidInfo
- Publication number
- SE424551B SE424551B SE7604887A SE7604887A SE424551B SE 424551 B SE424551 B SE 424551B SE 7604887 A SE7604887 A SE 7604887A SE 7604887 A SE7604887 A SE 7604887A SE 424551 B SE424551 B SE 424551B
- Authority
- SE
- Sweden
- Prior art keywords
- acid
- hydrogen peroxide
- reaction
- weight
- propylene
- Prior art date
Links
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 title claims description 55
- 238000010924 continuous production Methods 0.000 title claims 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 314
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 222
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 185
- 238000006243 chemical reaction Methods 0.000 claims description 144
- 238000000034 method Methods 0.000 claims description 96
- 235000019260 propionic acid Nutrition 0.000 claims description 92
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 92
- CZPZWMPYEINMCF-UHFFFAOYSA-N propaneperoxoic acid Chemical compound CCC(=O)OO CZPZWMPYEINMCF-UHFFFAOYSA-N 0.000 claims description 76
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 73
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 73
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 73
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 72
- 229910001868 water Inorganic materials 0.000 claims description 70
- 238000000605 extraction Methods 0.000 claims description 69
- 230000008569 process Effects 0.000 claims description 68
- 238000004821 distillation Methods 0.000 claims description 58
- 239000000243 solution Substances 0.000 claims description 38
- 239000007864 aqueous solution Substances 0.000 claims description 36
- 239000000203 mixture Substances 0.000 claims description 33
- 239000011541 reaction mixture Substances 0.000 claims description 33
- 239000003377 acid catalyst Substances 0.000 claims description 24
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 claims description 18
- 239000008346 aqueous phase Substances 0.000 claims description 18
- 238000010533 azeotropic distillation Methods 0.000 claims description 16
- -1 percarbonic acid organic peroxide Chemical class 0.000 claims description 15
- 239000012071 phase Substances 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 150000001735 carboxylic acids Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 230000008929 regeneration Effects 0.000 claims description 3
- 238000011069 regeneration method Methods 0.000 claims description 3
- 230000007306 turnover Effects 0.000 claims description 3
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- NVDBBGBUTKLRSN-UHFFFAOYSA-N 3-[1-(2-phenoxyethyl)piperidin-4-yl]-1h-benzimidazol-2-one Chemical compound O=C1NC2=CC=CC=C2N1C(CC1)CCN1CCOC1=CC=CC=C1 NVDBBGBUTKLRSN-UHFFFAOYSA-N 0.000 claims 1
- XEMZLVDIUVCKGL-UHFFFAOYSA-N hydrogen peroxide;sulfuric acid Chemical compound OO.OS(O)(=O)=O XEMZLVDIUVCKGL-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 66
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 45
- 239000002253 acid Substances 0.000 description 36
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 16
- 101100387923 Caenorhabditis elegans dos-1 gene Proteins 0.000 description 12
- 239000006227 byproduct Substances 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- 238000002156 mixing Methods 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 239000011707 mineral Substances 0.000 description 7
