SE411757B - Tiazolidinazetidinon till anvendning som mellanprodukt for framstellning av penicillin- och cefalosporinantibiotika samt forfarande for framstellning derav - Google Patents
Tiazolidinazetidinon till anvendning som mellanprodukt for framstellning av penicillin- och cefalosporinantibiotika samt forfarande for framstellning deravInfo
- Publication number
- SE411757B SE411757B SE7200872A SE87272A SE411757B SE 411757 B SE411757 B SE 411757B SE 7200872 A SE7200872 A SE 7200872A SE 87272 A SE87272 A SE 87272A SE 411757 B SE411757 B SE 411757B
- Authority
- SE
- Sweden
- Prior art keywords
- solution
- penicillin
- formula
- methoxybenzyl
- preparation
- Prior art date
Links
- 229930182555 Penicillin Natural products 0.000 title claims description 16
- 238000000034 method Methods 0.000 title claims description 15
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title claims description 12
- 229940049954 penicillin Drugs 0.000 title claims description 12
- 229930186147 Cephalosporin Natural products 0.000 title claims description 8
- 229940124587 cephalosporin Drugs 0.000 title claims description 8
- 150000001780 cephalosporins Chemical class 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 8
- 239000003242 anti bacterial agent Substances 0.000 title claims description 4
- 229940088710 antibiotic agent Drugs 0.000 title claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 38
- -1 t-butoxycarbonyl Chemical group 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 12
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical compound O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 125000004744 butyloxycarbonyl group Chemical group 0.000 claims description 7
- RWBFLRQNMJQDFQ-UHFFFAOYSA-N azetidin-2-one;1,3-thiazolidine Chemical compound C1CSCN1.O=C1CCN1 RWBFLRQNMJQDFQ-UHFFFAOYSA-N 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 239000011203 carbon fibre reinforced carbon Chemical group 0.000 claims description 3
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 2
- 125000006000 trichloroethyl group Chemical group 0.000 claims 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims 1
- 229910052799 carbon Chemical group 0.000 claims 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 claims 1
- 239000000243 solution Substances 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 16
- 230000009467 reduction Effects 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 238000005949 ozonolysis reaction Methods 0.000 description 7
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 125000005518 carboxamido group Chemical group 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- 230000008521 reorganization Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000003797 solvolysis reaction Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- FCZNNHHXCFARDY-WQRUCBPWSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)CC1=CC=CC=C1 FCZNNHHXCFARDY-WQRUCBPWSA-N 0.000 description 3
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 125000001984 thiazolidinyl group Chemical group 0.000 description 3
- CYTQBVOFDCPGCX-UHFFFAOYSA-N trimethyl phosphite Chemical compound COP(OC)OC CYTQBVOFDCPGCX-UHFFFAOYSA-N 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- SNWADPKKHSBPHT-UHFFFAOYSA-N 1,3-thiazolidine-2-carbonyl chloride Chemical compound ClC(=O)C1NCCS1 SNWADPKKHSBPHT-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- HHLFWLYXYJOTON-UHFFFAOYSA-N glyoxylic acid Chemical compound OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004949 mass spectrometry Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- 125000002769 thiazolinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RAMSPIDCEXFVEX-UHFFFAOYSA-N 2-benzyl-4,5-dihydro-1,3-thiazole Chemical compound C=1C=CC=CC=1CC1=NCCS1 RAMSPIDCEXFVEX-UHFFFAOYSA-N 0.000 description 1
- JHKNSLFGQODBHR-UHFFFAOYSA-N 2-phenoxy-1-(1,3-thiazolidin-2-yl)ethanone Chemical compound O(C1=CC=CC=C1)CC(=O)C1SCCN1 JHKNSLFGQODBHR-UHFFFAOYSA-N 0.000 description 1
