PL98486B1 - Srodek owadobojczy,roztoczobojczy lub nicieniobojczy - Google Patents
Srodek owadobojczy,roztoczobojczy lub nicieniobojczy Download PDFInfo
- Publication number
- PL98486B1 PL98486B1 PL1976187218A PL18721876A PL98486B1 PL 98486 B1 PL98486 B1 PL 98486B1 PL 1976187218 A PL1976187218 A PL 1976187218A PL 18721876 A PL18721876 A PL 18721876A PL 98486 B1 PL98486 B1 PL 98486B1
- Authority
- PL
- Poland
- Prior art keywords
- cyano
- radical
- hours
- carbon atoms
- compound
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title claims description 10
- 239000003795 chemical substances by application Substances 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 31
- 125000004432 carbon atom Chemical group C* 0.000 claims description 20
- 230000000895 acaricidal effect Effects 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 8
- 239000000642 acaricide Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052717 sulfur Chemical group 0.000 claims description 4
- FZTJMMWGVZSSKJ-UHFFFAOYSA-N (2-cyano-5-methylthiophen-3-yl) dimethyl phosphate Chemical compound COP(=O)(OC)OC=1C=C(C)SC=1C#N FZTJMMWGVZSSKJ-UHFFFAOYSA-N 0.000 claims description 3
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Natural products C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- IHSOUSPHWZILHU-UHFFFAOYSA-N (2-cyano-5-methoxythiophen-3-yl) dimethyl phosphate Chemical compound COC1=CC(OP(=O)(OC)OC)=C(C#N)S1 IHSOUSPHWZILHU-UHFFFAOYSA-N 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 239000000243 solution Substances 0.000 description 52
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 30
- -1 alkyl radical Chemical class 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 26
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 26
- 238000012360 testing method Methods 0.000 description 26
- 238000004458 analytical method Methods 0.000 description 24
- 238000002360 preparation method Methods 0.000 description 24
- 229940126062 Compound A Drugs 0.000 description 22
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 19
- 239000000706 filtrate Substances 0.000 description 15
- 229910000027 potassium carbonate Inorganic materials 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 230000000694 effects Effects 0.000 description 10
- 239000003480 eluent Substances 0.000 description 10
- 239000000741 silica gel Substances 0.000 description 10
- 229910002027 silica gel Inorganic materials 0.000 description 10
- 238000004587 chromatography analysis Methods 0.000 description 9
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Divinylene sulfide Natural products C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 8
- 241000238631 Hexapoda Species 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 241000238876 Acari Species 0.000 description 5
- 241001425390 Aphis fabae Species 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000000749 insecticidal effect Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000011591 potassium Substances 0.000 description 5
- 229910052700 potassium Inorganic materials 0.000 description 5
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 5
- 229930192474 thiophene Natural products 0.000 description 5
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- 241000244206 Nematoda Species 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 240000006677 Vicia faba Species 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- 239000013068 control sample Substances 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 4
