PL89478B1 - 2-Oxazoline derivatives[US3979405A] - Google Patents
2-Oxazoline derivatives[US3979405A] Download PDFInfo
- Publication number
- PL89478B1 PL89478B1 PL1973165975A PL16597573A PL89478B1 PL 89478 B1 PL89478 B1 PL 89478B1 PL 1973165975 A PL1973165975 A PL 1973165975A PL 16597573 A PL16597573 A PL 16597573A PL 89478 B1 PL89478 B1 PL 89478B1
- Authority
- PL
- Poland
- Prior art keywords
- hydrogen
- carbon atoms
- general formula
- amino
- reactions
- Prior art date
Links
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical class C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 32
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 239000001257 hydrogen Substances 0.000 claims abstract description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 14
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 238000002360 preparation method Methods 0.000 claims abstract description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract 2
- -1 alkyl radical Chemical group 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 13
- 238000009835 boiling Methods 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 11
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 10
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 8
- 239000008096 xylene Substances 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 6
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 claims description 5
- 150000001414 amino alcohols Chemical class 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 239000004246 zinc acetate Substances 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 239000011592 zinc chloride Substances 0.000 claims description 3
- 235000005074 zinc chloride Nutrition 0.000 claims description 3
- 150000001661 cadmium Chemical class 0.000 claims description 2
- LHQLJMJLROMYRN-UHFFFAOYSA-L cadmium acetate Chemical compound [Cd+2].CC([O-])=O.CC([O-])=O LHQLJMJLROMYRN-UHFFFAOYSA-L 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 125000003504 2-oxazolinyl group Chemical class O1C(=NCC1)* 0.000 claims 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000002560 nitrile group Chemical group 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract description 2
- 125000003277 amino group Chemical group 0.000 abstract 1
- 239000000047 product Substances 0.000 description 29
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 235000012000 cholesterol Nutrition 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 150000000376 2-oxazolines Chemical class 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- TXCGAZHTZHNUAI-UHFFFAOYSA-N clofibric acid Chemical compound OC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 TXCGAZHTZHNUAI-UHFFFAOYSA-N 0.000 description 3
- 210000004185 liver Anatomy 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- JENFRDUXBGWJGH-UHFFFAOYSA-N 2-(4-chlorophenoxy)-2-methylpropanenitrile Chemical compound N#CC(C)(C)OC1=CC=C(Cl)C=C1 JENFRDUXBGWJGH-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002825 nitriles Chemical group 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 150000003254 radicals Chemical group 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- UCCQXCFFHYCLEC-UHFFFAOYSA-N 1-quinolin-2-ylethanone Chemical compound C1=CC=CC2=NC(C(=O)C)=CC=C21 UCCQXCFFHYCLEC-UHFFFAOYSA-N 0.000 description 1
- RIZUCYSQUWMQLX-UHFFFAOYSA-N 2,3-dimethylbenzoic acid Chemical compound CC1=CC=CC(C(O)=O)=C1C RIZUCYSQUWMQLX-UHFFFAOYSA-N 0.000 description 1
