PT99411B - Processo para a preparacao de novos carboxilatos de 2-sacarinilmetil arilo utilizados como inibidores da enzima proteolitica - Google Patents
Processo para a preparacao de novos carboxilatos de 2-sacarinilmetil arilo utilizados como inibidores da enzima proteolitica Download PDFInfo
- Publication number
- PT99411B PT99411B PT99411A PT9941191A PT99411B PT 99411 B PT99411 B PT 99411B PT 99411 A PT99411 A PT 99411A PT 9941191 A PT9941191 A PT 9941191A PT 99411 B PT99411 B PT 99411B
- Authority
- PT
- Portugal
- Prior art keywords
- lower alkyl
- amino
- alkyl
- alkylene
- formula
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 132
- 238000000034 method Methods 0.000 title claims description 99
- 230000008569 process Effects 0.000 title claims description 41
- 150000007942 carboxylates Chemical class 0.000 title claims description 15
- 230000002797 proteolythic effect Effects 0.000 title claims 2
- 239000002532 enzyme inhibitor Substances 0.000 title 1
- -1 aryl carboxylates Chemical class 0.000 claims abstract description 220
- 239000002253 acid Substances 0.000 claims abstract description 64
- 125000000217 alkyl group Chemical group 0.000 claims description 139
- 238000006243 chemical reaction Methods 0.000 claims description 105
- 125000003545 alkoxy group Chemical group 0.000 claims description 83
- 150000001875 compounds Chemical class 0.000 claims description 83
- 235000019204 saccharin Nutrition 0.000 claims description 77
- 229940081974 saccharin Drugs 0.000 claims description 73
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 claims description 73
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical group C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 claims description 67
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 59
- 125000002947 alkylene group Chemical group 0.000 claims description 54
- 239000001257 hydrogen Substances 0.000 claims description 51
- 229910052739 hydrogen Inorganic materials 0.000 claims description 51
- 229910052757 nitrogen Inorganic materials 0.000 claims description 51
- 150000003839 salts Chemical class 0.000 claims description 44
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 43
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 42
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 31
- 229910052736 halogen Inorganic materials 0.000 claims description 29
- 150000002367 halogens Chemical class 0.000 claims description 29
- 125000003282 alkyl amino group Chemical group 0.000 claims description 28
- 229910052783 alkali metal Inorganic materials 0.000 claims description 27
- 239000002585 base Substances 0.000 claims description 27
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 25
- 150000002431 hydrogen Chemical group 0.000 claims description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 19
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 17
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 17
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 16
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 15
- 125000001624 naphthyl group Chemical group 0.000 claims description 15
- 102000004190 Enzymes Human genes 0.000 claims description 14
- 108090000790 Enzymes Proteins 0.000 claims description 14
- 229910021529 ammonia Inorganic materials 0.000 claims description 14
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 14
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 14
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- 229910052744 lithium Inorganic materials 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- MRUDNSFOFOQZDA-UHFFFAOYSA-M 2,6-dichlorobenzoate Chemical compound [O-]C(=O)C1=C(Cl)C=CC=C1Cl MRUDNSFOFOQZDA-UHFFFAOYSA-M 0.000 claims description 12
- POPVUKGJWNLYGW-UHFFFAOYSA-N (hydroxyamino) hydrogen sulfate Chemical compound ONOS(O)(=O)=O POPVUKGJWNLYGW-UHFFFAOYSA-N 0.000 claims description 11
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 11
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical group C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 11
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 9
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims description 9
- 229920006395 saturated elastomer Polymers 0.000 claims description 9
- 230000002378 acidificating effect Effects 0.000 claims description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 8
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 7
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 6
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000005046 Chlorosilane Substances 0.000 claims description 5
- 229930040373 Paraformaldehyde Natural products 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000005518 carboxamido group Chemical group 0.000 claims description 5
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical compound Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 5
- 239000003112 inhibitor Substances 0.000 claims description 5
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 5
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 5
- 229920002866 paraformaldehyde Polymers 0.000 claims description 5
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 4
- 125000005210 alkyl ammonium group Chemical group 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- RRURGOPYONTFSU-UHFFFAOYSA-N (6-hydroxy-1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-2-yl)methyl 2,6-dichlorobenzoate Chemical compound CC(C)C1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=C(Cl)C=CC=C1Cl RRURGOPYONTFSU-UHFFFAOYSA-N 0.000 claims description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 3
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 claims description 3
- 239000011260 aqueous acid Substances 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 3
- 150000007517 lewis acids Chemical class 0.000 claims description 3
- 229910052716 thallium Inorganic materials 0.000 claims description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 claims description 3
- 125000000586 2-(4-morpholinyl)ethoxy group Chemical group [H]C([H])(O*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- IPZJQDSFZGZEOY-UHFFFAOYSA-N dimethylmethylene Chemical group C[C]C IPZJQDSFZGZEOY-UHFFFAOYSA-N 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical group [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 4
- QAOJBHRZQQDFHA-UHFFFAOYSA-N 2,3-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Cl)=C1Cl QAOJBHRZQQDFHA-UHFFFAOYSA-N 0.000 claims 2
- 229910052751 metal Inorganic materials 0.000 claims 2
- 239000002184 metal Substances 0.000 claims 2
- LNETULKMXZVUST-UHFFFAOYSA-M 1-naphthoate Chemical compound C1=CC=C2C(C(=O)[O-])=CC=CC2=C1 LNETULKMXZVUST-UHFFFAOYSA-M 0.000 claims 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims 1
- CTZDCUSZXMZFNM-UHFFFAOYSA-N 2-methyl-2h-1,3-oxazine Chemical compound CC1OC=CC=N1 CTZDCUSZXMZFNM-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- 125000005529 alkyleneoxy group Chemical group 0.000 claims 1
- 125000004103 aminoalkyl group Chemical group 0.000 claims 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims 1
- 125000005111 carboxyalkoxy group Chemical group 0.000 claims 1
- 229910001947 lithium oxide Inorganic materials 0.000 claims 1
- 208000015122 neurodegenerative disease Diseases 0.000 abstract description 7
- 239000000243 solution Substances 0.000 description 150
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 137
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 137
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 124
- 239000000203 mixture Substances 0.000 description 117
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 94
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 93
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 93
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 82
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 75
- 239000000047 product Substances 0.000 description 64
- 239000011541 reaction mixture Substances 0.000 description 61
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 55
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 51
- 235000019439 ethyl acetate Nutrition 0.000 description 47
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 47
- 239000007787 solid Substances 0.000 description 44
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 40
- 229960000583 acetic acid Drugs 0.000 description 38
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- 239000002904 solvent Substances 0.000 description 33
- 239000000741 silica gel Substances 0.000 description 32
