RU2695815C9 - Хинолиновые производные в качестве ингибиторов smo - Google Patents
Хинолиновые производные в качестве ингибиторов smo Download PDFInfo
- Publication number
- RU2695815C9 RU2695815C9 RU2016141129A RU2016141129A RU2695815C9 RU 2695815 C9 RU2695815 C9 RU 2695815C9 RU 2016141129 A RU2016141129 A RU 2016141129A RU 2016141129 A RU2016141129 A RU 2016141129A RU 2695815 C9 RU2695815 C9 RU 2695815C9
- Authority
- RU
- Russia
- Prior art keywords
- mmol
- compound
- reaction mixture
- stirred
- added
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title abstract description 10
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 title description 2
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 792
- -1 methylsulphonyl Chemical group 0.000 claims abstract description 112
- 150000003839 salts Chemical class 0.000 claims abstract description 59
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 56
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 50
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 48
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 47
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 18
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 12
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims abstract description 3
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 claims abstract description 3
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 64
- 229910052794 bromium Inorganic materials 0.000 claims description 42
- 229910052740 iodine Inorganic materials 0.000 claims description 42
- 229910052760 oxygen Inorganic materials 0.000 claims description 34
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 24
- 125000003545 alkoxy group Chemical group 0.000 claims description 21
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 125000004076 pyridyl group Chemical group 0.000 claims description 18
- 125000002883 imidazolyl group Chemical group 0.000 claims description 13
- 125000000335 thiazolyl group Chemical group 0.000 claims description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 241000289669 Erinaceus europaeus Species 0.000 abstract description 12
- 206010028980 Neoplasm Diseases 0.000 abstract description 12
- 239000000126 substance Substances 0.000 abstract description 10
- 230000000694 effects Effects 0.000 abstract description 9
- 201000011510 cancer Diseases 0.000 abstract description 8
- 230000037361 pathway Effects 0.000 abstract description 4
- 150000002391 heterocyclic compounds Chemical class 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 712
- 239000011541 reaction mixture Substances 0.000 description 368
- 235000019439 ethyl acetate Nutrition 0.000 description 355
- 239000007787 solid Substances 0.000 description 313
- 239000000203 mixture Substances 0.000 description 302
- 239000000243 solution Substances 0.000 description 284
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 219
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 209
- 239000012074 organic phase Substances 0.000 description 195
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 175
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 156
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 156
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 130
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 128
- 239000012267 brine Substances 0.000 description 127
- 238000006243 chemical reaction Methods 0.000 description 124
- 239000012043 crude product Substances 0.000 description 124
- 239000000460 chlorine Substances 0.000 description 116
- 230000002829 reductive effect Effects 0.000 description 104
- 229910052938 sodium sulfate Inorganic materials 0.000 description 102
- 235000011152 sodium sulphate Nutrition 0.000 description 102
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 101
- 229910001873 dinitrogen Inorganic materials 0.000 description 95
- 238000010898 silica gel chromatography Methods 0.000 description 91
- 239000012298 atmosphere Substances 0.000 description 82
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 78
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 70
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 69
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 67
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 66
- 238000004440 column chromatography Methods 0.000 description 64
- 238000002953 preparative HPLC Methods 0.000 description 62
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 50
- 229910052717 sulfur Inorganic materials 0.000 description 49
- 239000011734 sodium Substances 0.000 description 46
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 41
- 239000000706 filtrate Substances 0.000 description 38
- 239000003921 oil Substances 0.000 description 38
- 238000000034 method Methods 0.000 description 34
- 229910000029 sodium carbonate Inorganic materials 0.000 description 33
- 238000004809 thin layer chromatography Methods 0.000 description 31
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 125000005842 heteroatom Chemical group 0.000 description 27
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 25
- 238000000605 extraction Methods 0.000 description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- 239000008346 aqueous phase Substances 0.000 description 24
- 239000007788 liquid Substances 0.000 description 24
- 239000002253 acid Substances 0.000 description 23
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 23
- 229910000024 caesium carbonate Inorganic materials 0.000 description 23
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 239000000047 product Substances 0.000 description 21
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 239000012230 colorless oil Substances 0.000 description 17
- 239000012046 mixed solvent Substances 0.000 description 16
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 238000001914 filtration Methods 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 15
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 15
- 239000002244 precipitate Substances 0.000 description 15
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 15
- 239000007858 starting material Substances 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- 239000007821 HATU Substances 0.000 description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 14
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 14
- 125000003282 alkyl amino group Chemical group 0.000 description 14
- 125000000623 heterocyclic group Chemical group 0.000 description 14
- 125000004122 cyclic group Chemical group 0.000 description 13
- 125000001424 substituent group Chemical group 0.000 description 13
- 125000001544 thienyl group Chemical group 0.000 description 13
- CEBAHYWORUOILU-UHFFFAOYSA-N (4-cyanophenyl)boronic acid Chemical compound OB(O)C1=CC=C(C#N)C=C1 CEBAHYWORUOILU-UHFFFAOYSA-N 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 12
- 125000004429 atom Chemical group 0.000 description 12
- 125000002541 furyl group Chemical group 0.000 description 12
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 12
- 229920006395 saturated elastomer Polymers 0.000 description 12
- HNVIQLPOGUDBSU-OLQVQODUSA-N (2s,6r)-2,6-dimethylmorpholine Chemical compound C[C@H]1CNC[C@@H](C)O1 HNVIQLPOGUDBSU-OLQVQODUSA-N 0.000 description 11
- 125000003118 aryl group Chemical group 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 238000000746 purification Methods 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 10
- 125000001786 isothiazolyl group Chemical group 0.000 description 10
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 10
- 125000002971 oxazolyl group Chemical group 0.000 description 10
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 9
- 235000010338 boric acid Nutrition 0.000 description 9
- 125000005619 boric acid group Chemical class 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- WLVKDFJTYKELLQ-UHFFFAOYSA-N cyclopropylboronic acid Chemical compound OB(O)C1CC1 WLVKDFJTYKELLQ-UHFFFAOYSA-N 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- 125000000168 pyrrolyl group Chemical group 0.000 description 9
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 235000019270 ammonium chloride Nutrition 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 125000001072 heteroaryl group Chemical group 0.000 description 8
- 150000002430 hydrocarbons Chemical group 0.000 description 8
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000003513 alkali Substances 0.000 description 7
- 125000004404 heteroalkyl group Chemical group 0.000 description 7
