PT78109B - 2h-<1>benzoxepino<5,4-b>1,4-oxazine derivatives - Google Patents
2h-<1>benzoxepino<5,4-b>1,4-oxazine derivatives Download PDFInfo
- Publication number
- PT78109B PT78109B PT78109A PT7810984A PT78109B PT 78109 B PT78109 B PT 78109B PT 78109 A PT78109 A PT 78109A PT 7810984 A PT7810984 A PT 7810984A PT 78109 B PT78109 B PT 78109B
- Authority
- PT
- Portugal
- Prior art keywords
- oxazine
- trans
- hexahydro
- benzoxepino
- hydrogen
- Prior art date
Links
- 150000004896 1,4-oxazines Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 38
- -1 trans-(4a Chemical compound 0.000 claims abstract description 27
- XISPDFMAOWZEQG-UHFFFAOYSA-N 4h-1,4-oxazin-3-one Chemical compound O=C1COC=CN1 XISPDFMAOWZEQG-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 8
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- LWZYUACNWRVDDJ-UHFFFAOYSA-N 1-benzoxepine Chemical compound O1C=CC=CC2=CC=CC=C12 LWZYUACNWRVDDJ-UHFFFAOYSA-N 0.000 claims description 3
- DNUJVGBNIXGTHC-UHFFFAOYSA-N 3,6-dihydro-2h-oxazine Chemical compound C1NOCC=C1 DNUJVGBNIXGTHC-UHFFFAOYSA-N 0.000 claims description 3
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 6
- IHKALFITVBQHPG-UHFFFAOYSA-N 2h-[1]benzoxepino[5,4-b][1,4]oxazine Chemical compound C1=COC2=CC=CC=C2C2=C1N=CCO2 IHKALFITVBQHPG-UHFFFAOYSA-N 0.000 abstract 2
- YRMMRFYPKHSIDT-PSASIEDQSA-N (4r,5r)-4-amino-2,3,4,5-tetrahydro-1-benzoxepin-5-ol Chemical compound O[C@H]1[C@H](N)CCOC2=CC=CC=C21 YRMMRFYPKHSIDT-PSASIEDQSA-N 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 239000000203 mixture Substances 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 7
- 239000012280 lithium aluminium hydride Substances 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- YRMMRFYPKHSIDT-UHFFFAOYSA-N 4-amino-2,3,4,5-tetrahydro-1-benzoxepin-5-ol Chemical class OC1C(N)CCOC2=CC=CC=C21 YRMMRFYPKHSIDT-UHFFFAOYSA-N 0.000 description 6
- 150000004678 hydrides Chemical class 0.000 description 6
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- YHWMFDLNZGIJSD-UHFFFAOYSA-N 2h-1,4-oxazine Chemical group C1OC=CN=C1 YHWMFDLNZGIJSD-UHFFFAOYSA-N 0.000 description 4
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical group NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 3
- 239000008116 calcium stearate Substances 0.000 description 3
- 235000013539 calcium stearate Nutrition 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 230000004873 systolic arterial blood pressure Effects 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- TVSPPYGAFOVROT-UHFFFAOYSA-N 2-phenoxybutanoic acid Chemical compound CCC(C(O)=O)OC1=CC=CC=C1 TVSPPYGAFOVROT-UHFFFAOYSA-N 0.000 description 2
- KNTMEDNZPJADJU-UHFFFAOYSA-N 3,4-dihydro-2h-1-benzoxepin-5-one Chemical compound O=C1CCCOC2=CC=CC=C12 KNTMEDNZPJADJU-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000005215 alkyl ethers Chemical class 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007963 capsule composition Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000007972 injectable composition Substances 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 150000002688 maleic acid derivatives Chemical class 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000007916 tablet composition Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- ADUJEROBDBLDMY-MWLCHTKSSA-N (4r,5r)-4-amino-7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-ol Chemical compound O1CC[C@@H](N)[C@H](O)C2=CC(OC)=CC=C21 ADUJEROBDBLDMY-MWLCHTKSSA-N 0.000 description 1
