PL82658B1 - Production of monohaloacyl halides[gb1374324a] - Google Patents
Production of monohaloacyl halides[gb1374324a] Download PDFInfo
- Publication number
- PL82658B1 PL82658B1 PL1972158007A PL15800772A PL82658B1 PL 82658 B1 PL82658 B1 PL 82658B1 PL 1972158007 A PL1972158007 A PL 1972158007A PL 15800772 A PL15800772 A PL 15800772A PL 82658 B1 PL82658 B1 PL 82658B1
- Authority
- PL
- Poland
- Prior art keywords
- ketene
- lactone
- halides
- halogen
- phenyl
- Prior art date
Links
- 150000004820 halides Chemical class 0.000 title claims abstract description 21
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000000034 method Methods 0.000 claims abstract description 46
- 150000002596 lactones Chemical class 0.000 claims abstract description 30
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 claims abstract description 20
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 13
- 150000002367 halogens Chemical class 0.000 claims abstract description 12
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 7
- 150000002561 ketenes Chemical class 0.000 claims abstract description 6
- 230000002140 halogenating effect Effects 0.000 claims abstract description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 4
- 125000006177 alkyl benzyl group Chemical group 0.000 claims abstract description 3
- 125000005037 alkyl phenyl group Chemical group 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 3
- 229960000380 propiolactone Drugs 0.000 claims abstract 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 11
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 239000007791 liquid phase Substances 0.000 claims description 3
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical group O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 2
- VEZXCJBBBCKRPI-UHFFFAOYSA-N beta-propiolactone Chemical group O=C1CCO1 VEZXCJBBBCKRPI-UHFFFAOYSA-N 0.000 claims 1
- GAEKPEKOJKCEMS-UHFFFAOYSA-N gamma-valerolactone Chemical group CC1CCC(=O)O1 GAEKPEKOJKCEMS-UHFFFAOYSA-N 0.000 claims 1
- 239000002904 solvent Substances 0.000 abstract description 35
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 abstract description 8
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 abstract description 6
- 150000001875 compounds Chemical class 0.000 abstract description 6
- 230000026030 halogenation Effects 0.000 abstract description 6
- 238000005658 halogenation reaction Methods 0.000 abstract description 6
- 239000006227 byproduct Substances 0.000 abstract description 5
- -1 α-butyl- Chemical group 0.000 abstract description 5
- 150000001266 acyl halides Chemical class 0.000 abstract description 4
- 239000003795 chemical substances by application Substances 0.000 abstract description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract description 3
- AOGQPLXWSUTHQB-UHFFFAOYSA-N hexyl acetate Chemical class CCCCCCOC(C)=O AOGQPLXWSUTHQB-UHFFFAOYSA-N 0.000 abstract description 3
- 239000007788 liquid Substances 0.000 abstract description 3
- RZGZTQYTDRQOEY-UHFFFAOYSA-N 2-phenylethenone Chemical compound O=C=CC1=CC=CC=C1 RZGZTQYTDRQOEY-UHFFFAOYSA-N 0.000 abstract description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 abstract description 2
- 238000002474 experimental method Methods 0.000 abstract description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 abstract description 2
- UYLUJGRCKKSWHS-UHFFFAOYSA-N prop-1-en-1-one Chemical compound CC=C=O UYLUJGRCKKSWHS-UHFFFAOYSA-N 0.000 abstract description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 abstract 2
- UKDOTCFNLHHKOF-FGRDZWBJSA-N (z)-1-chloroprop-1-ene;(z)-1,2-dichloroethene Chemical group C\C=C/Cl.Cl\C=C/Cl UKDOTCFNLHHKOF-FGRDZWBJSA-N 0.000 abstract 1
- 230000000052 comparative effect Effects 0.000 abstract 1
- 229910052739 hydrogen Inorganic materials 0.000 abstract 1