- 238000000926 separation method Methods 0.000 description 7
- 238000010626 work up procedure Methods 0.000 description 7
- KFNABOVSAPCOCY-UHFFFAOYSA-N 1-propanoyloxypropan-2-yl propanoate Chemical compound CCC(=O)OCC(C)OC(=O)CC KFNABOVSAPCOCY-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 150000004965 peroxy acids Chemical class 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000011552 falling film Substances 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 238000005191 phase separation Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 238000006735 epoxidation reaction Methods 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 239000013505 freshwater Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052759 nickel Inorganic materials 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- QMGLMRPHOITLSN-UHFFFAOYSA-N 2,4-dimethyloxolane Chemical compound CC1COC(C)C1 QMGLMRPHOITLSN-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- KNKRKFALVUDBJE-UHFFFAOYSA-N 1,2-dichloropropane Chemical compound CC(Cl)CCl KNKRKFALVUDBJE-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- PPPFYBPQAPISCT-UHFFFAOYSA-N 2-hydroxypropyl acetate Chemical compound CC(O)COC(C)=O PPPFYBPQAPISCT-UHFFFAOYSA-N 0.000 description 1
- FKOZPUORKCHONH-UHFFFAOYSA-N 2-methylpropane-1-sulfonic acid Chemical compound CC(C)CS(O)(=O)=O FKOZPUORKCHONH-UHFFFAOYSA-N 0.000 description 1
- GNFTZDOKVXKIBK-UHFFFAOYSA-N 3-(2-methoxyethoxy)benzohydrazide Chemical compound COCCOC1=CC=CC(C(=O)NN)=C1 GNFTZDOKVXKIBK-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 101000913968 Ipomoea purpurea Chalcone synthase C Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229940123973 Oxygen scavenger Drugs 0.000 description 1
- 101000907988 Petunia hybrida Chalcone-flavanone isomerase C Proteins 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910001093 Zr alloy Inorganic materials 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical compound CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- UHCBBWUQDAVSMS-UHFFFAOYSA-N fluoroethane Chemical compound CCF UHCBBWUQDAVSMS-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- GPGCPVFGIJFFAO-UHFFFAOYSA-N methyl(octoxy)phosphinic acid Chemical compound CCCCCCCCOP(C)(O)=O GPGCPVFGIJFFAO-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- QYSGYZVSCZSLHT-UHFFFAOYSA-N octafluoropropane Chemical compound FC(F)(F)C(F)(F)C(F)(F)F QYSGYZVSCZSLHT-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- JGTNAGYHADQMCM-UHFFFAOYSA-N perfluorobutanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F JGTNAGYHADQMCM-UHFFFAOYSA-N 0.000 description 1
- 229960004065 perflutren Drugs 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- FHHJDRFHHWUPDG-UHFFFAOYSA-N peroxysulfuric acid Chemical compound OOS(O)(=O)=O FHHJDRFHHWUPDG-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 239000001120 potassium sulphate Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- RLUCXJBHKHIDSP-UHFFFAOYSA-N propane-1,2-diol;propanoic acid Chemical compound CCC(O)=O.CC(O)CO RLUCXJBHKHIDSP-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L sodium sulphate Substances [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 1