- 229910002027 silica gel Inorganic materials 0.000 description 32
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 31
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 31
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 30
- 239000012074 organic phase Substances 0.000 description 29
- 238000003756 stirring Methods 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- 229940044609 sulfur dioxide Drugs 0.000 description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 23
- 239000003921 oil Substances 0.000 description 23
- 238000001914 filtration Methods 0.000 description 22
- 239000012362 glacial acetic acid Substances 0.000 description 22
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 238000010438 heat treatment Methods 0.000 description 21
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 21
- 239000000706 filtrate Substances 0.000 description 19
- VVPUIKNICYCXJZ-UHFFFAOYSA-N 4-iodobutyl benzoate Chemical compound ICCCCOC(=O)C1=CC=CC=C1 VVPUIKNICYCXJZ-UHFFFAOYSA-N 0.000 description 18
- 238000003818 flash chromatography Methods 0.000 description 18
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 18
- 239000012267 brine Substances 0.000 description 17
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 13
- 229940088598 enzyme Drugs 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 12
- 238000000746 purification Methods 0.000 description 12
- 239000011780 sodium chloride Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 11
- 150000007513 acids Chemical class 0.000 description 11
- 239000008346 aqueous phase Substances 0.000 description 11
- 229910003002 lithium salt Inorganic materials 0.000 description 11
- 159000000002 lithium salts Chemical class 0.000 description 11
- 239000012071 phase Substances 0.000 description 11
- 229910000027 potassium carbonate Inorganic materials 0.000 description 11
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 10
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical class CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 10
- OZLIDYFWKWHOTR-UHFFFAOYSA-M sodium (hydroxyamino) sulfate Chemical compound [Na+].ONOS([O-])(=O)=O OZLIDYFWKWHOTR-UHFFFAOYSA-M 0.000 description 10
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 235000011114 ammonium hydroxide Nutrition 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 150000004965 peroxy acids Chemical class 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 102000035195 Peptidases Human genes 0.000 description 8
- 108091005804 Peptidases Proteins 0.000 description 8
- 239000000908 ammonium hydroxide Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 239000006260 foam Substances 0.000 description 8
- 230000002401 inhibitory effect Effects 0.000 description 8
- 150000003475 thallium Chemical class 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 230000003197 catalytic effect Effects 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- PUYQLJDNZIEPCV-UHFFFAOYSA-N 1,1-dioxo-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical class S1(=O)(=O)NC(=O)C2CCCC=C12 PUYQLJDNZIEPCV-UHFFFAOYSA-N 0.000 description 6
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 6
- LWVDCUCGKCOXLT-UHFFFAOYSA-N 4-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC2=C1C(=O)NS2(=O)=O LWVDCUCGKCOXLT-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 206010014561 Emphysema Diseases 0.000 description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 102000012479 Serine Proteases Human genes 0.000 description 6
- 108010022999 Serine Proteases Proteins 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 239000003570 air Substances 0.000 description 6
- 150000003863 ammonium salts Chemical class 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 6
- 229910052794 bromium Inorganic materials 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 229960002376 chymotrypsin Drugs 0.000 description 6
- 229960003280 cupric chloride Drugs 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- MRUDNSFOFOQZDA-UHFFFAOYSA-N 2,6-dichlorobenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC=C1Cl MRUDNSFOFOQZDA-UHFFFAOYSA-N 0.000 description 5
- QBZUIAHJZRGHRJ-UHFFFAOYSA-N 6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC2=C1C(=O)NS2(=O)=O QBZUIAHJZRGHRJ-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 108090000317 Chymotrypsin Proteins 0.000 description 5
- 101000851058 Homo sapiens Neutrophil elastase Proteins 0.000 description 5
- 102100033174 Neutrophil elastase Human genes 0.000 description 5
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 150000001450 anions Chemical class 0.000 description 5
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 5
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000006264 debenzylation reaction Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- OBWFJXLKRAFEDI-UHFFFAOYSA-N methyl cyanoformate Chemical compound COC(=O)C#N OBWFJXLKRAFEDI-UHFFFAOYSA-N 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- RFAHYFCQZDZXLP-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CCl)C(=O)C2=C1 RFAHYFCQZDZXLP-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 241000209094 Oryza Species 0.000 description 4
- 235000007164 Oryza sativa Nutrition 0.000 description 4
- 108010067372 Pancreatic elastase Proteins 0.000 description 4
- 102000016387 Pancreatic elastase Human genes 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 238000012512 characterization method Methods 0.000 description 4
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 4
- 230000009849 deactivation Effects 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 4
- 230000006870 function Effects 0.000 description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 description 4
- 235000009566 rice Nutrition 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 3
- ITNOKSZSFCACOE-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-carbonitrile Chemical compound N#CC1=CC=C2C(=O)NS(=O)(=O)C2=C1 ITNOKSZSFCACOE-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 3
- QZHSLVWCHZTCPQ-UHFFFAOYSA-N 2-benzyl-5-chloro-1-oxo-1,2-thiazol-3-one Chemical compound O=S1C(Cl)=CC(=O)N1CC1=CC=CC=C1 QZHSLVWCHZTCPQ-UHFFFAOYSA-N 0.000 description 3
- NNNBYOYSLQUCNI-UHFFFAOYSA-N 4-chloro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound ClC1=CC=CC2=C1C(=O)NS2(=O)=O NNNBYOYSLQUCNI-UHFFFAOYSA-N 0.000 description 3
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 3
- SGQJHTPAGPKONZ-UHFFFAOYSA-N 6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OC)=CC2=C1C(=O)NS2(=O)=O SGQJHTPAGPKONZ-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 238000000023 Kugelrohr distillation Methods 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 3
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 3
- 150000001263 acyl chlorides Chemical class 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 125000000539 amino acid group Chemical group 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 3
- DZFYOYRNBGNPJW-UHFFFAOYSA-N ethoxythallium Chemical compound [Tl+].CC[O-] DZFYOYRNBGNPJW-UHFFFAOYSA-N 0.000 description 3
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000001119 stannous chloride Substances 0.000 description 3
- 235000011150 stannous chloride Nutrition 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- ZDUVXKZSRKSBCU-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 ZDUVXKZSRKSBCU-UHFFFAOYSA-N 0.000 description 2
- ZSWYICNLNOGISL-UHFFFAOYSA-N 1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical class O=S1(=O)C2=CC=CC=C2C(=O)N1CSC1=CC=CC=C1 ZSWYICNLNOGISL-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- GPVDHNVGGIAOQT-UHFFFAOYSA-N 2,4-dimethoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(OC)=C1 GPVDHNVGGIAOQT-UHFFFAOYSA-N 0.000 description 2
- LHJFBVDNRPBOOW-UHFFFAOYSA-N 2,6-dichloro-3-hydroxybenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(O)=C1Cl LHJFBVDNRPBOOW-UHFFFAOYSA-N 0.000 description 2
- FVDBDUWYRAXEDD-UHFFFAOYSA-N 2,6-dichloro-3-phenylmethoxybenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(OCC=2C=CC=CC=2)=C1Cl FVDBDUWYRAXEDD-UHFFFAOYSA-N 0.000 description 2
- MXYHEVHFDJKNHN-UHFFFAOYSA-N 2-(chloromethyl)-6-hydroxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC2=C1C(=O)N(CCl)S2(=O)=O MXYHEVHFDJKNHN-UHFFFAOYSA-N 0.000 description 2
- HHDDUPZAXJPTQF-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-4,5,6,7-tetrahydro-1,2-benzothiazol-3-one Chemical compound C1C(OC)CC(C(C)C)C2=C1S(=O)(=O)N(CCl)C2=O HHDDUPZAXJPTQF-UHFFFAOYSA-N 0.000 description 2
