PT86407B - Processo para a preparacao de novos derivados de alcano-sulfonanilida, e de composicoes farmaceuticas compreendendo os mesmos - Google Patents
Processo para a preparacao de novos derivados de alcano-sulfonanilida, e de composicoes farmaceuticas compreendendo os mesmos Download PDFInfo
- Publication number
- PT86407B PT86407B PT86407A PT8640787A PT86407B PT 86407 B PT86407 B PT 86407B PT 86407 A PT86407 A PT 86407A PT 8640787 A PT8640787 A PT 8640787A PT 86407 B PT86407 B PT 86407B
- Authority
- PT
- Portugal
- Prior art keywords
- compound
- difluorophenoxy
- hydrogen
- preparation
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 84
- 239000008194 pharmaceutical composition Substances 0.000 title claims abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 163
- -1 cyano, carboxy Chemical group 0.000 claims abstract description 161
- 238000002360 preparation method Methods 0.000 claims abstract description 129
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 37
- 239000001257 hydrogen Substances 0.000 claims abstract description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 29
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 24
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 22
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 18
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 18
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 15
- 150000002367 halogens Chemical class 0.000 claims abstract description 15
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 15
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 13
- 125000002252 acyl group Chemical group 0.000 claims abstract description 10
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 10
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 9
- 125000005236 alkanoylamino group Chemical group 0.000 claims abstract description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 7
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 7
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims abstract description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000003396 thiol group Chemical class [H]S* 0.000 claims abstract description 4
- 239000004480 active ingredient Substances 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 195
- 238000006243 chemical reaction Methods 0.000 claims description 81
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 39
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- NPUFTSHCCYEUKN-UHFFFAOYSA-N n-[4-cyano-2-(2,4-difluorophenoxy)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C#N)C=C1OC1=CC=C(F)C=C1F NPUFTSHCCYEUKN-UHFFFAOYSA-N 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 11
- DIIYLGZNZGPXRR-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 DIIYLGZNZGPXRR-UHFFFAOYSA-N 0.000 claims description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 4
- 125000005111 carboxyalkoxy group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 10
- 125000005085 alkoxycarbonylalkoxy group Chemical group 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000004966 cyanoalkyl group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 125000001145 hydrido group Chemical group *[H] 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 210000002268 wool Anatomy 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 192
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 173
- 239000000203 mixture Substances 0.000 description 151
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 99
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 84
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 66
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 64
- 239000000243 solution Substances 0.000 description 51
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 48
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 46
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 45
- 239000002585 base Substances 0.000 description 44
- 239000013078 crystal Substances 0.000 description 44
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 36
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 27
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 27
- 239000002904 solvent Substances 0.000 description 27
- 239000000843 powder Substances 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 23
- 239000007864 aqueous solution Substances 0.000 description 23
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 22
- 238000004440 column chromatography Methods 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 21
- 230000002411 adverse Effects 0.000 description 21
- 239000000741 silica gel Substances 0.000 description 21