- LDNZEVDMGMNCNA-PSASIEDQSA-N (4r,5r)-4-amino-9-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-5-ol Chemical compound O[C@H]1[C@H](N)CCOC2=C1C=CC=C2OC LDNZEVDMGMNCNA-PSASIEDQSA-N 0.000 description 1
- RPCBOMSVFIMNBI-UHFFFAOYSA-N 2,3-dihydro-1-benzoxepine-4,5-dione Chemical compound O=C1C(=O)CCOC2=CC=CC=C21 RPCBOMSVFIMNBI-UHFFFAOYSA-N 0.000 description 1
- UCXPMKAZINUHDW-ZWNOBZJWSA-N 2-chloro-n-[(4r,5r)-5-hydroxy-7-methoxy-2,3,4,5-tetrahydro-1-benzoxepin-4-yl]acetamide Chemical compound O1CC[C@@H](NC(=O)CCl)[C@H](O)C2=CC(OC)=CC=C21 UCXPMKAZINUHDW-ZWNOBZJWSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- RQKDTQACQPHOQL-UHFFFAOYSA-N 3h-2,3-benzodiazepine Chemical compound C1=NNC=CC2=CC=CC=C21 RQKDTQACQPHOQL-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- GPVMQXMRZLHXKF-UHFFFAOYSA-N C1OC(C(C=CC=C2)=C2OC=C2)=C2N=C1.Cl Chemical compound C1OC(C(C=CC=C2)=C2OC=C2)=C2N=C1.Cl GPVMQXMRZLHXKF-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- YCRMQHROSUPJGN-UHFFFAOYSA-N O1C=2C(NC(C1)=O)CCOC1C=2C=CC=C1 Chemical compound O1C=2C(NC(C1)=O)CCOC1C=2C=CC=C1 YCRMQHROSUPJGN-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000003869 acetamides Chemical class 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- AQEFLFZSWDEAIP-UHFFFAOYSA-N di-tert-butyl ether Chemical class CC(C)(C)OC(C)(C)C AQEFLFZSWDEAIP-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000007911 effervescent powder Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N hydroxymaleic acid group Chemical group O/C(/C(=O)O)=C/C(=O)O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- 238000002664 inhalation therapy Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- OWFXIOWLTKNBAP-UHFFFAOYSA-N isoamyl nitrite Chemical compound CC(C)CCON=O OWFXIOWLTKNBAP-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- YEGKQMHXWMODPW-UHFFFAOYSA-N n-(5-oxo-3,4-dihydro-2h-1-benzoxepin-4-yl)acetamide Chemical compound O=C1C(NC(=O)C)CCOC2=CC=CC=C21 YEGKQMHXWMODPW-UHFFFAOYSA-N 0.000 description 1
- UVBMZKBIZUWTLV-UHFFFAOYSA-N n-methyl-n-propylpropan-1-amine Chemical compound CCCN(C)CCC UVBMZKBIZUWTLV-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 150000003628 tricarboxylic acids Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D313/00—Heterocyclic compounds containing rings of more than six members having one oxygen atom as the only ring hetero atom
- C07D313/02—Seven-membered rings
- C07D313/06—Seven-membered rings condensed with carbocyclic rings or ring systems
- C07D313/08—Seven-membered rings condensed with carbocyclic rings or ring systems condensed with one six-membered ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46640783A | 1983-02-15 | 1983-02-15 | |