- BXQOWUSZAWCFIL-UHFFFAOYSA-N 2-benzyl-5-chloro-1,2-thiazol-3-one Chemical compound S1C(Cl)=CC(=O)N1CC1=CC=CC=C1 BXQOWUSZAWCFIL-UHFFFAOYSA-N 0.000 description 2
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 2
- IITQJMYAYSNIMI-UHFFFAOYSA-N 3-Methyl-2-cyclohexen-1-one Chemical compound CC1=CC(=O)CCC1 IITQJMYAYSNIMI-UHFFFAOYSA-N 0.000 description 2
- BANIKQOYSWTYOZ-UHFFFAOYSA-N 4,7-dimethyl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 BANIKQOYSWTYOZ-UHFFFAOYSA-N 0.000 description 2
- LKDMKWNDBAVNQZ-UHFFFAOYSA-N 4-[[1-[[1-[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid Chemical compound OC(=O)CCC(=O)NC(C)C(=O)NC(C)C(=O)N1CCCC1C(=O)NC(C(=O)NC=1C=CC(=CC=1)[N+]([O-])=O)CC1=CC=CC=C1 LKDMKWNDBAVNQZ-UHFFFAOYSA-N 0.000 description 2
- ZTNXVVOWKTYVFQ-UHFFFAOYSA-N 4-ethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCC1=CC=CC2=C1C(=O)NS2(=O)=O ZTNXVVOWKTYVFQ-UHFFFAOYSA-N 0.000 description 2
- IELNXGPPRWLPCZ-UHFFFAOYSA-N 4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC2=C1C(=O)NS2(=O)=O IELNXGPPRWLPCZ-UHFFFAOYSA-N 0.000 description 2
- RZDVCYHZYFLUNA-UHFFFAOYSA-N 4-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC(C)(C)C1=CC=CC2=C1C(=O)NS2(=O)=O RZDVCYHZYFLUNA-UHFFFAOYSA-N 0.000 description 2
- MUWHYUUQBYGDEG-UHFFFAOYSA-N 6-amino-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N)=CC2=C1C(=O)NS2(=O)=O MUWHYUUQBYGDEG-UHFFFAOYSA-N 0.000 description 2
- CNRNMBAPSVPGCJ-UHFFFAOYSA-N 6-fluoro-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(F)=CC2=C1C(=O)NS2(=O)=O CNRNMBAPSVPGCJ-UHFFFAOYSA-N 0.000 description 2
- HZZFBUZSKAVIOV-UHFFFAOYSA-N 6-nitro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound [O-][N+](=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 HZZFBUZSKAVIOV-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- KLYCPFXDDDMZNQ-UHFFFAOYSA-N Benzyne Chemical compound C1=CC#CC=C1 KLYCPFXDDDMZNQ-UHFFFAOYSA-N 0.000 description 2
- 206010006458 Bronchitis chronic Diseases 0.000 description 2
- DNWMFWMSFPHZFJ-UHFFFAOYSA-N C12CCC(CC1)C2.[Br] Chemical compound C12CCC(CC1)C2.[Br] DNWMFWMSFPHZFJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 108090000617 Cathepsin G Proteins 0.000 description 2
- 102100025975 Cathepsin G Human genes 0.000 description 2
- 201000003883 Cystic fibrosis Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 101000856199 Homo sapiens Chymotrypsin-like protease CTRL-1 Proteins 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- SPAGIJMPHSUYSE-UHFFFAOYSA-N Magnesium peroxide Chemical class [Mg+2].[O-][O-] SPAGIJMPHSUYSE-UHFFFAOYSA-N 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 229910017917 NH4 Cl Inorganic materials 0.000 description 2
- 206010033645 Pancreatitis Diseases 0.000 description 2
- 206010034277 Pemphigoid Diseases 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- LGPYGVFCRQDPEQ-UHFFFAOYSA-N S-chloro N,N-dimethylcarbamothioate Chemical compound CN(C(=O)SCl)C LGPYGVFCRQDPEQ-UHFFFAOYSA-N 0.000 description 2
- 208000019229 Spleen disease Diseases 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- HUGPKRHWFXCKPA-UHFFFAOYSA-N [chloro-[chloro(phenyl)methyl]sulfanylmethyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)SC(Cl)C1=CC=CC=C1 HUGPKRHWFXCKPA-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 208000006682 alpha 1-Antitrypsin Deficiency Diseases 0.000 description 2
- 108010027597 alpha-chymotrypsin Proteins 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- PSBVWYPZNCUYKF-UHFFFAOYSA-N benzyl 2,6-dichloro-3-hydroxybenzoate Chemical compound OC1=CC=C(Cl)C(C(=O)OCC=2C=CC=CC=2)=C1Cl PSBVWYPZNCUYKF-UHFFFAOYSA-N 0.000 description 2
- CMWCNAHHOODXNR-UHFFFAOYSA-N benzyl 2,6-dichloro-4-hydroxybenzoate Chemical compound ClC1=CC(O)=CC(Cl)=C1C(=O)OCC1=CC=CC=C1 CMWCNAHHOODXNR-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 238000005574 benzylation reaction Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 229910052792 caesium Inorganic materials 0.000 description 2
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 2
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- SATLIFYHNYMKJB-UHFFFAOYSA-N chloromethyl 2,6-dichlorobenzoate Chemical compound ClCOC(=O)C1=C(Cl)C=CC=C1Cl SATLIFYHNYMKJB-UHFFFAOYSA-N 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- MGNZXYYWBUKAII-UHFFFAOYSA-N cyclohexa-1,3-diene Chemical compound C1CC=CC=C1 MGNZXYYWBUKAII-UHFFFAOYSA-N 0.000 description 2
- ZSWFCLXCOIISFI-UHFFFAOYSA-N cyclopentadiene Chemical compound C1C=CC=C1 ZSWFCLXCOIISFI-UHFFFAOYSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000002849 elastaseinhibitory effect Effects 0.000 description 2
- 230000002901 elastaselike Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- RBBOWEDMXHTEPA-UHFFFAOYSA-N hexane;toluene Chemical compound CCCCCC.CC1=CC=CC=C1 RBBOWEDMXHTEPA-UHFFFAOYSA-N 0.000 description 2
- 210000003630 histaminocyte Anatomy 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000003760 magnetic stirring Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- QODPBEHOIIOUNV-UHFFFAOYSA-N methyl 2,6-dichloro-3-phenylmethoxybenzoate Chemical compound COC(=O)C1=C(Cl)C=CC(OCC=2C=CC=CC=2)=C1Cl QODPBEHOIIOUNV-UHFFFAOYSA-N 0.000 description 2
- BXRYSXCIRIKKJV-UHFFFAOYSA-N methyl 2-amino-6-chlorobenzoate Chemical compound COC(=O)C1=C(N)C=CC=C1Cl BXRYSXCIRIKKJV-UHFFFAOYSA-N 0.000 description 2
- GPNCYIZKJTXKRO-UHFFFAOYSA-N methyl 2-hydroxy-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1O GPNCYIZKJTXKRO-UHFFFAOYSA-N 0.000 description 2
- YKUCHDXIBAQWSF-UHFFFAOYSA-N methyl 3-hydroxybenzoate Chemical compound COC(=O)C1=CC=CC(O)=C1 YKUCHDXIBAQWSF-UHFFFAOYSA-N 0.000 description 2
- 229940095102 methyl benzoate Drugs 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- JIINXSMAUVPAPI-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propylbenzamide Chemical compound CCCC1=C(OC)C(OC)=CC=C1C(=O)N(CC)CC JIINXSMAUVPAPI-UHFFFAOYSA-N 0.000 description 2
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 230000007420 reactivation Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 208000023504 respiratory system disease Diseases 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 208000027140 splenic disease Diseases 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- XSNIGDABGWCQOG-UHFFFAOYSA-N (1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl) acetate Chemical compound CC(C)C1=CC(OC(C)=O)=CC2=C1C(=O)NS2(=O)=O XSNIGDABGWCQOG-UHFFFAOYSA-N 0.000 description 1
- QIVUCLWGARAQIO-OLIXTKCUSA-N (3s)-n-[(3s,5s,6r)-6-methyl-2-oxo-1-(2,2,2-trifluoroethyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]-2-oxospiro[1h-pyrrolo[2,3-b]pyridine-3,6'-5,7-dihydrocyclopenta[b]pyridine]-3'-carboxamide Chemical compound C1([C@H]2[C@H](N(C(=O)[C@@H](NC(=O)C=3C=C4C[C@]5(CC4=NC=3)C3=CC=CN=C3NC5=O)C2)CC(F)(F)F)C)=C(F)C=CC(F)=C1F QIVUCLWGARAQIO-OLIXTKCUSA-N 0.000 description 1
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- XKFVBPBRLDQVSH-UHFFFAOYSA-N 1,1,3-trioxo-1,2-benzothiazole-6-carbaldehyde Chemical compound O=CC1=CC=C2C(=O)NS(=O)(=O)C2=C1 XKFVBPBRLDQVSH-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- NIIUOWMRLBGYAG-UHFFFAOYSA-N 1,1-dioxo-2-(2-trimethylsilylethyl)-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CC[Si](C)(C)C)C(=O)C2=C1 NIIUOWMRLBGYAG-UHFFFAOYSA-N 0.000 description 1
- ZQYWVWZVMZOZIB-UHFFFAOYSA-N 1,1-dioxo-4,5,6,7-tetrahydro-1,2-benzothiazol-3-one Chemical class C1CCCC2=C1C(=O)NS2(=O)=O ZQYWVWZVMZOZIB-UHFFFAOYSA-N 0.000 description 1
- ZDTHRFZLOKXSMA-UHFFFAOYSA-N 1,1-dioxo-4-(1-trimethylsilylethyl)-1,2-benzothiazol-3-one Chemical compound C[Si](C)(C)C(C)C1=CC=CC2=C1C(=O)NS2(=O)=O ZDTHRFZLOKXSMA-UHFFFAOYSA-N 0.000 description 1
- CSTSZUTUXHBCQY-UHFFFAOYSA-N 1,1-dioxo-4-(trifluoromethyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)C1=CC=CC2=C1C(=O)NS2(=O)=O CSTSZUTUXHBCQY-UHFFFAOYSA-N 0.000 description 1
- HKRGCFFQZCGKRD-UHFFFAOYSA-N 1,1-dioxo-4-phenyl-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC(C=3C=CC=CC=3)=C2C(=O)N1CSC1=CC=CC=C1 HKRGCFFQZCGKRD-UHFFFAOYSA-N 0.000 description 1
- RKGSYHBHQGNXAU-UHFFFAOYSA-N 1,1-dioxo-4-propan-2-yl-6-pyrrolidin-1-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1N1CCCC1 RKGSYHBHQGNXAU-UHFFFAOYSA-N 0.000 description 1
- WWXOJCXAQAWOBW-UHFFFAOYSA-N 1,1-dioxo-4-propan-2-yl-6-sulfanyl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S)=CC2=C1C(=O)NS2(=O)=O WWXOJCXAQAWOBW-UHFFFAOYSA-N 0.000 description 1
- VTSFEVZZZKVVJF-UHFFFAOYSA-N 1,1-dioxo-4-propyl-1,2-benzothiazol-3-one Chemical compound CCCC1=CC=CC2=C1C(=O)NS2(=O)=O VTSFEVZZZKVVJF-UHFFFAOYSA-N 0.000 description 1
- TVOMGDRQXXWGBK-UHFFFAOYSA-N 1,1-dioxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 TVOMGDRQXXWGBK-UHFFFAOYSA-N 0.000 description 1
