PL89172B1 - - Google Patents
Download PDFInfo
- Publication number
- PL89172B1 PL89172B1 PL1973161818A PL16181873A PL89172B1 PL 89172 B1 PL89172 B1 PL 89172B1 PL 1973161818 A PL1973161818 A PL 1973161818A PL 16181873 A PL16181873 A PL 16181873A PL 89172 B1 PL89172 B1 PL 89172B1
- Authority
- PL
- Poland
- Prior art keywords
- keto
- tetrazol
- benzopyran
- carbonitrile
- reacted
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 48
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 claims description 39
- -1 1H-tetrazol-5-yl Chemical group 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000003277 amino group Chemical group 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- UBEONZHRYRTJFN-UHFFFAOYSA-N 6-ethyl-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(CC)=CC=C2OC=C1C=1N=NNN=1 UBEONZHRYRTJFN-UHFFFAOYSA-N 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- SFWNPLLGXKJESA-UHFFFAOYSA-N 4-oxochromene-3-carbonitrile Chemical compound C1=CC=C2C(=O)C(C#N)=COC2=C1 SFWNPLLGXKJESA-UHFFFAOYSA-N 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 3
- 150000004777 chromones Chemical class 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 150000007517 lewis acids Chemical class 0.000 claims description 3
- HJOBCUUZGWRLTO-UHFFFAOYSA-N 3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound C=1OC2=CC=CC=C2C(=O)C=1C=1N=NNN=1 HJOBCUUZGWRLTO-UHFFFAOYSA-N 0.000 claims description 2
- JHWOLPAENJJAJP-UHFFFAOYSA-N 6-chloro-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(Cl)=CC=C21 JHWOLPAENJJAJP-UHFFFAOYSA-N 0.000 claims description 2
- INTWLMCUQXOHDC-UHFFFAOYSA-N 7-hydroxy-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C=2C1=CC(O)=CC=2 INTWLMCUQXOHDC-UHFFFAOYSA-N 0.000 claims description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- CWTJOJPEKJNISG-ONEGZZNKSA-N (e)-3-(4-oxochromen-3-yl)prop-2-enenitrile Chemical compound C1=CC=C2C(=O)C(\C=C\C#N)=COC2=C1 CWTJOJPEKJNISG-ONEGZZNKSA-N 0.000 claims 1
- HTDZATWOZYMUGT-AATRIKPKSA-N 3-[(e)-2-(2h-tetrazol-5-yl)ethenyl]chromen-4-one Chemical group C=1OC2=CC=CC=C2C(=O)C=1\C=C\C1=NN=NN1 HTDZATWOZYMUGT-AATRIKPKSA-N 0.000 claims 1
- IMVAJLIIWCJMJP-UHFFFAOYSA-N 4-oxo-6-propan-2-ylchromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(C(C)C)=CC=C21 IMVAJLIIWCJMJP-UHFFFAOYSA-N 0.000 claims 1
- IYWKFNQGONTONW-UHFFFAOYSA-N 6-(dimethylamino)-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(N(C)C)=CC=C2OC=C1C1=NN=NN1 IYWKFNQGONTONW-UHFFFAOYSA-N 0.000 claims 1
- QTDOWIWPPKGKKP-UHFFFAOYSA-N 6-(dimethylamino)-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(N(C)C)=CC=C21 QTDOWIWPPKGKKP-UHFFFAOYSA-N 0.000 claims 1
- OQLAJQAQEYDCQH-UHFFFAOYSA-N 6-butyl-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(CCCC)=CC=C2OC=C1C1=NN=NN1 OQLAJQAQEYDCQH-UHFFFAOYSA-N 0.000 claims 1
- KTWGPFONYHCTBS-SOFGYWHQSA-N 6-butyl-3-[(e)-2-(2h-tetrazol-5-yl)ethenyl]chromen-4-one Chemical group O=C1C2=CC(CCCC)=CC=C2OC=C1\C=C\C1=NN=NN1 KTWGPFONYHCTBS-SOFGYWHQSA-N 0.000 claims 1
- WXVLUOKHJBDAHP-UHFFFAOYSA-N 6-chloro-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(Cl)=CC=C2OC=C1C=1N=NNN=1 WXVLUOKHJBDAHP-UHFFFAOYSA-N 0.000 claims 1
- QZTNLXJTIQFBDS-UHFFFAOYSA-N 6-cyclohexyl-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound C1=C2C(=O)C(C=3NN=NN=3)=COC2=CC=C1C1CCCCC1 QZTNLXJTIQFBDS-UHFFFAOYSA-N 0.000 claims 1