- OIWFXFNZHAOBJP-UHFFFAOYSA-N 2-(4-chloroanilino)-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)NC1=CC=C(Cl)C=C1 OIWFXFNZHAOBJP-UHFFFAOYSA-N 0.000 description 1
- MARVOSBVCBWWNB-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfanyl-2-methylpropanenitrile Chemical compound N#CC(C)(C)SC1=CC=C(Cl)C=C1 MARVOSBVCBWWNB-UHFFFAOYSA-N 0.000 description 1
- GUOJPBXXOMDAGO-UHFFFAOYSA-N 2-(4-chlorophenyl)sulfanyl-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)SC1=CC=C(Cl)C=C1 GUOJPBXXOMDAGO-UHFFFAOYSA-N 0.000 description 1
- BWXVFPRJHCRVKA-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)phenoxy]-2-methylpropanoic acid Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1C1=CC=C(Cl)C=C1 BWXVFPRJHCRVKA-UHFFFAOYSA-N 0.000 description 1
- CQKOMKZWVHDZMS-UHFFFAOYSA-N 2-benzhydryl-4,5-dihydro-1,3-oxazole Chemical compound O1CCN=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 CQKOMKZWVHDZMS-UHFFFAOYSA-N 0.000 description 1
- YAXGBZDYGZBRBQ-UHFFFAOYSA-N 4,5-dihydro-1,3-oxazol-2-amine Chemical group NC1=NCCO1 YAXGBZDYGZBRBQ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 241001122789 Suriana Species 0.000 description 1
- 240000002871 Tectona grandis Species 0.000 description 1
- LLKYEZPPLGGEJF-UHFFFAOYSA-N [2-[2-(4-chlorophenoxy)propan-2-yl]-4-(hydroxymethyl)-5h-1,3-oxazol-4-yl]methanol Chemical class N=1C(CO)(CO)COC=1C(C)(C)OC1=CC=C(Cl)C=C1 LLKYEZPPLGGEJF-UHFFFAOYSA-N 0.000 description 1
- JBBWEWYIVPXLIO-UHFFFAOYSA-N [2-[2-(4-chlorophenoxy)propan-2-yl]-4-ethyl-5h-1,3-oxazol-4-yl]methanol Chemical compound CCC1(CO)COC(C(C)(C)OC=2C=CC(Cl)=CC=2)=N1 JBBWEWYIVPXLIO-UHFFFAOYSA-N 0.000 description 1
- XBLOEMRMJXTDAI-UHFFFAOYSA-N [4-(hydroxymethyl)-5h-1,3-oxazol-4-yl]methanol Chemical compound OCC1(CO)COC=N1 XBLOEMRMJXTDAI-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- AUIZLSZEDUYGDE-UHFFFAOYSA-L cadmium(2+);diacetate;dihydrate Chemical compound O.O.[Cd+2].CC([O-])=O.CC([O-])=O AUIZLSZEDUYGDE-UHFFFAOYSA-L 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- ZXFCRFYULUUSDW-LANRQRAVSA-N cmt-3 Chemical compound C1C2CC3=CC=CC(O)=C3C(=O)C2=C(O)[C@@]2(O)C1CC(O)=C(C(=O)N)C2=O ZXFCRFYULUUSDW-LANRQRAVSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- YWOITFUKFOYODT-UHFFFAOYSA-N methanol;sodium Chemical compound [Na].OC YWOITFUKFOYODT-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- 238000005325 percolation Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000008237 rinsing water Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- BEAZKUGSCHFXIQ-UHFFFAOYSA-L zinc;diacetate;dihydrate Chemical compound O.O.[Zn+2].CC([O-])=O.CC([O-])=O BEAZKUGSCHFXIQ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/42—Oxazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/08—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D263/10—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D263/14—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUGO1222A HU167760B (enExample) | 1972-10-20 | 1972-10-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL89478B1 true PL89478B1 (en) | 1976-06-30 |
Family
ID=10996737
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973165975A PL89478B1 (en) | 1972-10-20 | 1973-10-20 | 2-Oxazoline derivatives[US3979405A] |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3979405A (enExample) |
| JP (1) | JPS4972250A (enExample) |
| AT (1) | AT331791B (enExample) |
| BE (1) | BE806342A (enExample) |
| CA (1) | CA1021343A (enExample) |
| CH (1) | CH602677A5 (enExample) |