- WXJYCAYBKTXXID-UHFFFAOYSA-N 1,1-dioxo-6-(trifluoromethylsulfonyl)-1,2-benzothiazol-3-one Chemical compound FC(F)(F)S(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 WXJYCAYBKTXXID-UHFFFAOYSA-N 0.000 description 1
- KRLRXJANBUGNSF-UHFFFAOYSA-N 1,2-dimethoxy-4-propan-2-ylbenzene Chemical compound COC1=CC=C(C(C)C)C=C1OC KRLRXJANBUGNSF-UHFFFAOYSA-N 0.000 description 1
- TVFJIXAFZXREJQ-UHFFFAOYSA-N 1,2-thiazole-5-carbaldehyde Chemical compound O=CC1=CC=NS1 TVFJIXAFZXREJQ-UHFFFAOYSA-N 0.000 description 1
- KRRUJXFCUPBUCQ-UHFFFAOYSA-N 1,3,2,4-dioxadithietane 2,2,4,4-tetraoxide Chemical compound S1(=O)(=O)OS(=O)(=O)O1 KRRUJXFCUPBUCQ-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- MBELGTLJWJJGLF-UHFFFAOYSA-N 1,4-dihydropyridine-3-carboxylic acid Chemical class OC(=O)C1=CNC=CC1 MBELGTLJWJJGLF-UHFFFAOYSA-N 0.000 description 1
- HUXJXNSHCKHFIL-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-methoxyethane Chemical compound COCCOCCBr HUXJXNSHCKHFIL-UHFFFAOYSA-N 0.000 description 1
- VWVZFHRDLPHBEG-UHFFFAOYSA-N 1-(chloromethyl)-4-methylsulfanylbenzene Chemical group CSC1=CC=C(CCl)C=C1 VWVZFHRDLPHBEG-UHFFFAOYSA-N 0.000 description 1
- NZVZVGPYTICZBZ-UHFFFAOYSA-N 1-benzylpiperidine Chemical compound C=1C=CC=CC=1CN1CCCCC1 NZVZVGPYTICZBZ-UHFFFAOYSA-N 0.000 description 1
- ITADIVACIVJFJF-UHFFFAOYSA-N 1-bromo-4-methoxy-2-propan-2-ylbenzene Chemical compound COC1=CC=C(Br)C(C(C)C)=C1 ITADIVACIVJFJF-UHFFFAOYSA-N 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- PBLCINWUOADHAN-UHFFFAOYSA-N 1-oxo-2-phenyl-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound O=S1(=S)C2=CC=CC=C2C(=O)N1C1=CC=CC=C1 PBLCINWUOADHAN-UHFFFAOYSA-N 0.000 description 1
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 1
- DVSLBDBGAXXLKZ-UHFFFAOYSA-N 2,3-diethylbenzamide Chemical compound CCC1=CC=CC(C(N)=O)=C1CC DVSLBDBGAXXLKZ-UHFFFAOYSA-N 0.000 description 1
- RXDAPJJFRLSRPX-UHFFFAOYSA-N 2,3-dimethoxypropan-1-ol Chemical compound COCC(CO)OC RXDAPJJFRLSRPX-UHFFFAOYSA-N 0.000 description 1
- WCEMOUOSGJJDCW-UHFFFAOYSA-N 2,3-dimethoxypropoxymethylbenzene Chemical compound COCC(OC)COCC1=CC=CC=C1 WCEMOUOSGJJDCW-UHFFFAOYSA-N 0.000 description 1
- KVIUXRJCBBXEGJ-UHFFFAOYSA-N 2,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C(OC)=C1 KVIUXRJCBBXEGJ-UHFFFAOYSA-N 0.000 description 1
- DAXROGDQROSFAX-UHFFFAOYSA-N 2,6-dichloro-3-[(2-oxo-2-phenylmethoxyethyl)sulfamoyl]benzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(S(=O)(=O)NCC(=O)OCC=2C=CC=CC=2)=C1Cl DAXROGDQROSFAX-UHFFFAOYSA-N 0.000 description 1
- KRALYVVECPOGCD-UHFFFAOYSA-N 2,6-dichloro-3-[2-(dimethylamino)ethyl-methylsulfamoyl]benzoic acid Chemical compound CN(C)CCN(C)S(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1Cl KRALYVVECPOGCD-UHFFFAOYSA-N 0.000 description 1
- RVCLISIPGZGQPU-UHFFFAOYSA-N 2,6-dichloro-3-chlorosulfonylbenzoic acid Chemical compound OC(=O)C1=C(Cl)C=CC(S(Cl)(=O)=O)=C1Cl RVCLISIPGZGQPU-UHFFFAOYSA-N 0.000 description 1
- JDTZZOXWEJEADB-UHFFFAOYSA-N 2,6-dichloro-3-hydroxybenzaldehyde Chemical compound OC1=CC=C(Cl)C(C=O)=C1Cl JDTZZOXWEJEADB-UHFFFAOYSA-N 0.000 description 1
- QVWZNESUFUVSMI-UHFFFAOYSA-N 2,6-dichloro-3-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=C(Cl)C(C(O)=O)=C1Cl QVWZNESUFUVSMI-UHFFFAOYSA-N 0.000 description 1
- WJOVLMLBLLKYKD-UHFFFAOYSA-N 2,6-dichloro-4-hydroxybenzoic acid Chemical compound OC(=O)C1=C(Cl)C=C(O)C=C1Cl WJOVLMLBLLKYKD-UHFFFAOYSA-N 0.000 description 1
- TYMXOVAJNLGZQC-UHFFFAOYSA-N 2,6-dichloro-4-methoxybenzoic acid Chemical compound COC1=CC(Cl)=C(C(O)=O)C(Cl)=C1 TYMXOVAJNLGZQC-UHFFFAOYSA-N 0.000 description 1
- JBLIDPPHFGWTKU-UHFFFAOYSA-N 2,6-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=C(Cl)C=CC=C1Cl JBLIDPPHFGWTKU-UHFFFAOYSA-N 0.000 description 1
- HJHWAFSKOPKTLH-UHFFFAOYSA-N 2,6-difluoro-3-(4-methylpiperazin-4-ium-1-yl)sulfonylbenzoate Chemical compound C1CN(C)CCN1S(=O)(=O)C1=CC=C(F)C(C(O)=O)=C1F HJHWAFSKOPKTLH-UHFFFAOYSA-N 0.000 description 1
- ONOTYLMNTZNAQZ-UHFFFAOYSA-N 2,6-difluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=CC=C1F ONOTYLMNTZNAQZ-UHFFFAOYSA-N 0.000 description 1
- YIKBQFPTPKEFSM-UHFFFAOYSA-N 2,6-dimethoxy-3-nitrobenzoic acid Chemical compound COC1=CC=C([N+]([O-])=O)C(OC)=C1C(O)=O YIKBQFPTPKEFSM-UHFFFAOYSA-N 0.000 description 1
- FAXUBRGCGJYLPU-UHFFFAOYSA-N 2-(1,2-dibromoethyl)-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(Br)CBr)C=CC=C1S(N)(=O)=O FAXUBRGCGJYLPU-UHFFFAOYSA-N 0.000 description 1
- HKZOBICNEHHXFA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)propan-2-ol Chemical compound COC1=CC=C(C(C)(C)O)C=C1OC HKZOBICNEHHXFA-UHFFFAOYSA-N 0.000 description 1
- PEKAELDGTPPFOJ-UHFFFAOYSA-N 2-(4-methoxyphenyl)benzenethiol Chemical compound C1=CC(OC)=CC=C1C1=CC=CC=C1S PEKAELDGTPPFOJ-UHFFFAOYSA-N 0.000 description 1
- DLMYXFNCIVZCRA-UHFFFAOYSA-N 2-(4-methylphenyl)benzenethiol Chemical compound C1=CC(C)=CC=C1C1=CC=CC=C1S DLMYXFNCIVZCRA-UHFFFAOYSA-N 0.000 description 1
- JFYVHYPSJPSTIY-UHFFFAOYSA-N 2-(azetidin-1-yl)-1h-imidazole Chemical compound C1CCN1C1=NC=CN1 JFYVHYPSJPSTIY-UHFFFAOYSA-N 0.000 description 1
- CUTVBDNGHSDKJQ-UHFFFAOYSA-N 2-(bromomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CBr)C(=O)C2=C1 CUTVBDNGHSDKJQ-UHFFFAOYSA-N 0.000 description 1
- KFHDKNYCWMFARS-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical class C1CCC=C2S(=O)(=O)N(CCl)C(=O)C21 KFHDKNYCWMFARS-UHFFFAOYSA-N 0.000 description 1
- DTRAMHZJAGWMIU-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O DTRAMHZJAGWMIU-UHFFFAOYSA-N 0.000 description 1
- CDGVYIINXAFJAK-UHFFFAOYSA-N 2-(chloromethyl)-1,1-dioxo-4-propyl-1,2-benzothiazol-3-one Chemical compound CCCC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O CDGVYIINXAFJAK-UHFFFAOYSA-N 0.000 description 1
- ZLDJKTZONIMWHD-UHFFFAOYSA-N 2-(chloromethyl)-4,6-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O ZLDJKTZONIMWHD-UHFFFAOYSA-N 0.000 description 1
- UFOKHSFJWFQYQC-UHFFFAOYSA-N 2-(chloromethyl)-4,7-dimethoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(OC)C2=C1C(=O)N(CCl)S2(=O)=O UFOKHSFJWFQYQC-UHFFFAOYSA-N 0.000 description 1
- JGUVRAIJJVSETO-UHFFFAOYSA-N 2-(chloromethyl)-4,7-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C2=C1C(=O)N(CCl)S2(=O)=O JGUVRAIJJVSETO-UHFFFAOYSA-N 0.000 description 1
- FWAWGLNOWDDHHB-UHFFFAOYSA-N 2-(chloromethyl)-4-ethoxy-7-[2-(2-methoxyethoxy)ethoxy]-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCOC1=CC=C(OCCOCCOC)C2=C1C(=O)N(CCl)S2(=O)=O FWAWGLNOWDDHHB-UHFFFAOYSA-N 0.000 description 1
- BGKLABSMIJAXHB-UHFFFAOYSA-N 2-(chloromethyl)-4-methoxy-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O BGKLABSMIJAXHB-UHFFFAOYSA-N 0.000 description 1
- WILUOACDJFOPRD-UHFFFAOYSA-N 2-(chloromethyl)-4-methoxy-7-[2-(2-methoxyethoxy)ethoxy]-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound COCCOCCOC1=CC=C(OC)C2=C1S(=O)(=O)N(CCl)C2=O WILUOACDJFOPRD-UHFFFAOYSA-N 0.000 description 1
- DRVSBKBRVIGXNR-UHFFFAOYSA-N 2-(chloromethyl)-4-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O DRVSBKBRVIGXNR-UHFFFAOYSA-N 0.000 description 1
- IAVWIJNTOZKJNL-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OC)=CC2=C1C(=O)N(CCl)S2(=O)=O IAVWIJNTOZKJNL-UHFFFAOYSA-N 0.000 description 1
- XBGHUXIIPRPVRF-UHFFFAOYSA-N 2-(chloromethyl)-6-nitro-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound [O-][N+](=O)C1=CC=C2C(=O)N(CCl)S(=O)(=O)C2=C1 XBGHUXIIPRPVRF-UHFFFAOYSA-N 0.000 description 1
- DARQLSDSHIJNTG-UHFFFAOYSA-N 2-(dibenzylamino)-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 DARQLSDSHIJNTG-UHFFFAOYSA-N 0.000 description 1
- YHOXJBDJTLMLMA-UHFFFAOYSA-N 2-(dibenzylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 YHOXJBDJTLMLMA-UHFFFAOYSA-N 0.000 description 1
- YEVUJTJCNAOPEF-UHFFFAOYSA-N 2-(dibenzylamino)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 YEVUJTJCNAOPEF-UHFFFAOYSA-N 0.000 description 1
- UZUPYNAQIMGZMO-UHFFFAOYSA-N 2-(dimethylamino)-n,n-diethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1N(C)C UZUPYNAQIMGZMO-UHFFFAOYSA-N 0.000 description 1
- NNHUJSDCFVOHGR-UHFFFAOYSA-N 2-(fluoromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CF)C(=O)C2=C1 NNHUJSDCFVOHGR-UHFFFAOYSA-N 0.000 description 1
- CDEUGGREIZGBIX-UHFFFAOYSA-N 2-(furan-2-carbonyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N1C(=O)C1=CC=CO1 CDEUGGREIZGBIX-UHFFFAOYSA-N 0.000 description 1
- PZWPTWZDBJUEMM-UHFFFAOYSA-N 2-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(CO)C(=O)C2=C1 PZWPTWZDBJUEMM-UHFFFAOYSA-N 0.000 description 1
- DLYXOFNUYLZPCF-UHFFFAOYSA-N 2-(iodomethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical class C1=CC=C2S(=O)(=O)N(CI)C(=O)C2=C1 DLYXOFNUYLZPCF-UHFFFAOYSA-N 0.000 description 1