| US56275983A | 1983-12-21 | 1983-12-21 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT78109A PT78109A (en) | 1984-03-01 |
| PT78109B true PT78109B (en) | 1986-05-20 |
Family
ID=27041648
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT78109A PT78109B (en) | 1983-02-15 | 1984-02-15 | 2h-<1>benzoxepino<5,4-b>1,4-oxazine derivatives |
Country Status (14)
| Country | Link |
|---|---|
| EP (1) | EP0116373B1 (enFirst) |
| KR (1) | KR900005471B1 (enFirst) |
| AU (1) | AU561700B2 (enFirst) |
| CA (1) | CA1236833A (enFirst) |
| DE (1) | DE3463142D1 (enFirst) |
| DK (1) | DK158986C (enFirst) |
| ES (1) | ES529720A0 (enFirst) |
| GR (1) | GR81510B (enFirst) |
| IE (1) | IE56788B1 (enFirst) |
| IL (1) | IL70941A (enFirst) |
| NO (1) | NO167571C (enFirst) |
| NZ (1) | NZ207110A (enFirst) |
| PH (1) | PH22343A (enFirst) |
| PT (1) | PT78109B (enFirst) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE939614C (de) * | 1949-02-26 | 1956-02-23 | Ernst Rodenhaeuser | Kolbendichtung fuer Kolbenfuellhalter |
| US4766212A (en) * | 1983-02-15 | 1988-08-23 | Merrell Dow Pharmaceuticals Inc. | 2H-[1]benzoxepino[5,4-b]-1,4-oxazine derivatives |
| NZ207111A (en) * | 1983-02-15 | 1986-07-11 | Merrell Dow Pharma | (4a,11b)-3,4,4a,5,6,11b-hexahydro-2h-(1)benzoxepino(5,4-b)-1,4 oxazine derivatives and pharmaceutical compositions |
| FR2698873B1 (fr) * | 1992-12-07 | 1995-02-24 | Lipha | Benzocycloheptènes, benzoxépines et benzothiépines activateurs des canaux potassiques, procédé de préparation, composition pharmaceutique les contenant. |
| EP2571858B1 (en) | 2010-05-21 | 2018-06-20 | Research Triangle Institute | Phenylmorpholines and analogues thereof |
| AU2011255456B2 (en) | 2010-05-21 | 2017-01-19 | Dignity Health Doing Business As St. Joseph's Hospital And Medical Center And Barrow Neurological Institute | 1 - phenylmorpholine derivatives as hydroxybupropion analogues for treating drug dependence |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1593760A1 (de) * | 1967-02-01 | 1972-06-08 | Boehringer Sohn Ingelheim | Verfahren zur Herstellung neuer Benz-epinderivate |
-
1984
- 1984-02-10 PH PH30228A patent/PH22343A/en unknown
- 1984-02-10 NZ NZ207110A patent/NZ207110A/en unknown
- 1984-02-13 CA CA000447245A patent/CA1236833A/en not_active Expired
- 1984-02-13 AU AU24542/84A patent/AU561700B2/en not_active Ceased
- 1984-02-13 IL IL70941A patent/IL70941A/xx not_active IP Right Cessation
- 1984-02-13 GR GR73786A patent/GR81510B/el unknown
- 1984-02-14 KR KR1019840000692A patent/KR900005471B1/ko not_active Expired
- 1984-02-14 NO NO840534A patent/NO167571C/no unknown
- 1984-02-14 DE DE8484101520T patent/DE3463142D1/de not_active Expired
- 1984-02-14 ES ES529720A patent/ES529720A0/es active Granted
- 1984-02-14 IE IE334/84A patent/IE56788B1/en not_active IP Right Cessation
- 1984-02-14 EP EP84101520A patent/EP0116373B1/en not_active Expired
- 1984-02-14 DK DK066284A patent/DK158986C/da active
- 1984-02-15 PT PT78109A patent/PT78109B/pt not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL70941A0 (en) | 1984-05-31 |
