PL95292B1 - Sposob wytwarzania nowych pochodnych cyklopro - Google Patents
Sposob wytwarzania nowych pochodnych cyklopro Download PDFInfo
- Publication number
- PL95292B1 PL95292B1 PL1974168814A PL16881474A PL95292B1 PL 95292 B1 PL95292 B1 PL 95292B1 PL 1974168814 A PL1974168814 A PL 1974168814A PL 16881474 A PL16881474 A PL 16881474A PL 95292 B1 PL95292 B1 PL 95292B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- compound
- general formula
- model
- acid
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 phenoxyphenyl group Chemical group 0.000 claims description 31
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 241000171293 Megoura viciae Species 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 241000238631 Hexapoda Species 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 230000034994 death Effects 0.000 claims description 2
- 231100000517 death Toxicity 0.000 claims description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 2
- 241000238876 Acari Species 0.000 claims 3
- 241000257159 Musca domestica Species 0.000 claims 2
- 241000255969 Pieris brassicae Species 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 241000894007 species Species 0.000 claims 2
- 241001124076 Aphididae Species 0.000 claims 1
- 240000007124 Brassica oleracea Species 0.000 claims 1
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 claims 1
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 claims 1
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 claims 1
- 241001465754 Metazoa Species 0.000 claims 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical group CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 claims 1
- 125000001559 cyclopropyl group Chemical class [H]C1([H])C([H])([H])C1([H])* 0.000 claims 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims 1
- 239000000460 chlorine Substances 0.000 description 20
- 239000002253 acid Substances 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 239000002574 poison Substances 0.000 description 7
- 231100000614 poison Toxicity 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 150000001942 cyclopropanes Chemical class 0.000 description 5
- 230000000749 insecticidal effect Effects 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 241000255925 Diptera Species 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 240000006677 Vicia faba Species 0.000 description 3
- 235000010749 Vicia faba Nutrition 0.000 description 3
- 235000002098 Vicia faba var. major Nutrition 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 230000000895 acaricidal effect Effects 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 230000000361 pesticidal effect Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- DIZKLZKLNKQFGB-UHFFFAOYSA-N 1-methylcyclopropane-1-carboxylic acid Chemical compound OC(=O)C1(C)CC1 DIZKLZKLNKQFGB-UHFFFAOYSA-N 0.000 description 2
- 235000011293 Brassica napus Nutrition 0.000 description 2
- 240000008100 Brassica rapa Species 0.000 description 2
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000005133 alkynyloxy group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 230000001804 emulsifying effect Effects 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- GBFUISVVTYNAKO-UHFFFAOYSA-N 1-(3-phenoxyphenyl)prop-2-yn-1-ol Chemical compound C#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GBFUISVVTYNAKO-UHFFFAOYSA-N 0.000 description 1
- CEUNXMNQSLWWMS-UHFFFAOYSA-N 1-chloro-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)CC1(Cl)C(O)=O CEUNXMNQSLWWMS-UHFFFAOYSA-N 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- DGXRGGUNBXNJRI-UHFFFAOYSA-N 2-methyl-4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C(C)=C1 DGXRGGUNBXNJRI-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 108010053481 Antifreeze Proteins Proteins 0.000 description 1
