RU2080322C1 - Производные полициклического гуанина - Google Patents
Производные полициклического гуанина Download PDFInfo
- Publication number
- RU2080322C1 RU2080322C1 RU9192016466A RU92016466A RU2080322C1 RU 2080322 C1 RU2080322 C1 RU 2080322C1 RU 9192016466 A RU9192016466 A RU 9192016466A RU 92016466 A RU92016466 A RU 92016466A RU 2080322 C1 RU2080322 C1 RU 2080322C1
- Authority
- RU
- Russia
- Prior art keywords
- phenylmethyl
- purin
- methyl
- imidazo
- dimethyl
- Prior art date
Links
- -1 Polycyclic guanine derivatives Chemical class 0.000 title claims abstract description 57
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 25
- 239000001257 hydrogen Substances 0.000 claims abstract description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 10
- 229910052717 sulfur Chemical group 0.000 claims abstract description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 9
- 150000002367 halogens Chemical class 0.000 claims abstract description 9
- 239000011593 sulfur Chemical group 0.000 claims abstract description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 8
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 8
- 239000001301 oxygen Substances 0.000 claims abstract description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 150000003254 radicals Chemical class 0.000 claims description 7
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 239000013589 supplement Substances 0.000 claims description 2
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 claims 1
- 230000000295 complement effect Effects 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 abstract description 22
- 239000003795 chemical substances by application Substances 0.000 abstract description 9
- 125000001072 heteroaryl group Chemical group 0.000 abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 abstract description 8
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract description 7
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 7
- 125000004663 dialkyl amino group Chemical group 0.000 abstract description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 6
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 5
- 239000000126 substance Substances 0.000 abstract description 5
- 230000000694 effects Effects 0.000 abstract description 4
- 125000001424 substituent group Chemical group 0.000 abstract description 4
- 125000003342 alkenyl group Chemical group 0.000 abstract description 3
- 125000004430 oxygen atom Chemical group O* 0.000 abstract description 3
- 125000003367 polycyclic group Chemical group 0.000 abstract description 3
- 230000004648 relaxation of smooth muscle Effects 0.000 abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract description 3
- 125000000304 alkynyl group Chemical group 0.000 abstract description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract description 2
- 239000003814 drug Substances 0.000 abstract description 2
- 230000002401 inhibitory effect Effects 0.000 abstract description 2
- WJSVJNDMOQTICG-UHFFFAOYSA-N 2-amino-1-[(2-methyl-4-methylidene-5-oxooxolan-2-yl)methyl]-7h-purin-6-one Chemical compound NC1=NC=2N=CNC=2C(=O)N1CC1(C)CC(=C)C(=O)O1 WJSVJNDMOQTICG-UHFFFAOYSA-N 0.000 abstract 1
- 206010021118 Hypotonia Diseases 0.000 abstract 1
- 238000004519 manufacturing process Methods 0.000 abstract 1
- 230000036640 muscle relaxation Effects 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 193
- 239000007787 solid Substances 0.000 description 125
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 81
- 239000000460 chlorine Substances 0.000 description 75
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 53
- 238000010265 fast atom bombardment Methods 0.000 description 48
- 239000000203 mixture Substances 0.000 description 45
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 43
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 40
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- 239000011541 reaction mixture Substances 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 25
- 239000000243 solution Substances 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- 238000002844 melting Methods 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- 239000006260 foam Substances 0.000 description 18
- 238000000034 method Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000003480 eluent Substances 0.000 description 15
- 235000011121 sodium hydroxide Nutrition 0.000 description 14
- LMKPHJYTFHAGHK-UHFFFAOYSA-N cyclodrine Chemical compound C1CCCC1(O)C(C(=O)OCCN(CC)CC)C1=CC=CC=C1 LMKPHJYTFHAGHK-UHFFFAOYSA-N 0.000 description 13
- 239000012044 organic layer Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 150000001414 amino alcohols Chemical class 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- 0 CC(c1c(C(C2*I)=*)[n](*)c(*)c1)C2=C Chemical compound CC(c1c(C(C2*I)=*)[n](*)c(*)c1)C2=C 0.000 description 9
- 102000004190 Enzymes Human genes 0.000 description 9
- 108090000790 Enzymes Proteins 0.000 description 9
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 9
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 9
- 239000003153 chemical reaction reagent Substances 0.000 description 9
- 230000005764 inhibitory process Effects 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- 235000019198 oils Nutrition 0.000 description 8
- OSXKHFTZRHDUJN-UHFFFAOYSA-N N(2),3-ethenoguanine Chemical compound O=C1NC2=NC=CN2C2=C1NC=N2 OSXKHFTZRHDUJN-UHFFFAOYSA-N 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 238000003818 flash chromatography Methods 0.000 description 7
- 239000000377 silicon dioxide Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 230000036772 blood pressure Effects 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 238000010828 elution Methods 0.000 description 6
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 150000003230 pyrimidines Chemical class 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- JFFOUICIRBXFRC-RFZPGFLSSA-N (1r,2r)-2-aminocyclopentan-1-ol Chemical compound N[C@@H]1CCC[C@H]1O JFFOUICIRBXFRC-RFZPGFLSSA-N 0.000 description 5
- 239000012267 brine Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- OCXGTPDKNBIOTF-UHFFFAOYSA-N dibromo(triphenyl)-$l^{5}-phosphane Chemical compound C=1C=CC=CC=1P(Br)(C=1C=CC=CC=1)(Br)C1=CC=CC=C1 OCXGTPDKNBIOTF-UHFFFAOYSA-N 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 5
- 230000008719 thickening Effects 0.000 description 5