- HKCIDVICIWFAGO-UHFFFAOYSA-N 6-cyclohexyl-4-oxochromene-3-carbonitrile Chemical compound C1=C2C(=O)C(C#N)=COC2=CC=C1C1CCCCC1 HKCIDVICIWFAGO-UHFFFAOYSA-N 0.000 claims 1
- GRYXAOXVOYEENX-UHFFFAOYSA-N 6-ethyl-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(CC)=CC=C21 GRYXAOXVOYEENX-UHFFFAOYSA-N 0.000 claims 1
- KYODOYCCRUBKCO-UHFFFAOYSA-N 6-methoxy-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(OC)=CC=C21 KYODOYCCRUBKCO-UHFFFAOYSA-N 0.000 claims 1
- VVCVSDJCXCPMPC-UHFFFAOYSA-N 6-methyl-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(C)=CC=C2OC=C1C=1N=NNN=1 VVCVSDJCXCPMPC-UHFFFAOYSA-N 0.000 claims 1
- HTXQVFXXVXOLCF-UHFFFAOYSA-N 6-methylchromen-4-one Chemical compound O1C=CC(=O)C2=CC(C)=CC=C21 HTXQVFXXVXOLCF-UHFFFAOYSA-N 0.000 claims 1
- XDGNQXLLFWQDEI-UHFFFAOYSA-N 6-nitro-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC([N+](=O)[O-])=CC=C2OC=C1C1=NN=NN1 XDGNQXLLFWQDEI-UHFFFAOYSA-N 0.000 claims 1
- CRXKYEYNBPXYOP-UHFFFAOYSA-N 6-nitro-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC([N+](=O)[O-])=CC=C21 CRXKYEYNBPXYOP-UHFFFAOYSA-N 0.000 claims 1
- OWGOLQNYJQWSJI-UHFFFAOYSA-N 6-propan-2-yl-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(C(C)C)=CC=C2OC=C1C=1N=NNN=1 OWGOLQNYJQWSJI-UHFFFAOYSA-N 0.000 claims 1
- BWTMLULCDVSEIX-UHFFFAOYSA-N 6-propyl-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(CCC)=CC=C2OC=C1C1=NN=NN1 BWTMLULCDVSEIX-UHFFFAOYSA-N 0.000 claims 1
- MJDWXEBWPUPOOK-UHFFFAOYSA-N 7-butoxy-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound C=1C(OCCCC)=CC=C(C2=O)C=1OC=C2C1=NN=NN1 MJDWXEBWPUPOOK-UHFFFAOYSA-N 0.000 claims 1
- VHHCUIADEKWJAU-UHFFFAOYSA-N 7-hydroxy-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound C=1C(O)=CC=C(C2=O)C=1OC=C2C1=NN=NN1 VHHCUIADEKWJAU-UHFFFAOYSA-N 0.000 claims 1
- CJKKBKNPMSTYOS-UHFFFAOYSA-N 7-methoxy-3-(2H-tetrazol-5-yl)chromen-4-one Chemical compound N1N=NN=C1C1=COC2=CC(=CC=C2C1=O)OC CJKKBKNPMSTYOS-UHFFFAOYSA-N 0.000 claims 1
- GKQQDLIXRFYLQD-UHFFFAOYSA-N 7-methoxy-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C=2C1=CC(OC)=CC=2 GKQQDLIXRFYLQD-UHFFFAOYSA-N 0.000 claims 1
- JVCURVBQFQHUCR-UHFFFAOYSA-N CCCCCCC1=CC2=C(C=C1)OC=CC2=O Chemical compound CCCCCCC1=CC2=C(C=C1)OC=CC2=O JVCURVBQFQHUCR-UHFFFAOYSA-N 0.000 claims 1
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 50
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 238000000354 decomposition reaction Methods 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 239000013078 crystal Substances 0.000 description 10
- 229910052799 carbon Inorganic materials 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 241000282421 Canidae Species 0.000 description 7
- 150000001299 aldehydes Chemical class 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 238000000921 elemental analysis Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 5
- 229960001653 citalopram Drugs 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 208000026935 allergic disease Diseases 0.000 description 4