- 241000239223 Arachnida Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 241001608568 Phaedon Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical class [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 244000273928 Zingiber officinale Species 0.000 description 1
- 235000006886 Zingiber officinale Nutrition 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000002528 anti-freeze Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical class [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000002816 gill Anatomy 0.000 description 1
- 235000008397 ginger Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 235000021552 granulated sugar Nutrition 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 235000012243 magnesium silicates Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- TURAMGVWNUTQKH-UHFFFAOYSA-N propa-1,2-dien-1-one Chemical group C=C=C=O TURAMGVWNUTQKH-UHFFFAOYSA-N 0.000 description 1
- PZQSQRCNMZGWFT-QXMHVHEDSA-N propan-2-yl (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC(C)C PZQSQRCNMZGWFT-QXMHVHEDSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/743—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring of acids with a three-membered ring and with unsaturation outside the ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB768573A GB1437789A (en) | 1973-02-16 | 1973-02-16 | Cyclopropane derivatives and their use as pesticides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL95292B1 true PL95292B1 (pl) | 1977-10-31 |
Family
ID=9837835
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974168814A PL95292B1 (pl) | 1973-02-16 | 1974-02-14 | Sposob wytwarzania nowych pochodnych cyklopro |
Country Status (28)
| Country | Link |
|---|---|
| US (2) | US3927068A (enExample) |
| JP (1) | JPS5831323B2 (enExample) |
| AR (1) | AR215113A1 (enExample) |
| AT (1) | AT331076B (enExample) |
| BE (1) | BE810886A (enExample) |
| BR (1) | BR7401067D0 (enExample) |
| CA (1) | CA1049550A (enExample) |
| CH (1) | CH593011A5 (enExample) |
| CS (1) | CS182808B2 (enExample) |
| DD (1) | DD111786A5 (enExample) |
| DE (1) | DE2407024A1 (enExample) |
| DK (1) | DK134982B (enExample) |
| EG (1) | EG11276A (enExample) |
| ES (1) | ES423229A1 (enExample) |
| FR (1) | FR2218316B1 (enExample) |
| GB (1) | GB1437789A (enExample) |
| HU (1) | HU172882B (enExample) |
| IL (1) | IL44204A (enExample) |
| IT (1) | IT1046788B (enExample) |
| NL (1) | NL7402018A (enExample) |
| OA (1) | OA04600A (enExample) |
| PH (1) | PH10824A (enExample) |
| PL (1) | PL95292B1 (enExample) |
| SE (1) | SE414304B (enExample) |
| SU (1) | SU701516A3 (enExample) |
| TR (1) | TR18152A (enExample) |
| YU (1) | YU35274A (enExample) |
| ZA (1) | ZA74992B (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3987193A (en) * | 1974-12-03 | 1976-10-19 | Shell Oil Company | Pesticidal dihalovinyl-spiroalkanecyclopropane derivatives |
| US4196215A (en) | 1975-06-19 | 1980-04-01 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Alkyne compounds and method of use |
| US4118510A (en) * | 1976-03-22 | 1978-10-03 | Shell Oil Company | Dispirocyclopropane carboxylate pesticides |
| GB1577136A (en) * | 1976-03-22 | 1980-10-22 | Shell Int Research | Cyclopropane carboxylate ester derivatives and their use as pesticides |
| US4130655A (en) * | 1976-07-12 | 1978-12-19 | Ciba-Geigy Corporation | Pesticidal 2,2-dimethyl-3-isobutyl-cyclopropionates |
| US4152455A (en) | 1977-02-02 | 1979-05-01 | Fmc Corporation | Insecticidal α-trifluoromethyl-3-phenoxybenzyl carboxylates |
| GB1597487A (en) * | 1977-03-31 | 1981-09-09 | Shell Int Research | Pesticidal cyclopropane carboxylates |
| DE2860436D1 (en) * | 1977-11-01 | 1981-02-26 | Ciba Geigy Ag | Phenoxy-alpha-vinylbenzyl esters of cyclopropane carboxylic acids, process for their preparation and their use as pesticides |
| DE2860310D1 (en) * | 1977-11-09 | 1981-02-19 | Ciba Geigy Ag | 3-phenoxy-alpha-vinylbenzylesters of vinylcyclopropanecarboxylic acids, process for their preparation and their use as pesticides |