- 241000283690 Bos taurus Species 0.000 description 4
- 206010006482 Bronchospasm Diseases 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 229920002261 Corn starch Polymers 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 206010020772 Hypertension Diseases 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000007885 bronchoconstriction Effects 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 239000008120 corn starch Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000008187 granular material Substances 0.000 description 4
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 238000004811 liquid chromatography Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- ZGLYVAGJXIRECZ-UHFFFAOYSA-N 1,7-dibenzyl-2-chloropurin-6-one Chemical compound C1=2C(=O)N(CC=3C=CC=CC=3)C(Cl)=NC=2N=CN1CC1=CC=CC=C1 ZGLYVAGJXIRECZ-UHFFFAOYSA-N 0.000 description 3
- IAUXHRVJAVWRKD-HUUCEWRRSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]-1,8-dimethylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(C)=NC=2N=C1N[C@@H]1CCC[C@H]1O IAUXHRVJAVWRKD-HUUCEWRRSA-N 0.000 description 3
- UAXKLFOSJJRTTP-UHFFFAOYSA-N 7-benzyl-2-chloro-1,8-dimethylpurin-6-one Chemical compound CC1=NC=2N=C(Cl)N(C)C(=O)C=2N1CC1=CC=CC=C1 UAXKLFOSJJRTTP-UHFFFAOYSA-N 0.000 description 3
- FHJHVHCVYRREAY-UHFFFAOYSA-N 7-benzyl-2-chloro-1-methylpurin-6-one Chemical compound C1=2C(=O)N(C)C(Cl)=NC=2N=CN1CC1=CC=CC=C1 FHJHVHCVYRREAY-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 230000005526 G1 to G0 transition Effects 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 239000001506 calcium phosphate Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002837 carbocyclic group Chemical group 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000010849 ion bombardment Methods 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 150000003212 purines Chemical class 0.000 description 3
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 3
- 125000003003 spiro group Chemical group 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- MDJOUBKGOCDAAP-NHCUHLMSSA-N 1,7-dibenzyl-2-[[(1r,2r)-2-hydroxycyclohexyl]amino]purin-6-one Chemical compound O[C@@H]1CCCC[C@H]1NC(N(C1=O)CC=2C=CC=CC=2)=NC2=C1N(CC=1C=CC=CC=1)C=N2 MDJOUBKGOCDAAP-NHCUHLMSSA-N 0.000 description 2
- UYYWPCLRSSPZHM-UHFFFAOYSA-N 1,7-dibenzyl-3h-purine-2,6-dione Chemical compound C1=2C(=O)N(CC=3C=CC=CC=3)C(=O)NC=2N=CN1CC1=CC=CC=C1 UYYWPCLRSSPZHM-UHFFFAOYSA-N 0.000 description 2
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- RMFWVOLULURGJI-UHFFFAOYSA-N 2,6-dichloro-7h-purine Chemical class ClC1=NC(Cl)=C2NC=NC2=N1 RMFWVOLULURGJI-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- MCOUPKWEDYTSHY-UHFFFAOYSA-N 2-bromo-7-cyclopentyl-1-methylpurin-6-one Chemical compound C1=2C(=O)N(C)C(Br)=NC=2N=CN1C1CCCC1 MCOUPKWEDYTSHY-UHFFFAOYSA-N 0.000 description 2
- UVXZZIOIPMBVCG-UHFFFAOYSA-N 2-bromo-7-cyclopentyl-3h-purin-6-one Chemical compound C1=2C(=O)NC(Br)=NC=2N=CN1C1CCCC1 UVXZZIOIPMBVCG-UHFFFAOYSA-N 0.000 description 2
- XWLDBUWSUISBKX-UHFFFAOYSA-N 2-bromo-9-cyclopentyl-1-methylpurin-6-one Chemical compound C1=NC=2C(=O)N(C)C(Br)=NC=2N1C1CCCC1 XWLDBUWSUISBKX-UHFFFAOYSA-N 0.000 description 2
- XKVATRYEPITAPH-UHFFFAOYSA-N 2-chloro-6-phenylmethoxy-7h-purine Chemical compound C=12NC=NC2=NC(Cl)=NC=1OCC1=CC=CC=C1 XKVATRYEPITAPH-UHFFFAOYSA-N 0.000 description 2
- YGLUIFSARZOYNS-UHFFFAOYSA-N 2-chloro-7-cyclopentyl-1-methylpurin-6-one Chemical compound C1=2C(=O)N(C)C(Cl)=NC=2N=CN1C1CCCC1 YGLUIFSARZOYNS-UHFFFAOYSA-N 0.000 description 2
- GNUQTXZOZWTAAE-UHFFFAOYSA-N 2-chloro-7-cyclopentyl-3h-purin-6-one Chemical compound C1=2C(=O)NC(Cl)=NC=2N=CN1C1CCCC1 GNUQTXZOZWTAAE-UHFFFAOYSA-N 0.000 description 2
- FBDVCEJREATIMN-UHFFFAOYSA-N 2-chloro-7-cyclopentyl-6-phenylmethoxypurine Chemical compound C=12N(C3CCCC3)C=NC2=NC(Cl)=NC=1OCC1=CC=CC=C1 FBDVCEJREATIMN-UHFFFAOYSA-N 0.000 description 2
- JBMBVWROWJGFMG-UHFFFAOYSA-N 2-chloro-7h-purine Chemical compound ClC1=NC=C2NC=NC2=N1 JBMBVWROWJGFMG-UHFFFAOYSA-N 0.000 description 2
- POXQKFWAIFQDFD-UHFFFAOYSA-N 2-chloro-9-cyclopentyl-1-methylpurin-6-one Chemical compound C1=NC=2C(=O)N(C)C(Cl)=NC=2N1C1CCCC1 POXQKFWAIFQDFD-UHFFFAOYSA-N 0.000 description 2
- YZOGBMRPJDMCHI-UHFFFAOYSA-N 2-chloro-9-cyclopentyl-6-phenylmethoxypurine Chemical compound C=12N=CN(C3CCCC3)C2=NC(Cl)=NC=1OCC1=CC=CC=C1 YZOGBMRPJDMCHI-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- JCGJSBVUVFPNHB-UHFFFAOYSA-N 6-amino-3-benzyl-1h-pyrimidine-2,4-dione Chemical compound O=C1NC(N)=CC(=O)N1CC1=CC=CC=C1 JCGJSBVUVFPNHB-UHFFFAOYSA-N 0.000 description 2
- PQEMRBOCMOMAOD-UHFFFAOYSA-N 6-amino-3-benzyl-2-methylsulfanylpyrimidin-4-one Chemical compound CSC1=NC(N)=CC(=O)N1CC1=CC=CC=C1 PQEMRBOCMOMAOD-UHFFFAOYSA-N 0.000 description 2
- KIGTUIJWPWWRSK-UHFFFAOYSA-N 6-amino-3-benzyl-5-nitroso-1h-pyrimidine-2,4-dione Chemical compound O=C1C(N=O)=C(N)NC(=O)N1CC1=CC=CC=C1 KIGTUIJWPWWRSK-UHFFFAOYSA-N 0.000 description 2
- NZJRDZMLYKCMGH-UHFFFAOYSA-N 6-amino-5-(benzylamino)-3-methyl-1h-pyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)NC(N)=C1NCC1=CC=CC=C1 NZJRDZMLYKCMGH-UHFFFAOYSA-N 0.000 description 2
- PWIHKINZXMRHDS-UHFFFAOYSA-N 6-amino-5-(benzylideneamino)-3-methyl-1h-pyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)NC(N)=C1N=CC1=CC=CC=C1 PWIHKINZXMRHDS-UHFFFAOYSA-N 0.000 description 2
- LEOWVIMYMRWTBO-UHFFFAOYSA-N 7-benzyl-1-methyl-3h-purine-2,6-dione Chemical compound C1=2C(=O)N(C)C(=O)NC=2N=CN1CC1=CC=CC=C1 LEOWVIMYMRWTBO-UHFFFAOYSA-N 0.000 description 2
- IRIIHHWMSBCKBJ-UHFFFAOYSA-N 7-benzyl-2-(2-hydroxyethylamino)-1-methylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NCCO)=NC=2N=CN1CC1=CC=CC=C1 IRIIHHWMSBCKBJ-UHFFFAOYSA-N 0.000 description 2
- PVMARSAXOSBRGR-UHFFFAOYSA-N 7-benzyl-2-(3-hydroxypropylamino)-1-methylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NCCCO)=NC=2N=CN1CC1=CC=CC=C1 PVMARSAXOSBRGR-UHFFFAOYSA-N 0.000 description 2
- CHFDUKMLRPBNBU-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxy-3-methylbutan-2-yl)amino]-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(CO)C(C)C)=NC=2N=C(C)N1CC1=CC=CC=C1 CHFDUKMLRPBNBU-UHFFFAOYSA-N 0.000 description 2
- PFDCDRFHQHEOJX-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxycyclohexyl)methylamino]-1,8-dimethylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(C)=NC=2N=C1NCC1(O)CCCCC1 PFDCDRFHQHEOJX-UHFFFAOYSA-N 0.000 description 2