- 230000003266 anti-allergic effect Effects 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- ATHHXGZTWNVVOU-UHFFFAOYSA-N monomethyl-formamide Natural products CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004442 acylamino group Chemical group 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- 208000010668 atopic eczema Diseases 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- 229960001340 histamine Drugs 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- XQDIZYUSQLQEHV-UHFFFAOYSA-N CC(C)=O.CC(C)=O.CC(C)=O Chemical compound CC(C)=O.CC(C)=O.CC(C)=O XQDIZYUSQLQEHV-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 230000000172 allergic effect Effects 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000000739 antihistaminic agent Substances 0.000 description 2
- 229940125715 antihistaminic agent Drugs 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- NBEMQPLNBYYUAZ-UHFFFAOYSA-N ethyl acetate;propan-2-one Chemical compound CC(C)=O.CCOC(C)=O NBEMQPLNBYYUAZ-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 239000000825 pharmaceutical preparation Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- YGSFNCRAZOCNDJ-UHFFFAOYSA-N propan-2-one Chemical compound CC(C)=O.CC(C)=O YGSFNCRAZOCNDJ-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 150000003536 tetrazoles Chemical group 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- FREHGEVVMNNOAE-UHFFFAOYSA-N (3-formyl-4-oxochromen-7-yl) acetate Chemical compound O1C=C(C=O)C(=O)C=2C1=CC(OC(=O)C)=CC=2 FREHGEVVMNNOAE-UHFFFAOYSA-N 0.000 description 1
- XTGCUDZCCIRWHL-UHFFFAOYSA-N 1-(5-chloro-2-hydroxyphenyl)ethanone Chemical compound CC(=O)C1=CC(Cl)=CC=C1O XTGCUDZCCIRWHL-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- YNPDFBFVMJNGKZ-UHFFFAOYSA-N 2'-Hydroxy-5'-methylacetophenone Chemical compound CC(=O)C1=CC(C)=CC=C1O YNPDFBFVMJNGKZ-UHFFFAOYSA-N 0.000 description 1
- LNCBPUWMGYOISS-UHFFFAOYSA-N 2'-hydroxy-5'-nitroacetophenone Chemical compound CC(=O)C1=CC([N+]([O-])=O)=CC=C1O LNCBPUWMGYOISS-UHFFFAOYSA-N 0.000 description 1
- JECYUBVRTQDVAT-UHFFFAOYSA-N 2-acetylphenol Chemical group CC(=O)C1=CC=CC=C1O JECYUBVRTQDVAT-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- WGTASENVNYJZBK-UHFFFAOYSA-N 3,4,5-trimethoxyamphetamine Chemical compound COC1=CC(CC(C)N)=CC(OC)=C1OC WGTASENVNYJZBK-UHFFFAOYSA-N 0.000 description 1
- UAQVSZRGIZWWLL-UHFFFAOYSA-N 4-oxo-6-propylchromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(CCC)=CC=C21 UAQVSZRGIZWWLL-UHFFFAOYSA-N 0.000 description 1
- RZGNEEWHPOEUDH-UHFFFAOYSA-N 6-hexyl-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(CCCCCC)=CC=C21 RZGNEEWHPOEUDH-UHFFFAOYSA-N 0.000 description 1
- YNZNWVPEGMADLF-UHFFFAOYSA-N 6-hydroxy-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(O)=CC=C2OC=C1C1=NN=NN1 YNZNWVPEGMADLF-UHFFFAOYSA-N 0.000 description 1
- SHYUITMLENOEDS-UHFFFAOYSA-N 6-methoxy-3-(2h-tetrazol-5-yl)chromen-4-one Chemical compound O=C1C2=CC(OC)=CC=C2OC=C1C1=NN=NN1 SHYUITMLENOEDS-UHFFFAOYSA-N 0.000 description 1
- FNRLRLMPBIRUSQ-UHFFFAOYSA-N 6-methyl-4-oxochromene-3-carbonitrile Chemical compound O1C=C(C#N)C(=O)C2=CC(C)=CC=C21 FNRLRLMPBIRUSQ-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- PCIITXGDSHXTSN-UHFFFAOYSA-N Chromone-3-carboxylic acid Chemical compound C1=CC=C2C(=O)C(C(=O)O)=COC2=C1 PCIITXGDSHXTSN-UHFFFAOYSA-N 0.000 description 1
