PL99117B1 - Sposob wytwarzania pylistego stalego chlorku cyjanuru - Google Patents
Sposob wytwarzania pylistego stalego chlorku cyjanuru Download PDFInfo
- Publication number
- PL99117B1 PL99117B1 PL1976191923A PL19192376A PL99117B1 PL 99117 B1 PL99117 B1 PL 99117B1 PL 1976191923 A PL1976191923 A PL 1976191923A PL 19192376 A PL19192376 A PL 19192376A PL 99117 B1 PL99117 B1 PL 99117B1
- Authority
- PL
- Poland
- Prior art keywords
- chloride
- liquid
- cyanuric chloride
- cyanurate
- scrubbing
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 title claims description 22
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 title claims description 19
- 238000004519 manufacturing process Methods 0.000 title claims 2
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 41
- 239000007788 liquid Substances 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 14
- 238000004821 distillation Methods 0.000 claims description 13
- 239000007789 gas Substances 0.000 claims description 13
- 238000005201 scrubbing Methods 0.000 claims description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 239000011261 inert gas Substances 0.000 claims description 8
- 238000001816 cooling Methods 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 7
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 claims description 6
- 238000005406 washing Methods 0.000 claims description 6
- QBRNFAFLULFMKX-UHFFFAOYSA-N 3-chloro-1,2,4-trifluoro-5-methylbenzene Chemical compound CC1=CC(F)=C(F)C(Cl)=C1F QBRNFAFLULFMKX-UHFFFAOYSA-N 0.000 claims description 4
- RWNKSTSCBHKHTB-UHFFFAOYSA-N Hexachloro-1,3-butadiene Chemical compound ClC(Cl)=C(Cl)C(Cl)=C(Cl)Cl RWNKSTSCBHKHTB-UHFFFAOYSA-N 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- DQRLCTAGMVGVFH-UHFFFAOYSA-N cyanide;hydrochloride Chemical compound Cl.N#[C-] DQRLCTAGMVGVFH-UHFFFAOYSA-N 0.000 claims description 4
- 238000002386 leaching Methods 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- XXZOEDQFGXTEAD-UHFFFAOYSA-N 1,2-bis(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC=CC=C1C(F)(F)F XXZOEDQFGXTEAD-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- -1 dodecylobenzene Chemical compound 0.000 claims description 2
- YVBBRRALBYAZBM-UHFFFAOYSA-N perfluorooctane Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F YVBBRRALBYAZBM-UHFFFAOYSA-N 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 claims 1
- 238000009835 boiling Methods 0.000 description 11
- KWKXNDCHNDYVRT-UHFFFAOYSA-N dodecylbenzene Chemical compound CCCCCCCCCCCCC1=CC=CC=C1 KWKXNDCHNDYVRT-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 6
- 239000002245 particle Substances 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- DHKHOPREWIWWPV-UHFFFAOYSA-N 2-chloro-1,1,1-trifluorobutane Chemical compound CCC(Cl)C(F)(F)F DHKHOPREWIWWPV-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 239000000110 cooling liquid Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- JTJMJGYZQZDUJJ-UHFFFAOYSA-N phencyclidine Chemical class C1CCCCN1C1(C=2C=CC=CC=2)CCCCC1 JTJMJGYZQZDUJJ-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000005829 trimerization reaction Methods 0.000 description 1
- 239000002912 waste gas Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/28—Only halogen atoms, e.g. cyanuric chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Vaporization, Distillation, Condensation, Sublimation, And Cold Traps (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752537673 DE2537673C2 (de) | 1975-08-23 | 1975-08-23 | Verfahren zur Herstellung von feinteiligem, festem Cyanurchlorid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL99117B1 true PL99117B1 (pl) | 1978-06-30 |
Family
ID=5954729