- ZHICPOAESCLGFT-UHFFFAOYSA-N 7-benzyl-2-[(2-hydroxy-2-phenylethyl)amino]-1-methylpurin-6-one Chemical compound N=1C=2N=CN(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1NCC(O)C1=CC=CC=C1 ZHICPOAESCLGFT-UHFFFAOYSA-N 0.000 description 2
- QXRMMAHQXRZYIE-KRWDZBQOSA-N 7-benzyl-2-[[(1r)-1-cyclohexyl-2-hydroxyethyl]amino]-1-methylpurin-6-one Chemical compound C1([C@H](CO)NC=2N(C(C=3N(CC=4C=CC=CC=4)C=NC=3N=2)=O)C)CCCCC1 QXRMMAHQXRZYIE-KRWDZBQOSA-N 0.000 description 2
- IUUYXAKEMTXQDS-IAGOWNOFSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycycloheptyl]amino]-1,8-dimethylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(C)=NC=2N=C1N[C@@H]1CCCCC[C@H]1O IUUYXAKEMTXQDS-IAGOWNOFSA-N 0.000 description 2
- NGKVKUBCLSIIAG-HZPDHXFCSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycyclohexyl]amino]-1,8-dimethylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(C)=NC=2N=C1N[C@@H]1CCCC[C@H]1O NGKVKUBCLSIIAG-HZPDHXFCSA-N 0.000 description 2
- FRFPQYSCLHJBDL-WOJBJXKFSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycyclohexyl]amino]-1-methyl-8-phenylpurin-6-one Chemical compound N=1C=2N=C(C=3C=CC=CC=3)N(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1N[C@@H]1CCCC[C@H]1O FRFPQYSCLHJBDL-WOJBJXKFSA-N 0.000 description 2
- RFIXRMIWEGKHJJ-HUUCEWRRSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycyclohexyl]amino]-1-methylpurin-6-one Chemical compound N=1C=2N=CN(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1N[C@@H]1CCCC[C@H]1O RFIXRMIWEGKHJJ-HUUCEWRRSA-N 0.000 description 2
- WGGDZPFLNXLEQM-RTBURBONSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]-1-methyl-8-phenylpurin-6-one Chemical compound N=1C=2N=C(C=3C=CC=CC=3)N(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1N[C@@H]1CCC[C@H]1O WGGDZPFLNXLEQM-RTBURBONSA-N 0.000 description 2
- QVHIYBNFQOCEEJ-ZIAGYGMSSA-N 7-benzyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]-1-methylpurin-6-one Chemical compound N=1C=2N=CN(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1N[C@@H]1CCC[C@H]1O QVHIYBNFQOCEEJ-ZIAGYGMSSA-N 0.000 description 2
- QXRMMAHQXRZYIE-QGZVFWFLSA-N 7-benzyl-2-[[(1s)-1-cyclohexyl-2-hydroxyethyl]amino]-1-methylpurin-6-one Chemical compound C1([C@@H](CO)NC=2N(C(C=3N(CC=4C=CC=CC=4)C=NC=3N=2)=O)C)CCCCC1 QXRMMAHQXRZYIE-QGZVFWFLSA-N 0.000 description 2
- OMRVEOLLWDSMBW-UHFFFAOYSA-N 7-benzyl-2-[[1-(hydroxymethyl)cyclopentyl]amino]-1,8-dimethylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(C)=NC=2N=C1NC1(CO)CCCC1 OMRVEOLLWDSMBW-UHFFFAOYSA-N 0.000 description 2
- SHHLXAJKURCJTL-UHFFFAOYSA-N 7-benzyl-2-[[1-(hydroxymethyl)cyclopentyl]amino]-1-methylpurin-6-one Chemical compound N=1C=2N=CN(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1NC1(CO)CCCC1 SHHLXAJKURCJTL-UHFFFAOYSA-N 0.000 description 2
- RLHVYMXDWYQWIH-HZPDHXFCSA-N 7-benzyl-8-ethyl-2-[[(1r,2r)-2-hydroxycyclohexyl]amino]-1-methylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(CC)=NC=2N=C1N[C@@H]1CCCC[C@H]1O RLHVYMXDWYQWIH-HZPDHXFCSA-N 0.000 description 2
- PWAILLQKNFIVFQ-HUUCEWRRSA-N 7-benzyl-8-ethyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]-1-methylpurin-6-one Chemical compound CN1C(=O)C=2N(CC=3C=CC=CC=3)C(CC)=NC=2N=C1N[C@@H]1CCC[C@H]1O PWAILLQKNFIVFQ-HUUCEWRRSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 102000000584 Calmodulin Human genes 0.000 description 2
- 108010041952 Calmodulin Proteins 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 208000024172 Cardiovascular disease Diseases 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- NYHBQMYGNKIUIF-UUOKFMHZSA-N Guanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O NYHBQMYGNKIUIF-UUOKFMHZSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 208000019693 Lung disease Diseases 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000005119 centrifugation Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- HRSAARHNOLAWSU-RQJHMYQMSA-N cis-5,6a,7,8,9,9a-hexahydro-5-methylcyclopenta[4,5]imidazo[2,1-b]purin-4(3h)-one Chemical compound N12C=3N=CNC=3C(=O)N(C)C2=N[C@H]2[C@@H]1CCC2 HRSAARHNOLAWSU-RQJHMYQMSA-N 0.000 description 2
- TVZPLCNGKSPOJA-UHFFFAOYSA-N copper zinc Chemical compound [Cu].[Zn] TVZPLCNGKSPOJA-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- ZOOGRGPOEVQQDX-KHLHZJAASA-N cyclic guanosine monophosphate Chemical compound C([C@H]1O2)O[P@](O)(=O)O[C@@H]1[C@H](O)[C@H]2N1C(N=C(NC2=O)N)=C2N=C1 ZOOGRGPOEVQQDX-KHLHZJAASA-N 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000002526 effect on cardiovascular system Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- CPSFDQWYYRRZAA-UHFFFAOYSA-N methyl 2-hydroxy-1-methylcyclopentane-1-carboxylate Chemical compound COC(=O)C1(C)CCCC1O CPSFDQWYYRRZAA-UHFFFAOYSA-N 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229940083542 sodium Drugs 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- PQMCFTMVQORYJC-PHDIDXHHSA-N (1r,2r)-2-aminocyclohexan-1-ol Chemical compound N[C@@H]1CCCC[C@H]1O PQMCFTMVQORYJC-PHDIDXHHSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- 125000004530 1,2,4-triazinyl group Chemical group N1=NC(=NC=C1)* 0.000 description 1
- QZWYVZQSZWFLPS-WOJBJXKFSA-N 1,7-dibenzyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]purin-6-one Chemical compound O[C@@H]1CCC[C@H]1NC(N(C1=O)CC=2C=CC=CC=2)=NC2=C1N(CC=1C=CC=CC=1)C=N2 QZWYVZQSZWFLPS-WOJBJXKFSA-N 0.000 description 1
- HWRCMZYRECJYAD-UHFFFAOYSA-N 1-benzyl-5-(benzylideneamino)-2h-pyrimidin-4-amine Chemical compound C1=C(N=CC=2C=CC=CC=2)C(N)=NCN1CC1=CC=CC=C1 HWRCMZYRECJYAD-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- HCSNLBURYKRATD-UHFFFAOYSA-N 1-nitrocyclopentene Chemical compound [O-][N+](=O)C1=CCCC1 HCSNLBURYKRATD-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 1
- ODGUJNOUOLYPOD-UHFFFAOYSA-N 2-(2-iodoethyl)-1,3-dioxane Chemical compound ICCC1OCCCO1 ODGUJNOUOLYPOD-UHFFFAOYSA-N 0.000 description 1
- RUHJZSZTSCSTCC-UHFFFAOYSA-N 2-(bromomethyl)naphthalene Chemical compound C1=CC=CC2=CC(CBr)=CC=C21 RUHJZSZTSCSTCC-UHFFFAOYSA-N 0.000 description 1
- YDAGLPIQWWSUJT-UHFFFAOYSA-N 2-(trifluoromethyl)-7h-purine Chemical compound FC(F)(F)C1=NC=C2NC=NC2=N1 YDAGLPIQWWSUJT-UHFFFAOYSA-N 0.000 description 1
- RRACLKFEAUDXRW-UHFFFAOYSA-N 2-[2-(2-nitrocyclopentyl)ethyl]-1,3-dioxane Chemical compound [O-][N+](=O)C1CCCC1CCC1OCCCO1 RRACLKFEAUDXRW-UHFFFAOYSA-N 0.000 description 1
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- CXTIHRQTCGOZRS-UHFFFAOYSA-N 2-hydroxy-1-methylcyclopentane-1-carboxylic acid Chemical compound OC(=O)C1(C)CCCC1O CXTIHRQTCGOZRS-UHFFFAOYSA-N 0.000 description 1