- 229910002027 silica gel Inorganic materials 0.000 description 21
- 238000010438 heat treatment Methods 0.000 description 20
- 239000002253 acid Substances 0.000 description 19
- 239000000706 filtrate Substances 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 18
- 235000019341 magnesium sulphate Nutrition 0.000 description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 239000002198 insoluble material Substances 0.000 description 15
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 13
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- 238000003756 stirring Methods 0.000 description 11
- 235000011054 acetic acid Nutrition 0.000 description 10
- LBTPIFQNEKOAIM-UHFFFAOYSA-N n-phenylmethanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=CC=C1 LBTPIFQNEKOAIM-UHFFFAOYSA-N 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 229920006395 saturated elastomer Polymers 0.000 description 10
- 238000006460 hydrolysis reaction Methods 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 235000019270 ammonium chloride Nutrition 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 230000007062 hydrolysis Effects 0.000 description 8
- 238000002347 injection Methods 0.000 description 8
- 239000007924 injection Substances 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 159000000000 sodium salts Chemical class 0.000 description 8
- 239000008096 xylene Substances 0.000 description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 238000006722 reduction reaction Methods 0.000 description 7
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 6
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 6
- 229910052783 alkali metal Inorganic materials 0.000 description 6
- 230000003110 anti-inflammatory effect Effects 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 6
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 235000011181 potassium carbonates Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- JXVYZLOOAZFTSQ-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=C(C(Cl)=O)C=C1OC1=CC=C(F)C=C1F JXVYZLOOAZFTSQ-UHFFFAOYSA-N 0.000 description 5
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 5
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 5
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 150000008065 acid anhydrides Chemical class 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 210000002683 foot Anatomy 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 4
- WQVCWXIKAUQXRO-UHFFFAOYSA-N 1-(2,4-difluorophenoxy)-n-phenylmethanesulfonamide Chemical compound FC1=CC(F)=CC=C1OCS(=O)(=O)NC1=CC=CC=C1 WQVCWXIKAUQXRO-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- LRAFFYILJROBMI-UHFFFAOYSA-N N-[4-acetyl-2-(2-methylphenyl)sulfanylphenyl]methanesulfonamide Chemical compound C(C)(=O)C1=CC(=C(NS(=O)(=O)C)C=C1)SC1=C(C=CC=C1)C LRAFFYILJROBMI-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- 229960000905 indomethacin Drugs 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 230000003902 lesion Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 3
- 229940116357 potassium thiocyanate Drugs 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 3
- 239000006188 syrup Substances 0.000 description 3
- 235000020357 syrup Nutrition 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- PXVLPDMOGXAKMG-UHFFFAOYSA-N 1-[3-(3-chlorophenoxy)-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C=C(Cl)C=CC=2)=C1 PXVLPDMOGXAKMG-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- INUAWAHMVCRKDX-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-(methanesulfonamido)benzoyl chloride Chemical compound CS(=O)(=O)NC1=CC=C(C(Cl)=O)C=C1OC1=CC=C(F)C=C1F INUAWAHMVCRKDX-UHFFFAOYSA-N 0.000 description 2
- STYLLJTXWBQHOK-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-nitrobenzenethiol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1OC1=CC=C(F)C=C1F STYLLJTXWBQHOK-UHFFFAOYSA-N 0.000 description 2
- JMDTYTPKUYOLPX-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)F)=C1 JMDTYTPKUYOLPX-UHFFFAOYSA-N 0.000 description 2
- LYQUUCPJXQIBNK-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1OC1=CC=C(F)C=C1F LYQUUCPJXQIBNK-UHFFFAOYSA-N 0.000 description 2
- UFEKPWVUUKLRLB-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-n-methyl-4-nitrobenzamide Chemical compound CNC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)F)=C1 UFEKPWVUUKLRLB-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- FSWXOANXOQPCFF-UHFFFAOYSA-N 4'-aminopropiophenone Chemical compound CCC(=O)C1=CC=C(N)C=C1 FSWXOANXOQPCFF-UHFFFAOYSA-N 0.000 description 2