- LWTXRSWGLSFPSU-UHFFFAOYSA-N 2-(trichloromethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LWTXRSWGLSFPSU-UHFFFAOYSA-N 0.000 description 1
- LJMNEQZBOODJQR-UHFFFAOYSA-N 2-(trichloromethyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)(Cl)Cl LJMNEQZBOODJQR-UHFFFAOYSA-N 0.000 description 1
- MXIUWSYTQJLIKE-UHFFFAOYSA-N 2-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=CC=C1C(Cl)=O MXIUWSYTQJLIKE-UHFFFAOYSA-N 0.000 description 1
- GTJYVWLOCBMAKJ-UHFFFAOYSA-N 2-[(1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl)amino]acetic acid Chemical compound CC(C)C1=CC(NCC(O)=O)=CC2=C1C(=O)NS2(=O)=O GTJYVWLOCBMAKJ-UHFFFAOYSA-N 0.000 description 1
- LAZKSSYOKYWMRN-UHFFFAOYSA-N 2-[(2,2,2-trifluoroacetyl)amino]benzoic acid Chemical class OC(=O)C1=CC=CC=C1NC(=O)C(F)(F)F LAZKSSYOKYWMRN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 1
- JLGPMOJYECOCEP-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CC1=CC=CC=C1 JLGPMOJYECOCEP-UHFFFAOYSA-N 0.000 description 1
- VRIWDDSMUSKLDG-UHFFFAOYSA-N 2-benzyl-1,1-dioxo-4-propan-2-yl-4,5,7,7a-tetrahydro-3ah-1,2-benzothiazole-3,6-dione Chemical compound CC(C)C1CC(=O)CC(S2(=O)=O)C1C(=O)N2CC1=CC=CC=C1 VRIWDDSMUSKLDG-UHFFFAOYSA-N 0.000 description 1
- UJFZDOCYWCYDMB-UHFFFAOYSA-N 2-benzyl-1,2-thiazol-3-one Chemical compound O=C1C=CSN1CC1=CC=CC=C1 UJFZDOCYWCYDMB-UHFFFAOYSA-N 0.000 description 1
- ADJQYTXVRDEWAZ-UHFFFAOYSA-N 2-benzyl-4-ethoxy-7-hydroxy-1-oxo-1,2-benzothiazol-3-one Chemical compound CCOC1=CC=C(O)C(S2=O)=C1C(=O)N2CC1=CC=CC=C1 ADJQYTXVRDEWAZ-UHFFFAOYSA-N 0.000 description 1
- SRYPMQCVJZXJJN-UHFFFAOYSA-N 2-benzyl-4-methoxy-7-[2-(2-methoxyethoxy)ethoxy]-1-oxo-1,2-benzothiazol-3-one Chemical compound COCCOCCOC1=CC=C(OC)C(C2=O)=C1S(=O)N2CC1=CC=CC=C1 SRYPMQCVJZXJJN-UHFFFAOYSA-N 0.000 description 1
- ZSDHBZYSXHAZCV-UHFFFAOYSA-N 2-benzyl-6-(dimethylamino)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(N(C)C)=CC(S2(=O)=O)=C1C(=O)N2CC1=CC=CC=C1 ZSDHBZYSXHAZCV-UHFFFAOYSA-N 0.000 description 1
- UOXVVFAKFSWMME-UHFFFAOYSA-N 2-benzyl-6-methoxy-1,1-dioxo-4-propan-2-yl-3a,4,5,6-tetrahydro-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC(OC)CC(C(C)C)C2C(=O)N1CC1=CC=CC=C1 UOXVVFAKFSWMME-UHFFFAOYSA-N 0.000 description 1
- GZFXWMMFLGXWNH-UHFFFAOYSA-N 2-benzylsulfanyl-6-phenylcyclohex-2-ene-1-carboxylic acid Chemical compound C1CC(C(C(=C1)SCC2=CC=CC=C2)C(=O)O)C3=CC=CC=C3 GZFXWMMFLGXWNH-UHFFFAOYSA-N 0.000 description 1
- ONMSBNJJCUCYED-UHFFFAOYSA-N 2-bromo-n,n-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1Br ONMSBNJJCUCYED-UHFFFAOYSA-N 0.000 description 1
- FISSCCRMZBJSID-UHFFFAOYSA-N 2-butan-2-yl-n,n-diethylbenzamide Chemical compound CCC(C)C1=CC=CC=C1C(=O)N(CC)CC FISSCCRMZBJSID-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- INDJCCHBFRVERC-UHFFFAOYSA-N 2-ethenyl-n,n-diethyl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C=C)C=CC=C1S(N)(=O)=O INDJCCHBFRVERC-UHFFFAOYSA-N 0.000 description 1
- FHUFFVIITDISHQ-UHFFFAOYSA-N 2-ethoxyfuran Chemical compound CCOC1=CC=CO1 FHUFFVIITDISHQ-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- MFSJUURIAOOSJR-UHFFFAOYSA-N 2-hydroxy-5-(2,4,4-trimethylpentan-2-yl)benzoic acid Chemical compound CC(C)(C)CC(C)(C)C1=CC=C(O)C(C(O)=O)=C1 MFSJUURIAOOSJR-UHFFFAOYSA-N 0.000 description 1
- OXCGHDNCMSOEBZ-UHFFFAOYSA-N 2-methoxyfuran Chemical compound COC1=CC=CO1 OXCGHDNCMSOEBZ-UHFFFAOYSA-N 0.000 description 1
- DDIIAJRLFATEEE-UHFFFAOYSA-N 2-methyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC=C2S(=O)(=O)N(C)C(=O)C2=C1 DDIIAJRLFATEEE-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- IQANHWBWTVLDTP-UHFFFAOYSA-N 2-methylhex-3-ene Chemical compound CCC=CC(C)C IQANHWBWTVLDTP-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- KGWNRZLPXLBMPS-UHFFFAOYSA-N 2h-1,3-oxazine Chemical compound C1OC=CC=N1 KGWNRZLPXLBMPS-UHFFFAOYSA-N 0.000 description 1
- QPLRNRONJHVNBF-UHFFFAOYSA-N 3,4-dimethoxy-n,n-dimethyl-2-propyl-6-sulfamoylbenzamide Chemical compound CCCC1=C(OC)C(OC)=CC(S(N)(=O)=O)=C1C(=O)N(C)C QPLRNRONJHVNBF-UHFFFAOYSA-N 0.000 description 1
- QDFXRVAOBHEBGJ-UHFFFAOYSA-N 3-(cyclononen-1-yl)-4,5,6,7,8,9-hexahydro-1h-diazonine Chemical compound C1CCCCCCC=C1C1=NNCCCCCC1 QDFXRVAOBHEBGJ-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N 3-methyl-2-pentanone Chemical compound CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- DKJUMLJXHSVZRQ-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1,2-benzothiazol-3-one Chemical compound C1CCCC2=C1SN=C2O DKJUMLJXHSVZRQ-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical class CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- SLRSBRRNLBPRSE-UHFFFAOYSA-N 4,7-dimethoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound COC1=CC=C(OC)C(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 SLRSBRRNLBPRSE-UHFFFAOYSA-N 0.000 description 1
- YRWHBHJLSKSUGV-UHFFFAOYSA-N 4,7-dimethyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C2=C1C(=O)NS2(=O)=O YRWHBHJLSKSUGV-UHFFFAOYSA-N 0.000 description 1
- ZAPMTSHEXFEPSD-UHFFFAOYSA-N 4-(2-chloroethyl)morpholine Chemical compound ClCCN1CCOCC1 ZAPMTSHEXFEPSD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- URXOMQYPMBJYBN-UHFFFAOYSA-N 4-(methylamino)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CNC1=CC=CC2=C1C(=O)NS2(=O)=O URXOMQYPMBJYBN-UHFFFAOYSA-N 0.000 description 1
- PGGOYACMHDPZQV-UHFFFAOYSA-N 4-(trichloromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 PGGOYACMHDPZQV-UHFFFAOYSA-N 0.000 description 1
- LNIAVCRNJMPGGT-UHFFFAOYSA-N 4-(trichloromethyl)benzoyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 LNIAVCRNJMPGGT-UHFFFAOYSA-N 0.000 description 1
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- JQSVXJNTPDVVKM-UHFFFAOYSA-N 4-amino-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NC1=CC=CC2=C1C(=O)NS2(=O)=O JQSVXJNTPDVVKM-UHFFFAOYSA-N 0.000 description 1
- FCBABQMEBSCFOO-UHFFFAOYSA-N 4-bromo-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound BrC1=CC=CC2=C1C(=O)NS2(=O)=O FCBABQMEBSCFOO-UHFFFAOYSA-N 0.000 description 1
- ZPCKQBQECBZKGN-UHFFFAOYSA-N 4-bromo-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound BrC1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 ZPCKQBQECBZKGN-UHFFFAOYSA-N 0.000 description 1
- GDUZDXFNMOFVIH-UHFFFAOYSA-N 4-bromo-2-tert-butyl-1,1-dioxo-1,2-thiazol-3-one Chemical compound CC(C)(C)N1C(=O)C(Br)=CS1(=O)=O GDUZDXFNMOFVIH-UHFFFAOYSA-N 0.000 description 1
- KJPGOPLCNOTYMQ-UHFFFAOYSA-N 4-butan-2-yl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CCC(C)C1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 KJPGOPLCNOTYMQ-UHFFFAOYSA-N 0.000 description 1
- KMDLKGQRTYEFDU-UHFFFAOYSA-N 4-butan-2-yl-2-(chloromethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CCC(C)C1=CC=CC2=C1C(=O)N(CCl)S2(=O)=O KMDLKGQRTYEFDU-UHFFFAOYSA-N 0.000 description 1
- AZGZINIKGIDBPR-UHFFFAOYSA-N 4-chloro-2-(hydroxymethyl)-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)N(CO)C(=O)C2=C1C=CC=C2Cl AZGZINIKGIDBPR-UHFFFAOYSA-N 0.000 description 1
- ZKIUBOCVOSYTQM-UHFFFAOYSA-N 4-cyclohexyl-n,n-diethyl-2-sulfamoylbenzamide Chemical compound C1=C(S(N)(=O)=O)C(C(=O)N(CC)CC)=CC=C1C1CCCCC1 ZKIUBOCVOSYTQM-UHFFFAOYSA-N 0.000 description 1
- SXTPWXBNAVFJOU-UHFFFAOYSA-N 4-cyclohexyl-n,n-diethylbenzamide Chemical compound C1=CC(C(=O)N(CC)CC)=CC=C1C1CCCCC1 SXTPWXBNAVFJOU-UHFFFAOYSA-N 0.000 description 1
- QCIWHVKGVVQHIY-UHFFFAOYSA-N 4-cyclohexylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1CCCCC1 QCIWHVKGVVQHIY-UHFFFAOYSA-N 0.000 description 1
- MWLQEWDQXQHQED-UHFFFAOYSA-N 4-cyclohexylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1CCCCC1 MWLQEWDQXQHQED-UHFFFAOYSA-N 0.000 description 1
- KJJBFZOTCYGZIF-UHFFFAOYSA-N 4-ethynyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound C1=CC(C#C)=C2C(=O)NS(=O)(=O)C2=C1 KJJBFZOTCYGZIF-UHFFFAOYSA-N 0.000 description 1
- DWWDNPIWPBIMOA-UHFFFAOYSA-N 4-fluoro-2-propan-2-ylbenzoic acid Chemical compound CC(C)C1=CC(F)=CC=C1C(O)=O DWWDNPIWPBIMOA-UHFFFAOYSA-N 0.000 description 1
- VLIFCVKBFRCCQT-UHFFFAOYSA-N 4-fluoro-2-propan-2-ylbenzoyl chloride Chemical compound CC(C)C1=CC(F)=CC=C1C(Cl)=O VLIFCVKBFRCCQT-UHFFFAOYSA-N 0.000 description 1
- ZJGLJAXKTJBYSD-UHFFFAOYSA-N 4-hydroxy-2h-1,2-benzothiazine-3-carboxylic acid Chemical class C1=CC=C2SNC(C(=O)O)=C(O)C2=C1 ZJGLJAXKTJBYSD-UHFFFAOYSA-N 0.000 description 1
- BUFBNKOBQPIKKV-UHFFFAOYSA-N 4-methyl-1,1-dioxo-2-(phenylsulfanylmethyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 BUFBNKOBQPIKKV-UHFFFAOYSA-N 0.000 description 1
- 125000006051 4-methyl-2-pentenyl group Chemical group 0.000 description 1
- 125000006418 4-methylphenylsulfonyl group Chemical group 0.000 description 1
