PT78195B - Process for the preparation of imidazolines and related compounds - Google Patents
Process for the preparation of imidazolines and related compounds Download PDFInfo
- Publication number
- PT78195B PT78195B PT78195A PT7819584A PT78195B PT 78195 B PT78195 B PT 78195B PT 78195 A PT78195 A PT 78195A PT 7819584 A PT7819584 A PT 7819584A PT 78195 B PT78195 B PT 78195B
- Authority
- PT
- Portugal
- Prior art keywords
- methyl
- dihydro
- compound
- naphthalenyl
- formula
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 53
- 238000000034 method Methods 0.000 title claims description 31
- 238000002360 preparation method Methods 0.000 title claims description 9
- 150000002462 imidazolines Chemical class 0.000 title description 3
- -1 3,4-dihydro- naphthalenyl Chemical group 0.000 claims abstract description 45
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 27
- 239000002253 acid Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 abstract description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 abstract description 5
- 230000001430 anti-depressive effect Effects 0.000 abstract description 4
- 239000000935 antidepressant agent Substances 0.000 abstract description 4
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 abstract description 3
- 150000002148 esters Chemical class 0.000 abstract description 3
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 abstract description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 abstract 1
- 125000005263 alkylenediamine group Chemical group 0.000 abstract 1
- 229940005513 antidepressants Drugs 0.000 abstract 1
- 239000002934 diuretic Substances 0.000 abstract 1
- 125000003392 indanyl group Chemical class C1(CCC2=CC=CC=C12)* 0.000 abstract 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 239000000047 product Substances 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- 239000000243 solution Substances 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- 229960002896 clonidine Drugs 0.000 description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 241000700159 Rattus Species 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 8
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- RONQOKZLZGKIQD-UHFFFAOYSA-N 2-(1-methyl-3,4-dihydronaphthalen-2-yl)acetonitrile Chemical compound C1=CC=C2C(C)=C(CC#N)CCC2=C1 RONQOKZLZGKIQD-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 150000004682 monohydrates Chemical class 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- DDHUNHGZUHZNKB-UHFFFAOYSA-N 2,2-dimethylpropane-1,3-diamine Chemical compound NCC(C)(C)CN DDHUNHGZUHZNKB-UHFFFAOYSA-N 0.000 description 3
- NVMKSYJWGFDXIN-UHFFFAOYSA-N 2-(1-methyl-2h-naphthalen-1-yl)acetonitrile Chemical compound C1=CC=C2C(C)(CC#N)CC=CC2=C1 NVMKSYJWGFDXIN-UHFFFAOYSA-N 0.000 description 3
- HZODSUZFJLKBTE-UHFFFAOYSA-N 2-(chloromethyl)-1-methylnaphthalene Chemical compound C1=CC=C2C(C)=C(CCl)C=CC2=C1 HZODSUZFJLKBTE-UHFFFAOYSA-N 0.000 description 3