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1976191923A PL99117B1 (pl) | 1975-08-23 | 1976-08-20 | Sposob wytwarzania pylistego stalego chlorku cyjanuru |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4038276A (index.php) |
| JP (1) | JPS5227789A (index.php) |
| AT (1) | AT349477B (index.php) |
| BE (1) | BE845417A (index.php) |
| BG (1) | BG27899A3 (index.php) |
| BR (1) | BR7605493A (index.php) |
| CA (1) | CA1049517A (index.php) |
| CH (1) | CH603605A5 (index.php) |
| CS (1) | CS196319B2 (index.php) |
| DD (1) | DD126872A5 (index.php) |
| DE (1) | DE2537673C2 (index.php) |
| ES (1) | ES450841A1 (index.php) |
| FR (1) | FR2322139A1 (index.php) |
| GB (1) | GB1527788A (index.php) |
| HU (1) | HU173978B (index.php) |
| IL (1) | IL50320A (index.php) |
| IN (1) | IN145176B (index.php) |
| IT (1) | IT1069689B (index.php) |
| MX (1) | MX4216E (index.php) |
| NL (1) | NL172239C (index.php) |
| PL (1) | PL99117B1 (index.php) |
| RO (1) | RO71372A (index.php) |
| SE (1) | SE419983B (index.php) |
| SU (1) | SU673170A3 (index.php) |
| YU (1) | YU203976A (index.php) |
| ZA (1) | ZA765020B (index.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2843381B2 (de) * | 1978-10-05 | 1980-07-10 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Gewinnung von Cyanurchlorid in fester und flüssiger Form |
| DE2843379C3 (de) * | 1978-10-05 | 1985-08-01 | Degussa Ag, 6000 Frankfurt | Verfahren zum Gewinnen von festem Cyanurchlorid |
| DE2843380B2 (de) * | 1978-10-05 | 1980-07-10 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Gewinnung von Cyanurchlorid in fester oder flüssiger Form |
| DE2843378C3 (de) * | 1978-10-05 | 1982-04-08 | Degussa Ag, 6000 Frankfurt | Verfahren zum Gewinnen von festem Cyanurchlorid |
| DE2843382C3 (de) * | 1978-10-05 | 1988-05-26 | Degussa Ag, 6000 Frankfurt | Verfahren zur Gewinnung von Cyanurchlorid in fester oder flüssiger Form |
| DE3336993A1 (de) * | 1983-10-11 | 1985-04-25 | Skw Trostberg Ag, 8223 Trostberg | Verfahren zur gewinnung von festem cyanurchlorid |
| DE3336994A1 (de) * | 1983-10-11 | 1985-04-25 | Skw Trostberg Ag, 8223 Trostberg | Verfahren zur gewinnung von cyanurchlorid |
| US5242502A (en) * | 1992-06-02 | 1993-09-07 | Occidental Chemical Corporation | Method and apparatus for cleaning articles |
| US6020299A (en) * | 1994-10-27 | 2000-02-01 | Occidental Chemical Corporation | Single phase cleaning fluid |
| DE10123072B4 (de) * | 2001-05-11 | 2004-12-30 | Degussa Ag | Vorrichtung zur Aufreinigung von Cyanurchlorid |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1411816A (fr) * | 1964-08-11 | 1965-09-24 | Electro Chimie Soc D | Procédé d'obtention de chlorure de cyanuryle purifié à partir de mélanges gazeux le contenant |
| GB1095454A (index.php) * | 1965-08-21 | |||
| DD111378A5 (index.php) * | 1973-06-27 | 1975-02-12 |
-
1975
- 1975-08-23 DE DE19752537673 patent/DE2537673C2/de not_active Expired
-
1976
- 1976-06-29 FR FR7619793A patent/FR2322139A1/fr active Granted
- 1976-08-04 IN IN1392/CAL/76A patent/IN145176B/en unknown
- 1976-08-18 HU HU76DE923A patent/HU173978B/hu unknown
- 1976-08-19 CA CA259,450A patent/CA1049517A/en not_active Expired
- 1976-08-20 IL IL50320A patent/IL50320A/xx unknown
- 1976-08-20 JP JP51099568A patent/JPS5227789A/ja active Pending
- 1976-08-20 PL PL1976191923A patent/PL99117B1/pl unknown
- 1976-08-20 NL NLAANVRAGE7609288,A patent/NL172239C/xx not_active IP Right Cessation
- 1976-08-20 ES ES450841A patent/ES450841A1/es not_active Expired
- 1976-08-20 DD DD194416A patent/DD126872A5/xx unknown
- 1976-08-20 GB GB34751/76A patent/GB1527788A/en not_active Expired
- 1976-08-20 CS CS765423A patent/CS196319B2/cs unknown
- 1976-08-20 IT IT69064/76A patent/IT1069689B/it active