- 230000005764 inhibitory process Effects 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 206010004146 Basal cell carcinoma Diseases 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- HTJWUNNIRKDDIV-UHFFFAOYSA-N bis(1-adamantyl)-butylphosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(CCCC)C1(C2)CC(C3)CC2CC3C1 HTJWUNNIRKDDIV-UHFFFAOYSA-N 0.000 description 6
- 150000007524 organic acids Chemical class 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 6
- 239000012047 saturated solution Substances 0.000 description 6
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 5
- 102000003693 Hedgehog Proteins Human genes 0.000 description 5
- 108090000031 Hedgehog Proteins Proteins 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 150000007522 mineralic acids Chemical class 0.000 description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 235000018102 proteins Nutrition 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 230000008410 smoothened signaling pathway Effects 0.000 description 5
- JZIBVTUXIVIFGC-UHFFFAOYSA-N 2H-pyrrole Chemical compound C1C=CC=N1 JZIBVTUXIVIFGC-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- IWISFMCRPQVFEE-UHFFFAOYSA-N BrC=1C=CC=C2C(=C(C=NC=12)I)OC Chemical compound BrC=1C=CC=C2C(=C(C=NC=12)I)OC IWISFMCRPQVFEE-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 229910052796 boron Inorganic materials 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 229940125782 compound 2 Drugs 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 3
- ZMCQQCBOZIGNRV-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-[2-(1,2,4-triazol-1-yl)ethyl]benzamide Chemical compound NCC1=CC(OC2=CC=CC(=C2)C(=O)NCCN2C=NC=N2)=NC(=C1)C(F)(F)F ZMCQQCBOZIGNRV-UHFFFAOYSA-N 0.000 description 3
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 108010016200 Zinc Finger Protein GLI1 Proteins 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 230000004071 biological effect Effects 0.000 description 3
- 125000000113 cyclohexyl group Chemical class [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 210000001161 mammalian embryo Anatomy 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 3
- 238000010791 quenching Methods 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 3
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 2
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical compound CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 2
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 2
- VQGHOUODWALEFC-UHFFFAOYSA-N 2-phenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CC=N1 VQGHOUODWALEFC-UHFFFAOYSA-N 0.000 description 2
- WSNKEJIFARPOSQ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-(1-benzothiophen-2-ylmethyl)benzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NCC2=CC3=C(S2)C=CC=C3)C=CC=1 WSNKEJIFARPOSQ-UHFFFAOYSA-N 0.000 description 2
- GDSLUYKCPYECNN-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-[(4-fluorophenyl)methyl]benzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NCC2=CC=C(C=C2)F)C=CC=1 GDSLUYKCPYECNN-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 206010062804 Basal cell naevus syndrome Diseases 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- TYZRMKGXDYAFDV-BGYRXZFFSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 TYZRMKGXDYAFDV-BGYRXZFFSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 201000009030 Carcinoma Diseases 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- HHKFIUWAKPHMOY-HDICACEKSA-N ClC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC(=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)Cl Chemical compound ClC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC(=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)Cl HHKFIUWAKPHMOY-HDICACEKSA-N 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 208000031995 Gorlin syndrome Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 description 2
- REAYFGLASQTHKB-UHFFFAOYSA-N [2-[3-(1H-pyrazol-4-yl)phenoxy]-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound N1N=CC(=C1)C=1C=C(OC2=NC(=CC(=C2)CN)C(F)(F)F)C=CC=1 REAYFGLASQTHKB-UHFFFAOYSA-N 0.000 description 2
- SAHIZENKTPRYSN-UHFFFAOYSA-N [2-[3-(phenoxymethyl)phenoxy]-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound O(C1=CC=CC=C1)CC=1C=C(OC2=NC(=CC(=C2)CN)C(F)(F)F)C=CC=1 SAHIZENKTPRYSN-UHFFFAOYSA-N 0.000 description 2
- YKKPYMXANSSQCA-UHFFFAOYSA-N [3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxyphenyl]-(3-pyrazol-1-ylazetidin-1-yl)methanone Chemical compound N1(N=CC=C1)C1CN(C1)C(=O)C1=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F YKKPYMXANSSQCA-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001263 acyl chlorides Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 125000005257 alkyl acyl group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 150000001502 aryl halides Chemical class 0.000 description 2
- 125000005002 aryl methyl group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 229940045996 isethionic acid Drugs 0.000 description 2
- 125000000959 isobutyl group Chemical class [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 2
- 125000000468 ketone group Chemical group 0.000 description 2
- 239000004310 lactic acid Substances 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 229960002510 mandelic acid Drugs 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- RLKHFSNWQCZBDC-UHFFFAOYSA-N n-(benzenesulfonyl)-n-fluorobenzenesulfonamide Chemical compound C=1C=CC=CC=1S(=O)(=O)N(F)S(=O)(=O)C1=CC=CC=C1 RLKHFSNWQCZBDC-UHFFFAOYSA-N 0.000 description 2
- 210000004898 n-terminal fragment Anatomy 0.000 description 2
- 201000005734 nevoid basal cell carcinoma syndrome Diseases 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- TYFQFVWCELRYAO-UHFFFAOYSA-N suberic acid Chemical compound OC(=O)CCCCCCC(O)=O TYFQFVWCELRYAO-UHFFFAOYSA-N 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical class [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical compound C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 2
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- BPQMGSKTAYIVFO-UHFFFAOYSA-N vismodegib Chemical compound ClC1=CC(S(=O)(=O)C)=CC=C1C(=O)NC1=CC=C(Cl)C(C=2N=CC=CC=2)=C1 BPQMGSKTAYIVFO-UHFFFAOYSA-N 0.000 description 2
- 229960004449 vismodegib Drugs 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- IFNWESYYDINUHV-OLQVQODUSA-N (2s,6r)-2,6-dimethylpiperazine Chemical compound C[C@H]1CNC[C@@H](C)N1 IFNWESYYDINUHV-OLQVQODUSA-N 0.000 description 1
- FZENHVRTOIYYIK-UHFFFAOYSA-N (4-chloro-2-fluorophenoxy)boronic acid Chemical compound OB(O)OC1=CC=C(Cl)C=C1F FZENHVRTOIYYIK-UHFFFAOYSA-N 0.000 description 1
- DXCRBMYIDDYCDQ-UHFFFAOYSA-N (5-formylthiophen-2-yl)oxyboronic acid Chemical compound OB(O)OC1=CC=C(C=O)S1 DXCRBMYIDDYCDQ-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- 125000004739 (C1-C6) alkylsulfonyl group Chemical class 0.000 description 1
- 125000006619 (C1-C6) dialkylamino group Chemical group 0.000 description 1
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000000196 1,4-pentadienyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])=C([H])[H] 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- LLFBKOTXULFGLF-UHFFFAOYSA-N 2,2,6,6-tetramethyloxane-3,5-dione Chemical compound CC1(C)OC(C)(C)C(=O)CC1=O LLFBKOTXULFGLF-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- AGERMSHNZYFJDC-UHFFFAOYSA-N 2,6-dimethyl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]morpholine Chemical compound CC1CN(CC(O1)C)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C AGERMSHNZYFJDC-UHFFFAOYSA-N 0.000 description 1
- FPUWYVKGFVPSTB-UHFFFAOYSA-N 2-(3-methylpentan-3-yloxy)-1,3-dioxane-4,6-dione Chemical compound C1(CC(=O)OC(OC(C)(CC)CC)O1)=O FPUWYVKGFVPSTB-UHFFFAOYSA-N 0.000 description 1
- SOHDPICLICFSOP-UHFFFAOYSA-N 2-bromo-6-methylpyridine Chemical compound CC1=CC=CC(Br)=N1 SOHDPICLICFSOP-UHFFFAOYSA-N 0.000 description 1
- OYUNTGBISCIYPW-UHFFFAOYSA-N 2-chloroprop-2-enenitrile Chemical compound ClC(=C)C#N OYUNTGBISCIYPW-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- MGADZUXDNSDTHW-UHFFFAOYSA-N 2H-pyran Chemical compound C1OC=CC=C1 MGADZUXDNSDTHW-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- VTNULXUEOJMRKZ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-(2H-tetrazol-5-ylmethyl)benzamide Chemical compound N=1NN=NC=1CNC(C1=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)=O VTNULXUEOJMRKZ-UHFFFAOYSA-N 0.000 description 1
- AJZDHLHTTJRNQJ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-[2-(tetrazol-1-yl)ethyl]benzamide Chemical compound N1(N=NN=C1)CCNC(C1=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)=O AJZDHLHTTJRNQJ-UHFFFAOYSA-N 0.000 description 1
- MZSAMHOCTRNOIZ-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylaniline Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(NC2=CC=CC=C2)C=CC=1 MZSAMHOCTRNOIZ-UHFFFAOYSA-N 0.000 description 1