- KCKZIWSINLBROE-UHFFFAOYSA-N 3,4-dihydro-1h-naphthalen-2-one Chemical compound C1=CC=C2CC(=O)CCC2=C1 KCKZIWSINLBROE-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 3
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- UMKVQXLSQRPFHQ-UHFFFAOYSA-N (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanol Chemical compound C1=CC=C2C(C)C(CO)CCC2=C1 UMKVQXLSQRPFHQ-UHFFFAOYSA-N 0.000 description 2
- IEVRECQMJRVENE-UHFFFAOYSA-N 1-methyl-2-[(1-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydroimidazole Chemical compound CN1CCN=C1CC1=C(C)C2=CC=CC=C2CC1 IEVRECQMJRVENE-UHFFFAOYSA-N 0.000 description 2
- VGZQKUJGVYFKBP-UHFFFAOYSA-N 1-methyl-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1=CC=C2C(C)C(=O)CCC2=C1 VGZQKUJGVYFKBP-UHFFFAOYSA-N 0.000 description 2
- JSOVLJUXGJHXKH-UHFFFAOYSA-N 2-(2,3-dihydro-1h-inden-1-yl)-4,5-dihydro-1h-imidazole Chemical compound N1CCN=C1C1C2=CC=CC=C2CC1 JSOVLJUXGJHXKH-UHFFFAOYSA-N 0.000 description 2
- KWMBADTWRIGGGG-UHFFFAOYSA-N 2-diethoxyphosphorylacetonitrile Chemical compound CCOP(=O)(CC#N)OCC KWMBADTWRIGGGG-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- GPEHQHXBPDGGDP-UHFFFAOYSA-N acetonitrile;propan-2-one Chemical compound CC#N.CC(C)=O GPEHQHXBPDGGDP-UHFFFAOYSA-N 0.000 description 2
- 239000000674 adrenergic antagonist Substances 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 230000003502 anti-nociceptive effect Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- 229960002003 hydrochlorothiazide Drugs 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical group C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- PLPIVSVTRFQJFM-UHFFFAOYSA-N methanimidoyl methanimidate;hydrochloride Chemical compound Cl.N=COC=N PLPIVSVTRFQJFM-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- OSDZHDOKXGSWOD-UHFFFAOYSA-N nitroxyl;hydrochloride Chemical compound Cl.O=N OSDZHDOKXGSWOD-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000004611 spectroscopical analysis Methods 0.000 description 2
- BYJAVTDNIXVSPW-UHFFFAOYSA-N tetryzoline Chemical compound N1CCN=C1C1C2=CC=CC=C2CCC1 BYJAVTDNIXVSPW-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 1
- NYYLZXREFNYPKB-UHFFFAOYSA-N 1-[ethoxy(methyl)phosphoryl]oxyethane Chemical compound CCOP(C)(=O)OCC NYYLZXREFNYPKB-UHFFFAOYSA-N 0.000 description 1
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 1
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 1
- JDBWLTKNTGCBJB-UHFFFAOYSA-N 2-(1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetonitrile Chemical compound C1=CC=C2C(C)C(CC#N)CCC2=C1 JDBWLTKNTGCBJB-UHFFFAOYSA-N 0.000 description 1
- YONMUQFJBVONIM-UHFFFAOYSA-N 2-(1-methyl-3,4-dihydronaphthalen-2-yl)acetic acid Chemical compound C1=CC=C2C(C)=C(CC(O)=O)CCC2=C1 YONMUQFJBVONIM-UHFFFAOYSA-N 0.000 description 1
- GSURLQOKWRJLPY-UHFFFAOYSA-N 2-(1-methylnaphthalen-2-yl)acetic acid Chemical compound C1=CC=C2C(C)=C(CC(O)=O)C=CC2=C1 GSURLQOKWRJLPY-UHFFFAOYSA-N 0.000 description 1
- BSPVWBQCXTWKSM-UHFFFAOYSA-N 2-(1H-inden-2-yl)-1H-imidazole Chemical compound C1C(=CC2=CC=CC=C12)C=1NC=CN=1 BSPVWBQCXTWKSM-UHFFFAOYSA-N 0.000 description 1