- 125000006026 2-methyl-1-butenyl group Chemical group 0.000 description 1
- MSBCQYAVXXTTSR-UHFFFAOYSA-N 2-nitro-2,3,4,5,6,6a-hexahydro-1h-pentalen-3a-ol Chemical compound C1CCC2CC([N+]([O-])=O)CC21O MSBCQYAVXXTTSR-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- APIXJSLKIYYUKG-UHFFFAOYSA-N 3 Isobutyl 1 methylxanthine Chemical compound O=C1N(C)C(=O)N(CC(C)C)C2=C1N=CN2 APIXJSLKIYYUKG-UHFFFAOYSA-N 0.000 description 1
- WRIUADNGMJXJRO-UHFFFAOYSA-N 3-benzyl-5,7,7-trimethyl-2-(trifluoromethyl)-8h-imidazo[2,1-b]purin-4-one Chemical compound C1=2C(=O)N(C)C3=NC(C)(C)CN3C=2N=C(C(F)(F)F)N1CC1=CC=CC=C1 WRIUADNGMJXJRO-UHFFFAOYSA-N 0.000 description 1
- WFJGMVOWVZKNLA-UHFFFAOYSA-N 3-benzyl-5-methyl-7,8-dihydroimidazo[2,1-b]purin-4-one Chemical compound C1=2C(=O)N(C)C3=NCCN3C=2N=CN1CC1=CC=CC=C1 WFJGMVOWVZKNLA-UHFFFAOYSA-N 0.000 description 1
- PNWOWTKHERLXTQ-UHFFFAOYSA-N 3-benzyl-5-methyl-8-phenyl-7,8-dihydroimidazo[2,1-b]purin-4-one Chemical compound C1=2C(=O)N(C)C3=NCC(C=4C=CC=CC=4)N3C=2N=CN1CC1=CC=CC=C1 PNWOWTKHERLXTQ-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- WZIYCIBURCPKAR-UHFFFAOYSA-N 4-(chloromethyl)pyridine Chemical compound ClCC1=CC=NC=C1 WZIYCIBURCPKAR-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- VMYIZJTYOYPOCT-UHFFFAOYSA-N 5-benzyl-4,8,11-trimethyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one Chemical compound C1=2C(=O)N(C)C3=NC4(C)CCCC4N3C=2N=C(C)N1CC1=CC=CC=C1 VMYIZJTYOYPOCT-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- PXYQQKWEFDEUIX-UHFFFAOYSA-N 6-amino-2-methylsulfanyl-1h-pyrimidin-4-one Chemical compound CSC1=NC(N)=CC(O)=N1 PXYQQKWEFDEUIX-UHFFFAOYSA-N 0.000 description 1
- XQJDPVONNZMWDC-UHFFFAOYSA-N 6-amino-3-benzyl-5-(benzylamino)-1h-pyrimidine-2,4-dione Chemical compound O=C1C(NCC=2C=CC=CC=2)=C(N)NC(=O)N1CC1=CC=CC=C1 XQJDPVONNZMWDC-UHFFFAOYSA-N 0.000 description 1
- YLIMXOKIGYGTOG-UHFFFAOYSA-N 6-amino-3-benzyl-5-(benzylideneamino)-1h-pyrimidine-2,4-dione Chemical compound O=C1C(N=CC=2C=CC=CC=2)=C(N)NC(=O)N1CC1=CC=CC=C1 YLIMXOKIGYGTOG-UHFFFAOYSA-N 0.000 description 1
- GUDXLMQIDACJSU-UHFFFAOYSA-N 6-amino-3-methyl-5-nitroso-1h-pyrimidine-2,4-dione Chemical compound CN1C(=O)NC(N)=C(N=O)C1=O GUDXLMQIDACJSU-UHFFFAOYSA-N 0.000 description 1
- VJPRHEVEJODDQX-UHFFFAOYSA-N 7-benzyl-1,8-dimethylpurin-6-one Chemical compound Cc1nc2ncn(C)c(=O)c2n1Cc1ccccc1 VJPRHEVEJODDQX-UHFFFAOYSA-N 0.000 description 1
- KRRJMJUVHMYZMY-UHFFFAOYSA-N 7-benzyl-1-methyl-8-(trifluoromethyl)-3h-purine-2,6-dione Chemical compound C1=2C(=O)N(C)C(=O)NC=2N=C(C(F)(F)F)N1CC1=CC=CC=C1 KRRJMJUVHMYZMY-UHFFFAOYSA-N 0.000 description 1
- UIJRKWWKHCKTTH-UHFFFAOYSA-N 7-benzyl-1-methyl-8-phenyl-3h-purine-2,6-dione Chemical compound C=1C=CC=CC=1CN1C=2C(=O)N(C)C(=O)NC=2N=C1C1=CC=CC=C1 UIJRKWWKHCKTTH-UHFFFAOYSA-N 0.000 description 1
- FNQDMLMIRYCTNP-UHFFFAOYSA-N 7-benzyl-2-(1-hydroxybutan-2-ylamino)-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(CO)CC)=NC=2N=C(C)N1CC1=CC=CC=C1 FNQDMLMIRYCTNP-UHFFFAOYSA-N 0.000 description 1
- OALQJDFCMGSZHF-UHFFFAOYSA-N 7-benzyl-2-(1-hydroxypentan-2-ylamino)-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(CO)CCC)=NC=2N=C(C)N1CC1=CC=CC=C1 OALQJDFCMGSZHF-UHFFFAOYSA-N 0.000 description 1
- QNPOMAQUFIZCIF-UHFFFAOYSA-N 7-benzyl-2-(1-hydroxypropan-2-ylamino)-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(CO)C)=NC=2N=C(C)N1CC1=CC=CC=C1 QNPOMAQUFIZCIF-UHFFFAOYSA-N 0.000 description 1
- LQYZVRFGUFRNJC-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxy-2-methylpropan-2-yl)amino]-1,8-dimethylpurin-6-one Chemical compound CC1=NC=2N=C(NC(C)(C)CO)N(C)C(=O)C=2N1CC1=CC=CC=C1 LQYZVRFGUFRNJC-UHFFFAOYSA-N 0.000 description 1
- XBURGHLKFSPYKX-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxy-2-methylpropan-2-yl)amino]-1-methyl-8-(trifluoromethyl)purin-6-one Chemical compound C1=2C(=O)N(C)C(NC(C)(C)CO)=NC=2N=C(C(F)(F)F)N1CC1=CC=CC=C1 XBURGHLKFSPYKX-UHFFFAOYSA-N 0.000 description 1
- TXJUAFANTTZHGS-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxy-3-methylpentan-2-yl)amino]-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(CO)C(C)CC)=NC=2N=C(C)N1CC1=CC=CC=C1 TXJUAFANTTZHGS-UHFFFAOYSA-N 0.000 description 1
- NPXWMKMMGKEZBS-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxy-4-methylpentan-2-yl)amino]-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(CO)CC(C)C)=NC=2N=C(C)N1CC1=CC=CC=C1 NPXWMKMMGKEZBS-UHFFFAOYSA-N 0.000 description 1
- PFCQIAWNCYGCLA-UHFFFAOYSA-N 7-benzyl-2-[(1-hydroxycyclohexyl)methylamino]-1-methylpurin-6-one Chemical compound N=1C=2N=CN(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1NCC1(O)CCCCC1 PFCQIAWNCYGCLA-UHFFFAOYSA-N 0.000 description 1
- NRRCSVSMJBVHNN-UHFFFAOYSA-N 7-benzyl-2-[(3-hydroxy-2-methylbutan-2-yl)amino]-1,8-dimethylpurin-6-one Chemical compound C1=2C(=O)N(C)C(NC(C)(C)C(O)C)=NC=2N=C(C)N1CC1=CC=CC=C1 NRRCSVSMJBVHNN-UHFFFAOYSA-N 0.000 description 1
- NGKVKUBCLSIIAG-HOTGVXAUSA-N 7-benzyl-2-[[(1S,2S)-2-hydroxycyclohexyl]amino]-1,8-dimethylpurin-6-one Chemical compound O[C@@H]1[C@H](CCCC1)NC=1N(C(C=2N(C(=NC=2N=1)C)CC1=CC=CC=C1)=O)C NGKVKUBCLSIIAG-HOTGVXAUSA-N 0.000 description 1
- PEOLYHHSLYJVBY-SFHVURJKSA-N 7-benzyl-2-[[(1r)-2-hydroxy-1-phenylethyl]amino]-1,8-dimethylpurin-6-one Chemical compound C1([C@H](CO)NC2=NC=3N=C(N(C=3C(=O)N2C)CC=2C=CC=CC=2)C)=CC=CC=C1 PEOLYHHSLYJVBY-SFHVURJKSA-N 0.000 description 1
- OCCBDZYBMNMEPX-LJQANCHMSA-N 7-benzyl-2-[[(2r)-1-hydroxy-3-phenylpropan-2-yl]amino]-1,8-dimethylpurin-6-one Chemical compound C([C@H](CO)NC1=NC=2N=C(N(C=2C(=O)N1C)CC=1C=CC=CC=1)C)C1=CC=CC=C1 OCCBDZYBMNMEPX-LJQANCHMSA-N 0.000 description 1
- KLUSAUDITKSLDT-UHFFFAOYSA-N 7-benzyl-2-[[1-(hydroxymethyl)cyclopentyl]amino]-1-methyl-8-(trifluoromethyl)purin-6-one Chemical compound N=1C=2N=C(C(F)(F)F)N(CC=3C=CC=CC=3)C=2C(=O)N(C)C=1NC1(CO)CCCC1 KLUSAUDITKSLDT-UHFFFAOYSA-N 0.000 description 1
- FNOMXNLYLZGYPI-UHFFFAOYSA-N 7-benzyl-2-chloro-1-methyl-8-(trifluoromethyl)purin-6-one Chemical compound C1=2C(=O)N(C)C(Cl)=NC=2N=C(C(F)(F)F)N1CC1=CC=CC=C1 FNOMXNLYLZGYPI-UHFFFAOYSA-N 0.000 description 1
- SLQOSNDVOWQGTM-UHFFFAOYSA-N 7-benzyl-2-chloro-1-methyl-8-phenylpurin-6-one Chemical compound C=1C=CC=CC=1CN1C=2C(=O)N(C)C(Cl)=NC=2N=C1C1=CC=CC=C1 SLQOSNDVOWQGTM-UHFFFAOYSA-N 0.000 description 1
- RGWGQVRSJYOWOC-UHFFFAOYSA-N 7-benzyl-2-chloro-8-ethyl-1-methylpurin-6-one Chemical compound CCC1=NC=2N=C(Cl)N(C)C(=O)C=2N1CC1=CC=CC=C1 RGWGQVRSJYOWOC-UHFFFAOYSA-N 0.000 description 1