- SYDSQUCGGHPSGU-UHFFFAOYSA-N 5-(2,4-difluorophenoxy)-2-methyl-4-nitrobenzoic acid Chemical compound C1=C(C(O)=O)C(C)=CC([N+]([O-])=O)=C1OC1=CC=C(F)C=C1F SYDSQUCGGHPSGU-UHFFFAOYSA-N 0.000 description 2
- AJEDJKSXBIOLLY-UHFFFAOYSA-N 5-(2,4-difluorophenoxy)-2-methyl-4-nitrobenzonitrile Chemical compound C1=C(C#N)C(C)=CC([N+]([O-])=O)=C1OC1=CC=C(F)C=C1F AJEDJKSXBIOLLY-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 208000009386 Experimental Arthritis Diseases 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- 208000002193 Pain Diseases 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 230000001760 anti-analgesic effect Effects 0.000 description 2
- 230000001754 anti-pyretic effect Effects 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 2
- 229940116901 diethyldithiocarbamate Drugs 0.000 description 2
- LMBWSYZSUOEYSN-UHFFFAOYSA-N diethyldithiocarbamic acid Chemical compound CCN(CC)C(S)=S LMBWSYZSUOEYSN-UHFFFAOYSA-N 0.000 description 2
- 239000012990 dithiocarbamate Substances 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 210000000548 hind-foot Anatomy 0.000 description 2
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- KSRHWBLHVZJTKV-UHFFFAOYSA-N iodobenzene dichloride Chemical compound ClI(Cl)C1=CC=CC=C1 KSRHWBLHVZJTKV-UHFFFAOYSA-N 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000005929 isobutyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC(*)=O 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- VRJCXBDHSCHEQQ-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-(4-nitrophenyl)sulfanylphenyl]methanesulfonamide Chemical compound C1=C(OC=2C(=CC(F)=CC=2)F)C(NS(=O)(=O)C)=CC=C1SC1=CC=C([N+]([O-])=O)C=C1 VRJCXBDHSCHEQQ-UHFFFAOYSA-N 0.000 description 2
- QXRFTNZBPHQQAR-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-formylphenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C=O)C=C1OC1=CC=C(F)C=C1F QXRFTNZBPHQQAR-UHFFFAOYSA-N 0.000 description 2
- PUEOYEGPIDDEKV-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-propanethioylphenyl]methanesulfonamide Chemical compound CCC(=S)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 PUEOYEGPIDDEKV-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000013222 sprague-dawley male rat Methods 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 239000011135 tin Substances 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- 125000006000 trichloroethyl group Chemical group 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 125000004505 1,2,4-oxadiazol-5-yl group Chemical group O1N=CN=C1* 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- GLWASYDLRWSDQJ-UHFFFAOYSA-N 1-(3-chloro-4-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(Cl)=C1 GLWASYDLRWSDQJ-UHFFFAOYSA-N 0.000 description 1
- NWYQDOFWQGYMTB-UHFFFAOYSA-N 1-(4-amino-3-phenoxyphenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C=CC=CC=2)=C1 NWYQDOFWQGYMTB-UHFFFAOYSA-N 0.000 description 1
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 1
- KAANTNXREIRLCT-UHFFFAOYSA-N 1-(triphenyl-$l^{5}-phosphanylidene)propan-2-one Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=CC(=O)C)C1=CC=CC=C1 KAANTNXREIRLCT-UHFFFAOYSA-N 0.000 description 1
- PABMMTOONPECLI-UHFFFAOYSA-N 1-[3-(2,5-dichlorophenoxy)-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC=C(Cl)C=2)Cl)=C1 PABMMTOONPECLI-UHFFFAOYSA-N 0.000 description 1
- NTIVVWMEFZZMED-UHFFFAOYSA-N 1-[3-(2,6-dichlorophenoxy)-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC=CC=2Cl)Cl)=C1 NTIVVWMEFZZMED-UHFFFAOYSA-N 0.000 description 1
- UPTFCSXURJILSM-UHFFFAOYSA-N 1-[3-(2-bromophenoxy)-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC=CC=2)Br)=C1 UPTFCSXURJILSM-UHFFFAOYSA-N 0.000 description 1
- YYKHAHLLMRYDOX-UHFFFAOYSA-N 1-[3-(2-chloro-4-fluorophenoxy)-4-nitrophenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)Cl)=C1 YYKHAHLLMRYDOX-UHFFFAOYSA-N 0.000 description 1
- SYWIFRRJWCOUHV-UHFFFAOYSA-N 1-[3-(2-methoxyphenoxy)-4-nitrophenyl]ethanone Chemical compound COC1=CC=CC=C1OC1=CC(C(C)=O)=CC=C1[N+]([O-])=O SYWIFRRJWCOUHV-UHFFFAOYSA-N 0.000 description 1
- OKQXEERVORMUKJ-UHFFFAOYSA-N 1-[4-amino-3-(2,3-dichlorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=C(Cl)C=CC=2)Cl)=C1 OKQXEERVORMUKJ-UHFFFAOYSA-N 0.000 description 1
- LGCFLWKYIOPMMB-UHFFFAOYSA-N 1-[4-amino-3-(2,4,6-trichlorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC(Cl)=CC=2Cl)Cl)=C1 LGCFLWKYIOPMMB-UHFFFAOYSA-N 0.000 description 1
- QOQXTZQLLZYNEJ-UHFFFAOYSA-N 1-[4-amino-3-(2,4-difluorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC(F)=CC=2)F)=C1 QOQXTZQLLZYNEJ-UHFFFAOYSA-N 0.000 description 1
- CBCPNRNSVGOKRF-UHFFFAOYSA-N 1-[4-amino-3-(2,5-dichlorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC=C(Cl)C=2)Cl)=C1 CBCPNRNSVGOKRF-UHFFFAOYSA-N 0.000 description 1