- 206010012434 Dermatitis allergic Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 206010019233 Headaches Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- FXTTXRHGRZVUAG-UHFFFAOYSA-N P.Cl.Cl.Cl.Cl.Cl Chemical compound P.Cl.Cl.Cl.Cl.Cl FXTTXRHGRZVUAG-UHFFFAOYSA-N 0.000 description 1
- UILPJVPSNHJFIK-UHFFFAOYSA-N Paeonol Chemical compound COC1=CC=C(C(C)=O)C(O)=C1 UILPJVPSNHJFIK-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000669298 Pseudaulacaspis pentagona Species 0.000 description 1
- 206010039897 Sedation Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000012435 aralkylating agent Substances 0.000 description 1
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- QFPHNMPZQGLYCV-UHFFFAOYSA-N chembl3278546 Chemical compound O=C1C=2C=C(O)C(O)=CC=2OC=C1C1=NN=NN1 QFPHNMPZQGLYCV-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- RCKMWOKWVGPNJF-UHFFFAOYSA-N diethylcarbamazine Chemical compound CCN(CC)C(=O)N1CCN(C)CC1 RCKMWOKWVGPNJF-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- QACCCIVMWADWMN-UHFFFAOYSA-N ethane-1,2-diol;methoxymethane Chemical compound COC.OCCO QACCCIVMWADWMN-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- HRIKRJRMQIBSTO-UHFFFAOYSA-N ethyl 3-cyano-4-oxochromene-6-carboxylate Chemical compound O1C=C(C#N)C(=O)C2=CC(C(=O)OCC)=CC=C21 HRIKRJRMQIBSTO-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 244000144992 flock Species 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000010200 folin Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 231100000869 headache Toxicity 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- CXHHBNMLPJOKQD-UHFFFAOYSA-N methyl hydrogen carbonate Chemical compound COC(O)=O CXHHBNMLPJOKQD-UHFFFAOYSA-N 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000479 mixture part Substances 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 201000009240 nasopharyngitis Diseases 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- NOOLISFMXDJSKH-UHFFFAOYSA-N p-menthan-3-ol Chemical compound CC(C)C1CCC(C)CC1O NOOLISFMXDJSKH-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N phenyl propionaldehyde Natural products CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 206010039083 rhinitis Diseases 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 230000036280 sedation Effects 0.000 description 1
- 210000000582 semen Anatomy 0.000 description 1
- 231100000489 sensitizer Toxicity 0.000 description 1
- 230000001953 sensory effect Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- JBJWASZNUJCEKT-UHFFFAOYSA-M sodium;hydroxide;hydrate Chemical compound O.[OH-].[Na+] JBJWASZNUJCEKT-UHFFFAOYSA-M 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WRWQVSOJXAVREP-UHFFFAOYSA-J tetrachlorotitanium hydrochloride Chemical compound Cl.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] WRWQVSOJXAVREP-UHFFFAOYSA-J 0.000 description 1
- 125000004299 tetrazol-5-yl group Chemical group [H]N1N=NC(*)=N1 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/92—Naphthopyrans; Hydrogenated naphthopyrans
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP47037235A JPS5118955B2 (US20100223739A1-20100909-C00005.png) | 1972-04-12 | 1972-04-12 |
Publications (1)
Publication Number | Publication Date |
---|---|
PL89172B1 true PL89172B1 (US20100223739A1-20100909-C00005.png) | 1976-10-30 |
Family