- OTLNPYWUJOZPPA-UHFFFAOYSA-M 4-nitrobenzoate Chemical compound [O-]C(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-M 0.000 description 1
- QWJWPDHACGGABF-UHFFFAOYSA-N 5,5-dimethylcyclopenta-1,3-diene Chemical compound CC1(C)C=CC=C1 QWJWPDHACGGABF-UHFFFAOYSA-N 0.000 description 1
- DXHBVVPBOMWHRG-UHFFFAOYSA-N 5,6-dimethoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propyl-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC(OC)=C(OC)C(CCC)=C2C(=O)N1CSC1=CC=CC=C1 DXHBVVPBOMWHRG-UHFFFAOYSA-N 0.000 description 1
- JHUBNQSPUZXGKI-UHFFFAOYSA-N 5-propan-2-yl-1,3-benzodioxole Chemical compound CC(C)C1=CC=C2OCOC2=C1 JHUBNQSPUZXGKI-UHFFFAOYSA-N 0.000 description 1
- DHKUQTIUQLTJRK-UHFFFAOYSA-N 6,7-dihydro-5h-1,2-benzothiazol-4-one Chemical compound O=C1CCCC2=C1C=NS2 DHKUQTIUQLTJRK-UHFFFAOYSA-N 0.000 description 1
- QXISDZNLLFCPLK-UHFFFAOYSA-N 6,7-dimethoxy-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound COC1=CC(C(C)C)=C2C(=O)NS(=O)(=O)C2=C1OC QXISDZNLLFCPLK-UHFFFAOYSA-N 0.000 description 1
- IYNMCOLTNXUUOH-UHFFFAOYSA-N 6-(benzenesulfonyl)-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1S(=O)(=O)C1=CC=CC=C1 IYNMCOLTNXUUOH-UHFFFAOYSA-N 0.000 description 1
- SSRKZHLPNHLAKM-UHFFFAOYSA-N 6-amino-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound NC1=CC=C2C(=O)NS(=O)(=O)C2=C1 SSRKZHLPNHLAKM-UHFFFAOYSA-N 0.000 description 1
- CIOSVBMRIVNNRA-UHFFFAOYSA-N 6-amino-2-benzyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC(N)=CC=C2C(=O)N1CC1=CC=CC=C1 CIOSVBMRIVNNRA-UHFFFAOYSA-N 0.000 description 1
- MACQRECUDXHEMB-UHFFFAOYSA-N 6-ethoxy-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(OCC)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 MACQRECUDXHEMB-UHFFFAOYSA-N 0.000 description 1
- HXSLXSMKOXQSHZ-UHFFFAOYSA-N 6-hydroxy-1,1-dioxo-2-(phenylsulfanylmethyl)-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(O)=CC(S2(=O)=O)=C1C(=O)N2CSC1=CC=CC=C1 HXSLXSMKOXQSHZ-UHFFFAOYSA-N 0.000 description 1
- ORCUFCMGTYHZAU-UHFFFAOYSA-N 6-imidazol-1-yl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C=1C(S(NC2=O)(=O)=O)=C2C(C(C)C)=CC=1N1C=CN=C1 ORCUFCMGTYHZAU-UHFFFAOYSA-N 0.000 description 1
- RRRGMXLPAKHDMX-UHFFFAOYSA-N 6-methyl-1-oxo-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound CC1=CC=C2C(=O)NS(=O)(=S)C2=C1 RRRGMXLPAKHDMX-UHFFFAOYSA-N 0.000 description 1
- JOQYJAMJVBTUAO-UHFFFAOYSA-N 6-methyl-1-oxo-4-propan-2-yl-1-sulfanylidene-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(C)=CC2=C1C(=O)NS2(=O)=S JOQYJAMJVBTUAO-UHFFFAOYSA-N 0.000 description 1
- SLGKNTRLTGMBCU-UHFFFAOYSA-N 6-methylsulfinyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S(C)=O)=CC2=C1C(=O)NS2(=O)=O SLGKNTRLTGMBCU-UHFFFAOYSA-N 0.000 description 1
- HRXRAGMPINUXGG-UHFFFAOYSA-N 6-methylsulfonyl-1,1-dioxo-1,2-benzothiazol-3-one Chemical compound CS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 HRXRAGMPINUXGG-UHFFFAOYSA-N 0.000 description 1
- RTRQYTQKLSTOAB-UHFFFAOYSA-N 6-methylsulfonyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound CC(C)C1=CC(S(C)(=O)=O)=CC2=C1C(=O)NS2(=O)=O RTRQYTQKLSTOAB-UHFFFAOYSA-N 0.000 description 1
- KBHOOQNTKFDMCG-UHFFFAOYSA-N 6-naphthalen-1-ylsulfonyl-1,1-dioxo-4-propan-2-yl-1,2-benzothiazol-3-one Chemical compound C1=CC=C2C(S(=O)(=O)C=3C=C(C4=C(S(NC4=O)(=O)=O)C=3)C(C)C)=CC=CC2=C1 KBHOOQNTKFDMCG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000238876 Acari Species 0.000 description 1
- SESFRYSPDFLNCH-UHFFFAOYSA-N Benzyl benzoate Natural products C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- KSGJVBSONKYXKJ-UHFFFAOYSA-N C1=CC(C)=CC=C1OC(=O)N1S(=O)(=O)C2=CC=CC=C2C1=O Chemical compound C1=CC(C)=CC=C1OC(=O)N1S(=O)(=O)C2=CC=CC=C2C1=O KSGJVBSONKYXKJ-UHFFFAOYSA-N 0.000 description 1
- VHUSXSMCTVQIEH-UHFFFAOYSA-N CC1=C(Cl)C(C(O)=O)=C(Cl)C(C(=O)C(=O)OC(C)(C)C)=C1S(N)(=O)=O Chemical compound CC1=C(Cl)C(C(O)=O)=C(Cl)C(C(=O)C(=O)OC(C)(C)C)=C1S(N)(=O)=O VHUSXSMCTVQIEH-UHFFFAOYSA-N 0.000 description 1
- GWMKMMXMYQEXMI-UHFFFAOYSA-N CCNCC.F.F.F.S Chemical compound CCNCC.F.F.F.S GWMKMMXMYQEXMI-UHFFFAOYSA-N 0.000 description 1
- DLPFFZOABYKWRI-UHFFFAOYSA-N C[Si](Cl)(C)C.[N] Chemical compound C[Si](Cl)(C)C.[N] DLPFFZOABYKWRI-UHFFFAOYSA-N 0.000 description 1
- 101100150553 Caenorhabditis elegans ssu-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- 102100024539 Chymase Human genes 0.000 description 1
- 108090000227 Chymases Proteins 0.000 description 1
- 102100025566 Chymotrypsin-like protease CTRL-1 Human genes 0.000 description 1
- 239000012027 Collins reagent Substances 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- 238000005698 Diels-Alder reaction Methods 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 235000004694 Eucalyptus leucoxylon Nutrition 0.000 description 1
- 244000166102 Eucalyptus leucoxylon Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 108010034145 Helminth Proteins Proteins 0.000 description 1
- 241000283891 Kobus Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 241001139947 Mida Species 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 229910004809 Na2 SO4 Inorganic materials 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- MJFKCEMCWOYWMX-UHFFFAOYSA-N O=C1C2CCCC=C2S(=O)(=O)N1CC1=CC=CC=C1 Chemical compound O=C1C2CCCC=C2S(=O)(=O)N1CC1=CC=CC=C1 MJFKCEMCWOYWMX-UHFFFAOYSA-N 0.000 description 1
- HLVWXPYVLRCCRO-UHFFFAOYSA-N O=C1N(CCl)S(=O)(=O)C2=C1C(C(C)C)=CC1=C2OCO1 Chemical compound O=C1N(CCl)S(=O)(=O)C2=C1C(C(C)C)=CC1=C2OCO1 HLVWXPYVLRCCRO-UHFFFAOYSA-N 0.000 description 1
- MNQITOYQZFGOTG-UHFFFAOYSA-N O=S=O.ONOS(O)(=O)=O Chemical compound O=S=O.ONOS(O)(=O)=O MNQITOYQZFGOTG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- HEFQYHSWBUJGNO-UHFFFAOYSA-N S(=O)(=O)=C1C(C(=O)OCN2S(=O)(=O)C3=CC=CC=C3C2=O)C=CC=C1 Chemical compound S(=O)(=O)=C1C(C(=O)OCN2S(=O)(=O)C3=CC=CC=C3C2=O)C=CC=C1 HEFQYHSWBUJGNO-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 238000006932 Simmons-Smith cyclopropanation reaction Methods 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 102100034130 Tumor necrosis factor alpha-induced protein 8-like protein 1 Human genes 0.000 description 1
- 101710177305 Tumor necrosis factor alpha-induced protein 8-like protein 1 Proteins 0.000 description 1
- XRKIHUXCUIFHAS-UHFFFAOYSA-N [4-(3-methoxy-3-oxopropyl)phenyl]boronic acid Chemical compound COC(=O)CCC1=CC=C(B(O)O)C=C1 XRKIHUXCUIFHAS-UHFFFAOYSA-N 0.000 description 1
- KPMXBXRJRMEDJP-UHFFFAOYSA-N [4-(dimethylamino)-1,1,3-trioxo-1,2-benzothiazol-2-yl]methyl 2,6-dichlorobenzoate Chemical compound CN(C)C1=CC=CC(S2(=O)=O)=C1C(=O)N2COC(=O)C1=C(Cl)C=CC=C1Cl KPMXBXRJRMEDJP-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- OQIQSTLJSLGHID-WNWIJWBNSA-N aflatoxin B1 Chemical compound C=1([C@@H]2C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O OQIQSTLJSLGHID-WNWIJWBNSA-N 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical class C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 208000000594 bullous pemphigoid Diseases 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000021235 carbamoylation Effects 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- ZKKYHMYMJNGPAE-UHFFFAOYSA-M cesium;2,6-dichlorobenzoate Chemical compound [Cs+].[O-]C(=O)C1=C(Cl)C=CC=C1Cl ZKKYHMYMJNGPAE-UHFFFAOYSA-M 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- BOXZXICVMMSYPE-UHFFFAOYSA-N chloromethyl benzoate Chemical compound ClCOC(=O)C1=CC=CC=C1 BOXZXICVMMSYPE-UHFFFAOYSA-N 0.000 description 1
- LLSMWLJPWFSMCP-UHFFFAOYSA-N chloromethylsulfanylbenzene Chemical compound ClCSC1=CC=CC=C1 LLSMWLJPWFSMCP-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 229940117975 chromium trioxide Drugs 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003412 degenerative effect Effects 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical compound CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-O diethylammonium Chemical compound CC[NH2+]CC HPNMFZURTQLUMO-UHFFFAOYSA-O 0.000 description 1
- VEJKSNHPNFHCLF-UHFFFAOYSA-N dimethyl 3-aminobenzene-1,2-dicarboxylate Chemical compound COC(=O)C1=CC=CC(N)=C1C(=O)OC VEJKSNHPNFHCLF-UHFFFAOYSA-N 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- 229940042399 direct acting antivirals protease inhibitors Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003602 elastase inhibitor Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- GEATWTXBCNOEFI-UHFFFAOYSA-N ethyl 2-(dibenzylamino)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GEATWTXBCNOEFI-UHFFFAOYSA-N 0.000 description 1
- SSCVTPLHVQXBOH-UHFFFAOYSA-N ethyl 2-(dimethylcarbamoylsulfanyl)-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1SC(=O)N(C)C SSCVTPLHVQXBOH-UHFFFAOYSA-N 0.000 description 1