- FSLSJTZWDATVTK-UHFFFAOYSA-N tris(6-methylheptyl) phosphate Chemical compound CC(C)CCCCCOP(=O)(OCCCCCC(C)C)OCCCCCC(C)C FSLSJTZWDATVTK-UHFFFAOYSA-N 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/24—Peroxy compounds the —O—O— group being bound between a >C=O group and hydrogen, i.e. peroxy acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
- C07C407/003—Separation; Purification; Stabilisation; Use of additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D301/00—Preparation of oxiranes
- C07D301/02—Synthesis of the oxirane ring
- C07D301/03—Synthesis of the oxirane ring by oxidation of unsaturated compounds, or of mixtures of unsaturated and saturated compounds
- C07D301/14—Synthesis of the oxirane ring by oxidation of unsaturated compounds, or of mixtures of unsaturated and saturated compounds with organic peracids, or salts, anhydrides or esters thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Epoxy Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2519298A DE2519298B2 (de) | 1975-04-30 | 1975-04-30 | Verfahren zur kontinuierlichen Herstellung von Propylenoxid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7604887L SE7604887L (sv) | 1976-11-10 |
| SE424551B true SE424551B (sv) | 1982-07-26 |
Family
ID=5945451
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7604887A SE424551B (sv) | 1975-04-30 | 1976-04-28 | Sett for kontinuerlig framstellning av propylenoxid |
Country Status (23)
| Country | Link |
|---|---|
| US (2) | US4113747A (enExample) |
| JP (1) | JPS5938231B2 (enExample) |
| AR (1) | AR228230A1 (enExample) |
| BE (1) | BE841208A (enExample) |
| BG (1) | BG27372A3 (enExample) |
| BR (1) | BR7602595A (enExample) |
| CA (1) | CA1087619A (enExample) |
| CS (1) | CS203917B2 (enExample) |
| DD (1) | DD125486A5 (enExample) |
| DE (1) | DE2519298B2 (enExample) |
| ES (1) | ES447406A1 (enExample) |
| FI (1) | FI62076C (enExample) |
| FR (1) | FR2309552A1 (enExample) |
| GB (1) | GB1489856A (enExample) |
| IE (1) | IE42713B1 (enExample) |
| IL (1) | IL49487A (enExample) |
| IT (1) | IT1059413B (enExample) |
| NL (1) | NL7604537A (enExample) |
| NO (1) | NO146709C (enExample) |
| PL (1) | PL103493B1 (enExample) |
| RO (1) | RO73727A (enExample) |
| SE (1) | SE424551B (enExample) |
| ZA (1) | ZA762524B (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4172840A (en) * | 1975-02-04 | 1979-10-30 | Interox Chemicals Limited | Epoxidation |
| DE2519292C3 (de) * | 1975-04-30 | 1979-03-29 | Bayer Ag, 5090 Leverkusen | Verfahren zur Auftrennung einer im wesentlichen Propylenoxid, Propylen, eine 1-4 Kohlenstoff atome aufweisende Carbonsäure und Benzol enthaltenden Losung |
| DE2734240A1 (de) * | 1977-07-29 | 1979-02-08 | Bayer Ag | Verfahren zur herstellung von vinyloxiran |
| DE2734242A1 (de) * | 1977-07-29 | 1979-02-08 | Bayer Ag | Verfahren zur herstellung von vinyloxiran |
| FR2421168A1 (fr) * | 1978-03-28 | 1979-10-26 | Propylox Sa | Procede pour la fabrication de peracides carboxyliques |
| DE2856665A1 (de) * | 1978-12-29 | 1980-07-17 | Bayer Ag | Verfahren zur herstellung von percarbonsaeureloesungen |
| FR2456096A1 (fr) | 1979-05-10 | 1980-12-05 | Solvay | Procede pour la fabrication d'oxydes d'olefines |
| FR2460927A1 (fr) * | 1979-07-09 | 1981-01-30 | Ugine Kuhlmann | Nouveau procede de preparation d'acides percarboxyliques |
| FR2464947A1 (fr) * | 1979-09-07 | 1981-03-20 | Ugine Kuhlmann | Procede de fabrication d'acides percarboxyliques |