ID=12491931
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PL1973161818A PL89172B1 (US20100223739A1-20100909-C00005.png) | 1972-04-12 | 1973-04-10 |
Country Status (21)
Families Citing this family (15)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB1540391A (en) * | 1975-04-11 | 1979-02-14 | Takeda Chemical Industries Ltd | 3-(1h-tetrazol-5-yl)-chromone derivatives |
US4033845A (en) * | 1975-11-20 | 1977-07-05 | Warner-Lambert Company | [2-(4-Oxo-4H-1-benzopyran-2-yl)ethenyl]benzonitriles and benzoic acids |
GB1560489A (en) * | 1976-05-21 | 1980-02-06 | Fisons Ltd | Pharmaceutical compositions |
US4177276A (en) * | 1976-06-16 | 1979-12-04 | Farmitalia Carlo Erba, S.P.A. | Substituted 2-vinyl-chromones and process for their preparation |
US4183945A (en) * | 1976-06-16 | 1980-01-15 | Carlo Erba S.P.A. | Substituted 2-vinyl-chromones and process for their preparation |
US4183946A (en) * | 1976-06-16 | 1980-01-15 | Carlo Erba S.P.A. | Substituted 2-vinyl-chromones and process for their preparation |
AU508350B2 (en) * | 1976-06-16 | 1980-03-20 | Farmitalia Carlo Erba S.P.A. | Substicuted 2-vinyl-chromones |
US4143145A (en) * | 1977-01-12 | 1979-03-06 | Carlo Erba S. P. A. | Substituted 2-vinyl-chromones and process for their preparation |
US4116971A (en) * | 1977-08-15 | 1978-09-26 | Warner-Lambert Company | 3-(1h-tetrazol-5-yl)chromones |
US4360527A (en) * | 1977-10-13 | 1982-11-23 | Warner-Lambert Company | 9-(Hydroxy, lower alkoxy or lower alkanoyloxy)-2-(1H-tetrazol-5-yl)naphtho-(2,1-b)-pyran-1-ones and anti-allergic use thereof |
DE2840936C2 (de) * | 1978-09-20 | 1983-02-10 | Warner-Lambert Co., 07950 Morris Plains, N.J. | 3-(1H-Tetrazol-5-yl)-chromone und ihre Verwendung |
EP0017332B1 (en) * | 1979-03-20 | 1985-07-31 | FISONS plc | Pharmaceutical heterocyclic compounds, processes for their preparation and compositions containing them |
ZA804788B (en) * | 1979-10-26 | 1981-07-29 | Erba Farmitalia | Substituted 2-(pyridyl-cyclopropyl)-chromones and process for their preparation |
JP2004323392A (ja) * | 2003-04-23 | 2004-11-18 | Toyo Kasei Kogyo Co Ltd | ビテトラゾールアミン化合物の製造方法 |
GB201506572D0 (en) | 2015-04-17 | 2015-06-03 | Johnson Matthey Davy Technologies Ltd | Process |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CA960223A (en) * | 1970-02-05 | 1974-12-31 | Mervyn E. Peel | Tetrazolyl chromones |
-
1972
- 1972-04-12 JP JP47037235A patent/JPS5118955B2/ja not_active Expired
-
1973
- 1973-04-05 AU AU54132/73A patent/AU470496B2/en not_active Expired
- 1973-04-10 US US349848A patent/US3896114A/en not_active Expired - Lifetime
- 1973-04-10 NL NL7305020A patent/NL7305020A/xx not_active Application Discontinuation
- 1973-04-10 PL PL1973161818A patent/PL89172B1/pl unknown
- 1973-04-10 DE DE2317899A patent/DE2317899A1/de not_active Withdrawn
- 1973-04-10 FR FR7312922A patent/FR2182951B1/fr not_active Expired
- 1973-04-11 CS CS7500001198A patent/CS185639B2/cs unknown
- 1973-04-11 PH PH14507A patent/PH13020A/en unknown
- 1973-04-11 ES ES413577A patent/ES413577A1/es not_active Expired
- 1973-04-11 SU SU1913752A patent/SU500758A3/ru active
- 1973-04-11 CA CA168,432A patent/CA1006160A/en not_active Expired
- 1973-04-11 CS CS7300002571A patent/CS185620B2/cs unknown