| CS (1) | CS181838B1 (enExample) |
| DD (1) | DD108753A1 (enExample) |
| DE (1) | DE2352055A1 (enExample) |
| DK (1) | DK135991B (enExample) |
| ES (1) | ES419969A1 (enExample) |
| FI (1) | FI57405C (enExample) |
| FR (1) | FR2203633B1 (enExample) |
| GB (1) | GB1426028A (enExample) |
| HU (1) | HU167760B (enExample) |
| NL (1) | NL7314414A (enExample) |
| NO (1) | NO141648C (enExample) |
| PL (1) | PL89478B1 (enExample) |
| SE (1) | SE386173B (enExample) |
| SU (1) | SU539528A3 (enExample) |
| YU (1) | YU273973A (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4119633A (en) * | 1972-10-20 | 1978-10-10 | Chinoin Gyogyszer Es Vegyeszeti Termekek Gyara Rt. | 2-Phenoxy and 2-phenylthio and 2-phenylamino-alkyl-2-oxazolines |
| CA1056842A (en) * | 1975-06-12 | 1979-06-19 | Masayuki Narisada | Dihydroethanoanthracene derivatives |
| GB1518280A (en) * | 1976-09-15 | 1978-07-19 | Texaco Development Corp | Method of preparing alpha-vinyloxazolines |
| US4294966A (en) * | 1978-07-28 | 1981-10-13 | Ciba-Geigy Corporation | Process for inverting the configuration in optically active compounds |
| US4205176A (en) * | 1978-10-18 | 1980-05-27 | Cincinnati Milacron Chemicals Inc. | Ester substituted oxazolines |
| US5227494A (en) * | 1988-09-14 | 1993-07-13 | Schering Corporation | Process for preparing oxazoline compounds |
| WO1990002738A1 (en) * | 1988-09-14 | 1990-03-22 | Schering Corporation | Process for preparing oxazoline compounds |
| WO1992007824A1 (en) * | 1990-10-25 | 1992-05-14 | Schering Corporation | Process for preparing florfenicol, its analogs and oxazoline intermediates thereto |
| IL135854A0 (en) | 1997-11-12 | 2001-05-20 | Penn State Res Found | Chiral ligands and processes utilizing the same |
| US6476233B1 (en) | 1998-11-12 | 2002-11-05 | The Penn State Research Foundation | Transition metal-catalyzed reactions based on chiral amine oxazolinyl ligands and related compounds |
| US8354441B2 (en) * | 2009-11-11 | 2013-01-15 | Hoffmann-La Roche Inc. | Oxazoline derivatives |
| US8673950B2 (en) * | 2010-11-02 | 2014-03-18 | Hoffmann-Laroche Inc. | Dihydrooxazol-2-amine derivatives |
| US9550955B2 (en) | 2012-12-21 | 2017-01-24 | Afton Chemical Corporation | Friction modifiers for lubricating oils |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2579478A (en) * | 1951-12-25 | Heterocyclic compounds | ||
| NL124622C (enExample) * | 1963-05-02 | |||
| US3637726A (en) * | 1970-04-09 | 1972-01-25 | Dow Chemical Co | Substituted-5-((3 4-dihalophenoxy)methyl)-2-oxazoline compounds |
| US3778445A (en) * | 1971-06-28 | 1973-12-11 | Scott & Sons Co O M | Phenoxyalkyloxazolines |
-
1972
- 1972-10-20 HU HUGO1222A patent/HU167760B/hu unknown
-
1973
- 1973-10-16 US US05/406,784 patent/US3979405A/en not_active Expired - Lifetime
- 1973-10-17 DE DE19732352055 patent/DE2352055A1/de active Pending
- 1973-10-17 DK DK561873AA patent/DK135991B/da unknown
- 1973-10-18 AT AT883573A patent/AT331791B/de not_active IP Right Cessation
- 1973-10-18 FI FI3243/73A patent/FI57405C/fi active
- 1973-10-18 SE SE7314214A patent/SE386173B/xx unknown
- 1973-10-18 DD DD174182A patent/DD108753A1/xx unknown
- 1973-10-19 SU SU1966754A patent/SU539528A3/ru active
- 1973-10-19 ES ES419969A patent/ES419969A1/es not_active Expired
- 1973-10-19 GB GB4893673A patent/GB1426028A/en not_active Expired
- 1973-10-19 CH CH1481073A patent/CH602677A5/xx not_active IP Right Cessation
- 1973-10-19 CA CA183,698A patent/CA1021343A/en not_active Expired