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N gamma-hexachlorocyclohexane Natural products ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 4
- 229960002809 lindane Drugs 0.000 description 4
- 230000001069 nematicidal effect Effects 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- GIIODLNKSMCVGQ-UHFFFAOYSA-N 3-ethoxy-3-oxopropanethioic s-acid Chemical compound CCOC(=O)CC(O)=S GIIODLNKSMCVGQ-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 235000010749 Vicia faba Nutrition 0.000 description 3
- 235000002098 Vicia faba var. major Nutrition 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- ITVPBBDAZKBMRP-UHFFFAOYSA-N chloro-dioxido-oxo-$l^{5}-phosphane;hydron Chemical compound OP(O)(Cl)=O ITVPBBDAZKBMRP-UHFFFAOYSA-N 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- UZDLWOZHCZOAIU-UHFFFAOYSA-N 3-hydroxy-5-methylthiophene-2-carbonitrile Chemical compound CC1=CC(O)=C(C#N)S1 UZDLWOZHCZOAIU-UHFFFAOYSA-N 0.000 description 2
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 2
- DHZOFWFPFXBMAO-UHFFFAOYSA-N 5-butoxy-3-hydroxythiophene-2-carbonitrile Chemical compound CCCCOC1=CC(O)=C(C#N)S1 DHZOFWFPFXBMAO-UHFFFAOYSA-N 0.000 description 2
- JEVSLJKRRFGYFS-UHFFFAOYSA-N 5-ethylsulfanyl-3-hydroxythiophene-2-carbonitrile Chemical compound CCSC1=CC(O)=C(C#N)S1 JEVSLJKRRFGYFS-UHFFFAOYSA-N 0.000 description 2
- 241000238657 Blattella germanica Species 0.000 description 2
- 241000255579 Ceratitis capitata Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- 241000255582 Drosophilidae Species 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 239000005949 Malathion Substances 0.000 description 2
- 241000257159 Musca domestica Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000254179 Sitophilus granarius Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- NGFFLHMFSINFGB-UHFFFAOYSA-N [chloro(methoxy)phosphoryl]oxymethane Chemical compound COP(Cl)(=O)OC NGFFLHMFSINFGB-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 2
- HPFKOFNYNQMWEF-UHFFFAOYSA-N chloro-dihydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound OP(O)(Cl)=S HPFKOFNYNQMWEF-UHFFFAOYSA-N 0.000 description 2
- 239000003245 coal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- JXSJBGJIGXNWCI-UHFFFAOYSA-N diethyl 2-[(dimethoxyphosphorothioyl)thio]succinate Chemical compound CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC JXSJBGJIGXNWCI-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000010410 dusting Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- AMYVXLNOYJFHQF-UHFFFAOYSA-N ethyl 3-butoxy-3-sulfanylidenepropanoate Chemical compound CCCCOC(=S)CC(=O)OCC AMYVXLNOYJFHQF-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229960000453 malathion Drugs 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000005645 nematicide Substances 0.000 description 2
- 230000003151 ovacidal effect Effects 0.000 description 2
- 239000012451 post-reaction mixture Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- ULYUMMSWBUTDDZ-UHFFFAOYSA-N (2-benzoyl-5-methoxythiophen-3-yl) dimethyl phosphate Chemical compound S1C(OC)=CC(OP(=O)(OC)OC)=C1C(=O)C1=CC=CC=C1 ULYUMMSWBUTDDZ-UHFFFAOYSA-N 0.000 description 1
- ITCIENINGSRYEX-UHFFFAOYSA-N (5-butoxy-2-cyanothiophen-3-yl) diethyl phosphate Chemical compound CCCCOC1=CC(OP(=O)(OCC)OCC)=C(C#N)S1 ITCIENINGSRYEX-UHFFFAOYSA-N 0.000 description 1