- VEFRYVFUSFTJDJ-UHFFFAOYSA-N 7-benzyl-8-ethyl-1-methyl-3h-purine-2,6-dione Chemical compound CCC1=NC=2NC(=O)N(C)C(=O)C=2N1CC1=CC=CC=C1 VEFRYVFUSFTJDJ-UHFFFAOYSA-N 0.000 description 1
- CSBTVDMIZFFDBE-VXGBXAGGSA-N 7-cyclopentyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]-1-methylpurin-6-one Chemical compound N=1C=2N=CN(C3CCCC3)C=2C(=O)N(C)C=1N[C@@H]1CCC[C@H]1O CSBTVDMIZFFDBE-VXGBXAGGSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- SGIFYRBCMYTLMQ-UHFFFAOYSA-N 8a-nitro-2,3,4,4a,5,6,7,8-octahydro-1h-naphthalen-1-ol;hydrochloride Chemical compound Cl.C1CCCC2([N+]([O-])=O)C(O)CCCC21 SGIFYRBCMYTLMQ-UHFFFAOYSA-N 0.000 description 1
- ZPQXKSCQGPVQRQ-VXGBXAGGSA-N 9-cyclopentyl-2-[[(1r,2r)-2-hydroxycyclopentyl]amino]-1-methylpurin-6-one Chemical compound N=1C=2N(C3CCCC3)C=NC=2C(=O)N(C)C=1N[C@@H]1CCC[C@H]1O ZPQXKSCQGPVQRQ-VXGBXAGGSA-N 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- MPKROBMGGRGDNO-UHFFFAOYSA-N CC(C(Cc1c2[n](C)cc1)=O)C2=O Chemical compound CC(C(Cc1c2[n](C)cc1)=O)C2=O MPKROBMGGRGDNO-UHFFFAOYSA-N 0.000 description 1
- RBQMXLCOGZAJTM-BGQFSCJGSA-N CC(C1c2c3[n](C)c(N)c2)C(C)(C)C=C1[C@@H](C)C3=O Chemical compound CC(C1c2c3[n](C)c(N)c2)C(C)(C)C=C1[C@@H](C)C3=O RBQMXLCOGZAJTM-BGQFSCJGSA-N 0.000 description 1
- UNCPJZDHNMCGIC-UHFFFAOYSA-N CC(CC(C=C(C1)NC)=O)C1O Chemical compound CC(CC(C=C(C1)NC)=O)C1O UNCPJZDHNMCGIC-UHFFFAOYSA-N 0.000 description 1
- FSWCCQWDVGZMRD-UHFFFAOYSA-N CC1CC=CCC1 Chemical compound CC1CC=CCC1 FSWCCQWDVGZMRD-UHFFFAOYSA-N 0.000 description 1
- UMSQMSOKQVCAOZ-UHFFFAOYSA-N CC1NC(C(CC2CC3CCC2)=O)=C3C=C1 Chemical compound CC1NC(C(CC2CC3CCC2)=O)=C3C=C1 UMSQMSOKQVCAOZ-UHFFFAOYSA-N 0.000 description 1
- FQKIGMWFFHFKRX-UHFFFAOYSA-N CN1C=C2C(=NCN2CC3=CC=CC=C3)N4C1=NCC45CCCCC5 Chemical compound CN1C=C2C(=NCN2CC3=CC=CC=C3)N4C1=NCC45CCCCC5 FQKIGMWFFHFKRX-UHFFFAOYSA-N 0.000 description 1
- HYKOTSJWOPVIIW-PAMDKMJYSA-N C[C@@H](NC1N2C3=CC=CC3NC2N2C)N(COC(C(C)(C)C)=O)C1C2=O Chemical compound C[C@@H](NC1N2C3=CC=CC3NC2N2C)N(COC(C(C)(C)C)=O)C1C2=O HYKOTSJWOPVIIW-PAMDKMJYSA-N 0.000 description 1
- NUBDLRGGGIDRCR-KOGDIJHLSA-N C[C@H]1NC2N3C(N(C(C2N1CC1=CC=NC=C1)=O)C)NC1C3=CC=C1 Chemical compound C[C@H]1NC2N3C(N(C(C2N1CC1=CC=NC=C1)=O)C)NC1C3=CC=C1 NUBDLRGGGIDRCR-KOGDIJHLSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- YASYEJJMZJALEJ-UHFFFAOYSA-N Citric acid monohydrate Chemical compound O.OC(=O)CC(O)(C(O)=O)CC(O)=O YASYEJJMZJALEJ-UHFFFAOYSA-N 0.000 description 1
- MIKUYHXYGGJMLM-GIMIYPNGSA-N Crotonoside Natural products C1=NC2=C(N)NC(=O)N=C2N1[C@H]1O[C@@H](CO)[C@H](O)[C@@H]1O MIKUYHXYGGJMLM-GIMIYPNGSA-N 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- NYHBQMYGNKIUIF-UHFFFAOYSA-N D-guanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1OC(CO)C(O)C1O NYHBQMYGNKIUIF-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 229920001425 Diethylaminoethyl cellulose Polymers 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- 239000001116 FEMA 4028 Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 108010044467 Isoenzymes Proteins 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- WKEXRQZDSMEKEZ-UHFFFAOYSA-N OC1C(CCC2ONCCO2)CCC1 Chemical compound OC1C(CCC2ONCCO2)CCC1 WKEXRQZDSMEKEZ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 235000014443 Pyrus communis Nutrition 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 102000010856 Type 1 Cyclic Nucleotide Phosphodiesterases Human genes 0.000 description 1
- 108010037572 Type 1 Cyclic Nucleotide Phosphodiesterases Proteins 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000001042 affinity chromatography Methods 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000005122 aminoalkylamino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 210000002403 aortic endothelial cell Anatomy 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 210000001367 artery Anatomy 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 description 1
- 235000011175 beta-cyclodextrine Nutrition 0.000 description 1
- 229960004853 betadex Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- NHYXMAKLBXBVEO-UHFFFAOYSA-N bromomethyl acetate Chemical compound CC(=O)OCBr NHYXMAKLBXBVEO-UHFFFAOYSA-N 0.000 description 1
- UUWSLBWDFJMSFP-UHFFFAOYSA-N bromomethylcyclohexane Chemical compound BrCC1CCCCC1 UUWSLBWDFJMSFP-UHFFFAOYSA-N 0.000 description 1
- 230000003182 bronchodilatating effect Effects 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 229940095672 calcium sulfate Drugs 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 1
- NQTXEYGGJHNFTM-KGLIPLIRSA-N cis-5,6a,7,8,9,9a-hexahydro-5-methyl-3-(4-chlorophenylmethyl)cyclopenta[4,5]imidazo[2,1-b]purin-4(3h)-one Chemical compound N1([C@H]2CCC[C@H]2N=C1N(C(C=12)=O)C)C=1N=CN2CC1=CC=C(Cl)C=C1 NQTXEYGGJHNFTM-KGLIPLIRSA-N 0.000 description 1
- 229960002303 citric acid monohydrate Drugs 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 235000005687 corn oil Nutrition 0.000 description 1
- 239000002285 corn oil Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- IHJTWSZEBFXORK-UHFFFAOYSA-N cyclopentylmethanesulfonic acid Chemical compound OS(=O)(=O)CC1CCCC1 IHJTWSZEBFXORK-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- OPGYRRGJRBEUFK-UHFFFAOYSA-L disodium;diacetate Chemical compound [Na+].[Na+].CC([O-])=O.CC([O-])=O OPGYRRGJRBEUFK-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 238000003821 enantio-separation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- 239000001761 ethyl methyl cellulose Substances 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 238000002523 gelfiltration Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 229940029575 guanosine Drugs 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- QKGYJVXSKCDGOK-UHFFFAOYSA-N hexane;propan-2-ol Chemical compound CC(C)O.CCCCCC QKGYJVXSKCDGOK-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000005191 hydroxyalkylamino group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- UVNXNSUKKOLFBM-UHFFFAOYSA-N imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=CSC2=NC=CN21 UVNXNSUKKOLFBM-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000004255 ion exchange chromatography Methods 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- VTRUEPHORZTAGC-UHFFFAOYSA-N methyl 2-[(7-benzyl-1,8-dimethyl-6-oxopurin-2-yl)amino]-3-hydroxypropanoate Chemical compound C1=2C(=O)N(C)C(NC(CO)C(=O)OC)=NC=2N=C(C)N1CC1=CC=CC=C1 VTRUEPHORZTAGC-UHFFFAOYSA-N 0.000 description 1