- FESLCEJIUHDFGJ-UHFFFAOYSA-N 1-[4-amino-3-(2,6-dichlorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC=CC=2Cl)Cl)=C1 FESLCEJIUHDFGJ-UHFFFAOYSA-N 0.000 description 1
- APSGFJQORBLQET-UHFFFAOYSA-N 1-[4-amino-3-(2-bromophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC=CC=2)Br)=C1 APSGFJQORBLQET-UHFFFAOYSA-N 0.000 description 1
- WKVFVZVJOWPIKV-UHFFFAOYSA-N 1-[4-amino-3-(2-chloro-4-fluorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC(F)=CC=2)Cl)=C1 WKVFVZVJOWPIKV-UHFFFAOYSA-N 0.000 description 1
- JEKKNOHMBOBSKZ-UHFFFAOYSA-N 1-[4-amino-3-(2-methoxyphenoxy)phenyl]ethanone Chemical compound COC1=CC=CC=C1OC1=CC(C(C)=O)=CC=C1N JEKKNOHMBOBSKZ-UHFFFAOYSA-N 0.000 description 1
- DESLVOIPLOMCKP-UHFFFAOYSA-N 1-[4-amino-3-(2-methylphenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C(N)C(OC=2C(=CC=CC=2)C)=C1 DESLVOIPLOMCKP-UHFFFAOYSA-N 0.000 description 1
- VUMATXPGXPJPAJ-UHFFFAOYSA-N 1-[4-amino-3-chloro-5-(2,4-difluorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC(Cl)=C(N)C(OC=2C(=CC(F)=CC=2)F)=C1 VUMATXPGXPJPAJ-UHFFFAOYSA-N 0.000 description 1
- SHNWBWLMDJJMOO-UHFFFAOYSA-N 1-[4-nitro-3-(2,4,6-trichlorophenoxy)phenyl]ethanone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(Cl)=CC=2Cl)Cl)=C1 SHNWBWLMDJJMOO-UHFFFAOYSA-N 0.000 description 1
- QDKWLJJOYIFEBS-UHFFFAOYSA-N 1-fluoro-4-$l^{1}-oxidanylbenzene Chemical group [O]C1=CC=C(F)C=C1 QDKWLJJOYIFEBS-UHFFFAOYSA-N 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- NVWVWEWVLBKPSM-UHFFFAOYSA-N 2,4-difluorophenol Chemical compound OC1=CC=C(F)C=C1F NVWVWEWVLBKPSM-UHFFFAOYSA-N 0.000 description 1
- WJDROWBOYGGADD-UHFFFAOYSA-N 2-(2,4-difluorophenoxy)-4-(trifluoromethyl)aniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1OC1=CC=C(F)C=C1F WJDROWBOYGGADD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LNQVZZGGOZBOQS-UHFFFAOYSA-N 2-amino-3-methyl-1,1-diphenylbutan-1-ol Chemical compound C=1C=CC=CC=1C(O)(C(N)C(C)C)C1=CC=CC=C1 LNQVZZGGOZBOQS-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- DMANTMOLWFDKBB-UHFFFAOYSA-N 3-(2,4-dichlorophenoxy)-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1OC1=CC=C(Cl)C=C1Cl DMANTMOLWFDKBB-UHFFFAOYSA-N 0.000 description 1
- RUZAGCGPASIORY-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-(methanesulfonamido)benzoic acid Chemical compound CS(=O)(=O)NC1=CC=C(C(O)=O)C=C1OC1=CC=C(F)C=C1F RUZAGCGPASIORY-UHFFFAOYSA-N 0.000 description 1
- GXIRCJJBQBMKPE-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)F)=C1 GXIRCJJBQBMKPE-UHFFFAOYSA-N 0.000 description 1
- RMPOPICJRJDYAX-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-4-nitrobenzamide Chemical compound NC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)F)=C1 RMPOPICJRJDYAX-UHFFFAOYSA-N 0.000 description 1
- KRXFPZXUTFDNON-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-n,n-dimethyl-4-nitrobenzamide Chemical compound CN(C)C(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)F)=C1 KRXFPZXUTFDNON-UHFFFAOYSA-N 0.000 description 1
- OKXKDFWPUGMJGT-UHFFFAOYSA-N 3-(2,4-difluorophenoxy)-n-methoxy-4-nitrobenzamide Chemical compound CONC(=O)C1=CC=C([N+]([O-])=O)C(OC=2C(=CC(F)=CC=2)F)=C1 OKXKDFWPUGMJGT-UHFFFAOYSA-N 0.000 description 1
- YEUDIMDQXFHNPE-UHFFFAOYSA-N 3-(4-amino-2,4-difluorocyclohexa-1,5-dien-1-yl)oxy-1-phenylpropan-1-one Chemical compound NC1(CC(=C(OCCC(=O)C2=CC=CC=C2)C=C1)F)F YEUDIMDQXFHNPE-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- XTKWCVZJUAYHRQ-UHFFFAOYSA-N 3-chloro-1-(4-nitrophenyl)propan-1-one Chemical compound [O-][N+](=O)C1=CC=C(C=C1)C(=O)CCCl XTKWCVZJUAYHRQ-UHFFFAOYSA-N 0.000 description 1
- PAIMPYHIOHKXAT-UHFFFAOYSA-N 3-chloro-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1Cl PAIMPYHIOHKXAT-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- DFICYURBTWEYLS-UHFFFAOYSA-N 4-amino-3-(2,4-dichlorophenoxy)benzonitrile Chemical compound NC1=CC=C(C#N)C=C1OC1=CC=C(Cl)C=C1Cl DFICYURBTWEYLS-UHFFFAOYSA-N 0.000 description 1
- ASGCAISCKMDNRS-UHFFFAOYSA-N 4-amino-3-(2,4-difluorophenoxy)benzamide Chemical compound NC(=O)C1=CC=C(N)C(OC=2C(=CC(F)=CC=2)F)=C1 ASGCAISCKMDNRS-UHFFFAOYSA-N 0.000 description 1
- GGTYAZUHKLEMJR-UHFFFAOYSA-N 4-amino-3-(2,4-difluorophenoxy)benzonitrile Chemical compound NC1=CC=C(C#N)C=C1OC1=CC=C(F)C=C1F GGTYAZUHKLEMJR-UHFFFAOYSA-N 0.000 description 1
- OREVCMGFYSUYPX-UHFFFAOYSA-N 4-amino-3-chlorobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1Cl OREVCMGFYSUYPX-UHFFFAOYSA-N 0.000 description 1
- AIBOXGBLHQZDGN-UHFFFAOYSA-N 4-anilino-3-(methylamino)butan-1-ol Chemical compound OCCC(NC)CNC1=CC=CC=C1 AIBOXGBLHQZDGN-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- MULZDIAQBSLEML-UHFFFAOYSA-N 5-(2,4-difluorophenoxy)-2-methyl-4-nitrobenzoyl chloride Chemical compound C1=C(C(Cl)=O)C(C)=CC([N+]([O-])=O)=C1OC1=CC=C(F)C=C1F MULZDIAQBSLEML-UHFFFAOYSA-N 0.000 description 1