- SGIKAVNBVLFQSG-UHFFFAOYSA-N 1,1-diethyl-2,2-dimethylhydrazine Chemical compound CCN(CC)N(C)C SGIKAVNBVLFQSG-UHFFFAOYSA-N 0.000 description 1
- PFJOTFSIBVZGPK-UHFFFAOYSA-N 1-ethyl-2-methylhydrazine Chemical compound CCNNC PFJOTFSIBVZGPK-UHFFFAOYSA-N 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- OKEHURCMYKPVFW-UHFFFAOYSA-N 2-methoxythiophene Chemical compound COC1=CC=CS1 OKEHURCMYKPVFW-UHFFFAOYSA-N 0.000 description 1
- BATLJJRWVYLNFT-UHFFFAOYSA-N 3-hydroxy-5-methoxythiophene-2-carbonitrile Chemical compound COC1=CC(O)=C(C#N)S1 BATLJJRWVYLNFT-UHFFFAOYSA-N 0.000 description 1
- UPIREZQHLJTWOQ-UHFFFAOYSA-N 3-hydroxy-5-phenylthiophene-2-carbonitrile Chemical compound S1C(C#N)=C(O)C=C1C1=CC=CC=C1 UPIREZQHLJTWOQ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 241000282421 Canidae Species 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 235000014277 Clidemia hirta Nutrition 0.000 description 1
- 244000033714 Clidemia hirta Species 0.000 description 1
- 241000255925 Diptera Species 0.000 description 1
- 241000255601 Drosophila melanogaster Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000244205 Panagrellus Species 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000219873 Vicia Species 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- QXRILJZYLNQLPW-UHFFFAOYSA-N chloro-ethoxy-hydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(O)(Cl)=S QXRILJZYLNQLPW-UHFFFAOYSA-N 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- KFUVAAKGERCXGZ-UHFFFAOYSA-N chloromethyl-dihydroxy-sulfanylidene-$l^{5}-phosphane Chemical compound OP(O)(=S)CCl KFUVAAKGERCXGZ-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 238000012943 effectiveness check Methods 0.000 description 1
- OPMLSKKVEAZENL-UHFFFAOYSA-N ethyl 3-methoxy-3-sulfanylidenepropanoate Chemical compound CCOC(=O)CC(=S)OC OPMLSKKVEAZENL-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000011121 hardwood Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 230000000974 larvacidal effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- GRKWHXNAHIMNJD-UHFFFAOYSA-N methoxysulfanyloxymethane Chemical group COSOC GRKWHXNAHIMNJD-UHFFFAOYSA-N 0.000 description 1
- FELLHCNTGRGTIK-UHFFFAOYSA-N methyl 3-diethoxyphosphinothioyloxy-5-methylthiophene-2-carboxylate Chemical compound CCOP(=S)(OCC)OC=1C=C(C)SC=1C(=O)OC FELLHCNTGRGTIK-UHFFFAOYSA-N 0.000 description 1
- NNPLFTBGNUKNKL-UHFFFAOYSA-N methyl 3-dimethoxyphosphoryloxy-5-methoxythiophene-2-carboxylate Chemical compound COC(=O)C=1SC(OC)=CC=1OP(=O)(OC)OC NNPLFTBGNUKNKL-UHFFFAOYSA-N 0.000 description 1
- JWVGLUKLEKSZEL-UHFFFAOYSA-N methyl 3-hydroxy-5-methoxythiophene-2-carboxylate Chemical compound COC(=O)C=1SC(OC)=CC=1O JWVGLUKLEKSZEL-UHFFFAOYSA-N 0.000 description 1
- PLTCMJBEOCSRII-UHFFFAOYSA-N methyl 3-hydroxy-5-methylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC(C)=CC=1O PLTCMJBEOCSRII-UHFFFAOYSA-N 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- UNFUYWDGSFDHCW-UHFFFAOYSA-N monochlorocyclohexane Chemical compound ClC1CCCCC1 UNFUYWDGSFDHCW-UHFFFAOYSA-N 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 230000001459 mortal effect Effects 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical group CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 231100000194 ovacidal Toxicity 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- XUWVIABDWDTJRZ-UHFFFAOYSA-N propan-2-ylazanide Chemical compound CC(C)[NH-] XUWVIABDWDTJRZ-UHFFFAOYSA-N 0.000 description 1