- PKUPAJQAJXVUEK-UHFFFAOYSA-N 2-phenoxyacetyl chloride Chemical compound ClC(=O)COC1=CC=CC=C1 PKUPAJQAJXVUEK-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- JBMKAUGHUNFTOL-UHFFFAOYSA-N Aldoclor Chemical class C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC=NS2(=O)=O JBMKAUGHUNFTOL-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- OJUABILNYGXHHX-UHFFFAOYSA-N [N].C1CSCN1 Chemical compound [N].C1CSCN1 OJUABILNYGXHHX-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- DZWJSQHJEZRIOO-UHFFFAOYSA-N butyl 1,3-thiazolidine-2-carboxylate Chemical compound S1C(NCC1)C(=O)OCCCC DZWJSQHJEZRIOO-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- VILAVOFMIJHSJA-UHFFFAOYSA-N dicarbon monoxide Chemical group [C]=C=O VILAVOFMIJHSJA-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000003951 lactams Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WURFKUQACINBSI-UHFFFAOYSA-M ozonide Chemical compound [O]O[O-] WURFKUQACINBSI-UHFFFAOYSA-M 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- JPKMMDLLAGJYEG-UHFFFAOYSA-N tert-butyl 1,3-thiazolidine-2-carboxylate Chemical compound CC(C)(C)OC(=O)C1NCCS1 JPKMMDLLAGJYEG-UHFFFAOYSA-N 0.000 description 1
- 239000003451 thiazide diuretic agent Substances 0.000 description 1
- 150000003549 thiazolines Chemical class 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US112389A US3862164A (en) | 1971-02-03 | 1971-02-03 | Thiazolidine azetidinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE411757B true SE411757B (sv) | 1980-02-04 |
Family
ID=22343631
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7200872A SE411757B (sv) | 1971-02-03 | 1972-01-26 | Tiazolidinazetidinon till anvendning som mellanprodukt for framstellning av penicillin- och cefalosporinantibiotika samt forfarande for framstellning derav |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3862164A (th) |
| JP (1) | JPS5614115B1 (th) |
| AT (1) | AT315837B (th) |
| AU (1) | AU461096B2 (th) |
| BE (1) | BE778321A (th) |
| CA (1) | CA986521A (th) |
| CH (2) | CH576984A5 (th) |
| CS (2) | CS176199B2 (th) |
| DE (1) | DE2205144C3 (th) |
| ES (1) | ES399423A1 (th) |
| FR (1) | FR2125060A5 (th) |
| GB (1) | GB1374486A (th) |
| HU (1) | HU164227B (th) |
| IE (1) | IE35989B1 (th) |
| IL (1) | IL38614A (th) |
| NL (1) | NL170004C (th) |
| PH (5) | PH11447A (th) |
| PL (4) | PL99979B1 (th) |
| SE (1) | SE411757B (th) |
| SU (2) | SU587866A3 (th) |
| YU (3) | YU36530B (th) |
| ZA (1) | ZA72364B (th) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1368232A (en) * | 1970-07-31 | 1974-09-25 | Glaxo Lab Ltd | Azetidino-thiazolidine compounds |
| US4267340A (en) * | 1971-06-24 | 1981-05-12 | Fujisawa Pharmaceutical Co., Ltd. | Disulfide substituted oxazetidine derivatives |
| GB1472863A (en) * | 1974-08-15 | 1977-05-11 | Farmaceutici Italia | Intermediates for cephalosporin synthesis |
| GB1468068A (en) * | 1974-10-03 | 1977-03-23 | Farmaceutici Italia | Preparation of cephalosporin precursors |
| CA1136132A (en) * | 1975-02-17 | 1982-11-23 | Teruji Tsuji | Cyclization to form cephem ring and intermediates therefor |
| GB1543048A (en) * | 1976-02-04 | 1979-03-28 | Beecham Group Ltd | 4-mercapto-3-phenoxyacetamido-2-azetidinone |
| US4147699A (en) * | 1976-11-11 | 1979-04-03 | Massachusetts Institute Of Technology | β-Lactam precursors of penicillin and cephalosporin antibiotics |
| GB1576219A (en) * | 1976-12-31 | 1980-10-01 | Connlab Holdings Ltd | Thiazoleneazetidinone derivatives |
| CA1090806A (en) * | 1977-01-10 | 1980-12-02 | Mitsuru Yoshioka | Oxazolines |
| DE69223663T2 (de) * | 1991-02-20 | 1998-06-04 | Meiji Seika Kaisha | Azetidinonderivate und Verfahren zur Herstellung von Azetidinon- und Cefalosporinderivaten |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS157620B2 (en) * | 1965-09-10 | 1974-09-16 | Robert B Woodward | Method of 2-oxoazetidino (3,2-d)-thiazolidinmethanecarboxyl acid's esters making |
| BR6915080D0 (pt) * | 1969-06-12 | 1973-03-08 | Lilly Co Eli | Processo para a preparacao de um produto rearranjado de penicilina |
-
1971
- 1971-02-03 US US112389A patent/US3862164A/en not_active Expired - Lifetime
-
1972
- 1972-01-18 IE IE70/72A patent/IE35989B1/xx unknown
- 1972-01-19 ZA ZA720364A patent/ZA72364B/xx unknown
- 1972-01-20 BE BE778321A patent/BE778321A/xx not_active IP Right Cessation