- HAEQAUJYNHQVHV-UHFFFAOYSA-N 3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxy-N-phenylbenzamide Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C(=O)NC2=CC=CC=C2)C=CC=1 HAEQAUJYNHQVHV-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- SMOGUURTGJUNNJ-AOOOYVTPSA-N 4-[(2r,6s)-2,6-dimethylmorpholin-4-yl]aniline Chemical compound C1[C@@H](C)O[C@@H](C)CN1C1=CC=C(N)C=C1 SMOGUURTGJUNNJ-AOOOYVTPSA-N 0.000 description 1
- OTRDBTJTZUXOKP-AOOOYVTPSA-N 4-[(2r,6s)-2,6-dimethylmorpholin-4-yl]benzoic acid Chemical compound C1[C@@H](C)O[C@@H](C)CN1C1=CC=C(C(O)=O)C=C1 OTRDBTJTZUXOKP-AOOOYVTPSA-N 0.000 description 1
- PLKIKCRHSLVAOI-UHFFFAOYSA-N 4-[2-[6-(3,5-dimethyl-4-propanoylpiperazin-1-yl)pyridin-3-yl]-1H-benzimidazol-4-yl]benzonitrile Chemical compound CC1CN(CC(N1C(CC)=O)C)C1=CC=C(C=N1)C1=NC2=C(N1)C=CC=C2C1=CC=C(C#N)C=C1 PLKIKCRHSLVAOI-UHFFFAOYSA-N 0.000 description 1
- BPPVUXSMLBXYGG-UHFFFAOYSA-N 4-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylbenzoyl]-2-methyl-1h-pyrazol-3-one Chemical compound CC1=C(C(=O)C=2C(N(C)NC=2)=O)C=CC(S(C)(=O)=O)=C1C1=NOCC1 BPPVUXSMLBXYGG-UHFFFAOYSA-N 0.000 description 1
- QYCIALNXUSFQBK-UHFFFAOYSA-N 4-[3-[2-(2,6-dimethylmorpholin-4-yl)-1,3-thiazol-4-yl]-4-methoxyquinolin-8-yl]benzonitrile Chemical compound CC1CN(CC(O1)C)C=1SC=C(N=1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 QYCIALNXUSFQBK-UHFFFAOYSA-N 0.000 description 1
- HDFGYHXHMUOBHM-UHFFFAOYSA-N 4-[3-[3-(2,6-dimethylmorpholin-4-yl)pyrrolidin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile Chemical compound CC1CN(CC(O1)C)C1CN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 HDFGYHXHMUOBHM-UHFFFAOYSA-N 0.000 description 1
- UMGBPLQTNNGRRL-UHFFFAOYSA-N 4-[3-[4-(2,6-dimethylmorpholin-4-yl)piperidin-1-yl]-4-methoxyquinolin-8-yl]benzonitrile Chemical compound CC1CN(CC(O1)C)C1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 UMGBPLQTNNGRRL-UHFFFAOYSA-N 0.000 description 1
- RSGZUEDPULCHSG-UHFFFAOYSA-N 4-[3-[6-(3,5-dimethyl-4-methylsulfonylpiperazin-1-yl)pyridin-3-yl]-4-methoxyquinolin-8-yl]benzonitrile Chemical compound CS(=O)(=O)N1C(CN(CC1C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C RSGZUEDPULCHSG-UHFFFAOYSA-N 0.000 description 1
- ZHJOXNGRYSKSFB-UHFFFAOYSA-N 4-[3-[6-(3,5-dimethyl-4-propanoylpiperazin-1-yl)pyridin-3-yl]-4-methoxycinnolin-8-yl]benzonitrile Chemical compound CC1CN(CC(N1C(CC)=O)C)C1=CC=C(C=N1)C=1N=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 ZHJOXNGRYSKSFB-UHFFFAOYSA-N 0.000 description 1
- AHFSBXRRSAVMJT-UHFFFAOYSA-N 4-[3-[6-[4-(2-hydroxyacetyl)-3,5-dimethylpiperazin-1-yl]pyridin-3-yl]-4-methoxyquinolin-8-yl]benzonitrile Chemical compound OCC(=O)N1C(CN(CC1C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C AHFSBXRRSAVMJT-UHFFFAOYSA-N 0.000 description 1
- FUCZJXWXWPGJDY-KYGBEAGPSA-N 4-[4-(cyclopenten-1-yl)-6-[3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2H-pyridin-3-yl]quinolin-8-yl]benzonitrile Chemical compound C1(=CCCC1)C1=CC=NC2=C(C=C(C=C12)C1(CN=CC=C1)N1C[C@@H](O[C@@H](C1)C)C)C1=CC=C(C#N)C=C1 FUCZJXWXWPGJDY-KYGBEAGPSA-N 0.000 description 1
- GJKHRZFADYGADV-UHFFFAOYSA-N 4-[4-methoxy-3-[6-(8-propanoyl-3,8-diazabicyclo[3.2.1]octan-3-yl)pyridin-3-yl]quinolin-8-yl]benzonitrile Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1CC2CCC(C1)N2C(CC)=O GJKHRZFADYGADV-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- 125000001054 5 membered carbocyclic group Chemical group 0.000 description 1
- PEAOEIWYQVXZMB-UHFFFAOYSA-N 5-bromo-2-chloropyridine Chemical compound ClC1=CC=C(Br)C=N1 PEAOEIWYQVXZMB-UHFFFAOYSA-N 0.000 description 1
- FQIUCPGDKPXSLL-UHFFFAOYSA-N 5-bromopyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC(Br)=C1 FQIUCPGDKPXSLL-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- VLPBNQMPKNGOJC-DTORHVGOSA-N 6-[(2r,6s)-2,6-dimethylmorpholin-4-yl]pyridin-3-amine Chemical compound C1[C@@H](C)O[C@@H](C)CN1C1=CC=C(N)C=N1 VLPBNQMPKNGOJC-DTORHVGOSA-N 0.000 description 1
- VVIAGPKUTFNRDU-UHFFFAOYSA-N 6S-folinic acid Natural products C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-UHFFFAOYSA-N 0.000 description 1
- 206010067484 Adverse reaction Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- HWAJSRDBRVULTH-UHFFFAOYSA-N BrC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC(N(CC1)C1=NC=C(C=C1)C(C)(C)O)C Chemical compound BrC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC(N(CC1)C1=NC=C(C=C1)C(C)(C)O)C HWAJSRDBRVULTH-UHFFFAOYSA-N 0.000 description 1
- FUZXNGSZKPPSNW-KDURUIRLSA-N BrC=1C=C(C=CC=1N1C[C@@H](O[C@@H](C1)C)C)N1C(C2=CC=CC(=C2C=C1)C1=CC=C(C#N)C=C1)=O Chemical compound BrC=1C=C(C=CC=1N1C[C@@H](O[C@@H](C1)C)C)N1C(C2=CC=CC(=C2C=C1)C1=CC=C(C#N)C=C1)=O FUZXNGSZKPPSNW-KDURUIRLSA-N 0.000 description 1
- MQZHOAJJVDULOV-UHFFFAOYSA-N BrC=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound BrC=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 MQZHOAJJVDULOV-UHFFFAOYSA-N 0.000 description 1
- CCOHQOLLWDOALP-BGYRXZFFSA-N C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)NC1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)OC Chemical compound C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)NC1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)OC CCOHQOLLWDOALP-BGYRXZFFSA-N 0.000 description 1
- QRKJQIVQLGWWSB-OYRHEFFESA-N C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)NC=1C=NC(=CC=1)N1C[C@@H](N([C@@H](C1)C)C(CC)=O)C)OC Chemical compound C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)NC=1C=NC(=CC=1)N1C[C@@H](N([C@@H](C1)C)C(CC)=O)C)OC QRKJQIVQLGWWSB-OYRHEFFESA-N 0.000 description 1
- DMOWVWUPAYQBMU-KDURUIRLSA-N C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)NC=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C)OC Chemical compound C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)NC=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C)OC DMOWVWUPAYQBMU-KDURUIRLSA-N 0.000 description 1
- RMESKYNBXMODRE-UHFFFAOYSA-N C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)O)OC Chemical compound C(#N)C1=CC=C(C=C1)C=1C=CC=C2C(=C(C=NC=12)C(=O)O)OC RMESKYNBXMODRE-UHFFFAOYSA-N 0.000 description 1
- ZZMDOHAHCPVJKO-CALCHBBNSA-N C(C(C)(C)C)(=O)NC=1C=CC=C2C(=C(C=NC=12)C=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C)OC Chemical compound C(C(C)(C)C)(=O)NC=1C=CC=C2C(=C(C=NC=12)C=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C)OC ZZMDOHAHCPVJKO-CALCHBBNSA-N 0.000 description 1
- CLWGMWRGRVUHDJ-UHFFFAOYSA-N C(C)(=O)N1C(CN(CC1C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C(C)(C)O Chemical compound C(C)(=O)N1C(CN(CC1C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C(C)(C)O CLWGMWRGRVUHDJ-UHFFFAOYSA-N 0.000 description 1
- BNNZRCARJFUFSI-BGYRXZFFSA-N C(C)(=O)NC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)C#N)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound C(C)(=O)NC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)C#N)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C BNNZRCARJFUFSI-BGYRXZFFSA-N 0.000 description 1
- ARSZKOMUKIZQKG-CLJLJLNGSA-N C(C1=CC=CC=C1)(=O)N1[C@@H](CN(C[C@H]1C)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=CC=C(C#N)C=C1)=O)C Chemical compound C(C1=CC=CC=C1)(=O)N1[C@@H](CN(C[C@H]1C)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=CC=C(C#N)C=C1)=O)C ARSZKOMUKIZQKG-CLJLJLNGSA-N 0.000 description 1
- ZBTGBHIFUOKBAA-UHFFFAOYSA-N C1(CC1)C(=O)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C1(CC1)C(=O)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 ZBTGBHIFUOKBAA-UHFFFAOYSA-N 0.000 description 1
- UMTSWOXUPRVNFA-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=C(C#N)C=CC=C1)N1C(CC(CC1)O)C1=NC=C(C=C1)C(C)(C)O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=C(C#N)C=CC=C1)N1C(CC(CC1)O)C1=NC=C(C=C1)C(C)(C)O UMTSWOXUPRVNFA-UHFFFAOYSA-N 0.000 description 1
- DEPVADGYHQLZKI-OYRHEFFESA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C DEPVADGYHQLZKI-OYRHEFFESA-N 0.000 description 1
- LETYXDAUGONQJQ-PMACEKPBSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1C[C@@H](O[C@H](C1)C)C Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1C[C@@H](O[C@H](C1)C)C LETYXDAUGONQJQ-PMACEKPBSA-N 0.000 description 1
- DKNVWXCWMXSHJQ-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1C(CN(CC1)C1=NC=C(C=C1)C(C)(C)O)=O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1C(CN(CC1)C1=NC=C(C=C1)C(C)(C)O)=O DKNVWXCWMXSHJQ-UHFFFAOYSA-N 0.000 description 1
- INRJZOLOKBAEEY-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC(N(CC1)C1=NC=C(C=C1)C(C)(C)O)(C)O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC(N(CC1)C1=NC=C(C=C1)C(C)(C)O)(C)O INRJZOLOKBAEEY-UHFFFAOYSA-N 0.000 description 1
- OMTRPFDKOORIOD-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC(N(CC1)C1=NC=C(C=C1)C(C)(C)O)=O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC(N(CC1)C1=NC=C(C=C1)C(C)(C)O)=O OMTRPFDKOORIOD-UHFFFAOYSA-N 0.000 description 1