| US4215138A (en) * | 1977-12-27 | 1980-07-29 | Nissan Chemical Industries, Ltd. | Insecticidal compounds of phenylcyclopropane carboxylic acid esters |
| FR2426673A1 (fr) * | 1978-05-25 | 1979-12-21 | Nat Res Dev | Pesticides du type pyrethrine |
| AU526817B2 (en) * | 1978-06-21 | 1983-02-03 | Ici Australia Limited | Pesticides |
| CA1152093A (en) * | 1978-06-27 | 1983-08-16 | Novartis Ag | Cyclopropane carboxylic acid esters |
| DE2960306D1 (en) * | 1978-06-27 | 1981-08-06 | Ciba Geigy Ag | Alpha-isopropyl-phenylacetic acid esters, their preparation and use as pesticides |
| DE3062656D1 (en) * | 1979-02-21 | 1983-05-19 | Shell Int Research | Pesticidal compositions and their use |
| NL8001813A (nl) * | 1979-03-30 | 1980-10-02 | Kuraray Co | Gesubstitueerde cyclopropaancarbonzure esters en het gebruik hiervan in bestrijdingsmiddelen tegen schadelijke organismen. |
| US4375476A (en) * | 1980-10-14 | 1983-03-01 | Fmc Corporation | Insecticidal (2,6-dimethyl-3-substituted phenyl)methyl cyclopropanecarboxylates |
| US4472313A (en) * | 1982-09-20 | 1984-09-18 | Sandoz, Inc. | Cyclopropanation of olefins |
| US4710518A (en) * | 1984-07-02 | 1987-12-01 | Nihon Tokushu Noyaku Seizo K.K. | Novel N-benzyl-cyclopropanecarboxamide fungicides |
| US4681593A (en) * | 1985-01-14 | 1987-07-21 | Ciba-Geigy Corporation | Process and compositions for protecting keratinous material from attack by pests that feed on keratin, and novel esters |
| US4704156A (en) * | 1986-05-07 | 1987-11-03 | Eli Lilly And Company | Method for plant growth regulation |
| JPS62968A (ja) * | 1986-05-16 | 1987-01-06 | Canon Inc | 現像方法及び装置 |
| FR2604173B1 (fr) * | 1986-09-18 | 1988-12-30 | Roussel Uclaf | Nouveaux derives de l'indole, leur procede de preparation et leur application comme pesticide |
| DE3740840A1 (de) * | 1987-11-27 | 1989-06-08 | Schering Ag | 2,2-difluorcyclopropylethanderivate, verfahren zu ihrer herstellung und ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3820895A1 (de) * | 1988-06-21 | 1989-12-28 | Basf Ag | Pyrethroide, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung von schaedlingen |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1117625A (en) * | 1966-08-24 | 1968-06-19 | Rexall Drug Chemical | Substituted phthalans |
| DE1793312A1 (de) * | 1968-08-29 | 1971-07-08 | Basf Ag | Substituierte Chrysanthemumsaeureester und diese enthaltende Schaedlingsbekaempfungsmittel |
| US3666789A (en) * | 1969-05-21 | 1972-05-30 | Sumitomo Chemical Co | Cyclopropanecarboxylic acid esters |
| US3683005A (en) * | 1970-01-08 | 1972-08-08 | Taisho Pharmaceutical Co Ltd | Cyclopropanecarboxylic acid esters |
| JPS49489B1 (enExample) * | 1970-06-13 | 1974-01-08 | ||
| JPS515450B1 (enExample) * | 1971-06-29 | 1976-02-20 | ||
| JPS569487B2 (enExample) * | 1971-11-26 | 1981-03-02 | ||
| US3862174A (en) * | 1972-06-26 | 1975-01-21 | Sumitomo Chemical Co | Cyclopropanecarboxylates |
-
1973
- 1973-02-16 GB GB768573A patent/GB1437789A/en not_active Expired
-
1974
- 1974-01-30 CA CA191,314A patent/CA1049550A/en not_active Expired
- 1974-02-11 PH PH15496A patent/PH10824A/en unknown
- 1974-02-11 IT IT20445/74A patent/IT1046788B/it active
- 1974-02-12 BE BE1005708A patent/BE810886A/xx not_active IP Right Cessation
- 1974-02-12 YU YU00352/74A patent/YU35274A/xx unknown
- 1974-02-14 ZA ZA00740992A patent/ZA74992B/xx unknown
- 1974-02-14 PL PL1974168814A patent/PL95292B1/pl unknown
- 1974-02-14 BR BR1067/74A patent/BR7401067D0/pt unknown
- 1974-02-14 JP JP49017191A patent/JPS5831323B2/ja not_active Expired
- 1974-02-14 SU SU741999302A patent/SU701516A3/ru active
- 1974-02-14 AR AR252363A patent/AR215113A1/es active
- 1974-02-14 IL IL44204A patent/IL44204A/xx unknown
- 1974-02-14 ES ES423229A patent/ES423229A1/es not_active Expired
- 1974-02-14 AT AT118574A patent/AT331076B/de not_active IP Right Cessation