- 1972-01-21 AU AU38173/72A patent/AU461096B2/en not_active Expired
- 1972-01-23 IL IL38614A patent/IL38614A/en unknown
- 1972-01-24 CA CA133018A patent/CA986521A/en not_active Expired
- 1972-01-26 GB GB370872A patent/GB1374486A/en not_active Expired
- 1972-01-26 SE SE7200872A patent/SE411757B/sv unknown
- 1972-01-31 YU YU00217/72A patent/YU36530B/xx unknown
- 1972-02-02 PL PL1972153242A patent/PL99979B1/pl unknown
- 1972-02-02 PL PL1972203155A patent/PL102203B1/xx unknown
- 1972-02-02 AT AT82372A patent/AT315837B/de not_active IP Right Cessation
- 1972-02-02 PH PH13248A patent/PH11447A/en unknown
- 1972-02-02 HU HUEI406A patent/HU164227B/hu unknown
- 1972-02-02 ES ES399423A patent/ES399423A1/es not_active Expired
- 1972-02-02 PL PL1972193666A patent/PL101586B1/pl unknown
- 1972-02-02 PL PL1972181152A patent/PL94440B1/pl unknown
- 1972-02-02 SU SU721743582A patent/SU587866A3/ru active
- 1972-02-03 NL NLAANVRAGE7201446,A patent/NL170004C/xx not_active IP Right Cessation
- 1972-02-03 CS CS7425A patent/CS176199B2/cs unknown
- 1972-02-03 CH CH707675A patent/CH576984A5/xx not_active IP Right Cessation
- 1972-02-03 CH CH157572A patent/CH583243A5/xx not_active IP Right Cessation
- 1972-02-03 FR FR7203628A patent/FR2125060A5/fr not_active Expired
- 1972-02-03 DE DE2205144A patent/DE2205144C3/de not_active Expired
- 1972-02-03 CS CS689A patent/CS176183B2/cs unknown
- 1972-02-03 JP JP1254672A patent/JPS5614115B1/ja active Pending
-
1974
- 1974-11-08 PH PH16496A patent/PH12071A/en unknown
- 1974-11-08 PH PH16497A patent/PH11077A/en unknown
-
1975
- 1975-03-03 PH PH16496A patent/PH12072A/en unknown
- 1975-03-19 SU SU2114600A patent/SU558645A3/ru active
-
1976
- 1976-11-08 PH PH16497A patent/PH18194A/en unknown
-
1979
- 1979-06-16 YU YU01428/79A patent/YU142879A/xx unknown
- 1979-12-10 YU YU02993/79A patent/YU36531B/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0042026A1 (de) | 3,4-Disubstituierte Azetidin-2-onverbindungen und Verfahren zu ihrer Herstellung | |
| CA1080713A (en) | Process for the manufacture of 3-substituted-hydroxy-crotonic and isocrotonic acid derivatives | |
| SE411757B (sv) | Tiazolidinazetidinon till anvendning som mellanprodukt for framstellning av penicillin- och cefalosporinantibiotika samt forfarande for framstellning derav | |
| DE69231815T2 (de) | Verfahren zur Herstellung von Cephalosporinen und Zwischenprodukte in diesem Verfahren | |
| US4735937A (en) | 8-oxo-5-thia-1-azabicyclo(4,2,0)oct-2-ene compounds | |
| DE2331078C2 (de) | 3-Substituierte 7β-Amino-cepham-4-carbonsäureverbindungen | |
| CH628900A5 (fr) | Procede de preparation de thio-oximes derivees de cephalosporines et de penicillines. | |
| DE2138322A1 (de) | Chemische Verbindungen | |
| US4093800A (en) | Process for preparing cepham compounds | |
| FI75165B (fi) | Foerbaettrat foerfarande foer framstaellning av penicillansyraklormetylestrar. | |
| EP0722946B1 (de) | Verfahren zur Herstellung von 3-Formyl-Cephem-Derivaten | |
| EP0018546A2 (en) | Process for the production of phenylglycyl chloride hydrochlorides | |
| US3832347A (en) | Imino-halides of 3-amido-2-halo-1-(1'-protected carboxy-2'-methyl-1'-propenyl)-4-azetidinones | |
| US4103086A (en) | 8-Oxo-4-thia-1-azabicyclo (4.2.0)-oct-2-ene derivatives | |
| EP0249176A2 (de) | Verfahren zur Herstellung von 2,3-Dioxo-4-oxicarbonylpiperazinderivaten | |
| EP0001149B1 (en) | Process for the preparation of 3-bromomethyl-3-cephem-sulphoxide derivatives | |
| NO761352L (th) | ||
| DE3780112T2 (de) | Verfahren zur herstellung von penicillansaeure-derivaten. | |
| US4379032A (en) | Process for preparing oxazolineazetidinone derivatives | |
| US4075219A (en) | Epimerization process | |
| US4430498A (en) | 8-Oxo-5-thia-1-azabicyclo(4,2,0)oct-2-ene compounds | |
| DE3018847C2 (de) | 6-α- und 6-β-substituierte Penicillansäurederivate und Verfahren zu ihrer Herstellung | |
| US4482435A (en) | Process for preparing thiazolidine compounds | |
| US3598832A (en) | 5-esterified hydroxy-thiazolidine-4-carboxylic acid compounds | |
| DE2528044A1 (de) | Methodikverfahren zur herstellung von methylderivaten |