- RHKPOHLSUYKSOG-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC2(C1)CN(C2)C1=NC=C(C=C1)C(C)(C)O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC2(C1)CN(C2)C1=NC=C(C=C1)C(C)(C)O RHKPOHLSUYKSOG-UHFFFAOYSA-N 0.000 description 1
- OICUCMRUQJZXRW-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCC2(CC1)CCN(CC2)C1=NC=C(C=C1)C(C)(C)O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCC2(CC1)CCN(CC2)C1=NC=C(C=C1)C(C)(C)O OICUCMRUQJZXRW-UHFFFAOYSA-N 0.000 description 1
- GDMOZZRJSLQMEH-UHFFFAOYSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCN(CC1)C1=CC(NC=C1)=O Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCN(CC1)C1=CC(NC=C1)=O GDMOZZRJSLQMEH-UHFFFAOYSA-N 0.000 description 1
- GOBGRPWVZVUUMF-OHGBUVMCSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1C[C@@H]([C@@H](CC1)N1C[C@@H](O[C@@H](C1)C)C)F Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1C[C@@H]([C@@H](CC1)N1C[C@@H](O[C@@H](C1)C)C)F GOBGRPWVZVUUMF-OHGBUVMCSA-N 0.000 description 1
- SFGQYGGJQVOGGB-BGYRXZFFSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)C#N)C=1C(=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C)C Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)C#N)C=1C(=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C)C SFGQYGGJQVOGGB-BGYRXZFFSA-N 0.000 description 1
- QQUGIEHSYUJXQF-KDURUIRLSA-N C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)OC(F)(F)F)C=1C=CC(=NC=1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound C1(CC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)OC(F)(F)F)C=1C=CC(=NC=1)N1C[C@@H](O[C@@H](C1)C)C QQUGIEHSYUJXQF-KDURUIRLSA-N 0.000 description 1
- QLZIBBOWBVGWJX-SZPZYZBQSA-N C1(CC1)C1=CC=C(C=C1)C1=C2C(=CN(C(C2=CC=C1)=O)C1=CC=C(C=C1)N1C[C@H](O[C@H](C1)C)C)C Chemical compound C1(CC1)C1=CC=C(C=C1)C1=C2C(=CN(C(C2=CC=C1)=O)C1=CC=C(C=C1)N1C[C@H](O[C@H](C1)C)C)C QLZIBBOWBVGWJX-SZPZYZBQSA-N 0.000 description 1
- USYRZMHBUPNPGA-OYRHEFFESA-N C1(CC1)C=1C=C(C=CC=1N1C[C@@H](O[C@@H](C1)C)C)N1C(C2=CC=CC(=C2C=C1)C1=CC=C(C#N)C=C1)=O Chemical compound C1(CC1)C=1C=C(C=CC=1N1C[C@@H](O[C@@H](C1)C)C)N1C(C2=CC=CC(=C2C=C1)C1=CC=C(C#N)C=C1)=O USYRZMHBUPNPGA-OYRHEFFESA-N 0.000 description 1
- YHOSHZJHIZEIKH-OYRHEFFESA-N C1(CCC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound C1(CCC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C YHOSHZJHIZEIKH-OYRHEFFESA-N 0.000 description 1
- BRTULESNFBDGMR-UHFFFAOYSA-N CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1CC(N(C(C1)C)C)C Chemical compound CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1CC(N(C(C1)C)C)C BRTULESNFBDGMR-UHFFFAOYSA-N 0.000 description 1
- GPUYXVXIXDUHCB-UHFFFAOYSA-N CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1CC2N(CC1)C(OC2)=O Chemical compound CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1CC2N(CC1)C(OC2)=O GPUYXVXIXDUHCB-UHFFFAOYSA-N 0.000 description 1
- BEIGQZDMWRHNMY-UHFFFAOYSA-N CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1CC=2N(C(C1)C)C(=NN=2)C(F)(F)F Chemical compound CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1CC=2N(C(C1)C)C(=NN=2)C(F)(F)F BEIGQZDMWRHNMY-UHFFFAOYSA-N 0.000 description 1
- KCXCGAQLQFFRQT-VWLOTQADSA-N CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1C[C@H]2N(CC1)C(CC2)=O Chemical compound CC1=CN(C(C2=CC=CC(=C12)C1=CC=C(C#N)C=C1)=O)C1=CC=C(C=C1)N1C[C@H]2N(CC1)C(CC2)=O KCXCGAQLQFFRQT-VWLOTQADSA-N 0.000 description 1
- GRBXQXTWMSBLKH-UHFFFAOYSA-N CC1=NC(=CC(=C1)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C Chemical compound CC1=NC(=CC(=C1)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C GRBXQXTWMSBLKH-UHFFFAOYSA-N 0.000 description 1
- ZCQKENDGWQQILR-UHFFFAOYSA-N CC1CN(CC(O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=C(C=C2C=1OC)F)C1=CC=C(C#N)C=C1 Chemical compound CC1CN(CC(O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=C(C=C2C=1OC)F)C1=CC=C(C#N)C=C1 ZCQKENDGWQQILR-UHFFFAOYSA-N 0.000 description 1
- OBBDQXZMHMSZOM-OYRHEFFESA-N CN(C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)C Chemical compound CN(C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)C OBBDQXZMHMSZOM-OYRHEFFESA-N 0.000 description 1
- NUATUYCGIDZFGY-BGYRXZFFSA-N CN(C1=C(C=NC2=C(C=NC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)C Chemical compound CN(C1=C(C=NC2=C(C=NC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)C NUATUYCGIDZFGY-BGYRXZFFSA-N 0.000 description 1
- UMXQAZSFSHGHBZ-UHFFFAOYSA-N COC(C1=CN=C(C=C1)N1CC(NCC1)=O)=O Chemical compound COC(C1=CN=C(C=C1)N1CC(NCC1)=O)=O UMXQAZSFSHGHBZ-UHFFFAOYSA-N 0.000 description 1
- UKHVRUFENFCVON-UHFFFAOYSA-N COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1CC=2N(C(C1)C)C(=NN=2)C(F)(F)F Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1CC=2N(C(C1)C)C(=NN=2)C(F)(F)F UKHVRUFENFCVON-UHFFFAOYSA-N 0.000 description 1
- QYXUKGFZDYPICM-UHFFFAOYSA-N COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC=2N(CC1)C(=NN=2)C(F)(F)F Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CC=2N(CC1)C(=NN=2)C(F)(F)F QYXUKGFZDYPICM-UHFFFAOYSA-N 0.000 description 1
- BRNQEXQIEBEESO-UHFFFAOYSA-N COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCC(CC1)N1CCCC1 Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCC(CC1)N1CCCC1 BRNQEXQIEBEESO-UHFFFAOYSA-N 0.000 description 1
- JUJIVAHEZFIKPM-UHFFFAOYSA-N COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCN(CC1)C(CC1=CC=NC=C1)=O Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCN(CC1)C(CC1=CC=NC=C1)=O JUJIVAHEZFIKPM-UHFFFAOYSA-N 0.000 description 1
- FGVPEBQEUXRJCA-UHFFFAOYSA-N COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCN(CC1)S(=O)(=O)C(C)C Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)N1CCN(CC1)S(=O)(=O)C(C)C FGVPEBQEUXRJCA-UHFFFAOYSA-N 0.000 description 1
- VCUHBFXGRCZGKV-KDURUIRLSA-N COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)C(F)(F)F)C1=CC=C(C=C1)N1C[C@H](O[C@H](C1)C)C Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C=C1)C(F)(F)F)C1=CC=C(C=C1)N1C[C@H](O[C@H](C1)C)C VCUHBFXGRCZGKV-KDURUIRLSA-N 0.000 description 1
- DASJBNRZMKQOKK-KDURUIRLSA-N COC1=C(C=NC2=C(C=CC=C12)C1=NC=CC=C1)C1=CC=C(C=C1)N1C[C@H](C)O[C@H](C)C1 Chemical compound COC1=C(C=NC2=C(C=CC=C12)C1=NC=CC=C1)C1=CC=C(C=C1)N1C[C@H](C)O[C@H](C)C1 DASJBNRZMKQOKK-KDURUIRLSA-N 0.000 description 1
- WFZJLKXWWQOHQL-DTORHVGOSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C(=N1)C)OB(O)O)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C(=N1)C)OB(O)O)C WFZJLKXWWQOHQL-DTORHVGOSA-N 0.000 description 1
- RVJABEHGLJLJLM-KDURUIRLSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C1=CN=C2C(=CC=NC2=C1OC)C1=CC=C(C#N)C=C1)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C1=CN=C2C(=CC=NC2=C1OC)C1=CC=C(C#N)C=C1)C RVJABEHGLJLJLM-KDURUIRLSA-N 0.000 description 1
- GMRMPQVJHOXIBM-KDURUIRLSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C(=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C(F)(F)F)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C(=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C(F)(F)F)C GMRMPQVJHOXIBM-KDURUIRLSA-N 0.000 description 1
- QIMLDAPYTRTWMG-FDRBHKFBSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1CCC(CC1)C#N)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1CCC(CC1)C#N)C QIMLDAPYTRTWMG-FDRBHKFBSA-N 0.000 description 1
- HXLCEYIHRJXUTA-CALCHBBNSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C=1SC=C(N=1)C#N)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C=1SC=C(N=1)C#N)C HXLCEYIHRJXUTA-CALCHBBNSA-N 0.000 description 1
- MJZKIKTZBRFHCR-OYRHEFFESA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OCC)C1=CC=C(C#N)C=C1)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OCC)C1=CC=C(C#N)C=C1)C MJZKIKTZBRFHCR-OYRHEFFESA-N 0.000 description 1
- KIYFPSVZVNUUMC-KDURUIRLSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(N=CC=C2C=1OC)C1=CC=C(C=C1)C#N)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(N=CC=C2C=1OC)C1=CC=C(C=C1)C#N)C KIYFPSVZVNUUMC-KDURUIRLSA-N 0.000 description 1
- VXQIZPCXSBZLLX-WVTGSOKESA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC=2C(CCCC=2C=1OC)(O)C1=CC=C(C#N)C=C1)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC=2C(CCCC=2C=1OC)(O)C1=CC=C(C#N)C=C1)C VXQIZPCXSBZLLX-WVTGSOKESA-N 0.000 description 1
- COQGUNNLNPKCSZ-WJLWENBXSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC=2C(CCCC=2C=1OC)(OC)C1=CC=C(C#N)C=C1)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)C=1C=NC=2C(CCCC=2C=1OC)(OC)C1=CC=C(C#N)C=C1)C COQGUNNLNPKCSZ-WJLWENBXSA-N 0.000 description 1
- NLBKWHGDJVKMON-KDURUIRLSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=COC=C1)=O)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=COC=C1)=O)C NLBKWHGDJVKMON-KDURUIRLSA-N 0.000 description 1