- QTADNCWTDKLYQH-UHFFFAOYSA-N 2-(3,4-dihydronaphthalen-2-yl)acetonitrile Chemical compound C1=CC=C2CCC(CC#N)=CC2=C1 QTADNCWTDKLYQH-UHFFFAOYSA-N 0.000 description 1
- NLJRUMRTUKUILX-UHFFFAOYSA-N 2-(3-methyl-1h-inden-2-yl)acetonitrile Chemical compound C1=CC=C2C(C)=C(CC#N)CC2=C1 NLJRUMRTUKUILX-UHFFFAOYSA-N 0.000 description 1
- LDBSFWCYFGGDCE-UHFFFAOYSA-N 2-(6-methoxy-1-methyl-3,4-dihydronaphthalen-2-yl)acetonitrile Chemical compound CC1=C(CC#N)CCC2=CC(OC)=CC=C21 LDBSFWCYFGGDCE-UHFFFAOYSA-N 0.000 description 1
- VIXRKFBKWOHVBR-UHFFFAOYSA-N 2-(naphthalen-2-ylmethyl)-4,5-dihydro-1h-imidazole Chemical compound C=1C=C2C=CC=CC2=CC=1CC1=NCCN1 VIXRKFBKWOHVBR-UHFFFAOYSA-N 0.000 description 1
- CMFMFKYITXSFQA-UHFFFAOYSA-N 2-[(1-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1h-imidazole Chemical compound C1CC2=CC=CC=C2C(C)=C1CC1=NCCN1 CMFMFKYITXSFQA-UHFFFAOYSA-N 0.000 description 1
- RZYAUMGMNAQIKJ-UHFFFAOYSA-N 2-[(1-methylnaphthalen-2-yl)methyl]-1,4,5,6-tetrahydropyrimidine Chemical compound C1=CC2=CC=CC=C2C(C)=C1CC1=NCCCN1 RZYAUMGMNAQIKJ-UHFFFAOYSA-N 0.000 description 1
- IAAPCMDPYJWYNE-UHFFFAOYSA-N 2-[(3-methyl-1h-inden-2-yl)methyl]-4,5-dihydro-1h-imidazole Chemical compound C1C2=CC=CC=C2C(C)=C1CC1=NCCN1 IAAPCMDPYJWYNE-UHFFFAOYSA-N 0.000 description 1
- LYIIBVSRGJSHAV-UHFFFAOYSA-N 2-aminoacetaldehyde Chemical compound NCC=O LYIIBVSRGJSHAV-UHFFFAOYSA-N 0.000 description 1
- LPCWDVLDJVZIHA-UHFFFAOYSA-N 2-naphthalen-2-ylacetonitrile Chemical compound C1=CC=CC2=CC(CC#N)=CC=C21 LPCWDVLDJVZIHA-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- YPXLBVJTQGGGAM-UHFFFAOYSA-N 5-methyl-2-[(1-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1h-imidazole Chemical compound N1C(C)CN=C1CC1=C(C)C2=CC=CC=C2CC1 YPXLBVJTQGGGAM-UHFFFAOYSA-N 0.000 description 1
- ISBHQRSVUQBOMI-UHFFFAOYSA-N 5-methyl-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1C(=O)CCC2=C1C=CC=C2C ISBHQRSVUQBOMI-UHFFFAOYSA-N 0.000 description 1
- PLVQHRKJVDZNTK-UHFFFAOYSA-N 6-methoxy-1-methyl-3,4-dihydro-1h-naphthalen-2-one Chemical compound CC1C(=O)CCC2=CC(OC)=CC=C21 PLVQHRKJVDZNTK-UHFFFAOYSA-N 0.000 description 1
- MKJIEFSOBYUXJB-UHFFFAOYSA-N 9,10-dimethoxy-3-isobutyl-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one Chemical compound C1CN2CC(CC(C)C)C(=O)CC2C2=C1C=C(OC)C(OC)=C2 MKJIEFSOBYUXJB-UHFFFAOYSA-N 0.000 description 1
- 229910001148 Al-Li alloy Inorganic materials 0.000 description 1
- 241000269350 Anura Species 0.000 description 1
- GSIOHTMXHUUION-UHFFFAOYSA-N C1=C(C=CC2=CC=CC=C12)CC=1NC=CN=1 Chemical class C1=C(C=CC2=CC=CC=C12)CC=1NC=CN=1 GSIOHTMXHUUION-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N Hydrocyanic acid Natural products N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- VELDDJHOYPMZNR-UHFFFAOYSA-J [C+4].[O-]S(=O)OS([O-])=O.[O-]S(=O)OS([O-])=O Chemical compound [C+4].[O-]S(=O)OS([O-])=O.[O-]S(=O)OS([O-])=O VELDDJHOYPMZNR-UHFFFAOYSA-J 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 230000003187 abdominal effect Effects 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- GANYMSDHMBJFIL-UHFFFAOYSA-N acetonitrile;ethoxyethane Chemical compound CC#N.CCOCC GANYMSDHMBJFIL-UHFFFAOYSA-N 0.000 description 1
