PL92134B1 - - Google Patents
Download PDFInfo
- Publication number
- PL92134B1 PL92134B1 PL17820973A PL17820973A PL92134B1 PL 92134 B1 PL92134 B1 PL 92134B1 PL 17820973 A PL17820973 A PL 17820973A PL 17820973 A PL17820973 A PL 17820973A PL 92134 B1 PL92134 B1 PL 92134B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- general formula
- compound
- carried out
- hydrogen atom
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 4
- 238000006356 dehydrogenation reaction Methods 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 229910052763 palladium Inorganic materials 0.000 claims description 4
- -1 six-methylenne Chemical compound 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 3
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910000423 chromium oxide Inorganic materials 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 229910000510 noble metal Inorganic materials 0.000 claims description 3
- 229910052762 osmium Inorganic materials 0.000 claims description 3
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- 229910052711 selenium Inorganic materials 0.000 claims description 3
- 239000011669 selenium Substances 0.000 claims description 3
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical class N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000011630 iodine Chemical group 0.000 claims description 2
- CWQXQMHSOZUFJS-UHFFFAOYSA-N molybdenum disulfide Chemical compound S=[Mo]=S CWQXQMHSOZUFJS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 2
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims 6
- 238000006243 chemical reaction Methods 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- 150000003568 thioethers Chemical class 0.000 claims 2
- JTSFIVQMXUDGAB-UHFFFAOYSA-N 4-thiomorpholin-4-ylmorpholine Chemical compound C1COCCN1N1CCSCC1 JTSFIVQMXUDGAB-UHFFFAOYSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical group CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims 1
- 238000005984 hydrogenation reaction Methods 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 238000000197 pyrolysis Methods 0.000 claims 1
- PTISTKLWEJDJID-UHFFFAOYSA-N sulfanylidenemolybdenum Chemical compound [Mo]=S PTISTKLWEJDJID-UHFFFAOYSA-N 0.000 claims 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 9
- 241000699670 Mus sp. Species 0.000 description 9
- 239000000126 substance Substances 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000001914 calming effect Effects 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 238000011785 NMRI mouse Methods 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- OMOVVBIIQSXZSZ-UHFFFAOYSA-N [6-(4-acetyloxy-5,9a-dimethyl-2,7-dioxo-4,5a,6,9-tetrahydro-3h-pyrano[3,4-b]oxepin-5-yl)-5-formyloxy-3-(furan-3-yl)-3a-methyl-7-methylidene-1a,2,3,4,5,6-hexahydroindeno[1,7a-b]oxiren-4-yl] 2-hydroxy-3-methylpentanoate Chemical compound CC12C(OC(=O)C(O)C(C)CC)C(OC=O)C(C3(C)C(CC(=O)OC4(C)COC(=O)CC43)OC(C)=O)C(=C)C32OC3CC1C=1C=COC=1 OMOVVBIIQSXZSZ-UHFFFAOYSA-N 0.000 description 2
- 238000010171 animal model Methods 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 230000002040 relaxant effect Effects 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- BAVAZRNEAWBRLO-UHFFFAOYSA-N 1,2-benzodiazepin-4-one Chemical compound O=C1C=NN=C2C=CC=CC2=C1 BAVAZRNEAWBRLO-UHFFFAOYSA-N 0.000 description 1
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000002082 anti-convulsion Effects 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- ZVTQWXCKQTUVPY-UHFFFAOYSA-N chloromethylcyclopropane Chemical compound ClCC1CC1 ZVTQWXCKQTUVPY-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- YWOITFUKFOYODT-UHFFFAOYSA-N methanol;sodium Chemical compound [Na].OC YWOITFUKFOYODT-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 229910052982 molybdenum disulfide Inorganic materials 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732326657 DE2326657A1 (de) | 1973-05-25 | 1973-05-25 | Neue verfahren zur herstellung von 1,4-benzodiazepinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL92134B1 true PL92134B1 (enExample) | 1977-03-31 |
Family
ID=5882116
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL17820873A PL92133B1 (enExample) | 1973-05-25 | 1973-07-11 | |
| PL17820973A PL92134B1 (enExample) | 1973-05-25 | 1973-07-11 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL17820873A PL92133B1 (enExample) | 1973-05-25 | 1973-07-11 |