- 125000006261 methyl amino sulfonyl group Chemical group [H]N(C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000004712 monophosphates Chemical class 0.000 description 1
- 125000005322 morpholin-1-yl group Chemical group 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 210000002464 muscle smooth vascular Anatomy 0.000 description 1
- ORXWIDRGKWBMNL-UHFFFAOYSA-N n-(6-amino-3-methyl-2,4-dioxo-1h-pyrimidin-5-yl)-n-benzyl-2,2,2-trifluoroacetamide Chemical compound O=C1N(C)C(=O)NC(N)=C1N(C(=O)C(F)(F)F)CC1=CC=CC=C1 ORXWIDRGKWBMNL-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000018791 negative regulation of catalytic activity Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen(.) Chemical compound [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 229940083251 peripheral vasodilators purine derivative Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- XOVSRHHCHKUFKM-UHFFFAOYSA-N s-methylthiohydroxylamine Chemical compound CSN XOVSRHHCHKUFKM-UHFFFAOYSA-N 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000003378 silver Chemical class 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229960003010 sodium sulfate Drugs 0.000 description 1
- WZWGGYFEOBVNLA-UHFFFAOYSA-N sodium;dihydrate Chemical compound O.O.[Na] WZWGGYFEOBVNLA-UHFFFAOYSA-N 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/14—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/08—Bronchodilators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/02—Drugs for disorders of the nervous system for peripheral neuropathies
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pulmonology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Filtering Materials (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US54156890A | 1990-06-21 | 1990-06-21 | |
| US541.568 | 1990-06-21 | ||
| US541568 | 1990-06-21 | ||
| PCT/US1991/004154 WO1991019717A1 (en) | 1990-06-21 | 1991-06-20 | Polycyclic guanine derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU92016466A RU92016466A (ru) | 1995-05-20 |
| RU2080322C1 true RU2080322C1 (ru) | 1997-05-27 |
Family
ID=24160139
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU9192016466A RU2080322C1 (ru) | 1990-06-21 | 1991-06-20 | Производные полициклического гуанина |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US5393755A (show.php) |
| EP (1) | EP0538332B1 (show.php) |
| JP (1) | JPH0747589B2 (show.php) |
| KR (1) | KR960004532B1 (show.php) |
| AT (1) | ATE155786T1 (show.php) |
| AU (1) | AU651607B2 (show.php) |
| CA (1) | CA2085733C (show.php) |
| CZ (1) | CZ281920B6 (show.php) |
| DE (1) | DE69126980T2 (show.php) |
| FI (1) | FI925731A7 (show.php) |
| HU (1) | HUT65623A (show.php) |
| IE (1) | IE912126A1 (show.php) |
| IL (1) | IL98559A0 (show.php) |
| NO (1) | NO924940L (show.php) |
| NZ (1) | NZ238609A (show.php) |
| OA (1) | OA09723A (show.php) |
| PL (1) | PL169481B1 (show.php) |
| RU (1) | RU2080322C1 (show.php) |
| TW (1) | TW197441B (show.php) |
| WO (1) | WO1991019717A1 (show.php) |
| ZA (1) | ZA914727B (show.php) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2258705C2 (ru) * | 1999-07-27 | 2005-08-20 | Алмираль Продесфарма С.А. | ПРОИЗВОДНЫЕ 8-ФЕНИЛ-6,9-ДИГИДРО[1,2,4]-ТРИАЗОЛО[3,4-i]ПУРИН-5-ОНА, СПОСОБЫ ИХ ПОЛУЧЕНИЯ, ПРОМЕЖУТОЧНЫЕ СОЕДИНЕНИЯ, ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ И СПОСОБ ЛЕЧЕНИЯ |
| RU2436777C2 (ru) * | 2005-11-09 | 2011-12-20 | Тосох корпорейшн | Нуклеиновое основание, имеющее перфторалкильную группу и способ его получения |
Families Citing this family (76)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0686157A1 (en) * | 1993-02-26 | 1995-12-13 | Schering Corporation | 2-benzyl-polycyclic guanine derivatives and process for preparing them |
| US5929046A (en) * | 1994-06-08 | 1999-07-27 | Cancer Research Campaign Technology Limited | Pyrimidine and purine derivatives and their use in treating tumour cells |
| US5661153A (en) * | 1994-07-19 | 1997-08-26 | Japan Energy Corporation | 1-arylpyrimidine derivatives and pharmaceutical use thereof |
| US5824683A (en) * | 1995-11-28 | 1998-10-20 | Schering Corporation | 2'- 4'-halo- 1,1'-biphenyl!-4-yl!methyl!-5'-methyl-spiro cyclopentane-1,7' (8'H)- 3H! imidazo 2,1-b!purin!-4' (5'H)-ones |
| ZA969888B (en) * | 1995-11-28 | 1997-05-26 | Schering Corp | 2'-[[4'-halo-[1,1-biphenyl]-4-yl]methyl]-5'-methyl-spiro[cyclopentane-1,7'(8'H)-[3H]imidazo[2,1-b]purin]-4'(5'H)-ones |
| CA2238283C (en) | 1997-05-30 | 2002-08-20 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of neoplastic lesions, pharmaceutical compositions from such compounds and uses of such compounds and compositions for treating neoplastic lesions |
| US5858694A (en) * | 1997-05-30 | 1999-01-12 | Cell Pathways, Inc. | Method for identifying compounds for inhibition of cancerous lesions |
| US6410584B1 (en) * | 1998-01-14 | 2002-06-25 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells with indole derivatives |
| US6130053A (en) * | 1999-08-03 | 2000-10-10 | Cell Pathways, Inc. | Method for selecting compounds for inhibition of neoplastic lesions |
| US6200771B1 (en) | 1998-10-15 | 2001-03-13 | Cell Pathways, Inc. | Method of using a novel phosphodiesterase in pharmaceutical screeing to identify compounds for treatment of neoplasia |
| US6133271A (en) * | 1998-11-19 | 2000-10-17 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure thienopyrimidine derivatives |
| US6187779B1 (en) | 1998-11-20 | 2001-02-13 | Cell Pathways, Inc. | Method for inhibiting neoplastic cells and related conditions by exposure to 2,8-disubstituted quinazoline derivatives |
| US6369092B1 (en) | 1998-11-23 | 2002-04-09 | Cell Pathways, Inc. | Method for treating neoplasia by exposure to substituted benzimidazole derivatives |
| US6486155B1 (en) | 1998-11-24 | 2002-11-26 | Cell Pathways Inc | Method of inhibiting neoplastic cells with isoquinoline derivatives |
| US6077842A (en) * | 1998-11-24 | 2000-06-20 | Cell Pathways, Inc. | Method of inhibiting neoplastic cells with pyrazolopyridylpyridazinone derivatives |
| US6034099A (en) * | 1998-11-24 | 2000-03-07 | Cell Pathways, Inc. | Method for inhibiting neoplastic lesions by administering 4-(arylmethylene)- 2, 3- dihydro-pyrazol-3-ones |
| US6025394A (en) | 1999-01-29 | 2000-02-15 | Cell Pathways, Inc. | Method for treating patients with acne by administering substituted sulfonyl indenyl acetic acids, amides and alcohols |
| US6020379A (en) * | 1999-02-19 | 2000-02-01 | Cell Pathways, Inc. | Position 7 substituted indenyl-3-acetic acid derivatives and amides thereof for the treatment of neoplasia |