- CQAYJDMWUGRKOJ-UHFFFAOYSA-N acetyloxy-oxido-oxophosphanium Chemical compound CC(=O)O[P+]([O-])=O CQAYJDMWUGRKOJ-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003160 antidiuretic agent Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- UUYYJWFAHPQMJY-UHFFFAOYSA-N cyanomethoxy-oxido-oxophosphanium Chemical compound [O-][P+](=O)OCC#N UUYYJWFAHPQMJY-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 1
- UZWIGTPBKXOYJT-UHFFFAOYSA-N ethyl 2-(1-methyl-3,4-dihydronaphthalen-2-yl)acetate Chemical compound C1=CC=C2CCC(CC(=O)OCC)=C(C)C2=C1 UZWIGTPBKXOYJT-UHFFFAOYSA-N 0.000 description 1
- IBQXCEHAEYSYBT-UHFFFAOYSA-N ethyl 2-(3,4-dihydronaphthalen-2-yl)acetate Chemical compound C1=CC=C2CCC(CC(=O)OCC)=CC2=C1 IBQXCEHAEYSYBT-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 238000007163 homologation reaction Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- UMJJFEIKYGFCAT-UHFFFAOYSA-N indan-2-one Chemical compound C1=CC=C2CC(=O)CC2=C1 UMJJFEIKYGFCAT-UHFFFAOYSA-N 0.000 description 1
- SNWQUNCRDLUDEX-UHFFFAOYSA-N inden-1-one Chemical class C1=CC=C2C(=O)C=CC2=C1 SNWQUNCRDLUDEX-UHFFFAOYSA-N 0.000 description 1
- 150000002469 indenes Chemical group 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- VGOUDZRMSWVZTB-UHFFFAOYSA-N methyl 1-methyl-2h-naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)(C)CC=CC2=C1 VGOUDZRMSWVZTB-UHFFFAOYSA-N 0.000 description 1
- WPQDZEYPGYMDAI-UHFFFAOYSA-N methyl 1-methyl-3,4-dihydro-2h-naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)(C)CCCC2=C1 WPQDZEYPGYMDAI-UHFFFAOYSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- SCZVXVGZMZRGRU-UHFFFAOYSA-N n'-ethylethane-1,2-diamine Chemical compound CCNCCN SCZVXVGZMZRGRU-UHFFFAOYSA-N 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- 239000000133 nasal decongestant Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003040 nociceptive effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical class [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940127230 sympathomimetic drug Drugs 0.000 description 1
- 230000001975 sympathomimetic effect Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 210000001177 vas deferen Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
- C07D233/58—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/18—Monohydroxylic alcohols containing only six-membered aromatic rings as cyclic part
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/34—Monohydroxylic alcohols containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/06—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/22—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/475,193 US4540705A (en) | 1983-03-14 | 1983-03-14 | Antidepressant imidazolines and related compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT78195A PT78195A (en) | 1984-04-01 |