- 1974-02-14 TR TR18152A patent/TR18152A/xx unknown
- 1974-02-14 SE SE7401998A patent/SE414304B/xx unknown
- 1974-02-14 FR FR7405018A patent/FR2218316B1/fr not_active Expired
- 1974-02-14 DE DE19742407024 patent/DE2407024A1/de not_active Withdrawn
- 1974-02-14 HU HU74SE00001711A patent/HU172882B/hu unknown
- 1974-02-14 OA OA55120A patent/OA04600A/xx unknown
- 1974-02-14 DK DK77874AA patent/DK134982B/da unknown
- 1974-02-14 EG EG42/74A patent/EG11276A/xx active
- 1974-02-14 CH CH206374A patent/CH593011A5/xx not_active IP Right Cessation
- 1974-02-14 CS CS7400001076A patent/CS182808B2/cs unknown
- 1974-02-14 NL NL7402018A patent/NL7402018A/xx not_active Application Discontinuation
- 1974-02-15 US US442994A patent/US3927068A/en not_active Expired - Lifetime
- 1974-02-15 US US05/442,992 patent/US3979424A/en not_active Expired - Lifetime
- 1974-02-18 DD DD176623A patent/DD111786A5/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU35274A (en) | 1982-08-31 |
| TR18152A (tr) | 1976-10-11 |
| EG11276A (en) | 1977-01-31 |
| SU701516A3 (ru) | 1979-11-30 |
| AU6560574A (en) | 1975-08-14 |
| NL7402018A (enExample) | 1974-08-20 |
| JPS5831323B2 (ja) | 1983-07-05 |
| IL44204A0 (en) | 1974-05-16 |
| AR215113A1 (es) | 1979-09-14 |
| GB1437789A (en) | 1976-06-03 |
| SE414304B (sv) | 1980-07-21 |
| IL44204A (en) | 1978-03-10 |
| BE810886A (nl) | 1974-08-12 |
| DK134982B (da) | 1977-02-21 |
| CH593011A5 (enExample) | 1977-11-15 |
| ES423229A1 (es) | 1976-05-01 |
| US3979424A (en) | 1976-09-07 |
| CA1049550A (en) | 1979-02-27 |
| ZA74992B (en) | 1975-01-29 |
| FR2218316B1 (enExample) | 1977-06-10 |
| JPS49110648A (enExample) | 1974-10-22 |
| DK134982C (enExample) | 1977-07-11 |
| DD111786A5 (enExample) | 1975-03-12 |
| AT331076B (de) | 1976-08-10 |
| FR2218316A1 (enExample) | 1974-09-13 |
| IT1046788B (it) | 1980-07-31 |
| OA04600A (fr) | 1980-06-30 |
| CS182808B2 (en) | 1978-05-31 |
| US3927068A (en) | 1975-12-16 |
| DE2407024A1 (de) | 1974-08-29 |
| BR7401067D0 (pt) | 1974-11-19 |
| ATA118574A (de) | 1975-10-15 |
| HU172882B (hu) | 1978-12-28 |
| PH10824A (en) | 1977-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL95292B1 (pl) | Sposob wytwarzania nowych pochodnych cyklopro | |
| DE2019821B2 (de) | Phenoxybenzoesäureverbindungen, Verfahren zu deren Herstellung und Verwendung | |
| DE1803084A1 (de) | Schaedlingsbekaempfungsmittel | |
| JPS5829754A (ja) | ベンゾイルヒドラゾン誘導体および殺虫剤 | |
| US3950535A (en) | Cyanobenzyl cyclopropane carboxylates | |
| EP0007089B1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| US4237168A (en) | N-(4-Chloro-2-methylphenyl)-N-hydroxy methanimidamide and its pesticidal use | |
| US2382976A (en) | N-hydrocarbon-substituted alkanolamine salts of halo-phenols | |
| JPS6261973A (ja) | ジフエニルエ−テル除草剤 | |
| CH676596A5 (enExample) | ||
| JP2673175B2 (ja) | ナフトキノン系化合物、それを含む殺ダニ剤およびダニ類を防除する方法 | |
| JPH0240642B2 (enExample) | ||
| JPS5811842B2 (ja) | サツダニザイ | |
| US4596893A (en) | 2-trifluoromethyl-4,6-dinitro-phenol and derivatives thereof, process for the preparation thereof and herbicidal, acaricidal and crop regulation compositions containing same | |
| US3970751A (en) | Certain thiazolotriazolyphosphonothioates used as insecticides | |
| US4100363A (en) | 2-Substituted isovaleric acid ester pesticides | |
| JPS6045571A (ja) | 1,3−ジチアン類,その製造法及び殺虫組成物 | |
| GB1600803A (en) | Furylmethyloxime ethers and pesticidal compositions containing them | |
| US4377408A (en) | Herbicidal derivatives of 5-phenoxy-4(3H)-quinazolinone-1-oxide | |
| CA1122223A (en) | Certain cyclopropane thiolcarboxylates and use thereof as miticides | |
| PL88775B1 (enExample) | ||
| PT88374B (pt) | Processo para a preparacao de herbicidas de eter difenilico | |
| JPH0543536A (ja) | 新規アミジン誘導体、及びこれを含有する殺虫、殺ダニ剤 | |
| US3275718A (en) | O, o-dialkyl-o-(2, 5-dichloro-4-bromophenyl)-thiophosphates | |
| KR820000325B1 (ko) | 진드기류 살충제로서 유효한 시클로프로판 티올카르복실산 에스테르류의 제법 |