| DK66284D0 (da) | 1984-02-14 |
| GR81510B (enFirst) | 1984-12-11 |
| AU561700B2 (en) | 1987-05-14 |
| IE56788B1 (en) | 1991-12-18 |
| DE3463142D1 (de) | 1987-05-21 |
| PH22343A (en) | 1988-08-12 |
| NO167571C (no) | 1991-11-20 |
| NO840534L (no) | 1984-08-16 |
| IL70941A (en) | 1987-12-31 |
| DK158986C (da) | 1991-01-07 |
| DK158986B (da) | 1990-08-13 |
| ES8600301A1 (es) | 1985-10-01 |
| KR840007729A (ko) | 1984-12-10 |
| ES529720A0 (es) | 1985-10-01 |
| IE840334L (en) | 1984-08-15 |
| NO167571B (no) | 1991-08-12 |
| EP0116373A1 (en) | 1984-08-22 |
| EP0116373B1 (en) | 1987-04-15 |
| CA1236833A (en) | 1988-05-17 |
| KR900005471B1 (ko) | 1990-07-30 |
| AU2454284A (en) | 1984-08-23 |
| DK66284A (da) | 1984-08-16 |
| PT78109A (en) | 1984-03-01 |
| NZ207110A (en) | 1986-05-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100246154B1 (ko) | 수용성 캠프토테신 유도체 | |
| JP2703408B2 (ja) | 1,4‐ベンゾチアゼピン誘導体 | |
| JPS6350354B2 (enFirst) | ||
| IE913732A1 (en) | Oxindole peptide antagonists | |
| JPS6049192B2 (ja) | 新規置換ベンズアミド、その製造方法及びこれを有効成分とする向精神薬 | |
| US4609494A (en) | 5-acetyl-3,4,5,6-tetrahydro-4-oxo-2,6-methano-2H-1,3,5-benzothiazocine(benzodiazocine)-11-carboxylates useful as calcium channel blockers | |
| HU211872A9 (en) | Sulfonamides derived from benzocyclic or benzoheterocyclic acids, their preparation and application in therapeutics | |
| US4529724A (en) | 6H-indolo[2,1-c][1,4]benzodiazepines and 12-oxo derivatives useful as antihypertensives | |
| PT78109B (en) | 2h-<1>benzoxepino<5,4-b>1,4-oxazine derivatives | |
| JPS63290868A (ja) | ジケトピペラジン誘導体およびその塩類 | |
| GB2092144A (en) | Novel indanyl derivaitves | |
| BE1003698A3 (fr) | Derives sulfonyles de la thieno-triazolo-diazepine, un procede pour leur preparation et des compositions therapeutiques en contenant. | |
| EP0179428B1 (en) | Indoleacetic acid derivative and a pharmaceutical preparation | |
| GB1594687A (en) | 2-aminotetralin derivatives and processes for producing the same | |
| JPH03120271A (ja) | 抗虚血活性を有するフェニルアルキルアミン誘導体 | |
| AU771745B2 (en) | New aminopyrroline compounds, a process for their preparation and pharmaceutical compositions containing them | |
| US4141988A (en) | 2,9-Dioxatricyclo[4,3,1,03,7 ]decane derivatives, processes for their preparation and pharmaceutical compositions thereof | |
| PT93504A (pt) | Processo para a preparacao de derivados de tetra-hidronaftaleno e de composicoes farmaceuticas que os contem | |
| SU1438611A3 (ru) | Способ получени производных 1,5-бензоксатиепина или его кислотно-аддитивных солей | |
| US3635971A (en) | 3 (3 4-dihydro-3-oxo-2-quinoxalinyl) propionamides | |
| JPS61100555A (ja) | ベンゾフエノンオキシム誘導体 | |
| JPH05506654A (ja) | 1,5―ベンゾチアゼピノン誘導体、その製法および医薬品用途 | |
| RU2033414C1 (ru) | Производные 4,5,6,7-тетрагидробензимидазола | |
| WO1992020666A1 (fr) | Derive de benzothiadiazine | |
| JPH05148250A (ja) | オキサジアジン誘導体を有効成分として含有する抗血栓剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM3A | Annulment or lapse |
Free format text: LAPSE DUE TO NON-PAYMENT OF FEES Effective date: 20001130 |