| PT78195B true PT78195B (en) | 1986-04-24 |
Family
ID=23886585
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT78195A PT78195B (en) | 1983-03-14 | 1984-03-02 | Process for the preparation of imidazolines and related compounds |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4540705A (Direct) |
| EP (1) | EP0125410A3 (Direct) |
| JP (1) | JPS59193875A (Direct) |
| KR (1) | KR900001216B1 (Direct) |
| AU (1) | AU568839B2 (Direct) |
| CA (1) | CA1215369A (Direct) |
| DK (1) | DK112984A (Direct) |
| ES (1) | ES530345A0 (Direct) |
| FI (1) | FI840839A7 (Direct) |
| GR (1) | GR81813B (Direct) |
| IL (1) | IL70966A (Direct) |
| NO (1) | NO840893L (Direct) |
| NZ (1) | NZ207184A (Direct) |
| PH (1) | PH19715A (Direct) |
| PT (1) | PT78195B (Direct) |
| ZA (1) | ZA841323B (Direct) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9016800D0 (en) * | 1990-07-31 | 1990-09-12 | Shell Int Research | Tetrahydropyrimidine derivatives |
| US6559157B2 (en) | 1997-10-02 | 2003-05-06 | Daiichi Pharmaceutical Co., Ltd. | Dihydronaphthalene compounds |
| ZA988954B (en) * | 1997-10-02 | 1999-04-12 | Snow Brand Milk Products Co Ltd | Novel dihydronaphthalene compound and production process of the same |
| US6329369B1 (en) | 1997-12-04 | 2001-12-11 | Allergan Sales, Inc. | Methods of treating pain and other conditions |
| US6841684B2 (en) | 1997-12-04 | 2005-01-11 | Allergan, Inc. | Imidiazoles having reduced side effects |
| PT924209E (pt) * | 1997-12-19 | 2003-08-29 | Lilly Co Eli | Compostos de imidazolina hipoglicemicos |
| EP1266897A3 (en) * | 1997-12-19 | 2003-12-03 | Eli Lilly And Company | Hypoglycemic imidazoline compounds |
| US6410562B1 (en) | 1998-12-18 | 2002-06-25 | Eli Lilly And Company | Hypoglycemic imidazoline compounds |
| FR2787451B1 (fr) * | 1998-12-18 | 2001-01-26 | Adir | Nouveaux composes imidazoliniques, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| WO2007085557A2 (en) * | 2006-01-27 | 2007-08-02 | F. Hoffmann-La Roche Ag | Use of substituted 2-imidazole of imidazoline derivatives |
| ES2381589T3 (es) | 2006-10-19 | 2012-05-29 | F. Hoffmann-La Roche Ag | Aminometil-4-imidazoles |
| EP2086959B1 (en) | 2006-11-02 | 2011-11-16 | F. Hoffmann-La Roche AG | Substituted 2-imidazoles as modulators of the trace amine associated receptors |
| CN101535298A (zh) | 2006-11-16 | 2009-09-16 | 弗·哈夫曼-拉罗切有限公司 | 取代的4-咪唑类化合物 |
| CA2672617A1 (en) | 2006-12-13 | 2008-06-19 | F. Hoffmann-La Roche Ag | Novel 2-imidazoles as ligands for trace amine associated receptors (taar) |
| US20080146523A1 (en) | 2006-12-18 | 2008-06-19 | Guido Galley | Imidazole derivatives |
| US7582691B2 (en) * | 2007-01-17 | 2009-09-01 | Sabic Innovative Plastics Ip B.V. | Poly(arylene ether) compositions and articles |
| UA98951C2 (ru) | 2007-02-02 | 2012-07-10 | Ф. Хоффманн-Ля Рош Аг | 2-аминооксазолины и лекарственное средство, которое их содержит |
| JP5130305B2 (ja) | 2007-02-15 | 2013-01-30 | エフ.ホフマン−ラ ロシュ アーゲー | Taar1リガンドとしての2−アミノオキサゾリン |