- YIUMLILLUMQKHK-UHFFFAOYSA-N ethyl 2-chlorosulfonyl-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1S(Cl)(=O)=O YIUMLILLUMQKHK-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 244000000013 helminth Species 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical group C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000006138 lithiation reaction Methods 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- CYCHFUMPPITFHT-UHFFFAOYSA-N methyl 1,1,3-trioxo-1,2-benzothiazole-4-carboxylate Chemical compound COC(=O)C1=CC=CC2=C1C(=O)NS2(=O)=O CYCHFUMPPITFHT-UHFFFAOYSA-N 0.000 description 1
- VQMDSJOGHWUVSO-UHFFFAOYSA-N methyl 2,6-dichloro-3-hydroxybenzoate Chemical compound COC(=O)C1=C(Cl)C=CC(O)=C1Cl VQMDSJOGHWUVSO-UHFFFAOYSA-N 0.000 description 1
- PXJKQTNNXCVMOY-UHFFFAOYSA-N methyl 2,6-dichloro-4-methoxybenzoate Chemical compound COC(=O)C1=C(Cl)C=C(OC)C=C1Cl PXJKQTNNXCVMOY-UHFFFAOYSA-N 0.000 description 1
- JCWPOAFRJQXRKG-UHFFFAOYSA-N methyl 2-chloro-6-chlorosulfonylbenzoate Chemical compound COC(=O)C1=C(Cl)C=CC=C1S(Cl)(=O)=O JCWPOAFRJQXRKG-UHFFFAOYSA-N 0.000 description 1
- WVWZECQNFWFVFW-UHFFFAOYSA-N methyl 2-methylbenzoate Chemical compound COC(=O)C1=CC=CC=C1C WVWZECQNFWFVFW-UHFFFAOYSA-N 0.000 description 1
- 229940120152 methyl 3-hydroxybenzoate Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N methyl mercaptane Natural products SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- XYDYWTJEGDZLTH-UHFFFAOYSA-N methylenetriphenylphosphorane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=C)C1=CC=CC=C1 XYDYWTJEGDZLTH-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- PLSYPGKOSAWICF-UHFFFAOYSA-N n,n,2-triethylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1CC PLSYPGKOSAWICF-UHFFFAOYSA-N 0.000 description 1
- JBBGSSMOHPZVLV-UHFFFAOYSA-N n,n-diethyl-2,4-dimethoxy-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(OC)C=C(OC)C=C1S(N)(=O)=O JBBGSSMOHPZVLV-UHFFFAOYSA-N 0.000 description 1
- FUTVQQSUNQOZSN-UHFFFAOYSA-N n,n-diethyl-2,4-dimethoxybenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C=C1OC FUTVQQSUNQOZSN-UHFFFAOYSA-N 0.000 description 1
- MGUZDZPNZLKONE-UHFFFAOYSA-N n,n-diethyl-2-(1-trimethylsilylethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C(C)[Si](C)(C)C MGUZDZPNZLKONE-UHFFFAOYSA-N 0.000 description 1
- UQMOFOIGNYOFLH-UHFFFAOYSA-N n,n-diethyl-2-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1C(Cl)(Cl)Cl UQMOFOIGNYOFLH-UHFFFAOYSA-N 0.000 description 1
- ZFIIUAIWXACNKN-UHFFFAOYSA-N n,n-diethyl-2-methoxybenzamide Chemical compound CCN(CC)C(=O)C1=CC=CC=C1OC ZFIIUAIWXACNKN-UHFFFAOYSA-N 0.000 description 1
- NVCSQMXGKSECGZ-UHFFFAOYSA-N n,n-diethyl-2-pentan-3-ylbenzamide Chemical compound CCC(CC)C1=CC=CC=C1C(=O)N(CC)CC NVCSQMXGKSECGZ-UHFFFAOYSA-N 0.000 description 1
- GCYCIZXGEFVREK-UHFFFAOYSA-N n,n-diethyl-2-propylbenzamide Chemical compound CCCC1=CC=CC=C1C(=O)N(CC)CC GCYCIZXGEFVREK-UHFFFAOYSA-N 0.000 description 1
- NOJMEBSLFMCECA-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-4-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1S(N)(=O)=O NOJMEBSLFMCECA-UHFFFAOYSA-N 0.000 description 1
- FGQRELBMYAIRQL-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(1-trimethylsilylethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(C)[Si](C)(C)C)C=CC=C1S(N)(=O)=O FGQRELBMYAIRQL-UHFFFAOYSA-N 0.000 description 1
- MUENLESMFGCZMO-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(Cl)(Cl)Cl)C=CC=C1S(N)(=O)=O MUENLESMFGCZMO-UHFFFAOYSA-N 0.000 description 1
- TUMBBYOKEOPGDW-UHFFFAOYSA-N n,n-diethyl-2-sulfamoyl-6-(trifluoromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=C(C(F)(F)F)C=CC=C1S(N)(=O)=O TUMBBYOKEOPGDW-UHFFFAOYSA-N 0.000 description 1
- CYOBYGVYQIXLPM-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propan-2-yl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(S(N)(=O)=O)C=C(OC)C(OC)=C1C(C)C CYOBYGVYQIXLPM-UHFFFAOYSA-N 0.000 description 1
- OXTGQBUZGBZLPS-UHFFFAOYSA-N n,n-diethyl-3,4-dimethoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C(OC)=C1C(C)C OXTGQBUZGBZLPS-UHFFFAOYSA-N 0.000 description 1
- NRTUBAKONZTQMO-UHFFFAOYSA-N n,n-diethyl-4,5-dimethoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC(OC)=C(OC)C=C1C(C)C NRTUBAKONZTQMO-UHFFFAOYSA-N 0.000 description 1
- OHUSWGCHTXXTKX-UHFFFAOYSA-N n,n-diethyl-4-(trichloromethyl)benzamide Chemical compound CCN(CC)C(=O)C1=CC=C(C(Cl)(Cl)Cl)C=C1 OHUSWGCHTXXTKX-UHFFFAOYSA-N 0.000 description 1
- WJHWLEBLOGOEHP-UHFFFAOYSA-N n,n-diethyl-4-fluoro-2-propan-2-yl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(C)C)C=C(F)C=C1S(N)(=O)=O WJHWLEBLOGOEHP-UHFFFAOYSA-N 0.000 description 1
- QDLFLVWJFFVBSL-UHFFFAOYSA-N n,n-diethyl-4-fluoro-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(F)C=C1C(C)C QDLFLVWJFFVBSL-UHFFFAOYSA-N 0.000 description 1
- IZUSLUJUTFMNLS-UHFFFAOYSA-N n,n-diethyl-4-methoxy-2-propan-2-yl-6-sulfamoylbenzamide Chemical compound CCN(CC)C(=O)C1=C(C(C)C)C=C(OC)C=C1S(N)(=O)=O IZUSLUJUTFMNLS-UHFFFAOYSA-N 0.000 description 1
- IDNGNZOXBMVMLM-UHFFFAOYSA-N n,n-diethyl-4-methoxy-2-propan-2-ylbenzamide Chemical compound CCN(CC)C(=O)C1=CC=C(OC)C=C1C(C)C IDNGNZOXBMVMLM-UHFFFAOYSA-N 0.000 description 1
- GGBJIZFRYFHKDF-UHFFFAOYSA-N n,n-diethyl-6-ethynyl-6-sulfamoylcyclohexa-2,4-diene-1-carboxamide Chemical compound CCN(CC)C(=O)C1C=CC=CC1(C#C)S(N)(=O)=O GGBJIZFRYFHKDF-UHFFFAOYSA-N 0.000 description 1
- HUUSTUALCPTCGJ-UHFFFAOYSA-N n,n-diethylcarbamothioyl chloride Chemical compound CCN(CC)C(Cl)=S HUUSTUALCPTCGJ-UHFFFAOYSA-N 0.000 description 1
- CSOYDKKOANQZJS-UHFFFAOYSA-N n-(1,1,3-trioxo-1,2-benzothiazol-6-yl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C2C(=O)NS(=O)(=O)C2=C1 CSOYDKKOANQZJS-UHFFFAOYSA-N 0.000 description 1
- AEMKYKOVNQKSLP-UHFFFAOYSA-N n-(1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl)acetamide Chemical compound CC(C)C1=CC(NC(C)=O)=CC2=C1C(=O)NS2(=O)=O AEMKYKOVNQKSLP-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- GXUJEVAYWDGTKY-UHFFFAOYSA-N n-methylsulfonyl-1,1,3-trioxo-1,2-benzothiazole-6-sulfonamide Chemical compound CS(=O)(=O)NS(=O)(=O)C1=CC=C2C(=O)NS(=O)(=O)C2=C1 GXUJEVAYWDGTKY-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 1
- SEXOVMIIVBKGGM-UHFFFAOYSA-N naphthalene-1-thiol Chemical compound C1=CC=C2C(S)=CC=CC2=C1 SEXOVMIIVBKGGM-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- JFNLZVQOOSMTJK-KNVOCYPGSA-N norbornene Chemical compound C1[C@@H]2CC[C@H]1C=C2 JFNLZVQOOSMTJK-KNVOCYPGSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 210000001819 pancreatic juice Anatomy 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000137 peptide hydrolase inhibitor Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- SNZXFRFQGXSSGN-UHFFFAOYSA-N phenylsulfanyloxysulfanylbenzene Chemical compound C=1C=CC=CC=1SOSC1=CC=CC=C1 SNZXFRFQGXSSGN-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- KNCYXPMJDCCGSJ-UHFFFAOYSA-N piperidine-2,6-dione Chemical class O=C1CCCC(=O)N1 KNCYXPMJDCCGSJ-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- NPRDHMWYZHSAHR-UHFFFAOYSA-N pyridine;trioxochromium Chemical compound O=[Cr](=O)=O.C1=CC=NC=C1.C1=CC=NC=C1 NPRDHMWYZHSAHR-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 230000006965 reversible inhibition Effects 0.000 description 1
- IXTYVGVNWHFZBK-UHFFFAOYSA-N s-benzyl benzenecarbothioate Chemical compound C=1C=CC=CC=1C(=O)SCC1=CC=CC=C1 IXTYVGVNWHFZBK-UHFFFAOYSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229940125723 sedative agent Drugs 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001923 silver oxide Inorganic materials 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- FKDRRMVMNHSFLQ-UHFFFAOYSA-N tert-butyl 2-[(1,1,3-trioxo-4-propan-2-yl-1,2-benzothiazol-6-yl)amino]acetate Chemical compound CC(C)C1=CC(NCC(=O)OC(C)(C)C)=CC2=C1C(=O)NS2(=O)=O FKDRRMVMNHSFLQ-UHFFFAOYSA-N 0.000 description 1
- YZUAOVCUGSBIPP-UHFFFAOYSA-N tert-butyl N-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]carbamate Chemical compound C1=CC=CN2C(C(NC(=O)OC(C)(C)C)C)=NN=C21 YZUAOVCUGSBIPP-UHFFFAOYSA-N 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000009901 transfer hydrogenation reaction Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- ZCPSWAFANXCCOT-UHFFFAOYSA-N trichloromethanesulfonyl chloride Chemical compound ClC(Cl)(Cl)S(Cl)(=O)=O ZCPSWAFANXCCOT-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- GRGCWBWNLSTIEN-UHFFFAOYSA-N trifluoromethanesulfonyl chloride Chemical compound FC(F)(F)S(Cl)(=O)=O GRGCWBWNLSTIEN-UHFFFAOYSA-N 0.000 description 1
- MFLLMKMFWIUACU-UHFFFAOYSA-N trifluoromethanethiol Chemical compound FC(F)(F)S MFLLMKMFWIUACU-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical class FC(F)(F)* 0.000 description 1