| US4379025A (en) * | 1982-05-24 | 1983-04-05 | Atlantic Richfield Company | Water removal from butylene oxides by liquid extraction with selected extractive solvents |
| DE3247255A1 (de) * | 1982-12-21 | 1984-06-28 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von isolierung von polyglycidylverbindungen |
| US4891437A (en) * | 1984-12-31 | 1990-01-02 | Texaco Inc. | Olefin epoxidation of olefins in a polar medium |
| DE3528007A1 (de) * | 1985-08-05 | 1987-02-05 | Degussa | Verfahren zur herstellung von epoxidierten polybutadienen |
| DE3528002A1 (de) * | 1985-08-05 | 1987-02-05 | Degussa | Verfahren zur herstellung eines cycloaliphatischen diepoxids |
| DE3643207C1 (de) * | 1986-12-18 | 1988-05-11 | Degussa | Kontinuierliches Verfahren zur Epoxydierung von Olefinen oder Olefingemischen |
| JPS63194118U (enExample) * | 1987-05-31 | 1988-12-14 | ||
| US5127997A (en) * | 1991-05-09 | 1992-07-07 | Texaco Chemical Company | Purification of propylene oxide by liquid extraction |
| US6337412B1 (en) | 2000-04-25 | 2002-01-08 | Chemical Research & Licensing Company | Three stage propylene oxide process |
| US6392078B1 (en) | 2000-06-12 | 2002-05-21 | Catalytic Distillation Technologies | Process and catalyst for making dialkyl carbonates |
| AU2012201510B2 (en) * | 2011-03-18 | 2013-03-28 | Jx Nippon Mining & Metals Corporation | Method of recovering gold from dilute gold solution |
| CN103172486B (zh) * | 2011-12-22 | 2015-07-29 | 中国石油化工股份有限公司 | 一种从直接环氧化反应产物中回收丙烯的方法 |
| CN106831661B (zh) * | 2017-01-24 | 2020-10-02 | 南京工业大学 | 一种利用微反应装置制备环氧丙烷的方法 |
| CA3110357A1 (en) | 2021-02-25 | 2022-08-25 | Sixring Inc. | Modified sulfuric acid and uses thereof |
| CA3110364A1 (en) * | 2021-02-25 | 2022-08-25 | Sixring Inc. | Modified sulfuric acid and uses thereof |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1188791A (en) * | 1966-04-14 | 1970-04-22 | Laporte Chemical | Olefin Oxides |
| GB1217000A (en) * | 1968-04-05 | 1970-12-23 | Petrocarbon Dev Ltd | Improvements in or relating to the production of propylene oxide and propylene glycol and its esters |
| GB1216997A (en) * | 1968-04-05 | 1970-12-23 | Petrocarbon Dev Ltd | Improvements in or relating to the production of propylene oxide |
| DE2141156C3 (de) * | 1971-08-17 | 1981-01-22 | Degussa Ag, 6000 Frankfurt | Verfahren zur Gewinnung wasserfreier organischer Percarbonsäurelösungen |
| BE808108A (fr) * | 1972-12-22 | 1974-05-30 | Degussa | Procede pour la preparation de solutions d'acide percarboxylique dans des solvants organiques |
-
1975
- 1975-04-30 DE DE2519298A patent/DE2519298B2/de not_active Ceased
-
1976
- 1976-04-28 US US05/678,822 patent/US4113747A/en not_active Expired - Lifetime
- 1976-04-28 BR BR2595/76A patent/BR7602595A/pt unknown
- 1976-04-28 ZA ZA762524A patent/ZA762524B/xx unknown
- 1976-04-28 IE IE896/76A patent/IE42713B1/en unknown
- 1976-04-28 RO RO7685935A patent/RO73727A/ro unknown
- 1976-04-28 CA CA251,370A patent/CA1087619A/en not_active Expired
- 1976-04-28 ES ES447406A patent/ES447406A1/es not_active Expired
- 1976-04-28 IT IT49230/76A patent/IT1059413B/it active
- 1976-04-28 BG BG033054A patent/BG27372A3/xx unknown
- 1976-04-28 SE SE7604887A patent/SE424551B/sv not_active IP Right Cessation
- 1976-04-28 FI FI761184A patent/FI62076C/fi not_active IP Right Cessation
- 1976-04-28 AR AR263145A patent/AR228230A1/es active