- SHLUIPDABYPUGL-SEJPIABJSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(C1)C)C1=CC=C(C#N)C=C1)=O)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(C1)C)C1=CC=C(C#N)C=C1)=O)C SHLUIPDABYPUGL-SEJPIABJSA-N 0.000 description 1
- DCWPYVJZSUFTRU-BGYRXZFFSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C(C=2C=CN=C(C=2C(=C1)C)C1=CC=C(C#N)C=C1)=O)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C(C=2C=CN=C(C=2C(=C1)C)C1=CC=C(C#N)C=C1)=O)C DCWPYVJZSUFTRU-BGYRXZFFSA-N 0.000 description 1
- QVMJRSUKMHHCJF-BGYRXZFFSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C=C(C=2C(=CC=NC=2C1=O)C1=CC=C(C#N)C=C1)C)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C=C(C=2C(=CC=NC=2C1=O)C1=CC=C(C#N)C=C1)C)C QVMJRSUKMHHCJF-BGYRXZFFSA-N 0.000 description 1
- FKOBTVZZINUXMP-BGYRXZFFSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C=C(C=2C(=CN=CC=2C1=O)C1=CC=C(C#N)C=C1)C)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=C1)N1C=C(C=2C(=CN=CC=2C1=O)C1=CC=C(C#N)C=C1)C)C FKOBTVZZINUXMP-BGYRXZFFSA-N 0.000 description 1
- CALRXOFQJVFIFE-OYRHEFFESA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1C(C)C)C1=CC=C(C#N)C=C1)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1C(C)C)C1=CC=C(C#N)C=C1)C CALRXOFQJVFIFE-OYRHEFFESA-N 0.000 description 1
- SYTTWYJNSLSOCO-HDICACEKSA-N C[C@@H]1O[C@@H](CN(C1)C1=CC=C(N=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C Chemical compound C[C@@H]1O[C@@H](CN(C1)C1=CC=C(N=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C SYTTWYJNSLSOCO-HDICACEKSA-N 0.000 description 1
- UDTJBVBBSLKABF-BGYRXZFFSA-N C[C@H]1CN(C[C@@H](C)O1)C1=CC=C(C=C1)C1=C(C2CC2)C2=CC=CC(C3=NC=CC=C3)=C2N=C1 Chemical compound C[C@H]1CN(C[C@@H](C)O1)C1=CC=C(C=C1)C1=C(C2CC2)C2=CC=CC(C3=NC=CC=C3)=C2N=C1 UDTJBVBBSLKABF-BGYRXZFFSA-N 0.000 description 1
- ZKEHMBBIFGZJGM-NHCUHLMSSA-N C[C@H]1CN(C[C@@H](C1)C)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=CC=C(C#N)C=C1)=O Chemical compound C[C@H]1CN(C[C@@H](C1)C)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=CC=C(C#N)C=C1)=O ZKEHMBBIFGZJGM-NHCUHLMSSA-N 0.000 description 1
- GWOLDVVGFTUUGY-SZPZYZBQSA-N C[C@H]1CN(C[C@H](N1C(CC)=O)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](N1C(CC)=O)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 GWOLDVVGFTUUGY-SZPZYZBQSA-N 0.000 description 1
- UWIKPXTXBOHEMQ-BGYRXZFFSA-N C[C@H]1CN(C[C@H](N1C(CC)=O)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1O)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](N1C(CC)=O)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1O)C1=CC=C(C#N)C=C1 UWIKPXTXBOHEMQ-BGYRXZFFSA-N 0.000 description 1
- LIHISXHRSVSLSI-BGYRXZFFSA-N C[C@H]1CN(C[C@H](N1C(CC)=O)C)C1=CC=C(C=N1)C=1C=NC2=C(N=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](N1C(CC)=O)C)C1=CC=C(C=N1)C=1C=NC2=C(N=CC=C2C=1OC)C1=CC=C(C#N)C=C1 LIHISXHRSVSLSI-BGYRXZFFSA-N 0.000 description 1
- MDMBMDNIPGKKSY-OYRHEFFESA-N C[C@H]1CN(C[C@H](N1C=1SC=CN=1)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](N1C=1SC=CN=1)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 MDMBMDNIPGKKSY-OYRHEFFESA-N 0.000 description 1
- MSPAKFRMBIOEAG-HDICACEKSA-N C[C@H]1CN(C[C@H](O1)C)C(=O)C1=CC=C(S1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](O1)C)C(=O)C1=CC=C(S1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 MSPAKFRMBIOEAG-HDICACEKSA-N 0.000 description 1
- PBUHKNLIIRZEIW-KDURUIRLSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC(=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)F Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC(=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)F PBUHKNLIIRZEIW-KDURUIRLSA-N 0.000 description 1
- ODXZLMDQVNUMTL-KDURUIRLSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C(=N1)C)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C=C1)C#N Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C(=N1)C)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C=C1)C#N ODXZLMDQVNUMTL-KDURUIRLSA-N 0.000 description 1
- WSPWJUVMBHVVQR-BGYRXZFFSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1)C1=CC=C(C#N)C=C1 WSPWJUVMBHVVQR-BGYRXZFFSA-N 0.000 description 1
- YTRWISODLWPKQU-BGYRXZFFSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1S(=O)(=O)C)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1S(=O)(=O)C)C1=CC=C(C#N)C=C1 YTRWISODLWPKQU-BGYRXZFFSA-N 0.000 description 1
- IJIPYRZKJPBTED-KDURUIRLSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1C)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1C)C1=CC=C(C#N)C=C1 IJIPYRZKJPBTED-KDURUIRLSA-N 0.000 description 1
- MTHWMYLVBRDJNB-KDURUIRLSA-N C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C=C1)C#N Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C=C1)C#N MTHWMYLVBRDJNB-KDURUIRLSA-N 0.000 description 1
- KOSOCWHKISLGOE-HDICACEKSA-N C[C@H]1CN(C[C@H](O1)C)C1=NC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound C[C@H]1CN(C[C@H](O1)C)C1=NC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 KOSOCWHKISLGOE-HDICACEKSA-N 0.000 description 1
- JCZQLXLLYXZXDE-BGYRXZFFSA-N C[C@H]1O[C@H](CN(C1)C1=CC=C(C=C1)C1=NC2=CC=CC(=C2C(=C1)OC)C1=CC=C(C#N)C=C1)C Chemical compound C[C@H]1O[C@H](CN(C1)C1=CC=C(C=C1)C1=NC2=CC=CC(=C2C(=C1)OC)C1=CC=C(C#N)C=C1)C JCZQLXLLYXZXDE-BGYRXZFFSA-N 0.000 description 1
- NNWQSWYLMOBGHA-KDURUIRLSA-N C[C@H]1O[C@H](CN(C1)C1=CC=C(C=C1)C=1N=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C Chemical compound C[C@H]1O[C@H](CN(C1)C1=CC=C(C=C1)C=1N=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C NNWQSWYLMOBGHA-KDURUIRLSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 208000005623 Carcinogenesis Diseases 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- GMRNDLPYTOOLQP-KDURUIRLSA-N ClC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound ClC1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C GMRNDLPYTOOLQP-KDURUIRLSA-N 0.000 description 1
- PLMBAAWCAZGFKZ-HDICACEKSA-N ClC1=C(C=NC2=C(C=NC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound ClC1=C(C=NC2=C(C=NC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C PLMBAAWCAZGFKZ-HDICACEKSA-N 0.000 description 1
- RYACYELYJGLCOH-KDURUIRLSA-N ClC=1C=C(C=CC=1N1C[C@@H](O[C@@H](C1)C)C)N1C(C2=CC=CC(=C2C=C1)C1=CC=C(C#N)C=C1)=O Chemical compound ClC=1C=C(C=CC=1N1C[C@@H](O[C@@H](C1)C)C)N1C(C2=CC=CC(=C2C=C1)C1=CC=C(C#N)C=C1)=O RYACYELYJGLCOH-KDURUIRLSA-N 0.000 description 1
- WZAULQYORLWLGZ-KDURUIRLSA-N ClC=1C=C2C(=C(C=NC2=C(C=1)C1=CC=C(C=C1)C#N)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)OC Chemical compound ClC=1C=C2C(=C(C=NC2=C(C=1)C1=CC=C(C=C1)C#N)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)OC WZAULQYORLWLGZ-KDURUIRLSA-N 0.000 description 1
- 241001091551 Clio Species 0.000 description 1
- 102100032373 Coiled-coil domain-containing protein 85B Human genes 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 208000001333 Colorectal Neoplasms Diseases 0.000 description 1
- QASFUMOKHFSJGL-LAFRSMQTSA-N Cyclopamine Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H](CC2=C3C)[C@@H]1[C@@H]2CC[C@@]13O[C@@H]2C[C@H](C)CN[C@H]2[C@H]1C QASFUMOKHFSJGL-LAFRSMQTSA-N 0.000 description 1
- YPZMPEPLWKRVLD-PJEQPVAWSA-N D-Glycero-D-gulo-Heptose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O YPZMPEPLWKRVLD-PJEQPVAWSA-N 0.000 description 1
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-AQKNRBDQSA-N D-glucopyranuronic acid Chemical compound OC1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-AQKNRBDQSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- GMNHQUNYDSBVQY-WCRBZPEASA-N FC(C(=O)N1[C@H](CN(C[C@H]1C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C)C Chemical compound FC(C(=O)N1[C@H](CN(C[C@H]1C)C1=CC=C(C=N1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C)C GMNHQUNYDSBVQY-WCRBZPEASA-N 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- MPJKWIXIYCLVCU-UHFFFAOYSA-N Folinic acid Natural products NC1=NC2=C(N(C=O)C(CNc3ccc(cc3)C(=O)NC(CCC(=O)O)CC(=O)O)CN2)C(=O)N1 MPJKWIXIYCLVCU-UHFFFAOYSA-N 0.000 description 1
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- 101000868814 Homo sapiens Coiled-coil domain-containing protein 85B Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 108010052285 Membrane Proteins Proteins 0.000 description 1
- 102000018697 Membrane Proteins Human genes 0.000 description 1
- QGAISXMELKHBPU-SZPZYZBQSA-N N1(CCC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound N1(CCC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C QGAISXMELKHBPU-SZPZYZBQSA-N 0.000 description 1
- RSDDHJPCSHXEGF-OYRHEFFESA-N N1(CCC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C Chemical compound N1(CCC1)C1=C(C=NC2=C(C=CC=C12)C1=CC=C(C#N)C=C1)C=1C=NC(=CC=1)N1C[C@@H](O[C@@H](C1)C)C RSDDHJPCSHXEGF-OYRHEFFESA-N 0.000 description 1