| US6555547B1 (en) | 2000-02-28 | 2003-04-29 | Cell Pathways, Inc. | Method for treating a patient with neoplasia by treatment with a vinca alkaloid derivative |
| US6569638B1 (en) | 2000-03-03 | 2003-05-27 | Cell Pathways, Inc | Method for screening compounds for the treatment of neoplasia |
| US6821978B2 (en) | 2000-09-19 | 2004-11-23 | Schering Corporation | Xanthine phosphodiesterase V inhibitors |
| EP1790652A1 (en) * | 2001-08-28 | 2007-05-30 | Schering Corporation | Polycyclic guanine phosphodiesterase V inhibitors |
| DE60226615D1 (show.php) * | 2001-08-28 | 2008-06-26 | Schering Corp | |
| CA2459161A1 (en) | 2001-08-31 | 2003-03-13 | The Rockefeller University | Phosphodiesterase activity and regulation of phosphodiesterase 1b-mediated signaling in brain |
| EP1312363A1 (en) * | 2001-09-28 | 2003-05-21 | Pfizer Products Inc. | Methods of treatment and kits comprising a growth hormone secretagogue |
| US6943171B2 (en) * | 2001-11-09 | 2005-09-13 | Schering Corporation | Polycyclic guanine derivative phosphodiesterase V inhibitors |
| US7342884B2 (en) * | 2002-03-13 | 2008-03-11 | Harmonic, Inc. | Method and apparatus for one directional communications in bidirectional communications channel |
| CN100497336C (zh) * | 2002-05-31 | 2009-06-10 | 先灵公司 | 制备黄嘌呤磷酸二酯酶v抑制剂及其前体的方法 |
| EP1719772A1 (en) | 2002-05-31 | 2006-11-08 | Schering Corporation | Process for preparing xanthine phosphodiesterase v inhibitors and precursors thereof |
| ATE363483T1 (de) * | 2003-07-31 | 2007-06-15 | Schering Corp | Metabolit eines xanthinphosphodiesterase-5- inhibitors und derivate davon, die sich zur behandlung von errektionsstörungen eignen |
| AU2004260758B2 (en) * | 2003-08-01 | 2007-06-07 | Nippon Soda Co., Ltd. | Phenylazole compounds, production process, and antioxidants |
| EP1691788A2 (en) * | 2003-11-21 | 2006-08-23 | Schering Corporation | Phosphodiesterase v inhibitor formulations |
| WO2006104870A2 (en) * | 2005-03-25 | 2006-10-05 | Schering Corporation | Methods of treating benign prostatic hyperplasia or lower urinary track symptoms by using pde 5 inhibitors |
| CN101248050B (zh) * | 2005-06-06 | 2013-07-17 | 武田药品工业株式会社 | 有机化合物 |
| WO2007025103A2 (en) * | 2005-08-23 | 2007-03-01 | Intra-Cellular Therapies, Inc. | Organic compounds for treating reduced dopamine receptor signalling activity |
| GB0601951D0 (en) | 2006-01-31 | 2006-03-15 | Novartis Ag | Organic compounds |
| MX2008015489A (es) | 2006-06-06 | 2009-01-13 | Intra Cellular Therapies Inc | Compuestos organicos. |
| WO2008063505A1 (en) | 2006-11-13 | 2008-05-29 | Intra-Cellular Therapies, Inc. | Organic compounds |
| US9006258B2 (en) * | 2006-12-05 | 2015-04-14 | Intra-Cellular Therapies, Inc. | Method of treating female sexual dysfunction with a PDE1 inhibitor |
| KR20100023040A (ko) | 2007-06-21 | 2010-03-03 | 쉐링 코포레이션 | 폴리사이클릭 구아닌 유도체 및 이의 용도 |
| KR20120012831A (ko) | 2007-12-06 | 2012-02-10 | 인트라-셀룰라 써래피스, 인코퍼레이티드. | 유기 화합물 |
| CN101969774A (zh) | 2007-12-06 | 2011-02-09 | 细胞内治疗公司 | 有机化合物 |
| EA201170768A1 (ru) | 2008-12-06 | 2012-05-30 | Интра-Селлулар Терапиз, Инк. | Органические соединения |
| US8633180B2 (en) * | 2008-12-06 | 2014-01-21 | Intra-Cellular Therapies, Inc. | Organic compounds |
| JP5784501B2 (ja) | 2008-12-06 | 2015-09-24 | イントラ−セルラー・セラピーズ・インコーポレイテッドIntra−Cellular Therapies, Inc. | 有機化合物 |
| US8859564B2 (en) | 2008-12-06 | 2014-10-14 | Intra-Cellular Therapies, Inc. | Pyrazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione derivatives useful as inhibitors of phosphodiesterase 1 |
| WO2010065153A1 (en) | 2008-12-06 | 2010-06-10 | Intra-Cellular Therapies, Inc. | Organic compounds |
| MX2011005933A (es) | 2008-12-06 | 2011-12-16 | Intra Cellular Therapies Inc | Compuestos organicos. |
| EP2400970A4 (en) | 2009-02-25 | 2012-07-18 | Intra Cellular Therapies Inc | PDE-1-HEMMER FOR EYE DRESSING |
| AU2010222289B2 (en) * | 2009-03-13 | 2013-07-11 | Advinus Therapeutics Private Limited | Substituted fused pyrimidine compounds |
| WO2010132127A1 (en) | 2009-05-13 | 2010-11-18 | Intra-Cellular Therapies, Inc. | Organic compounds |
| WO2011016861A2 (en) | 2009-08-05 | 2011-02-10 | Intra-Cellular Therapies, Inc. | Novel regulatory proteins and inhibitors |
| US20110190192A1 (en) * | 2009-12-15 | 2011-08-04 | Cebix Inc. | Methods for treating erectile dysfunction in patients with insulin-dependent diabetes |
| EP2590657A4 (en) | 2010-05-31 | 2014-02-12 | Intra Cellular Therapies Inc | ORGANIC CONNECTIONS |
| TW201206937A (en) | 2010-05-31 | 2012-02-16 | Intra Cellular Therapies Inc | Organic compounds |
| EP2575817A4 (en) | 2010-05-31 | 2014-01-08 | Intra Cellular Therapies Inc | ORGANIC CONNECTIONS |
| EP2576551A4 (en) | 2010-05-31 | 2014-04-16 | Intra Cellular Therapies Inc | ORGANIC CONNECTIONS |
| WO2012171016A1 (en) | 2011-06-10 | 2012-12-13 | Intra-Cellular Therapies, Inc. | Organic compounds |
| US9801882B2 (en) | 2013-02-17 | 2017-10-31 | Intra-Cellular Therapies, Inc. | Phosphodiesterase-1 inhibitors and their use in treatment of cardiovascular diseases |
| EP2968338B1 (en) | 2013-03-15 | 2019-01-09 | Intra-Cellular Therapies, Inc. | Pde1 inhibitors for use in the treatment and/or prevention of cns injuries, and pns diseases, disorders or injuries |
| PL2970279T3 (pl) | 2013-03-15 | 2021-05-31 | Intra-Cellular Therapies, Inc. | Związki organiczne |
| JP6696904B2 (ja) | 2014-01-08 | 2020-05-20 | イントラ−セルラー・セラピーズ・インコーポレイテッドIntra−Cellular Therapies, Inc. | 製剤および医薬組成物 |
| WO2015196186A1 (en) | 2014-06-20 | 2015-12-23 | Intra-Cellular Therapies, Inc. | Organic compounds |
| EP3177627B1 (en) | 2014-08-07 | 2019-07-24 | Intra-Cellular Therapies, Inc. | Imidazo[1,2-a]-pyrazolo[4,3-e]-pyrimidin-4-one derivatives with pde1 inhibiting activity |
| US10285992B2 (en) | 2014-08-07 | 2019-05-14 | Intra-Cellular Therapies, Inc. | Combinations of PDE1 inhibitors and NEP inhibitors and associated methods |
| US9546175B2 (en) | 2014-08-07 | 2017-01-17 | Intra-Cellular Therapies, Inc. | Organic compounds |
| JP6596080B2 (ja) | 2014-09-17 | 2019-10-23 | イントラ−セルラー・セラピーズ・インコーポレイテッド | 化合物および方法 |
| HK1243935A1 (zh) | 2014-12-06 | 2018-07-27 | Intra-Cellular Therapies, Inc. | 有机化合物 |
| WO2016090380A1 (en) | 2014-12-06 | 2016-06-09 | Intra-Cellular Therapies, Inc. | Organic compounds |
| WO2017172795A1 (en) | 2016-03-28 | 2017-10-05 | Intra-Cellular Therapies, Inc. | Novel compositions and methods |