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 229920003987 resole Polymers 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- 229910001948 sodium oxide Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms
- C07F9/655345—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms the sulfur atom being part of a five-membered ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Biochemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7504628A FR2300768A1 (fr) | 1975-02-14 | 1975-02-14 | Nouveaux composes thiopeniques phosphoryles, procede de preparation et application comme pesticides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL98486B1 true PL98486B1 (pl) | 1978-05-31 |
Family
ID=9151233
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1976187218A PL98486B1 (pl) | 1975-02-14 | 1976-02-13 | Srodek owadobojczy,roztoczobojczy lub nicieniobojczy |
Country Status (25)
| Country | Link |
|---|---|
| JP (1) | JPS51105053A (tr) |
| BE (1) | BE838487A (tr) |
| BG (1) | BG25196A3 (tr) |
| BR (1) | BR7600876A (tr) |
| CA (1) | CA1074795A (tr) |
| CH (1) | CH610331A5 (tr) |
| DD (1) | DD125575A5 (tr) |
| DE (1) | DE2605649A1 (tr) |
| DK (1) | DK58376A (tr) |
| EG (1) | EG12442A (tr) |
| ES (1) | ES444618A1 (tr) |
| FR (1) | FR2300768A1 (tr) |
| GB (1) | GB1511413A (tr) |
| GR (1) | GR59269B (tr) |
| HU (1) | HU176606B (tr) |
| IL (1) | IL48857A (tr) |
| IT (1) | IT1053490B (tr) |
| NL (1) | NL7601489A (tr) |
| OA (1) | OA05248A (tr) |
| PH (1) | PH15203A (tr) |
| PL (1) | PL98486B1 (tr) |
| PT (1) | PT64795B (tr) |
| SU (1) | SU644360A3 (tr) |
| TR (1) | TR19251A (tr) |
| ZA (1) | ZA76709B (tr) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2831936A1 (de) * | 1978-07-20 | 1980-02-07 | Basf Ag | Thienylmethyl-phosphorsaeureester |
| JPS6058918B2 (ja) * | 1980-01-22 | 1985-12-23 | 宇部興産株式会社 | チオフエン誘導体および農園芸用殺菌剤 |
| US4454131A (en) * | 1982-04-30 | 1984-06-12 | Ube Industries, Ltd. | Thiophene derivatives |
| US8193372B2 (en) * | 2009-03-04 | 2012-06-05 | Idenix Pharmaceuticals, Inc. | Phosphothiophene and phosphothiazole HCV polymerase inhibitors |
-
1975
- 1975-02-14 FR FR7504628A patent/FR2300768A1/fr active Granted
-
1976
- 1976-01-16 IL IL48857A patent/IL48857A/xx unknown
- 1976-01-26 ES ES444618A patent/ES444618A1/es not_active Expired
- 1976-01-28 BG BG032211A patent/BG25196A3/xx unknown
- 1976-02-05 CA CA245,098A patent/CA1074795A/en not_active Expired
- 1976-02-06 ZA ZA760709A patent/ZA76709B/xx unknown
- 1976-02-09 PH PH18068A patent/PH15203A/en unknown
- 1976-02-10 SU SU762318651A patent/SU644360A3/ru active
- 1976-02-10 EG EG66/76A patent/EG12442A/xx active
- 1976-02-12 DD DD191215A patent/DD125575A5/xx unknown
- 1976-02-12 BE BE164261A patent/BE838487A/xx unknown
- 1976-02-12 DE DE19762605649 patent/DE2605649A1/de not_active Withdrawn
- 1976-02-12 BR BR7600876A patent/BR7600876A/pt unknown
- 1976-02-13 GR GR50050A patent/GR59269B/el unknown
- 1976-02-13 NL NL7601489A patent/NL7601489A/xx not_active Application Discontinuation
- 1976-02-13 CH CH181076A patent/CH610331A5/xx not_active IP Right Cessation
- 1976-02-13 TR TR19251A patent/TR19251A/tr unknown
- 1976-02-13 HU HU76RO878A patent/HU176606B/hu unknown
- 1976-02-13 PL PL1976187218A patent/PL98486B1/pl unknown
- 1976-02-13 GB GB5698/76A patent/GB1511413A/en not_active Expired