- 1973-04-11 NO NO1505/73A patent/NO137825C/no unknown
- 1973-04-11 BE BE129880A patent/BE798059A/xx unknown
- 1973-04-11 SE SE7305124A patent/SE402291B/xx unknown
- 1973-04-12 ZA ZA732526A patent/ZA732526B/xx unknown
- 1973-04-12 CH CH523773A patent/CH582174A5/xx not_active IP Right Cessation
- 1973-04-12 CH CH921976A patent/CH603616A5/xx not_active IP Right Cessation
- 1973-04-12 CH CH127977A patent/CH605891A5/xx not_active IP Right Cessation
- 1973-04-12 AT AT325073A patent/AT323739B/de not_active IP Right Cessation
- 1973-04-12 HU HUTA1333A patent/HU168124B/hu unknown
- 1973-04-12 GB GB1760273A patent/GB1417461A/en not_active Expired
- 1973-04-12 FI FI1160/73A patent/FI57408C/fi active
- 1973-04-12 GB GB1497275A patent/GB1417462A/en not_active Expired
- 1973-04-12 HU HUTA1246A patent/HU167386B/hu unknown
-
1974
- 1974-10-11 NO NO743670A patent/NO141556C/no unknown
- 1974-12-19 ES ES0433109A patent/ES433109A1/es not_active Expired
-
1975
- 1975-01-17 SU SU752099318A patent/SU745367A3/ru active
- 1975-04-10 FR FR7511248A patent/FR2273003B1/fr not_active Expired
-
1976
- 1976-02-18 SE SE7601868A patent/SE7601868L/xx unknown
-
1977
- 1977-07-21 PH PH20019A patent/PH13114A/en unknown
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
PL89172B1 (US20100223739A1-20100909-C00005.png) | ||
SU820659A3 (ru) | Способ получени производных 4-амино- 5-АлКилСульфОНилОАНизАМидОВ, иХ СОлЕй,ОКиСЕй, лЕВО- и пРАВОВРАщАющиХизОМЕРОВ /иХ ВАРиАНТы/ | |
US4126635A (en) | 2-amino-3-(5- and 6-)benzoylphenylacetic acids, esters and metal salts thereof | |
CA3063111C (en) | Histone deacetylases (hdacs) inhibitors | |
Khanage et al. | Synthesis and pharmacological evaluation of some new pyrimidine derivatives containing 1, 2, 4-triazole | |
JPS60209577A (ja) | ベンゾチオフェン誘導体 | |
JPH02240058A (ja) | ジアリール置換複素環式化合物 | |
GB2140412A (en) | Thiazolidine derivatives, process for the preparation and pharmaceutical compositions thereof | |
KR840001131B1 (ko) | 치환된 β-옥소-α-페닐-카바모일-피롤 프로피오니트릴의 제조방법 | |
NO771610L (no) | Fremgangsm}te for fremstilling av kinazolin-derivater | |
Brzozowski et al. | Synthesis, antitumor and anti-HIV activities of benzodithiazine-dioxides | |
EP0592664A1 (en) | Novel diphenylthyazole derivative | |
GB1561731A (en) | Process for the preparation of benzopyrane derivatives | |
JPS5967292A (ja) | チアジン誘導体 | |
JPS61502959A (ja) | 4↓−(イソキサゾリル)↓−チアゾ−ル↓−2↓−オキサミド酸誘導体 | |
Salam et al. | Facile synthesis of heterocycles having bacteriocidal activity incorporating oleic acid residues | |
Reddy et al. | 2‐Arylethenyl‐2′‐arylethynyl sulfones: A potential source for some spiroheterocycles | |
Abdullah et al. | Synthesis and evaluation of new pyrazoline and thiazolidinone derivatives as anticancer activity | |
US3415836A (en) | Salicylic acid esters of beta-pyridyl carbinol | |
US4151180A (en) | Chromone derivatives | |
US4085116A (en) | Novel chromone derivatives | |
HUT62004A (en) | Process for producing new piperazinoalkyl benzoxazine and thiazine derivatives with heterocyclic substituent, as well as pharmaceutical compositions comprising such compounds | |
US4031105A (en) | 3-(N-2', 6'xylyl)-carboxamide pyridone-2 | |
JPS6324498B2 (US20100223739A1-20100909-C00005.png) | ||
JPS649989B2 (US20100223739A1-20100909-C00005.png) |