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 description 1
- ZGNCNUVMSLHPQH-UHFFFAOYSA-N trimethyl(5-methylhexa-1,3-dien-2-yloxy)silane Chemical compound CC(C)C=CC(=C)O[Si](C)(C)C ZGNCNUVMSLHPQH-UHFFFAOYSA-N 0.000 description 1
- HCTBXWTVGRRILT-UHFFFAOYSA-N trimethyl-(1-methylpyrrol-2-yl)stannane Chemical compound CN1C=CC=C1[Sn](C)(C)C HCTBXWTVGRRILT-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- ABDKAPXRBAPSQN-UHFFFAOYSA-N veratrole Chemical compound COC1=CC=CC=C1OC ABDKAPXRBAPSQN-UHFFFAOYSA-N 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/02—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings
- C07D275/03—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6536—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having nitrogen and sulfur atoms with or without oxygen atoms, as the only ring hetero atoms
- C07F9/6539—Five-membered rings
- C07F9/6541—Five-membered rings condensed with carbocyclic rings or carbocyclic ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Biochemistry (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US60806890A | 1990-11-01 | 1990-11-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT99411A PT99411A (pt) | 1992-10-30 |
| PT99411B true PT99411B (pt) | 1999-04-30 |
Family
ID=24434891
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT99411A PT99411B (pt) | 1990-11-01 | 1991-10-31 | Processo para a preparacao de novos carboxilatos de 2-sacarinilmetil arilo utilizados como inibidores da enzima proteolitica |
Country Status (17)
| Country | Link |
|---|---|
| EP (1) | EP0483928A1 (OSRAM) |
| JP (1) | JPH04273866A (OSRAM) |
| KR (1) | KR920009807A (OSRAM) |
| AU (1) | AU642537B2 (OSRAM) |
| CA (1) | CA2054653A1 (OSRAM) |
| FI (1) | FI103112B1 (OSRAM) |
| HU (2) | HUT63399A (OSRAM) |
| IE (1) | IE913827A1 (OSRAM) |
| IL (1) | IL99913A (OSRAM) |
| MX (1) | MX9101861A (OSRAM) |
| MY (1) | MY131053A (OSRAM) |
| NO (1) | NO300373B1 (OSRAM) |
| NZ (1) | NZ240444A (OSRAM) |
| PT (1) | PT99411B (OSRAM) |
| RU (1) | RU2114843C1 (OSRAM) |
| SG (1) | SG69977A1 (OSRAM) |
| TW (1) | TW221294B (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU637614B2 (en) * | 1989-05-04 | 1993-06-03 | Sanofi | Saccharin derivatives useful as proteolytic enzyme inhibitors and preparation thereof |
| US5306818A (en) * | 1990-11-01 | 1994-04-26 | Sterling Winthrop Inc. | Tetrahydro 2-saccharinylmerthyl aryl carboxylates |
| US5512589A (en) * | 1990-11-01 | 1996-04-30 | Sterling Winthrop Inc. | 2-saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| AU656027B2 (en) * | 1991-11-15 | 1995-01-19 | Sanofi | Saccharin derivative proteolytic enzime inhibitors |
| US5378720A (en) * | 1991-12-19 | 1995-01-03 | Sterling Winthrop Inc. | Saccharin derivative proteolytic enzyme inhibitors |
| AU668694B2 (en) * | 1991-12-19 | 1996-05-16 | Sanofi-Synthelabo | Saccharin derivative proteolytic enzyme inhibitors |
| US5296496A (en) * | 1991-12-27 | 1994-03-22 | Sterling Winthrop Inc. | 2-saccharinylmethyl phosphates, phosphonates and phosphinates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| US5187173A (en) * | 1991-12-27 | 1993-02-16 | Sterling Winthrop Inc. | 2-saccharinylmethyl and 4,5,6,7-tetrahydro-2-saccharinylmethyl phosphates, phosphonates and phosphinates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| TW226016B (OSRAM) * | 1991-12-30 | 1994-07-01 | Sterling Winthrop Inc | |
| AU653279B2 (en) * | 1991-12-30 | 1994-09-22 | Sanofi | Novel 2-saccharinylmethyl heterocyclic carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof |
| US5684195A (en) * | 1994-07-14 | 1997-11-04 | G. D. Searle & Co. | Method of preparing sulfmonamides from sulfones |
| DE4427996A1 (de) * | 1994-08-08 | 1996-02-15 | Basf Ag | Verfahren zur Herstellung von Saccharincarbonsäuren und -carbonsäureestern |
| DE19533643A1 (de) * | 1995-09-12 | 1997-03-13 | Nycomed Arzneimittel Gmbh | Neue cyclische Derivate von Benzolsulfonamiden |
| TWI462745B (zh) * | 2005-04-28 | 2014-12-01 | Takeda Pharmaceutical | 安定的乳化組成物 |
| JP6239458B2 (ja) * | 2014-07-22 | 2017-11-29 | 日本曹達株式会社 | 2−(ベンジルスルフィニル)−1−シクロアルケン−1−カルボン酸エステルの製造方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4276298A (en) * | 1978-03-24 | 1981-06-30 | Merck & Co., Inc. | 2-Aryl-1,2-benzisothiazolinone-1,1-dioxides and their use as selective protease inhibitors |
| DE3617976A1 (de) * | 1986-05-28 | 1988-01-14 | Alter Sa | 1,4-dihydropyridin, verfahren zu dessen herstellung und dessen verwendung in antithrombotischen medikamenten |
| US4783473A (en) * | 1987-09-02 | 1988-11-08 | E. R. Squibb & Sons, Inc. | Geminally substituted cyclic ether carboxylic acids, derivatives thereof, compositions containing same and method of use |
| AU637614B2 (en) * | 1989-05-04 | 1993-06-03 | Sanofi | Saccharin derivatives useful as proteolytic enzyme inhibitors and preparation thereof |
-
1991
- 1991-10-24 AU AU86083/91A patent/AU642537B2/en not_active Ceased
- 1991-10-30 MX MX9101861A patent/MX9101861A/es not_active IP Right Cessation
- 1991-10-30 EP EP91202809A patent/EP0483928A1/en not_active Withdrawn
- 1991-10-30 SG SG1996007579A patent/SG69977A1/en unknown
- 1991-10-31 CA CA002054653A patent/CA2054653A1/en not_active Abandoned
- 1991-10-31 PT PT99411A patent/PT99411B/pt not_active IP Right Cessation
- 1991-10-31 HU HU913430A patent/HUT63399A/hu unknown
- 1991-10-31 IL IL9991391A patent/IL99913A/en not_active IP Right Cessation
- 1991-11-01 RU SU5010338A patent/RU2114843C1/ru active
- 1991-11-01 KR KR1019910019381A patent/KR920009807A/ko not_active Ceased
- 1991-11-01 MY MYPI91002030A patent/MY131053A/en unknown
- 1991-11-01 FI FI915163A patent/FI103112B1/fi active
- 1991-11-01 JP JP3288080A patent/JPH04273866A/ja active Pending
- 1991-11-01 NZ NZ240444A patent/NZ240444A/en unknown
- 1991-11-01 NO NO914288A patent/NO300373B1/no unknown
- 1991-11-01 IE IE382791A patent/IE913827A1/en not_active Application Discontinuation
- 1991-11-04 TW TW080108649A patent/TW221294B/zh active
-
1995
- 1995-06-29 HU HU95P/P00542P patent/HU211929A9/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HU913430D0 (en) | 1992-01-28 |
| MY131053A (en) | 2007-07-31 |
| AU8608391A (en) | 1992-05-07 |
| PT99411A (pt) | 1992-10-30 |
| IL99913A0 (en) | 1992-08-18 |
| IL99913A (en) | 1996-11-14 |
| HUT63399A (en) | 1993-08-30 |
| RU2114843C1 (ru) | 1998-07-10 |
| FI103112B (fi) | 1999-04-30 |
| NO914288D0 (no) | 1991-11-01 |
| NO300373B1 (no) | 1997-05-20 |
| NZ240444A (en) | 1994-06-27 |
| CA2054653A1 (en) | 1992-05-02 |
| IE913827A1 (en) | 1992-05-22 |
| KR920009807A (ko) | 1992-06-25 |
| FI103112B1 (fi) | 1999-04-30 |
| SG69977A1 (en) | 2000-01-25 |
| FI915163A7 (fi) | 1992-05-02 |
| HU211929A9 (en) | 1996-01-29 |
| AU642537B2 (en) | 1993-10-21 |
| EP0483928A1 (en) | 1992-05-06 |
| NO914288L (no) | 1992-05-04 |
| JPH04273866A (ja) | 1992-09-30 |
| FI915163A0 (fi) | 1991-11-01 |
| TW221294B (OSRAM) | 1994-02-21 |
| MX9101861A (es) | 1992-07-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT99411B (pt) | Processo para a preparacao de novos carboxilatos de 2-sacarinilmetil arilo utilizados como inibidores da enzima proteolitica | |
| US5783589A (en) | 2-saccharinylmethyl aryl and arloxy acetates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| US5563163A (en) | 2-saccharinylmethyl heterocyclic carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| US5128339A (en) | Proteolytic enzyme inhibition method | |
| US5306818A (en) | Tetrahydro 2-saccharinylmerthyl aryl carboxylates | |
| US5250696A (en) | 2-saccharinylmethyl aryl carboxylate | |
| RU2091377C1 (ru) | 2-сахаринилметил- или 4,5,6,7-тетрагидро-2-сахаринилметилфосфаты, -фосфонаты или -фосфинаты и фармацевтическая композиция на их основе | |
| US5597841A (en) | 2-saccharinylmethyl aryl carboxylates useful as proteolytic enzyme inhibitors and compositions and method of use thereof | |
| IL114773A (en) | 2-Tetrahydro-saccharinylmethyl aryl carboxylates their preparation and pharmaceutical compositions containing them | |
| HU211888A9 (hu) | 2-Szacharinil-metil-foszfátok, -foszfonátok és -foszfinátok, melyek proteolitikus enzim inhibitorként használhatók, ezeket tartalmazó gyógyszerkészítmények és eljárás alkalmazásukra | |
| IL119685A (en) | 4,5,6,7-tetrahydro-2-saccharinylmethyl aryl and aryloxy acetates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB1A | Laying open of patent application |
Effective date: 19920527 |
|
| FG3A | Patent granted, date of granting |
Effective date: 19990114 |
|
| MM3A | Annulment or lapse |
Free format text: LAPSE DUE TO NON-PAYMENT OF FEES Effective date: 20000731 |