- 1976-04-28 GB GB17173/76A patent/GB1489856A/en not_active Expired
- 1976-04-28 BE BE2054991A patent/BE841208A/xx not_active IP Right Cessation
- 1976-04-28 JP JP51047894A patent/JPS5938231B2/ja not_active Expired
- 1976-04-28 FR FR7612611A patent/FR2309552A1/fr active Granted
- 1976-04-28 CS CS762787A patent/CS203917B2/cs unknown
- 1976-04-28 PL PL1976189128A patent/PL103493B1/pl unknown
- 1976-04-28 IL IL49487A patent/IL49487A/xx unknown
- 1976-04-28 DD DD192572A patent/DD125486A5/xx unknown
- 1976-04-28 NL NL7604537A patent/NL7604537A/xx not_active Application Discontinuation
- 1976-04-28 NO NO761470A patent/NO146709C/no unknown
-
1980
- 1980-02-14 US US06/121,605 patent/USRE30945E/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IT1059413B (it) | 1982-05-31 |
| AR228230A1 (es) | 1983-02-15 |
| USRE30945E (en) | 1982-05-25 |
| NO146709B (no) | 1982-08-16 |
| JPS5938231B2 (ja) | 1984-09-14 |
| CS203917B2 (en) | 1981-03-31 |
| FI761184A7 (enExample) | 1976-10-31 |
| BE841208A (fr) | 1976-10-28 |
| FR2309552A1 (fr) | 1976-11-26 |
| DD125486A5 (enExample) | 1977-04-20 |
| BG27372A3 (bg) | 1979-10-12 |
| US4113747A (en) | 1978-09-12 |
| JPS51143604A (en) | 1976-12-10 |
| SE7604887L (sv) | 1976-11-10 |
| RO73727A (ro) | 1983-06-01 |
| CA1087619A (en) | 1980-10-14 |
| ES447406A1 (es) | 1977-07-01 |
| ZA762524B (en) | 1977-04-27 |
| IE42713L (en) | 1976-10-30 |
| IL49487A (en) | 1979-07-25 |
| NO146709C (no) | 1982-11-24 |
| DE2519298A1 (de) | 1976-11-11 |
| NO761470L (enExample) | 1976-11-02 |
| BR7602595A (pt) | 1976-11-23 |
| NL7604537A (nl) | 1976-11-02 |
| GB1489856A (en) | 1977-10-26 |
| IE42713B1 (en) | 1980-10-08 |
| DE2519298B2 (de) | 1981-06-04 |
| PL103493B1 (pl) | 1979-06-30 |
| FI62076C (fi) | 1982-11-10 |
| IL49487A0 (en) | 1976-06-30 |
| FR2309552B1 (enExample) | 1980-02-29 |
| RO73727B (ro) | 1983-05-30 |
| FI62076B (fi) | 1982-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE424551B (sv) | Sett for kontinuerlig framstellning av propylenoxid | |
| USRE31381E (en) | Process for the preparation of propylene oxide | |
| SE459089B (sv) | Foerfarande foer framstaellning av etylenglykol fraan en vattenhaltig loesning av etylenoxid | |
| JPS6326111B2 (enExample) | ||
| US3374153A (en) | Process for recovery of glycidol from alcohol by azeotropic distillation with a hydrocarbon | |
| US4193929A (en) | Epoxidation | |
| CA1097367A (en) | Process for the preparation of propylene oxide | |
| JPH0333718B2 (enExample) | ||
| US8716502B2 (en) | Process for preparing divinylarene oxides | |
| US4172840A (en) | Epoxidation | |
| US4115410A (en) | Process for making peroxycarboxylic acid | |
| US4381973A (en) | Process for the preparation of pyrocatechol and hydroquinone | |
| US20220388949A1 (en) | A process for working up water containing 4,4'-dichlorodiphenyl sulfoxide and/or 4,4'-dichlorodiphenyl sulfone as impurities | |
| JPS6233167A (ja) | 脂環式ジエポキシドの製造法 | |
| EP0000532B1 (de) | Verfahren zur Herstellung von Vinyloxiran | |
| RU2855524C2 (ru) | Способ получения (мет)акриловой кислоты высокой чистоты | |
| KR20240031055A (ko) | 고순도 아크릴산의 제조방법 | |
| CN103998437B (zh) | 回收二乙烯基芳烃二氧化物的方法 | |
| NO761472L (enExample) | ||
| JP2000256339A (ja) | エポキシヘキサヒドロフタル酸ジアルキルの製造方法 | |
| JPH07118250A (ja) | α−メチルスチレンオキサイドの製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 7604887-5 Effective date: 19900411 Format of ref document f/p: F |