| US11291666B2 (en) | 2016-09-12 | 2022-04-05 | Intra-Cellular Therapies, Inc. | Uses |
| US10981916B2 (en) | 2016-12-28 | 2021-04-20 | Dart Neuroscience, Llc | Substituted pyrazolopyrimidinone compounds as PDE2 inhibitors |
| CA3120971A1 (en) | 2017-11-27 | 2019-05-31 | Dart Neuroscience, Llc | Substituted furanopyrimidine compounds as pde1 inhibitors |
| EP3746081A4 (en) | 2018-01-31 | 2021-10-27 | Intra-Cellular Therapies, Inc. | Novel uses |
| US12410175B2 (en) | 2019-09-03 | 2025-09-09 | Intra-Cellular Therapies, Inc. | Compounds |
| US12364695B2 (en) | 2020-06-02 | 2025-07-22 | Intra-Cellular Therapies, Inc. | Methods of treating inflammatory disease |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE863525A (fr) * | 1977-02-14 | 1978-07-31 | Bristol Myers Co | Heterocyclopyrimidines |
| CA1095906A (en) * | 1977-02-14 | 1981-02-17 | Davis L. Temple, Jr. | Heterocyclopyrimidines, compositions and therapeutic process |
| US5064947A (en) * | 1989-03-29 | 1991-11-12 | Merrell Dow Pharmaceuticals Inc. | Selective adenosine reseptor compounds |
| AU623755B2 (en) * | 1989-03-29 | 1992-05-21 | Merrell Pharmaceuticals Inc. | Selective adenosine receptor compounds |
| US5173492A (en) * | 1989-09-14 | 1992-12-22 | Kyowa Hakko Kogyo Co., Ltd. | s-Triazolo(3,4-I)purine derivatives |
| ES2152207T3 (es) * | 1989-10-20 | 2001-02-01 | Kyowa Hakko Kogyo Kk | Derivados condensados de la purina. |
-
1991
- 1991-06-19 IL IL98559A patent/IL98559A0/xx unknown
- 1991-06-19 ZA ZA914727A patent/ZA914727B/xx unknown
- 1991-06-19 NZ NZ238609A patent/NZ238609A/en unknown
- 1991-06-20 AT AT91912779T patent/ATE155786T1/de not_active IP Right Cessation
- 1991-06-20 CA CA002085733A patent/CA2085733C/en not_active Expired - Fee Related
- 1991-06-20 CZ CS923749A patent/CZ281920B6/cs unknown
- 1991-06-20 KR KR1019920703316A patent/KR960004532B1/ko not_active Expired - Fee Related
- 1991-06-20 US US07/949,811 patent/US5393755A/en not_active Expired - Lifetime
- 1991-06-20 WO PCT/US1991/004154 patent/WO1991019717A1/en not_active Ceased
- 1991-06-20 RU RU9192016466A patent/RU2080322C1/ru active
- 1991-06-20 PL PL91297299A patent/PL169481B1/pl unknown
- 1991-06-20 IE IE212691A patent/IE912126A1/en unknown
- 1991-06-20 TW TW080104761A patent/TW197441B/zh active
- 1991-06-20 JP JP3512084A patent/JPH0747589B2/ja not_active Expired - Fee Related
- 1991-06-20 DE DE69126980T patent/DE69126980T2/de not_active Expired - Fee Related
- 1991-06-20 HU HU9204032A patent/HUT65623A/hu unknown
- 1991-06-20 AU AU81992/91A patent/AU651607B2/en not_active Ceased
- 1991-06-20 EP EP91912779A patent/EP0538332B1/en not_active Expired - Lifetime
-
1992
- 1992-12-17 FI FI925731A patent/FI925731A7/fi not_active Application Discontinuation
- 1992-12-18 NO NO92924940A patent/NO924940L/no unknown
- 1992-12-21 OA OA60319A patent/OA09723A/en unknown
Non-Patent Citations (1)
| Title |
|---|
| Патент ЕПВ N 350742, кл. С 07 D 473/38, 1989. * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2258705C2 (ru) * | 1999-07-27 | 2005-08-20 | Алмираль Продесфарма С.А. | ПРОИЗВОДНЫЕ 8-ФЕНИЛ-6,9-ДИГИДРО[1,2,4]-ТРИАЗОЛО[3,4-i]ПУРИН-5-ОНА, СПОСОБЫ ИХ ПОЛУЧЕНИЯ, ПРОМЕЖУТОЧНЫЕ СОЕДИНЕНИЯ, ФАРМАЦЕВТИЧЕСКАЯ КОМПОЗИЦИЯ И СПОСОБ ЛЕЧЕНИЯ |
| RU2436777C2 (ru) * | 2005-11-09 | 2011-12-20 | Тосох корпорейшн | Нуклеиновое основание, имеющее перфторалкильную группу и способ его получения |
Also Published As
| Publication number | Publication date |
|---|---|
| US5393755A (en) | 1995-02-28 |
| AU8199291A (en) | 1992-01-07 |
| DE69126980D1 (de) | 1997-09-04 |
| CA2085733A1 (en) | 1991-12-22 |
| HUT65623A (en) | 1994-07-28 |
| OA09723A (en) | 1993-08-30 |
| HU9204032D0 (en) | 1993-03-29 |
| NO924940D0 (no) | 1992-12-18 |
| CZ281920B6 (cs) | 1997-04-16 |
| AU651607B2 (en) | 1994-07-28 |
| JPH0747589B2 (ja) | 1995-05-24 |
| NZ238609A (en) | 1993-12-23 |
| FI925731A0 (fi) | 1992-12-17 |
| IL98559A0 (en) | 1992-07-15 |
| KR960004532B1 (ko) | 1996-04-06 |
| PL297299A1 (show.php) | 1992-07-13 |
| EP0538332A1 (en) | 1993-04-28 |
| DE69126980T2 (de) | 1998-01-08 |
| CA2085733C (en) | 1996-03-05 |
| NO924940L (no) | 1992-12-18 |
| JPH05508647A (ja) | 1993-12-02 |
| FI925731A7 (fi) | 1992-12-17 |
| ZA914727B (en) | 1992-03-25 |
| CZ374992A3 (en) | 1993-10-13 |
| IE912126A1 (en) | 1992-01-01 |
| PL169481B1 (pl) | 1996-07-31 |
| WO1991019717A1 (en) | 1991-12-26 |
| TW197441B (show.php) | 1993-01-01 |
| ATE155786T1 (de) | 1997-08-15 |
| EP0538332B1 (en) | 1997-07-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2080322C1 (ru) | Производные полициклического гуанина | |
| US5641784A (en) | 8-substituted 1,3-dialiphaticxanthine derivatives | |
| RU2603140C2 (ru) | Соединения имидазотриазинона | |
| EP2402334B1 (en) | Inhibitors of E1 Activating Enzymes | |
| JP5649614B2 (ja) | 有機化合物 | |
| HK1002935A1 (en) | Pyrrolopyrimidine derivatives with antiproliferative action | |
| HK1002935B (en) | Pyrrolopyrimidine derivatives with antiproliferative action | |
| JP3026020B2 (ja) | 3環性プテリジノン類及びその製造方法 | |
| KR20200032146A (ko) | Egfr 키나제 억제제로써의 아릴-인-산소 화합물 | |
| EP3719012A1 (en) | Uracil compound as c-met/axl inhibitor | |
| JPH08507068A (ja) | 2−ベンジル−多環式グアニン誘導体およびそれらの製造方法 | |
| JP2018513184A (ja) | Pde1阻害剤としてのイミダゾトリアジノン | |
| WO2008152387A1 (en) | Quinazoline derivatives as pi3 kinase inhibitors | |
| EP3315498A1 (en) | Imidazo-pyrimidone compounds, and preparation method and application thereof | |
| US5565463A (en) | 9-subtituted-8-unsubstituted-9-deazaguanines | |
| EP3738961B1 (en) | Heterocyclic compound as csf-1r inhibitor and use thereof | |
| KR100195368B1 (ko) | 선택적인 아데노신 수용체 제제 및 이의 제조방법 | |
| MC1315A1 (fr) | Derives de l'imidazole et leur synthese et preparation de medicaments contenant ces substances | |
| US4943576A (en) | Substituted quinoxalyl-imidazolidine-2,4-diones, processes for their preparation, their use as medicaments and pharmaceutical preparations | |
| JPH0573754B2 (show.php) | ||
| AU2020101057A4 (en) | Preparation method of adenosine receptor antagonist | |
| EP4617265A1 (en) | Nitrogen-containing spirocyclic compound, pharmaceutical composition and use thereof | |
| HK40038950A (en) | N-[4-[(2-amino-4-pyridinyl)oxy]-3-fluorophenyl]-3-(4-fluorophenyl)-1,2,3,4-tetrahydro-2,4-dioxo-5-pyrimidinecarboxamide derivatives as c-met/axl inhibitors for the treatment of tumors | |
| HK1064100A1 (en) | Adenosine a 2a receptor antagonists | |
| HK1064100B (en) | Adenosine a 2a receptor antagonists |