- ICPPDFBNUAGZKN-UHFFFAOYSA-N 5-chloro-2-methyl-4-nitrobenzonitrile Chemical compound CC1=CC([N+]([O-])=O)=C(Cl)C=C1C#N ICPPDFBNUAGZKN-UHFFFAOYSA-N 0.000 description 1
- UJTTUOLQLCQZEA-UHFFFAOYSA-N 9h-fluoren-9-ylmethyl n-(4-hydroxybutyl)carbamate Chemical compound C1=CC=C2C(COC(=O)NCCCCO)C3=CC=CC=C3C2=C1 UJTTUOLQLCQZEA-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 229910001148 Al-Li alloy Inorganic materials 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JLMMTUACMOLMHB-UHFFFAOYSA-N C1=CC=CC=C1.ClICl Chemical compound C1=CC=CC=C1.ClICl JLMMTUACMOLMHB-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241001137251 Corvidae Species 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 208000004454 Hyperalgesia Diseases 0.000 description 1
- 208000035154 Hyperesthesia Diseases 0.000 description 1
- 206010065390 Inflammatory pain Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000187479 Mycobacterium tuberculosis Species 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- DIJLLOKXFPTQNU-UHFFFAOYSA-N NC1=C(C=C(C=C1)C(C)=O)SC1=C(C=CC=C1)C Chemical compound NC1=C(C=C(C=C1)C(C)=O)SC1=C(C=CC=C1)C DIJLLOKXFPTQNU-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000229872 Tolus Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- VGWHZPMBGPMEDV-UHFFFAOYSA-N [1-[3-(2,4-difluorophenoxy)-4-(methanesulfonamido)phenyl]ethylideneamino]urea Chemical compound NC(=O)NN=C(C)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 VGWHZPMBGPMEDV-UHFFFAOYSA-N 0.000 description 1
- QQRFOIGYOLFEDH-UHFFFAOYSA-N [3-(2,4-difluorophenoxy)-4-nitrophenyl]-phenylmethanone Chemical compound [O-][N+](=O)C1=CC=C(C(=O)C=2C=CC=CC=2)C=C1OC1=CC=C(F)C=C1F QQRFOIGYOLFEDH-UHFFFAOYSA-N 0.000 description 1
- MFVLHXQESAJUNV-UHFFFAOYSA-N [4-amino-3-(2,4-difluorophenoxy)phenyl]-phenylmethanone Chemical compound NC1=CC=C(C(=O)C=2C=CC=CC=2)C=C1OC1=CC=C(F)C=C1F MFVLHXQESAJUNV-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- WRWYGOVGIGCDLE-UHFFFAOYSA-N [O]c1ccccc1F Chemical group [O]c1ccccc1F WRWYGOVGIGCDLE-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- UAZDIGCOBKKMPU-UHFFFAOYSA-O azanium;azide Chemical compound [NH4+].[N-]=[N+]=[N-] UAZDIGCOBKKMPU-UHFFFAOYSA-O 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- KRFJLUBVMFXRPN-UHFFFAOYSA-N cuprous oxide Chemical compound [O-2].[Cu+].[Cu+] KRFJLUBVMFXRPN-UHFFFAOYSA-N 0.000 description 1
- 229940112669 cuprous oxide Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- PHWSCBWNPZDYRI-UHFFFAOYSA-N ethyl 4-nitrobenzoate Chemical compound CCOC(=O)C1=CC=C([N+]([O-])=O)C=C1 PHWSCBWNPZDYRI-UHFFFAOYSA-N 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229960002089 ferrous chloride Drugs 0.000 description 1
- 230000027950 fever generation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005935 hexyloxycarbonyl group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- VRNINGUKUJWZTH-UHFFFAOYSA-L lead(2+);dithiocyanate Chemical compound [Pb+2].[S-]C#N.[S-]C#N VRNINGUKUJWZTH-UHFFFAOYSA-L 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- INBDPOJZYZJUDA-UHFFFAOYSA-N methanedithiol Chemical compound SCS INBDPOJZYZJUDA-UHFFFAOYSA-N 0.000 description 1
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 description 1
- XHXXWWGGXFUMAJ-UHFFFAOYSA-N methanethiol;sodium Chemical compound [Na].SC XHXXWWGGXFUMAJ-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 125000001419 myristoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- OJAJMEGPAYWVFS-UHFFFAOYSA-N n-(2-chloro-4-cyanophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(C#N)C=C1Cl OJAJMEGPAYWVFS-UHFFFAOYSA-N 0.000 description 1
- GRHWSFKXOMTFHO-UHFFFAOYSA-N n-(4-acetyl-2-phenoxyphenyl)methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C=CC=CC=2)=C1 GRHWSFKXOMTFHO-UHFFFAOYSA-N 0.000 description 1
- UFKRTEWFEYWIHD-UHFFFAOYSA-N n-(4-cyanophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(C#N)C=C1 UFKRTEWFEYWIHD-UHFFFAOYSA-N 0.000 description 1
- YABUKBRATHJUGT-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-(1-hydroxyethyl)phenyl]methanesulfonamide Chemical compound CC(O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 YABUKBRATHJUGT-UHFFFAOYSA-N 0.000 description 1
- VDXAFRXZGNEPCA-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-(2h-tetrazol-5-yl)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C2=NNN=N2)C=C1OC1=CC=C(F)C=C1F VDXAFRXZGNEPCA-UHFFFAOYSA-N 0.000 description 1
- IHEGZKVHZPENQJ-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-(3-oxobut-1-enyl)phenyl]methanesulfonamide Chemical compound CC(=O)C=CC1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 IHEGZKVHZPENQJ-UHFFFAOYSA-N 0.000 description 1