- VQKWYLWJRXRWDQ-KDURUIRLSA-N N1C(=NC2=C1C=CC=C2)C=1C=CC=C2C(=C(C=NC=12)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)OC Chemical compound N1C(=NC2=C1C=CC=C2)C=1C=CC=C2C(=C(C=NC=12)C1=CC=C(C=C1)N1C[C@@H](O[C@@H](C1)C)C)OC VQKWYLWJRXRWDQ-KDURUIRLSA-N 0.000 description 1
- KRAHMMZDHOHAMR-UHFFFAOYSA-N OC(C)(C)C=1C=CC(=NC=1)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1C(F)(F)F)C1=CC=C(C#N)C=C1 Chemical compound OC(C)(C)C=1C=CC(=NC=1)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1C(F)(F)F)C1=CC=C(C#N)C=C1 KRAHMMZDHOHAMR-UHFFFAOYSA-N 0.000 description 1
- UJOWEPTVUSAVET-UHFFFAOYSA-N OC(C)(C)C=1C=CC(=NC=1)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound OC(C)(C)C=1C=CC(=NC=1)N1CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 UJOWEPTVUSAVET-UHFFFAOYSA-N 0.000 description 1
- WKOBRNLBQOYGRD-MMTVBGGISA-N OC(C)(C)[C@H]1O[C@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C Chemical compound OC(C)(C)[C@H]1O[C@H](CN(C1)C1=CC=C(C=C1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C WKOBRNLBQOYGRD-MMTVBGGISA-N 0.000 description 1
- FITRQFQYEROQTP-UHFFFAOYSA-N OC1(CCN(CC1)C1=NC=C(C=C1)C(C)(C)O)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 Chemical compound OC1(CCN(CC1)C1=NC=C(C=C1)C(C)(C)O)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1 FITRQFQYEROQTP-UHFFFAOYSA-N 0.000 description 1
- CEKGBLCZMSFTOC-UHFFFAOYSA-N OC1(CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C1=NC(=CC(=C1)C)C Chemical compound OC1(CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C1=NC(=CC(=C1)C)C CEKGBLCZMSFTOC-UHFFFAOYSA-N 0.000 description 1
- CCONAZKDFMNAAW-UHFFFAOYSA-N OC1(CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C1=NC=C(C=C1)C(C)(C)O Chemical compound OC1(CCN(CC1)C=1C=NC2=C(C=CC=C2C=1OC)C1=CC=C(C#N)C=C1)C1=NC=C(C=C1)C(C)(C)O CCONAZKDFMNAAW-UHFFFAOYSA-N 0.000 description 1
- JMRZGDLSXMXYMT-UHFFFAOYSA-N OC1C(CN(CC1(C)C)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=CC=C(C#N)C=C1)=O)(C)C Chemical compound OC1C(CN(CC1(C)C)C1=CC=C(C=C1)N1C(C2=CC=CC(=C2C(=C1)C)C1=CC=C(C#N)C=C1)=O)(C)C JMRZGDLSXMXYMT-UHFFFAOYSA-N 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 206010061535 Ovarian neoplasm Diseases 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 241000051107 Paraechinus aethiopicus Species 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 108010088665 Zinc Finger Protein Gli2 Proteins 0.000 description 1
- BFPLMTPHDFFMTG-UHFFFAOYSA-N [1,3]oxazolo[5,4-b]pyridine Chemical compound C1=CN=C2OC=NC2=C1 BFPLMTPHDFFMTG-UHFFFAOYSA-N 0.000 description 1
- BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
- ABRVLXLNVJHDRQ-UHFFFAOYSA-N [2-pyridin-3-yl-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound FC(C1=CC(=CC(=N1)C=1C=NC=CC=1)CN)(F)F ABRVLXLNVJHDRQ-UHFFFAOYSA-N 0.000 description 1
- YQYBUJYBXOVWQW-UHFFFAOYSA-N [3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxyphenyl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C=CC=1)C(=O)N1CC2=CC=CC=C2CC1 YQYBUJYBXOVWQW-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000006838 adverse reaction Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000006242 amine protecting group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 229940041181 antineoplastic drug Drugs 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 1
- 125000005251 aryl acyl group Chemical group 0.000 description 1
- 125000005101 aryl methoxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 125000004566 azetidin-1-yl group Chemical group N1(CCC1)* 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004935 benzoxazolinyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 238000002306 biochemical method Methods 0.000 description 1
- 238000010876 biochemical test Methods 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 230000036952 cancer formation Effects 0.000 description 1
- 230000005907 cancer growth Effects 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 231100000504 carcinogenesis Toxicity 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000006552 constitutive activation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000006310 cycloalkyl amino group Chemical group 0.000 description 1
- 125000005144 cycloalkylsulfonyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- MIUALDDWOKMYDA-UHFFFAOYSA-N cyclobutylboronic acid Chemical compound OB(O)C1CCC1 MIUALDDWOKMYDA-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- QASFUMOKHFSJGL-UHFFFAOYSA-N cyclopamine Natural products C1C=C2CC(O)CCC2(C)C(CC2=C3C)C1C2CCC13OC2CC(C)CNC2C1C QASFUMOKHFSJGL-UHFFFAOYSA-N 0.000 description 1
- JCWIWBWXCVGEAN-UHFFFAOYSA-L cyclopentyl(diphenyl)phosphane;dichloropalladium;iron Chemical compound [Fe].Cl[Pd]Cl.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1.[CH]1[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1 JCWIWBWXCVGEAN-UHFFFAOYSA-L 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical class [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Substances CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 1
- 125000004786 difluoromethoxy group Chemical group [H]C(F)(F)O* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-M dihydrogenphosphate Chemical compound OP(O)([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-M 0.000 description 1
- LVTYICIALWPMFW-UHFFFAOYSA-N diisopropanolamine Chemical compound CC(O)CNCC(C)O LVTYICIALWPMFW-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical group C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 1
- VVIAGPKUTFNRDU-ABLWVSNPSA-N folinic acid Chemical compound C1NC=2NC(N)=NC(=O)C=2N(C=O)C1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 VVIAGPKUTFNRDU-ABLWVSNPSA-N 0.000 description 1
- 239000011672 folinic acid Substances 0.000 description 1
- 235000008191 folinic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- CYEFKCRAAGLNHW-UHFFFAOYSA-N furan-3-ylboronic acid Chemical compound OB(O)C=1C=COC=1 CYEFKCRAAGLNHW-UHFFFAOYSA-N 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- LRBQNJMCXXYXIU-QWKBTXIPSA-N gallotannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@H]2[C@@H]([C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-QWKBTXIPSA-N 0.000 description 1
- JVZRCNQLWOELDU-UHFFFAOYSA-N gamma-Phenylpyridine Natural products C1=CC=CC=C1C1=CC=NC=C1 JVZRCNQLWOELDU-UHFFFAOYSA-N 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000000174 gluconic acid Substances 0.000 description 1
- 235000012208 gluconic acid Nutrition 0.000 description 1
- 229940097043 glucuronic acid Drugs 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005253 heteroarylacyl group Chemical group 0.000 description 1
- 125000004366 heterocycloalkenyl group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical group C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229960001691 leucovorin Drugs 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 1
- 230000036244 malformation Effects 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- GXHFUVWIGNLZSC-UHFFFAOYSA-N meldrum's acid Chemical compound CC1(C)OC(=O)CC(=O)O1 GXHFUVWIGNLZSC-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 125000004572 morpholin-3-yl group Chemical group N1C(COCC1)* 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- DMQSHEKGGUOYJS-UHFFFAOYSA-N n,n,n',n'-tetramethylpropane-1,3-diamine Chemical compound CN(C)CCCN(C)C DMQSHEKGGUOYJS-UHFFFAOYSA-N 0.000 description 1
- IMSODBCFSUAZMZ-UHFFFAOYSA-N n-(3-amino-1h-isoindol-2-ium-2-yl)-4-chlorobenzamide;bromide Chemical compound Br.C1=CC(Cl)=CC=C1C(=O)NN1C(=N)C2=CC=CC=C2C1 IMSODBCFSUAZMZ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical class C(CCCCC)* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 235000005152 nicotinamide Nutrition 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 125000004591 piperonyl group Chemical group C(C1=CC=2OCOC2C=C1)* 0.000 description 1
- XIPFMBOWZXULIA-UHFFFAOYSA-N pivalamide Chemical compound CC(C)(C)C(N)=O XIPFMBOWZXULIA-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical compound [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- VVWRJUBEIPHGQF-MDZDMXLPSA-N propan-2-yl (ne)-n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)\N=N\C(=O)OC(C)C VVWRJUBEIPHGQF-MDZDMXLPSA-N 0.000 description 1
- VVWRJUBEIPHGQF-UHFFFAOYSA-N propan-2-yl n-propan-2-yloxycarbonyliminocarbamate Chemical compound CC(C)OC(=O)N=NC(=O)OC(C)C VVWRJUBEIPHGQF-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical class [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 108091006024 signal transducing proteins Proteins 0.000 description 1
- 102000034285 signal transducing proteins Human genes 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 235000011006 sodium potassium tartrate Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 229960004274 stearic acid Drugs 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229940032330 sulfuric acid Drugs 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 229960001367 tartaric acid Drugs 0.000 description 1