- 1976-08-20 CH CH1062376A patent/CH603605A5/xx not_active IP Right Cessation
- 1976-08-20 BR BR7605493A patent/BR7605493A/pt unknown
- 1976-08-20 ZA ZA765020A patent/ZA765020B/xx unknown
- 1976-08-20 RO RO7687341A patent/RO71372A/ro unknown
- 1976-08-20 US US05/716,353 patent/US4038276A/en not_active Expired - Lifetime
- 1976-08-20 SU SU762388609A patent/SU673170A3/ru active
- 1976-08-20 BG BG034041A patent/BG27899A3/xx unknown
- 1976-08-20 AT AT620376A patent/AT349477B/de not_active IP Right Cessation
- 1976-08-20 BE BE6045643A patent/BE845417A/xx unknown
- 1976-08-20 YU YU02039/76A patent/YU203976A/xx unknown
- 1976-08-20 MX MX764846U patent/MX4216E/es unknown
- 1976-08-20 SE SE7609281A patent/SE419983B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7609288A (nl) | 1977-02-25 |
| AT349477B (de) | 1979-04-10 |
| FR2322139B1 (index.php) | 1978-05-19 |
| IN145176B (index.php) | 1978-09-02 |
| IL50320A (en) | 1979-10-31 |
| CH603605A5 (index.php) | 1978-08-31 |
| DD126872A5 (index.php) | 1977-08-17 |
| FR2322139A1 (fr) | 1977-03-25 |
| ATA620376A (de) | 1978-09-15 |
| SE419983B (sv) | 1981-09-07 |
| SE7609281L (sv) | 1977-02-24 |
| CA1049517A (en) | 1979-02-27 |
| NL172239C (nl) | 1983-08-01 |
| JPS5227789A (en) | 1977-03-02 |
| US4038276A (en) | 1977-07-26 |
| HU173978B (hu) | 1979-10-28 |
| MX4216E (es) | 1982-02-04 |
| IT1069689B (it) | 1985-03-25 |
| ES450841A1 (es) | 1977-08-16 |
| BR7605493A (pt) | 1977-08-16 |
| SU673170A3 (ru) | 1979-07-05 |
| YU203976A (en) | 1982-08-31 |
| BE845417A (fr) | 1977-02-21 |
| BG27899A3 (en) | 1980-01-15 |
| NL172239B (nl) | 1983-03-01 |
| DE2537673C2 (de) | 1977-09-29 |
| RO71372A (ro) | 1982-02-26 |
| CS196319B2 (en) | 1980-03-31 |
| GB1527788A (en) | 1978-10-11 |
| DE2537673B1 (de) | 1977-02-17 |
| ZA765020B (en) | 1977-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL99117B1 (pl) | Sposob wytwarzania pylistego stalego chlorku cyjanuru | |
| CN111630093B (zh) | 用于回收基于酰胺的化合物的方法 | |
| SA97180416B1 (ar) | عملية لتحضير اليوريا urea | |
| JPS62238224A (ja) | 石炭タ−ル油から抽出によりフエノ−ルおよび塩基を分離する方法 | |
| US2755887A (en) | Melamine purification | |
| US20010053339A1 (en) | Separation of metal chlorides from gaseous reaction mixtures from the synthesis of chlorosilane | |
| US2540083A (en) | Continuous extractive crystallization process | |
| GB937904A (en) | Process for the recovery of organic acid anhydrides | |
| US4008255A (en) | Recovery of phthalic anhydride | |
| KR100433826B1 (ko) | 추출법과 증류법을 병용한 용제회수 방법 | |
| US2446868A (en) | Process for purifying aqueous alkali metal hydroxides | |
| US3338898A (en) | Process for the production of cyanuric chloride | |
| WO1992014532A1 (en) | Process and apparatus for purifying elemental sulfur carried in an aqueous cake | |
| US5925224A (en) | Method of and apparatus for purifying a solvent | |
| US3607671A (en) | Condensing liquid cyanuric chloride from cases including washing the gases with liquid phosphorous oxychloride | |
| CA1105018A (en) | Process for producing cyanuric chloride (ii) | |
| CA1100499A (en) | Process for producing cyanuric chloride (i) | |
| CA1121982A (en) | Purification of aluminium chloride | |
| US3426065A (en) | Combined sublimation-leaching process | |
| CA1105017A (en) | Process for producing cyanuric chloride (iii) | |
| US3578664A (en) | Process for the recovery of melamine from a synthesis gas mixture containing hot melamine vapour | |
| US4217451A (en) | Process for the recovery of solid cyanuric chloride (B) | |
| CN114470812B (zh) | Tdi回收液中焦油粉末的分离装置及方法 | |
| US5175249A (en) | Process for the isolation and purification of polyarylene sulphides | |
| US3589872A (en) | Precipitating kci from an aqueous solution with nacl by adding pyridine and n-methyl-morphaline |