- SGMLMAGBEBKEMM-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-methylsulfanylphenyl]methanesulfonamide Chemical compound CSC1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 SGMLMAGBEBKEMM-UHFFFAOYSA-N 0.000 description 1
- FVHIRUNXUUXKFO-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-methylsulfinylphenyl]methanesulfonamide Chemical compound CS(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC(F)=CC=2)F)=C1 FVHIRUNXUUXKFO-UHFFFAOYSA-N 0.000 description 1
- ALWGRWXCJPZGMT-UHFFFAOYSA-N n-[2-(2,4-difluorophenoxy)-4-methylsulfonylphenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(S(C)(=O)=O)C=C1OC1=CC=C(F)C=C1F ALWGRWXCJPZGMT-UHFFFAOYSA-N 0.000 description 1
- XDKRKYUIMSGORW-UHFFFAOYSA-N n-[4-(2-bromoacetyl)-2-(2,4-difluorophenoxy)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(C(=O)CBr)C=C1OC1=CC=C(F)C=C1F XDKRKYUIMSGORW-UHFFFAOYSA-N 0.000 description 1
- WKCWRSLGNZGMID-UHFFFAOYSA-N n-[4-acetyl-2-(2,3-dichlorophenoxy)phenyl]methanesulfonamide;sodium Chemical compound [Na].CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=C(Cl)C=CC=2)Cl)=C1 WKCWRSLGNZGMID-UHFFFAOYSA-N 0.000 description 1
- YYNCBFMBGISKKV-UHFFFAOYSA-N n-[4-acetyl-2-(2,4-difluorophenoxy)phenyl]ethanesulfonamide Chemical compound CCS(=O)(=O)NC1=CC=C(C(C)=O)C=C1OC1=CC=C(F)C=C1F YYNCBFMBGISKKV-UHFFFAOYSA-N 0.000 description 1
- NPSGBFYQEJJWCY-UHFFFAOYSA-N n-[4-acetyl-2-(2-bromophenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC=CC=2)Br)=C1 NPSGBFYQEJJWCY-UHFFFAOYSA-N 0.000 description 1
- KXIUFKOSMDRMQZ-UHFFFAOYSA-N n-[4-acetyl-2-(2-chlorophenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC=CC=2)Cl)=C1 KXIUFKOSMDRMQZ-UHFFFAOYSA-N 0.000 description 1
- URQKRSOUXCLDGZ-UHFFFAOYSA-N n-[4-acetyl-2-(2-fluorophenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC=CC=2)F)=C1 URQKRSOUXCLDGZ-UHFFFAOYSA-N 0.000 description 1
- LZGRDPFGYSRKCE-UHFFFAOYSA-N n-[4-acetyl-2-(2-methoxyphenoxy)phenyl]methanesulfonamide Chemical compound COC1=CC=CC=C1OC1=CC(C(C)=O)=CC=C1NS(C)(=O)=O LZGRDPFGYSRKCE-UHFFFAOYSA-N 0.000 description 1
- BKICFVBWWSTQRR-UHFFFAOYSA-N n-[4-acetyl-2-(2-methylsulfinylphenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC=CC=2)S(C)=O)=C1 BKICFVBWWSTQRR-UHFFFAOYSA-N 0.000 description 1
- NNXRNGYWQJUILQ-UHFFFAOYSA-N n-[4-acetyl-2-(2-methylsulfonylphenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C(=CC=CC=2)S(C)(=O)=O)=C1 NNXRNGYWQJUILQ-UHFFFAOYSA-N 0.000 description 1
- GPABWNLMTWMXHR-UHFFFAOYSA-N n-[4-acetyl-2-(3-chlorophenoxy)phenyl]methanesulfonamide;sodium Chemical compound [Na].CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C=C(Cl)C=CC=2)=C1 GPABWNLMTWMXHR-UHFFFAOYSA-N 0.000 description 1
- JBTINWVAFHNBOJ-UHFFFAOYSA-N n-[4-acetyl-2-(4-chlorophenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C=CC(Cl)=CC=2)=C1 JBTINWVAFHNBOJ-UHFFFAOYSA-N 0.000 description 1
- WJXHFYLQDVXXKV-UHFFFAOYSA-N n-[4-acetyl-2-(4-fluorophenoxy)phenyl]methanesulfonamide Chemical compound CC(=O)C1=CC=C(NS(C)(=O)=O)C(OC=2C=CC(F)=CC=2)=C1 WJXHFYLQDVXXKV-UHFFFAOYSA-N 0.000 description 1
- IAXOHHMHNZMWOR-UHFFFAOYSA-N n-[4-amino-2-(2,4-difluorophenoxy)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(N)C=C1OC1=CC=C(F)C=C1F IAXOHHMHNZMWOR-UHFFFAOYSA-N 0.000 description 1
- VQPKLBMRMGEROW-UHFFFAOYSA-N n-[4-cyano-2-(2,4-difluorophenoxy)-5-methylphenyl]methanesulfonamide Chemical compound C1=C(C#N)C(C)=CC(NS(C)(=O)=O)=C1OC1=CC=C(F)C=C1F VQPKLBMRMGEROW-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229960002009 naproxen Drugs 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- PJNZPQUBCPKICU-UHFFFAOYSA-N phosphoric acid;potassium Chemical compound [K].OP(O)(O)=O PJNZPQUBCPKICU-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 235000015108 pies Nutrition 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- TZLVRPLSVNESQC-UHFFFAOYSA-N potassium azide Chemical compound [K+].[N-]=[N+]=[N-] TZLVRPLSVNESQC-UHFFFAOYSA-N 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000001308 pyruvoyl group Chemical group O=C([*])C(=O)C([H])([H])[H] 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- NMNAURDDHOXIDH-UHFFFAOYSA-N sodium;triethoxyalumane Chemical compound [Na].CCO[Al](OCC)OCC NMNAURDDHOXIDH-UHFFFAOYSA-N 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- MXJGKTHZWIGRJG-UHFFFAOYSA-N tert-butyl 2-aminooxyacetate Chemical compound CC(C)(C)OC(=O)CON MXJGKTHZWIGRJG-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- SRVJKTDHMYAMHA-WUXMJOGZSA-N thioacetazone Chemical compound CC(=O)NC1=CC=C(\C=N\NC(N)=S)C=C1 SRVJKTDHMYAMHA-WUXMJOGZSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/22—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/16—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing only one pyridine ring