- 1976-02-13 DK DK58376*#A patent/DK58376A/da unknown
- 1976-02-13 JP JP51014121A patent/JPS51105053A/ja active Pending
- 1976-02-13 PT PT64795A patent/PT64795B/pt unknown
- 1976-02-13 IT IT48103/76A patent/IT1053490B/it active
- 1976-02-14 OA OA55742A patent/OA05248A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD125575A5 (tr) | 1977-05-04 |
| OA05248A (fr) | 1981-02-28 |
| ES444618A1 (es) | 1977-10-01 |
| IL48857A (en) | 1978-06-15 |
| ZA76709B (en) | 1977-03-30 |
| FR2300768A1 (fr) | 1976-09-10 |
| GR59269B (en) | 1977-12-05 |
| IT1053490B (it) | 1981-08-31 |
| PT64795B (fr) | 1978-02-06 |
| TR19251A (tr) | 1978-08-15 |
| EG12442A (en) | 1981-03-31 |
| PH15203A (en) | 1982-09-17 |
| JPS51105053A (tr) | 1976-09-17 |
| NL7601489A (nl) | 1976-08-17 |
| FR2300768B1 (tr) | 1977-07-22 |
| BE838487A (fr) | 1976-08-12 |
| DE2605649A1 (de) | 1976-08-26 |
| AU1110476A (en) | 1977-08-18 |
| DK58376A (da) | 1976-08-15 |
| IL48857A0 (en) | 1976-03-31 |
| CA1074795A (en) | 1980-04-01 |
| HU176606B (en) | 1981-03-28 |
| BR7600876A (pt) | 1976-09-14 |
| GB1511413A (en) | 1978-05-17 |
| SU644360A3 (ru) | 1979-01-25 |
| BG25196A3 (en) | 1978-08-10 |
| CH610331A5 (en) | 1979-04-12 |
| PT64795A (fr) | 1976-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2813341C2 (de) | 2-Phenyl-1,3-Cyclohexandion-Derivate, ihre Herstellung und diese enthaltende Mitizide und Herbizide | |
| PL86963B1 (tr) | ||
| PL98486B1 (pl) | Srodek owadobojczy,roztoczobojczy lub nicieniobojczy | |
| EP0102062B1 (en) | 1,3-dithianes, their production and use | |
| PL121559B1 (en) | Insecticide | |
| PL105939B1 (pl) | Srodek owadobojczy i roztoczobojczy | |
| PL95242B1 (tr) | ||
| US4473562A (en) | Pesticidal O-(N-alkoxy-aliphatic hydroxamate)-phosphorus esters and thioesters | |
| SU664530A3 (ru) | Инсектоакарицидонематоцидное средство | |
| DE2131734A1 (de) | Neue organische Phosphorverbindungen,Verfahren zu ihrer Herstellung und Verwendung zur Bekaempfung tierischer und pflanzlicher Schaedlinge | |
| US4086239A (en) | Thiazole bis-phosphates and phosphonates, intermediates, and insecticidal compositions and methods | |
| US3206357A (en) | Aminoaryltriazene pesticide | |
| US4155996A (en) | 3-(Phosphoryloxy) and (phosphonyloxy)-thiophenes | |
| SU1134563A1 (ru) | Фосфорные эфиры циангидринов,обладающие инсектоакарицидной активностью | |
| US4062951A (en) | Organophosphorus compounds, compositions containing them and their method of use | |
| CH636361A5 (de) | Einen isoxazolinonring enthaltende mono- und dithiophosphorsaeureester. | |
| CA1078399A (en) | Insecticidal active thiophene phosphorous derivatives | |
| EP0011363B1 (en) | Pyrazole phosphates and phosphonates, preparation thereof and use thereof as insecticides | |
| US4104375A (en) | Isoxazole phosphates and phosphonates | |
| DK142083B (da) | Pyrimidinyl (thiono) (thiol)-phosphor (phosphon)-syreestere med insecticid og acaricid virkning | |
| US4478832A (en) | Pesticidal O-(N-alkoxy-substituted-benzimidoyl)-phosphorus esters and thioesters | |
| US3960885A (en) | Succinic acid oximidophosphoric esters | |
| JP2673175B2 (ja) | ナフトキノン系化合物、それを含む殺ダニ剤およびダニ類を防除する方法 | |
| US4066783A (en) | Insecticidal and acaricidal metal halide complexes of 4-cyano-2,2-dimethylbutyraldoxime-N-methylcarbamate | |
| US4115558A (en) | Hydrazone dithiophosphates and phosphonates and use thereof as insecticides |