- 231100000378 teratogenic Toxicity 0.000 description 1
- 230000003390 teratogenic effect Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000004192 tetrahydrofuran-2-yl group Chemical group [H]C1([H])OC([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 125000005309 thioalkoxy group Chemical group 0.000 description 1
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- PBIMIGNDTBRRPI-UHFFFAOYSA-N trifluoro borate Chemical compound FOB(OF)OF PBIMIGNDTBRRPI-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
- A61K31/472—Non-condensed isoquinolines, e.g. papaverine
- A61K31/4725—Non-condensed isoquinolines, e.g. papaverine containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/496—Non-condensed piperazines containing further heterocyclic rings, e.g. rifampin, thiothixene or sparfloxacin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/535—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one oxygen as the ring hetero atoms, e.g. 1,2-oxazines
- A61K31/5375—1,4-Oxazines, e.g. morpholine
- A61K31/5377—1,4-Oxazines, e.g. morpholine not condensed and containing further heterocyclic rings, e.g. timolol
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/10—Spiro-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/10—Spiro-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CN201410110890.1 | 2014-03-24 | ||
| CN201410110890.1A CN104945377A (zh) | 2014-03-24 | 2014-03-24 | 作为smo抑制剂的喹啉衍生物 |
| CN201510104908.1 | 2015-03-10 | ||
| CN201510104908 | 2015-03-10 | ||
| PCT/CN2015/074268 WO2015144001A1 (zh) | 2014-03-24 | 2015-03-16 | 作为smo抑制剂的喹啉衍生物 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| RU2016141129A RU2016141129A (ru) | 2018-04-28 |
| RU2016141129A3 RU2016141129A3 (enExample) | 2018-04-28 |
| RU2695815C2 RU2695815C2 (ru) | 2019-07-29 |
| RU2695815C9 true RU2695815C9 (ru) | 2019-10-28 |
Family
ID=54193978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2016141129A RU2695815C9 (ru) | 2014-03-24 | 2015-03-16 | Хинолиновые производные в качестве ингибиторов smo |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US9938292B2 (enExample) |
| EP (1) | EP3124482B1 (enExample) |
| JP (1) | JP6377245B2 (enExample) |
| KR (1) | KR101910724B1 (enExample) |
| CN (1) | CN106458974B (enExample) |
| AU (1) | AU2015237050B2 (enExample) |
| BR (1) | BR112016021730B1 (enExample) |
| CA (1) | CA2943100C (enExample) |
| CL (1) | CL2016002394A1 (enExample) |
| EC (1) | ECSP16083602A (enExample) |
| IL (1) | IL247970A (enExample) |
| MX (1) | MX370438B (enExample) |
| NZ (1) | NZ724691A (enExample) |
| PE (1) | PE20170331A1 (enExample) |
| RU (1) | RU2695815C9 (enExample) |
| SG (1) | SG11201607973XA (enExample) |
| TW (1) | TW201623242A (enExample) |
| WO (1) | WO2015144001A1 (enExample) |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI433674B (zh) | 2006-12-28 | 2014-04-11 | Infinity Discovery Inc | 環杷明(cyclopamine)類似物類 |
| US9745319B2 (en) | 2013-03-15 | 2017-08-29 | Araxes Pharma Llc | Irreversible covalent inhibitors of the GTPase K-Ras G12C |
| UY35464A (es) | 2013-03-15 | 2014-10-31 | Araxes Pharma Llc | Inhibidores covalentes de kras g12c. |
| TWI659021B (zh) | 2013-10-10 | 2019-05-11 | 亞瑞克西斯製藥公司 | Kras g12c之抑制劑 |
| JO3556B1 (ar) | 2014-09-18 | 2020-07-05 | Araxes Pharma Llc | علاجات مدمجة لمعالجة السرطان |
| WO2016049568A1 (en) | 2014-09-25 | 2016-03-31 | Araxes Pharma Llc | Methods and compositions for inhibition of ras |
| EP3280708B1 (en) | 2015-04-10 | 2021-09-01 | Araxes Pharma LLC | Substituted quinazoline compounds and methods of use thereof |
| ES2856880T3 (es) | 2015-04-15 | 2021-09-28 | Araxes Pharma Llc | Inhibidores tricíclicos condensados de KRAS y métodos de uso de los mismos |
| JP6796638B2 (ja) | 2015-06-04 | 2020-12-09 | ペレファーム, インク.Pellepharm, Inc. | ヘッジホッグ阻害性化合物の送達のための局所的製剤及びその使用 |
| EP3325447A1 (en) * | 2015-07-22 | 2018-05-30 | Araxes Pharma LLC | Substituted quinazoline compounds and their use as inhibitors of g12c mutant kras, hras and/or nras proteins |
| US10144724B2 (en) | 2015-07-22 | 2018-12-04 | Araxes Pharma Llc | Substituted quinazoline compounds and methods of use thereof |
| US10975071B2 (en) | 2015-09-28 | 2021-04-13 | Araxes Pharma Llc | Inhibitors of KRAS G12C mutant proteins |
| WO2017058902A1 (en) | 2015-09-28 | 2017-04-06 | Araxes Pharma Llc | Inhibitors of kras g12c mutant proteins |
| WO2017058807A1 (en) | 2015-09-28 | 2017-04-06 | Araxes Pharma Llc | Inhibitors of kras g12c mutant proteins |
| US10730867B2 (en) | 2015-09-28 | 2020-08-04 | Araxes Pharma Llc | Inhibitors of KRAS G12C mutant proteins |
| US10647703B2 (en) | 2015-09-28 | 2020-05-12 | Araxes Pharma Llc | Inhibitors of KRAS G12C mutant proteins |
| US10858343B2 (en) | 2015-09-28 | 2020-12-08 | Araxes Pharma Llc | Inhibitors of KRAS G12C mutant proteins |
| WO2017058792A1 (en) | 2015-09-28 | 2017-04-06 | Araxes Pharma Llc | Inhibitors of kras g12c mutant proteins |
| KR20180086187A (ko) | 2015-10-05 | 2018-07-30 | 더 트러스티이스 오브 콜롬비아 유니버시티 인 더 시티 오브 뉴욕 | 자가포식 유동의 활성체 및 포스포리파제 d 및 타우를 포함하는 단백질 응집물의 클리어런스 및 단백질질환의 치료 |
| EP3364977A4 (en) | 2015-10-19 | 2019-09-04 | Araxes Pharma LLC | PROCESS FOR SCREENING INHIBITORS OF RAS |
| EA038635B9 (ru) | 2015-11-16 | 2021-10-26 | Араксис Фарма Ллк | 2-замещенные соединения хиназолина, содержащие замещенную гетероциклическую группу, и способы их применения |
| US9988357B2 (en) | 2015-12-09 | 2018-06-05 | Araxes Pharma Llc | Methods for preparation of quinazoline derivatives |
| SMT202400141T1 (it) | 2015-12-17 | 2024-05-14 | Merck Patent Gmbh | 8-ciano-5-piperidino-chinoline come antagonisti di tlr7/8 e loro usi per trattamento di disturbi immunitari |
| US10822312B2 (en) | 2016-03-30 | 2020-11-03 | Araxes Pharma Llc | Substituted quinazoline compounds and methods of use |
| US10646488B2 (en) | 2016-07-13 | 2020-05-12 | Araxes Pharma Llc | Conjugates of cereblon binding compounds and G12C mutant KRAS, HRAS or NRAS protein modulating compounds and methods of use thereof |
| JP7125385B2 (ja) | 2016-08-08 | 2022-08-24 | メルク パテント ゲゼルシャフト ミット ベシュレンクテル ハフツング | Tlr7/8アンタゴニストおよびそれらの使用 |
| US10280172B2 (en) | 2016-09-29 | 2019-05-07 | Araxes Pharma Llc | Inhibitors of KRAS G12C mutant proteins |
| KR102688614B1 (ko) | 2016-09-30 | 2024-07-26 | 삼성전자주식회사 | 이미지 처리 방법 및 이를 지원하는 전자 장치 |
| JP2019534260A (ja) | 2016-10-07 | 2019-11-28 | アラクセス ファーマ エルエルシー | Rasの阻害剤としての複素環式化合物およびその使用方法 |
| ES2884073T3 (es) * | 2016-11-11 | 2021-12-10 | Bayer Animal Health Gmbh | Nuevos derivados antihelmínticos de quinolina-3-carboxamida |
| WO2018140514A1 (en) | 2017-01-26 | 2018-08-02 | Araxes Pharma Llc | 1-(6-(3-hydroxynaphthalen-1-yl)quinazolin-2-yl)azetidin-1-yl)prop-2-en-1-one derivatives and similar compounds as kras g12c inhibitors for the treatment of cancer |
| US11279689B2 (en) | 2017-01-26 | 2022-03-22 | Araxes Pharma Llc | 1-(3-(6-(3-hydroxynaphthalen-1-yl)benzofuran-2-yl)azetidin-1 yl)prop-2-en-1-one derivatives and similar compounds as KRAS G12C modulators for treating cancer |
| WO2018140600A1 (en) | 2017-01-26 | 2018-08-02 | Araxes Pharma Llc | Fused hetero-hetero bicyclic compounds and methods of use thereof |
| WO2018140512A1 (en) | 2017-01-26 | 2018-08-02 | Araxes Pharma Llc | Fused bicyclic benzoheteroaromatic compounds and methods of use thereof |
| WO2018140599A1 (en) | 2017-01-26 | 2018-08-02 | Araxes Pharma Llc | Benzothiophene and benzothiazole compounds and methods of use thereof |
| CN110869357A (zh) | 2017-05-25 | 2020-03-06 | 亚瑞克西斯制药公司 | 化合物及其用于治疗癌症的使用方法 |
| US11639346B2 (en) | 2017-05-25 | 2023-05-02 | Araxes Pharma Llc | Quinazoline derivatives as modulators of mutant KRAS, HRAS or NRAS |
| AU2018271990A1 (en) | 2017-05-25 | 2019-12-12 | Araxes Pharma Llc | Covalent inhibitors of KRAS |
| CA3068350A1 (en) | 2017-06-30 | 2019-01-03 | Bayer Animal Health Gmbh | New azaquinoline derivatives |
| EP3692037A1 (en) * | 2017-12-15 | 2020-08-12 | Bayer Animal Health GmbH | Process for preparing antihelmintic 4-amino-quinoline-3-carboxamide derivatives |
| KR20250073542A (ko) | 2018-03-09 | 2025-05-27 | 리커리엄 아이피 홀딩스, 엘엘씨 | 치환된 1,2-다이하이드로-3H-피라졸로[3,4-d]피리미딘-3-온 |
| US12134620B2 (en) | 2018-08-01 | 2024-11-05 | Araxes Pharma Llc | Heterocyclic spiro compounds and methods of use thereof for the treatment of cancer |
| CN117105933A (zh) | 2018-10-31 | 2023-11-24 | 吉利德科学公司 | 具有hpk1抑制活性的取代的6-氮杂苯并咪唑化合物 |
| CN113227089B (zh) | 2018-10-31 | 2024-07-05 | 吉利德科学公司 | 作为hpk1抑制剂的取代的6-氮杂苯并咪唑化合物 |
| MX2021005314A (es) * | 2018-11-09 | 2021-08-24 | Vivace Therapeutics Inc | Compuestos biciclicos. |
| AU2020257207A1 (en) | 2019-04-16 | 2021-11-25 | Vivace Therapeutics, Inc. | Bicyclic compounds |