- C07D213/20—Quaternary compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
- C07D271/07—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/40—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB868631083A GB8631083D0 (en) | 1986-12-31 | 1986-12-31 | 2'-phenoxyalkanesulfonanilide derivatives |
| GB878712647A GB8712647D0 (en) | 1987-05-29 | 1987-05-29 | 2'-phenoxyalkanesulfonanilide derivatives |
| GB878724903A GB8724903D0 (en) | 1987-10-23 | 1987-10-23 | 2-phenoxyalkanesulfonanilide derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT86407A PT86407A (en) | 1988-01-01 |
| PT86407B true PT86407B (pt) | 1990-11-20 |
Family
ID=27263273
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT86407A PT86407B (pt) | 1986-12-31 | 1987-12-18 | Processo para a preparacao de novos derivados de alcano-sulfonanilida, e de composicoes farmaceuticas compreendendo os mesmos |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4866091A (enExample) |
| EP (1) | EP0273369B1 (enExample) |
| KR (1) | KR910008138B1 (enExample) |
| CN (1) | CN87108295A (enExample) |
| AR (1) | AR243499A1 (enExample) |
| AU (1) | AU600782B2 (enExample) |
| DE (1) | DE3777122D1 (enExample) |
| DK (1) | DK693587A (enExample) |
| ES (1) | ES2033292T3 (enExample) |
| FI (1) | FI875719L (enExample) |
| GR (1) | GR3004051T3 (enExample) |
| HU (1) | HU200322B (enExample) |
| IL (1) | IL84913A0 (enExample) |
| NO (1) | NO168299C (enExample) |
| PT (1) | PT86407B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL86462A (en) * | 1987-05-29 | 1992-12-01 | Fujisawa Pharmaceutical Co | Alkanesulfonanilide derivatives, processes for preparation thereof and pharmaceutical compositions comprising the same |
| JPH0753725B2 (ja) * | 1987-10-08 | 1995-06-07 | 富山化学工業株式会社 | 4h―1―ベンゾピラン―4―オン誘導体およびその塩、それらの製造法並びにそれらを含有する抗炎症剤 |
| FI911633A7 (fi) * | 1990-04-27 | 1991-10-28 | Fujisawa Pharmaceutical Co | Menetelmä alkaanisulfoanilidijohdosten valmistamiseksi |
| WO1993003008A1 (fr) * | 1991-08-08 | 1993-02-18 | Taisho Pharmaceutical Co., Ltd. | Compose 5-aminosulfonanilide |
| AU661906B2 (en) * | 1992-06-12 | 1995-08-10 | Taisho Pharmaceutical Co., Ltd. | 5-amino-2-phenoxysulfonanilide compound |
| US5604260A (en) * | 1992-12-11 | 1997-02-18 | Merck Frosst Canada Inc. | 5-methanesulfonamido-1-indanones as an inhibitor of cyclooxygenase-2 |
| CA2211320C (en) * | 1995-01-31 | 2007-03-20 | Merck Frosst Canada Inc. | 5-methanesulfonamido-3h-isobenzofuran-1-ones as inhibitors of cyclooxygenase-2 |
| US5681842A (en) * | 1996-11-08 | 1997-10-28 | Abbott Laboratories | Prostaglandin synthase-2 inhibitors |
| JP2001526648A (ja) | 1997-04-22 | 2001-12-18 | コセンシス・インコーポレイテッド | 炭素環及びヘテロ環で置換されたセミカルバゾン及びチオセミカルバゾン、及びその使用 |
| ES2158809B1 (es) * | 1999-10-18 | 2002-03-16 | Menarini Lab | Nuevos derivados sulfonados como inhibidores de la ciclooxigenasa ii. |
| BRPI0411275A (pt) * | 2003-06-10 | 2006-08-01 | Kalypsys Inc | compostos de carbonila como inibidores de histona deacetilase para tratamento de doenças; composição farmacêutica; método de modular a atividade catalìtica de hdac; método de tratar doença em um indivìduo; utilização de um composto ou composição; método de inibir hdac |
| US7470722B2 (en) | 2004-06-10 | 2008-12-30 | Kalypsys, Inc. | Multicyclic sulfonamide compounds as inhibitors of histone deacetylase for the treatment of disease |
| WO2011053706A1 (en) * | 2009-10-30 | 2011-05-05 | Janssen Pharmaceutica Nv | 4-substituted-2-phenoxy-phenylamine delta opioid receptor modulators |
| JP6484555B2 (ja) * | 2013-08-29 | 2019-03-13 | 京都薬品工業株式会社 | 新規芳香族化合物およびその用途 |
| CN109912434B (zh) * | 2017-12-13 | 2022-07-12 | 上海安谱实验科技股份有限公司 | 苯乙醇胺类β受体激动剂的合成方法 |
| CN109608370A (zh) * | 2019-01-22 | 2019-04-12 | 山西康斯亚森生物科技有限公司 | 尼美舒利衍生物和制备方法及用途 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3531523A (en) * | 1967-07-18 | 1970-09-29 | Upjohn Co | N-(phenoxyphenyl)sulfamides |
| US3531522A (en) * | 1967-07-18 | 1970-09-29 | Upjohn Co | 4'-phenoxyalkanesulfonanilides |
| US3906024A (en) * | 1971-02-24 | 1975-09-16 | Minnesota Mining & Mfg | Perfluoroalkanesulfonamidoaryl compounds |
| US3840597A (en) * | 1971-02-24 | 1974-10-08 | Riker Laboratories Inc | Substituted 2-phenoxy alkane-sulfonanilides |
| AR206496A1 (es) * | 1972-07-03 | 1976-07-30 | Riker Laboratories Inc | Procedimiento para la preparacion de 2-fenoxi-4-nitro-alquil o haloalquilsulfonanilidas |
| US4465508A (en) * | 1979-07-18 | 1984-08-14 | Imperial Chemical Industries Plc | Diphenyl ether herbicides |