- 1973-10-19 NO NO4058/73A patent/NO141648C/no unknown
- 1973-10-19 NL NL7314414A patent/NL7314414A/xx not_active Application Discontinuation
- 1973-10-19 JP JP48117689A patent/JPS4972250A/ja active Pending
- 1973-10-19 YU YU02739/73A patent/YU273973A/xx unknown
- 1973-10-19 FR FR7337427A patent/FR2203633B1/fr not_active Expired
- 1973-10-20 PL PL1973165975A patent/PL89478B1/pl unknown
- 1973-10-22 BE BE136916A patent/BE806342A/xx unknown
- 1973-10-22 CS CS7300007264A patent/CS181838B1/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI57405C (fi) | 1980-08-11 |
| SE386173B (sv) | 1976-08-02 |
| DK135991B (da) | 1977-07-25 |
| JPS4972250A (enExample) | 1974-07-12 |
| YU273973A (en) | 1980-10-31 |
| AT331791B (de) | 1976-08-25 |
| CH602677A5 (enExample) | 1978-07-31 |
| DE2352055A1 (de) | 1974-05-09 |
| BE806342A (fr) | 1974-02-15 |
| SU539528A3 (ru) | 1976-12-15 |
| HU167760B (enExample) | 1975-12-25 |
| US3979405A (en) | 1976-09-07 |
| NO141648B (no) | 1980-01-07 |
| FR2203633A1 (enExample) | 1974-05-17 |
| ATA883573A (de) | 1975-12-15 |
| NO141648C (no) | 1980-04-16 |
| GB1426028A (en) | 1976-02-25 |
| ES419969A1 (es) | 1976-08-01 |
| FR2203633B1 (enExample) | 1976-07-02 |
| CA1021343A (en) | 1977-11-22 |
| DK135991C (enExample) | 1977-12-27 |
| FI57405B (fi) | 1980-04-30 |
| CS181838B1 (en) | 1978-03-31 |
| DD108753A1 (enExample) | 1974-10-05 |
| NL7314414A (enExample) | 1974-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL89478B1 (en) | 2-Oxazoline derivatives[US3979405A] | |
| AU2010288477B8 (en) | (thio)morpholine derivatives as S1P modulators | |
| DE3881166T2 (de) | Sulfonanilidverbindungen. | |
| DD247216A5 (de) | Verfahren zur herstellung von 4-(c tief 1-c tief 4-alkyl-suelfonyl)-2-chloro-3-hydroxybenzoesaeure | |
| EP0200051B1 (de) | Verfahren zur Herstellung von Imidaten | |
| US1987546A (en) | Process for the manufacture of basic esters of phenyl substituted fatty acids | |
| DE3613573A1 (de) | Cyclopentylether und ihre herstellung sowie pharmazeutische formulierung | |
| KR20070089153A (ko) | (4,5-디히드로이소옥사졸로-3-일)티오카르복사미딘염화합물의 제조 방법 | |
| DE2024694B2 (de) | Verfahren zur Herstellung von 3,4-Dihydro-1,2,3-oxathiazin-4-onen | |
| CH653026A5 (it) | Derivati diazolidinici, loro preparazione ed utilizzazione. | |
| SU730309A3 (ru) | Способ получени 3-алкил-5-изохинолилиминотиазоло-(3,4-б) изохинолинов, или их оптических изомеров, или смесей их оптических изомеров или их солей | |
| DE69606107T2 (de) | Verfahren zur Herstellung von N-(Alkylsulfonyl)amiden | |
| EP0415473B1 (en) | Process for preparing sulphophenyl carbonate esters | |
| DE2454950A1 (de) | Verfahren zur herstellung von alphaaminoalkoholen und von deren saeureanlagerungssalzen | |
| SU486508A3 (ru) | Способ получени замещенных гуанидинофенилмочевины | |
| DE1938227A1 (de) | Verfahren zur Herstellung von Mono- und Dicarbomethoxybenzolsulfonaten | |
| JPS6354712B2 (enExample) | ||
| WO2004078706A1 (de) | Verfahren zur herstellung von thioessigsäure und ihren salzen | |
| US4133960A (en) | Novel ester derivatives of ether polycarboxylic acids and process for making same | |
| PL77042B1 (enExample) | ||
| SU589756A1 (ru) | Способ получени солей перфторалкилфосфиновых кислот | |
| US2060181A (en) | Alkali-metal salts of antimoniothiomalic acid | |
| SU471358A1 (ru) | Способ получени производных 2"окси-3-фенилпропиофенона | |
| US3161680A (en) | Nu-alkyl-nu-benzyl-beta-thiopropionamides | |
| KR810000071B1 (ko) | 1-에틸-2-(페닐-옥시메틸)-5-니트로-이미다졸의 제조방법 |