| EP3972695A1 (en) | 2019-05-23 | 2022-03-30 | Gilead Sciences, Inc. | Substituted exo-methylene-oxindoles which are hpk1/map4k1 inhibitors |
| CN114008046B (zh) * | 2019-06-27 | 2023-08-18 | 南京明德新药研发有限公司 | 作为cdk9抑制剂的氮杂吲哚连吡唑类化合物 |
| CN115298172B (zh) * | 2020-03-27 | 2023-11-14 | 广东众生药业股份有限公司 | 一种作为smo抑制剂化合物的盐型、晶型及其制备方法 |
| US20230242511A1 (en) * | 2020-05-14 | 2023-08-03 | Glixogen Therapeutics Ltd. | Fused pyrazole and imidazole based compounds and use thereof as gli1 inhibitors |
| WO2021257863A1 (en) | 2020-06-19 | 2021-12-23 | Incyte Corporation | Pyrrolotriazine compounds as jak2 v617f inhibitors |
| US11691971B2 (en) | 2020-06-19 | 2023-07-04 | Incyte Corporation | Naphthyridinone compounds as JAK2 V617F inhibitors |
| US11767323B2 (en) | 2020-07-02 | 2023-09-26 | Incyte Corporation | Tricyclic pyridone compounds as JAK2 V617F inhibitors |
| HRP20250814T1 (hr) | 2020-07-02 | 2025-09-12 | Incyte Corporation | Spojevi tricikličke uree kao jak2 v617f inhibitori |
| US11661422B2 (en) | 2020-08-27 | 2023-05-30 | Incyte Corporation | Tricyclic urea compounds as JAK2 V617F inhibitors |
| WO2022140231A1 (en) | 2020-12-21 | 2022-06-30 | Incyte Corporation | Deazaguaine compounds as jak2 v617f inhibitors |
| CA3211748A1 (en) | 2021-02-25 | 2022-09-01 | Incyte Corporation | Spirocyclic lactams as jak2 v617f inhibitors |
| TW202317104A (zh) * | 2021-06-25 | 2023-05-01 | 美商賽迪拉治療股份有限公司 | Tead抑制劑及其用途 |
| IL315647A (en) | 2022-03-17 | 2024-11-01 | Incyte Corp | Tricyclic urea compounds as Jak2 and 617f inhibitors |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2007109154A2 (en) * | 2006-03-16 | 2007-09-27 | Renovis, Inc. | Bicycloheteroaryl compounds as p2x7 modulators and uses thereof |
| WO2007109192A2 (en) * | 2006-03-16 | 2007-09-27 | Renovis, Inc. | Bicycloheteroaryl compounds as p2x7 modulators and uses thereof |
| WO2007109172A2 (en) * | 2006-03-16 | 2007-09-27 | Renovis, Inc. | Bicycloheteroaryl compounds as p2x7 modulators and uses thereof |
| EA017262B1 (ru) * | 2004-09-02 | 2012-11-30 | Дженентек, Инк. | Соединения 2-(2-галоген-4-аминофенил)пиридиновых ингибиторов передачи сигналов белком hedgehog (варианты), способ их получения, композиция и способы лечения рака и ингибирований ангиогенеза и сигнального пути hedgehog в клетках на их основе |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH07173138A (ja) * | 1993-10-25 | 1995-07-11 | Kyowa Hakko Kogyo Co Ltd | キノリン誘導体 |
| NZ325248A (en) * | 1995-12-23 | 1999-09-29 | Pfizer Res & Dev | Quinoline and quinazoline compounds useful in therapy |
| GB9700504D0 (en) | 1997-01-11 | 1997-02-26 | Pfizer Ltd | Pharmaceutical compounds |
| DE19738615A1 (de) * | 1997-09-04 | 1999-03-11 | Clariant Gmbh | Neue Lichtschutzmittel auf Basis von sterisch gehinderten Aminen |
| DE10219037A1 (de) | 2002-04-29 | 2003-11-06 | Bayer Ag | Herstellung und Verwendung von Iminodibernsteinsäureammoniummetallsalzen |
| WO2004035549A1 (en) * | 2002-10-17 | 2004-04-29 | Amgen Inc. | Benzimidazole derivatives and their use as vanilloid receptor ligands |
| JP2005132834A (ja) | 2003-10-09 | 2005-05-26 | Kyowa Hakko Kogyo Co Ltd | キノリン誘導体 |
| ATE444068T1 (de) | 2004-01-23 | 2009-10-15 | Janssen Pharmaceutica Nv | Chinolinderivate und ihre verwendung als mycobakterielle inhibitoren |
| US20070054916A1 (en) * | 2004-10-01 | 2007-03-08 | Amgen Inc. | Aryl nitrogen-containing bicyclic compounds and methods of use |
| UA93548C2 (uk) | 2006-05-05 | 2011-02-25 | Айерем Елелсі | Сполуки та композиції як модулятори хеджхогівського сигнального шляху |
| WO2008012623A1 (en) * | 2006-07-25 | 2008-01-31 | Pfizer Products Inc. | Benzimidazolyl compounds as potentiators of mglur2 subtype of glutamate receptor |
| BRPI0808772A2 (pt) | 2007-03-14 | 2014-08-12 | Exelixis Inc | Inibidores da via de hedgehog |
| WO2010021381A1 (ja) | 2008-08-22 | 2010-02-25 | 武田薬品工業株式会社 | 縮合複素環誘導体およびその用途 |
| JP5555236B2 (ja) * | 2008-08-25 | 2014-07-23 | アイアールエム・リミテッド・ライアビリティ・カンパニー | ヘッジホッグ経路モジュレーター |
| EP2334683B1 (en) | 2008-08-29 | 2017-03-22 | MSD Italia S.r.l. | Saturated bicyclic heterocyclic derivatives as smo antagonists |
| GB0900484D0 (en) | 2009-01-13 | 2009-02-11 | Angeletti P Ist Richerche Bio | Therapeutic agent |
| WO2010144586A1 (en) * | 2009-06-09 | 2010-12-16 | Abraxis Bioscience, Llc | Isoquinoline, quinoline, and quinazoline derivatives as inhibitors of hedgehog signaling |
| AR077004A1 (es) * | 2009-06-09 | 2011-07-27 | Hoffmann La Roche | Compuestos heterociclicos antivirales |
| JP5739334B2 (ja) * | 2009-08-26 | 2015-06-24 | 武田薬品工業株式会社 | 縮合複素環誘導体およびその用途 |
| WO2011097491A1 (en) * | 2010-02-04 | 2011-08-11 | Glaxosmithkline Llc | Benzimidazole antiviral agents |
| TW201311149A (zh) | 2011-06-24 | 2013-03-16 | Ishihara Sangyo Kaisha | 有害生物防治劑 |
| CA2853923A1 (en) * | 2011-11-03 | 2013-05-10 | Merck Sharp & Dohme Corp. | Quinoline carboxamide and quinoline carbonitrile derivatives as mglur2-negative allosteric modulators, compositions, and their use |
| CN103588771B (zh) | 2013-01-15 | 2016-01-27 | 苏州云轩医药科技有限公司 | 具有刺猬通路拮抗剂活性的嘧啶类抗肿瘤化合物 |
| TW201446763A (zh) * | 2013-03-14 | 2014-12-16 | Abbvie Inc | 吡咯并[2,3-b]吡啶cdk9激酶抑制劑 |
-
2015
- 2015-03-16 JP JP2017501450A patent/JP6377245B2/ja active Active
- 2015-03-16 PE PE2016001704A patent/PE20170331A1/es unknown
- 2015-03-16 WO PCT/CN2015/074268 patent/WO2015144001A1/zh not_active Ceased
- 2015-03-16 MX MX2016012470A patent/MX370438B/es active IP Right Grant
- 2015-03-16 AU AU2015237050A patent/AU2015237050B2/en active Active
- 2015-03-16 BR BR112016021730-6A patent/BR112016021730B1/pt active IP Right Grant
- 2015-03-16 NZ NZ724691A patent/NZ724691A/en unknown
- 2015-03-16 US US15/128,064 patent/US9938292B2/en active Active
- 2015-03-16 KR KR1020167029472A patent/KR101910724B1/ko active Active
- 2015-03-16 CN CN201580015666.7A patent/CN106458974B/zh active Active
- 2015-03-16 RU RU2016141129A patent/RU2695815C9/ru active
- 2015-03-16 CA CA2943100A patent/CA2943100C/en active Active
- 2015-03-16 EP EP15768666.8A patent/EP3124482B1/en active Active
- 2015-03-16 SG SG11201607973XA patent/SG11201607973XA/en unknown
- 2015-03-20 TW TW104109029A patent/TW201623242A/zh unknown
-
2016
- 2016-09-22 IL IL247970A patent/IL247970A/en active IP Right Grant
- 2016-09-23 CL CL2016002394A patent/CL2016002394A1/es unknown
- 2016-10-24 EC ECIEPI201683602A patent/ECSP16083602A/es unknown
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA017262B1 (ru) * | 2004-09-02 | 2012-11-30 | Дженентек, Инк. | Соединения 2-(2-галоген-4-аминофенил)пиридиновых ингибиторов передачи сигналов белком hedgehog (варианты), способ их получения, композиция и способы лечения рака и ингибирований ангиогенеза и сигнального пути hedgehog в клетках на их основе |
| WO2007109154A2 (en) * | 2006-03-16 | 2007-09-27 | Renovis, Inc. | Bicycloheteroaryl compounds as p2x7 modulators and uses thereof |
| WO2007109192A2 (en) * | 2006-03-16 | 2007-09-27 | Renovis, Inc. | Bicycloheteroaryl compounds as p2x7 modulators and uses thereof |
| WO2007109172A2 (en) * | 2006-03-16 | 2007-09-27 | Renovis, Inc. | Bicycloheteroaryl compounds as p2x7 modulators and uses thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| ECSP16083602A (es) | 2017-01-31 |
| US20170174703A1 (en) | 2017-06-22 |
| KR101910724B1 (ko) | 2018-10-22 |
| MX2016012470A (es) | 2017-05-23 |
| US9938292B2 (en) | 2018-04-10 |
| MX370438B (es) | 2019-12-13 |
| JP2017509707A (ja) | 2017-04-06 |
| IL247970A (en) | 2017-07-31 |
| NZ724691A (en) | 2018-02-23 |
| JP6377245B2 (ja) | 2018-08-22 |
| EP3124482A4 (en) | 2017-03-22 |
| PE20170331A1 (es) | 2017-04-28 |
| RU2016141129A (ru) | 2018-04-28 |
| RU2016141129A3 (enExample) | 2018-04-28 |
| CA2943100A1 (en) | 2015-10-01 |
| EP3124482A1 (en) | 2017-02-01 |
| CL2016002394A1 (es) | 2018-05-04 |
| EP3124482B1 (en) | 2019-09-11 |
| AU2015237050A8 (en) | 2016-10-27 |
| KR20160127159A (ko) | 2016-11-02 |
| TW201623242A (zh) | 2016-07-01 |
| AU2015237050A1 (en) | 2016-10-20 |
| WO2015144001A1 (zh) | 2015-10-01 |
| BR112016021730B1 (pt) | 2022-09-06 |
| BR112016021730A2 (enExample) | 2017-08-15 |
| CN106458974A (zh) | 2017-02-22 |
| CN106458974B (zh) | 2019-07-16 |
| RU2695815C2 (ru) | 2019-07-29 |
| AU2015237050B2 (en) | 2019-05-09 |
| SG11201607973XA (en) | 2016-11-29 |
| IL247970A0 (en) | 2016-12-01 |
| CA2943100C (en) | 2017-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2695815C9 (ru) | Хинолиновые производные в качестве ингибиторов smo | |
| US12410193B2 (en) | Bicyclic heterocyclyl derivatives as IRAK4 inhibitors | |
| AU2020214404B2 (en) | Immunomodulators, compositions and methods thereof | |
| JP6173327B2 (ja) | イミダゾピリダジン化合物 | |
| CN104945377A (zh) | 作为smo抑制剂的喹啉衍生物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| TH4A | Reissue of patent specification |