| DE3114072A1 (de) * | 1981-04-08 | 1982-11-04 | Basf Ag, 6700 Ludwigshafen | Herbizide diphenylether, deren herstellung und verwendung als herbizide |
| DE3466979D1 (en) * | 1983-12-16 | 1987-12-03 | Ciba Geigy Ag | Process for the protection of keratinic material against the attack of keratin eating insects and phenoxytrifluoromethane sulfonanilides |
-
1987
- 1987-12-18 PT PT86407A patent/PT86407B/pt not_active IP Right Cessation
- 1987-12-22 EP EP87119063A patent/EP0273369B1/en not_active Expired - Lifetime
- 1987-12-22 IL IL84913A patent/IL84913A0/xx unknown
- 1987-12-22 ES ES198787119063T patent/ES2033292T3/es not_active Expired - Lifetime
- 1987-12-22 DE DE8787119063T patent/DE3777122D1/de not_active Expired - Fee Related
- 1987-12-28 AR AR87309710A patent/AR243499A1/es active
- 1987-12-28 FI FI875719A patent/FI875719L/fi not_active Application Discontinuation
- 1987-12-30 HU HU876136A patent/HU200322B/hu not_active IP Right Cessation
- 1987-12-30 AU AU83152/87A patent/AU600782B2/en not_active Ceased
- 1987-12-30 DK DK693587A patent/DK693587A/da not_active Application Discontinuation
- 1987-12-30 NO NO875488A patent/NO168299C/no unknown
- 1987-12-30 KR KR1019870015412A patent/KR910008138B1/ko not_active Expired
- 1987-12-31 CN CN198787108295A patent/CN87108295A/zh active Pending
-
1988
- 1988-06-02 US US07/202,017 patent/US4866091A/en not_active Expired - Fee Related
-
1992
- 1992-03-13 GR GR910402219T patent/GR3004051T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL84913A0 (en) | 1988-06-30 |
| EP0273369B1 (en) | 1992-03-04 |
| FI875719A0 (fi) | 1987-12-28 |
| AU8315287A (en) | 1988-07-07 |
| FI875719A7 (fi) | 1988-07-01 |
| NO875488D0 (no) | 1987-12-30 |
| NO875488L (no) | 1988-07-01 |
| US4866091A (en) | 1989-09-12 |
| KR910008138B1 (ko) | 1991-10-10 |
| DK693587D0 (da) | 1987-12-30 |
| EP0273369A3 (en) | 1989-10-18 |
| NO168299B (no) | 1991-10-28 |
| PT86407A (en) | 1988-01-01 |
| HU200322B (en) | 1990-05-28 |
| GR3004051T3 (enExample) | 1993-03-31 |
| FI875719L (fi) | 1988-07-01 |
| DE3777122D1 (de) | 1992-04-09 |
| AU600782B2 (en) | 1990-08-23 |
| KR880007447A (ko) | 1988-08-27 |
| ES2033292T3 (es) | 1993-03-16 |
| AR243499A1 (es) | 1993-08-31 |
| NO168299C (no) | 1992-02-05 |
| EP0273369A2 (en) | 1988-07-06 |
| HUT45971A (en) | 1988-09-28 |
| CN87108295A (zh) | 1988-07-13 |
| DK693587A (da) | 1988-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT86407B (pt) | Processo para a preparacao de novos derivados de alcano-sulfonanilida, e de composicoes farmaceuticas compreendendo os mesmos | |
| US5612377A (en) | Method of inhibiting leukotriene biosynthesis | |
| TW446694B (en) | Novel 3-aryl-2-hydroxypropionic acid derivative for use in conditions associated with insulin resistance and pharmaceutical composition containing same | |
| US7956214B2 (en) | Process for the preparation of aniline-derived thyroid receptor ligands | |
| CA2166413A1 (en) | Anti-atherosclerotic diaryl compounds | |
| US5034417A (en) | New alkanesulfonanilide derivatives, processes for preparation thereof and pharmaceutical composition comprising the same | |
| WO1992005165A1 (en) | Diphenylpiperazine derivative and drug for circulatory organ containing the same | |
| US4876247A (en) | Methlenediphosphonic acid derivatives, and antirheumatic pharmaceutical composition in which they are present and methods of using same | |
| US4505929A (en) | Sulfur-substituted diphenyl ethers having antiviral activity | |
| PL103550B1 (pl) | Sposob wytwarzania nowych kwasow fenoksyalkilokarboksylowych | |
| US4349568A (en) | Sulfur-substituted diphenyl ethers having antiviral activity | |
| JPS6310777A (ja) | ピペラジンアセトアミド誘導体 | |
| JPH0519543B2 (enExample) | ||
| US3342846A (en) | Asymmetrical diisothiocyanato benzenes | |
| Chang et al. | A general and efficient synthesis of 2-phenylbenzothiazoles from diphenyl disulfides | |
| US3515749A (en) | Amino acid derivatives | |
| EP0777471B1 (en) | Inhibition of leukotriene biosynthesis with urea derivatives | |
| US3709926A (en) | Substituted phenoxy-alkanoic acids and derivatives thereof | |
| US4118501A (en) | Thiazolidine derivatives | |
| IE58684B1 (en) | Aminobenzamide derivatives | |
| US4156735A (en) | Thiazolidine derivatives | |
| PL94264B1 (enExample) | ||
| BR9913012B1 (pt) | processo para preparar um composto, e, composto. | |
| EP0352812A1 (en) | Antiarthritic alpha-arylcarbamoyl cyanoacetic acid derivatives | |
| US3262848A (en) | Poultry enterohepatitis treating compositions and methods of using same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM3A | Annulment or lapse |
Free format text: LAPSE DUE TO NON-PAYMENT OF FEES Effective date: 19941031 |