| CA2691082A1 (en) | 2007-07-02 | 2009-01-08 | F. Hoffmann-La Roche Ag | 2 -imidazolines having a good affinity to the trace amine associated receptors (taars) |
| EP2173719A1 (en) | 2007-07-03 | 2010-04-14 | F. Hoffmann-Roche AG | 4-imidazolines and their use as antidepressants |
| RU2010104632A (ru) | 2007-07-27 | 2011-09-20 | Ф.Хоффманн-Ля Рош Аг (Ch) | 2-азетидинметанамины и 2-пирролидинметанамины в качестве лигандов taar |
| KR101167773B1 (ko) | 2007-08-03 | 2012-07-24 | 에프. 호프만-라 로슈 아게 | Taar1 리간드로서의 피리딘카복스아마이드 및 벤즈아마이드 유도체 |
| US8242153B2 (en) | 2008-07-24 | 2012-08-14 | Hoffmann-La Roche Inc. | 4,5-dihydro-oxazol-2YL derivatives |
| US8354441B2 (en) | 2009-11-11 | 2013-01-15 | Hoffmann-La Roche Inc. | Oxazoline derivatives |
| US9452980B2 (en) | 2009-12-22 | 2016-09-27 | Hoffmann-La Roche Inc. | Substituted benzamides |
| RS60825B1 (sr) | 2016-03-17 | 2020-10-30 | Hoffmann La Roche | Aktivnost derivata 5-etiol-4-metil-pirazol-3-karboksamida kao agonista taar-a |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2731471A (en) * | 1956-01-17 | Nxg hi | ||
| US2161938A (en) * | 1934-07-31 | 1939-06-13 | Soc Of Chemical Ind | Imidazolines |
| FR926661A (fr) * | 1941-07-09 | 1947-10-08 | Lovens Kemiske Fabrik V Aug Ko | Méthyle-imidazolines substituées et leur procédé de préparation |
| GB757650A (en) * | 1953-06-15 | 1956-09-19 | Pfizer & Co C | Improvements in or relating to substituted imidazolines and the preparation thereof |
| DE1150180B (de) * | 1962-04-12 | 1963-06-12 | Merck Ag E | Mittel zur Vorbehandlung der Haut fuer die Rasur |
| GB1317514A (en) * | 1970-11-30 | 1973-05-23 | Erba Carlo Spa | Imidazoline derivatives |
| US4085209A (en) * | 1975-02-05 | 1978-04-18 | Rohm And Haas Company | Preparation and safening effect of 1-substituted imidazole metal salt complexes |
-
1983
- 1983-03-14 US US06/475,193 patent/US4540705A/en not_active Expired - Fee Related
-
1984
- 1984-02-15 IL IL70966A patent/IL70966A/xx not_active IP Right Cessation
- 1984-02-16 NZ NZ207184A patent/NZ207184A/en unknown
- 1984-02-23 ZA ZA841323A patent/ZA841323B/xx unknown
- 1984-02-23 PH PH30284A patent/PH19715A/en unknown
- 1984-02-23 AU AU24877/84A patent/AU568839B2/en not_active Ceased
- 1984-02-28 DK DK112984A patent/DK112984A/da not_active Application Discontinuation
- 1984-02-29 GR GR73944A patent/GR81813B/el unknown
- 1984-03-02 PT PT78195A patent/PT78195B/pt unknown
- 1984-03-02 FI FI840839A patent/FI840839A7/fi not_active Application Discontinuation
- 1984-03-05 EP EP84102382A patent/EP0125410A3/en not_active Withdrawn
- 1984-03-07 ES ES530345A patent/ES530345A0/es active Granted
- 1984-03-08 NO NO840893A patent/NO840893L/no unknown
- 1984-03-09 KR KR1019840001189A patent/KR900001216B1/ko not_active Expired
- 1984-03-09 JP JP59045333A patent/JPS59193875A/ja active Pending
- 1984-03-13 CA CA000449452A patent/CA1215369A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI840839A7 (fi) | 1984-09-15 |
| PH19715A (en) | 1986-06-17 |