Country Status (8)
| Country | Link |
|---|---|
| AT (3) | AT327926B (enExample) |
| BG (2) | BG21219A3 (enExample) |
| CH (2) | CH589633A5 (enExample) |
| CS (1) | CS176250B2 (enExample) |
| DE (1) | DE2326657A1 (enExample) |
| ES (2) | ES422321A1 (enExample) |
| PL (2) | PL92133B1 (enExample) |
| SU (2) | SU572203A3 (enExample) |
-
1973
- 1973-05-25 DE DE19732326657 patent/DE2326657A1/de active Pending
- 1973-07-09 CH CH1370976A patent/CH589633A5/xx not_active IP Right Cessation
- 1973-07-09 CH CH1371076A patent/CH590855A5/xx not_active IP Right Cessation
- 1973-07-10 BG BG026530A patent/BG21219A3/xx unknown
- 1973-07-10 BG BG2533673A patent/BG21407A3/xx unknown
- 1973-07-11 AT AT1008474A patent/AT327926B/de not_active IP Right Cessation
- 1973-07-11 AT AT1008374A patent/AT327925B/de not_active IP Right Cessation
- 1973-07-11 PL PL17820873A patent/PL92133B1/pl unknown
- 1973-07-11 PL PL17820973A patent/PL92134B1/pl unknown
- 1973-07-11 AT AT1008473A patent/ATA1008474A/de unknown
- 1973-07-12 CS CS3273A patent/CS176250B2/cs unknown
-
1974
- 1974-01-16 ES ES422321A patent/ES422321A1/es not_active Expired
- 1974-01-16 ES ES422320A patent/ES422320A1/es not_active Expired
- 1974-10-09 SU SU7402065459A patent/SU572203A3/ru active
- 1974-10-09 SU SU7402067357A patent/SU563916A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| ES422320A1 (es) | 1976-04-16 |
| DE2326657A1 (de) | 1974-12-12 |
| BG21219A3 (bg) | 1976-03-20 |
| SU563916A3 (ru) | 1977-06-30 |
| ES422321A1 (es) | 1976-04-16 |
| CH590855A5 (enExample) | 1977-08-31 |
| AT327926B (de) | 1976-02-25 |
| CH589633A5 (enExample) | 1977-07-15 |
| ATA1008374A (de) | 1975-05-15 |
| CS176250B2 (enExample) | 1977-06-30 |
| PL92133B1 (enExample) | 1977-03-31 |
| BG21407A3 (enExample) | 1976-05-20 |
| AT327925B (de) | 1976-02-25 |
| ATA1008474A (de) | 1975-05-15 |
| SU572203A3 (ru) | 1977-09-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Kukla et al. | Synthesis and anti-HIV-1 activity of 4, 5, 6, 7-tetrahydro-5-methylimidazo [4, 5, 1-jk][1, 4] benzodiazepin-2 (1H)-one (TIBO) derivatives. 2 | |
| US4816586A (en) | Delta opioid receptor antagonists | |
| CS251795B2 (en) | Method of 5h-2,3-benzodiazepine's derivatives preparation | |
| WO1998056792A1 (de) | 3-substituierte 3,4-dihydro-thieno[2,3-d]pyrimidin-derivate, ihre herstellung und verwendung | |
| US3466274A (en) | Fluoreno-(1,9-ef)-1,4-diazepine-1-oxides and 1,3-diazafluoranthene-1-oxides | |
| WO2003051275A2 (en) | Benzodiazepine derivatives, preparation thereof and use thereof | |
| GB2180536A (en) | Gamma-carbolines | |
| US3362962A (en) | Certain benzothiazepine derivatives | |
| Offel et al. | Synthesis of Substituted 3‐Anilino‐5‐phenyl‐1, 3‐dihydro‐2H‐1, 4‐benzodiazepine‐2‐ones and their Evaluation as Cholecystokinin‐Ligands | |
| US3984398A (en) | 1,5-Benzodiazepine-2,4-diones | |
| US4358456A (en) | Antipsychotic piperidinomethyl-indole derivatives | |
| US3836653A (en) | Pharmaceutical compositions containing a 5-phenyl-7-bromo-1h-1,5-benzodiazepine-2,4-(3h,5h)-dione | |
| PL92134B1 (enExample) | ||
| DK162220B (da) | Tricykliske pyridazinderivater, som er agonister af cholinerge receptorer, fremgangsmaade til fremstilling af derivaterne, og laegemidler, hvori de er til stede | |
| PL141846B1 (en) | Method of obtaining novel derivatives of 1h,3h-pyrolo/1,2-c/thiazoles | |
| US4183932A (en) | Fused quinazolinones and preparation thereof | |
| US4603130A (en) | 1-substituted-2-(piperazinyl or homopiperazinyl)-benzimidazole compounds and pharmaceutical composition | |
| WO1999007711A1 (de) | 3-substituierte 3,4,5,7-tetrahydro-pyrrolo[3',4':4,5] thieno[2,3-d] pyrimidin-derivate, ihre herstellung und verwendung als 5ht-antagonisten | |
| EP1023296B1 (de) | 3-SUBSTITUIERTE PYRIDO 3',4':4,5] THIENO 2,3-d] PYRIMIDIN-DERIVATE, IHRE HERSTELLUNG UND VERWENDUNG | |
| USRE28939E (en) | 3-Aminoindazole derivatives | |
| JPH0291063A (ja) | 新規な6,11‐ジヒドロ‐ジベンゾ〔c,f〕〔1,2,5〕チアジアゼピン‐5,5‐ジオキシド誘導体,その塩及びその製造法 | |
| EP0167920A2 (en) | Benzodiazepine derivatives and pharmaceutical compositions containing them | |
| US3828039A (en) | 2-amino-thieno(2,3-e)(1,4)diazepine compounds | |
| US5760050A (en) | Antipsychotic method utilizing certain tetrahydrochromeno 3,4-c!pyridin-5-ones | |
| US3773768A (en) | 7-amino-2-chloro-11-(4-methyl-1-piperazinyl)dibenz(b,f)(1,4)oxazepine and salts thereof |