| ES8601907A1 (es) | 1985-11-16 |
| JPS59193875A (ja) | 1984-11-02 |
| NZ207184A (en) | 1986-12-05 |
| US4540705A (en) | 1985-09-10 |
| CA1215369A (en) | 1986-12-16 |
| NO840893L (no) | 1984-09-17 |
| GR81813B (Direct) | 1984-12-12 |
| DK112984D0 (da) | 1984-02-28 |
| ES530345A0 (es) | 1985-11-16 |
| ZA841323B (en) | 1984-10-31 |
| EP0125410A2 (en) | 1984-11-21 |
| PT78195A (en) | 1984-04-01 |
| IL70966A (en) | 1987-08-31 |
| AU568839B2 (en) | 1988-01-14 |
| AU2487784A (en) | 1984-09-20 |
| FI840839A0 (fi) | 1984-03-02 |
| KR840008327A (ko) | 1984-12-14 |
| KR900001216B1 (ko) | 1990-02-28 |
| DK112984A (da) | 1984-09-15 |
| IL70966A0 (en) | 1984-05-31 |
| EP0125410A3 (en) | 1987-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT78195B (en) | Process for the preparation of imidazolines and related compounds | |
| EP0028834B1 (en) | Imidazole-5-acetic acid derivatives, their production and use | |
| CS9100906A2 (en) | Substituted azoles, method of their production, preparations that contain these compounds and their application | |
| JP6073229B2 (ja) | [3−(1−(1h−イミダゾール−4−イル)エチル)−2−メチルフェニル]メタノールのエステル・プロドラッグ | |
| PL148590B1 (en) | Method of obtaining novel derivatives of 2-amino-5-hydroxy-4-methylpyrimidine | |
| SU1128837A3 (ru) | Способ получени 2- @ 2-(1,4-бензодиоксанил) @ -2-имидазолин гидрохлорида | |
| NZ238688A (en) | Substituted histidines: pharmaceutical compositions, preparation and uses thereof | |
| US4738979A (en) | α2 -blocking derivatives of imidazole | |
| NZ244258A (en) | 1-(biphenylmethyl)-imidazoline and -pyrimidine derivatives | |
| PL142626B1 (en) | Method of obtaining novel derivatives of aminoguanidine | |
| JPS6222986B2 (Direct) | ||
| NZ222382A (en) | Diazole derivatives and pharmaceutical compositions | |
| US4560696A (en) | Analgesic, antipyretic or anti-inflammatory imidazole compounds | |
| EP0064820A1 (en) | Substituted imidazole and imidazoline derivatives and their preparation and use | |
| US3732243A (en) | 2-(p-bromophenyl)-9-dimethyl-amino-propyl-9h-imidazo(1,2-a)benzimidazole | |
| US3657229A (en) | 1 3-diaza-2 3-cycloalkene derivatives | |
| US3449357A (en) | 2-((2,6-substituted)phenoxymethyl)-2-imidazolines | |
| PL122750B1 (en) | Process for preparing novel ethers of oximes | |
| US4142051A (en) | Arylaminoimidazoline derivatives | |
| US3897431A (en) | 2-{8 {60 -Alkoxy-arylmethyl{9 -2-imidazolines and -1,4,5,6-tetrahydropyrimidines | |
| US5030646A (en) | Novel tricyclic indole compound | |
| US4581460A (en) | Substituted 1-benzoyl-2-phenyliminoimidazolidine derivatives | |
| JP3015702B2 (ja) | イミダゾール誘導体及びそれらの薬剤として許容される酸付加塩及びその製造法並びにそれらを有効成分とする抗潰瘍剤 | |
| BG61121B2 (bg) | Съединения,производни на индана,метод за получаване и междинни продукти при получаването,тяхното приложение като лекарствени средства и съдържащите ги фармацевтични състави | |
| US4663319A (en) | 3-(1,3-dithiol-2-ylidene)-2,4-dioxopyrrolidines, -piperidines, and -hexahydroazepines and use thereof against hepatic diseases |