- 239000001257 hydrogen Substances 0.000 abstract 1
- 238000011065 in-situ storage Methods 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000000047 product Substances 0.000 description 12
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 10
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 8
- 239000012346 acetyl chloride Substances 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 8
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 238000011084 recovery Methods 0.000 description 4
- 239000000376 reactant Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- BSVMPWANOMFSPR-UHFFFAOYSA-N 2-iodoacetyl chloride Chemical compound ClC(=O)CI BSVMPWANOMFSPR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical class [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- VPCWSGCHQIRQHR-UHFFFAOYSA-N 2,2-diiodoacetyl chloride Chemical compound ClC(=O)C(I)I VPCWSGCHQIRQHR-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- NWXORMWIWGSYJJ-UHFFFAOYSA-N 2-ethylbut-1-en-1-one Chemical compound CCC(CC)=C=O NWXORMWIWGSYJJ-UHFFFAOYSA-N 0.000 description 1
- VDOKWPVSGXHSNP-UHFFFAOYSA-N 2-methylprop-1-en-1-one Chemical compound CC(C)=C=O VDOKWPVSGXHSNP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- JOYHVAXKUNIIQD-UHFFFAOYSA-N ClC(C(=O)Cl)Cl.ClCC(=O)Cl Chemical compound ClC(C(=O)Cl)Cl.ClCC(=O)Cl JOYHVAXKUNIIQD-UHFFFAOYSA-N 0.000 description 1
- AJDDLWRITFOPPN-UHFFFAOYSA-N O=C(CCCl)Cl.Cl Chemical compound O=C(CCCl)Cl.Cl AJDDLWRITFOPPN-UHFFFAOYSA-N 0.000 description 1
- BWWJXTYJTUMQMN-UHFFFAOYSA-N [Cl].C=C=O Chemical compound [Cl].C=C=O BWWJXTYJTUMQMN-UHFFFAOYSA-N 0.000 description 1
- XBMQSWGBBPMRDW-UHFFFAOYSA-N [Cl].CC(C)=O Chemical compound [Cl].CC(C)=O XBMQSWGBBPMRDW-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- JSEMCPMTAXQTJN-UHFFFAOYSA-N but-1-en-1-one Chemical compound CCC=C=O JSEMCPMTAXQTJN-UHFFFAOYSA-N 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ZWJPCOALBPMBIC-UHFFFAOYSA-N diphenylketene Chemical compound C=1C=CC=CC=1C(=C=O)C1=CC=CC=C1 ZWJPCOALBPMBIC-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000012907 honey Nutrition 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/58—Preparation of carboxylic acid halides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US18544971A | 1971-09-30 | 1971-09-30 | |
| US27796072A | 1972-08-04 | 1972-08-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82658B1 true PL82658B1 (en) | 1975-10-31 |
Family
ID=26881151
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972158007A PL82658B1 (en) | 1971-09-30 | 1972-09-29 | Production of monohaloacyl halides[gb1374324a] |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS5110215B2 (https=) |
| BE (1) | BE789466A (https=) |
| BG (1) | BG25204A3 (https=) |
| CA (1) | CA972767A (https=) |
| CH (1) | CH576931A5 (https=) |
| CS (1) | CS161808B2 (https=) |
| DD (1) | DD99982A5 (https=) |
| DE (1) | DE2247765C3 (https=) |
| DK (1) | DK153082C (https=) |
| EG (1) | EG11319A (https=) |
| FR (1) | FR2154768B1 (https=) |
| GB (1) | GB1374324A (https=) |
| IL (1) | IL40465A (https=) |
| IT (1) | IT968447B (https=) |
| NL (1) | NL158161B (https=) |
| PL (1) | PL82658B1 (https=) |
| RO (1) | RO59345A (https=) |
| SU (1) | SU489304A3 (https=) |
| YU (1) | YU37305B (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL181578C (nl) * | 1973-07-16 | 1987-09-16 | Monsanto Co | Werkwijze voor de bereiding van monohalogeenacylhalogeniden. |
| JPS51144424U (https=) * | 1975-05-16 | 1976-11-20 | ||
| JPS53147208U (https=) * | 1977-04-25 | 1978-11-20 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2862964A (en) * | 1955-07-12 | 1958-12-02 | Distillers Co Yeast Ltd | Process for producing monochloro acetyl chloride |
-
0
- BE BE789466D patent/BE789466A/xx not_active IP Right Cessation
-
1972
- 1972-09-26 NL NL7212983.A patent/NL158161B/xx not_active IP Right Cessation
- 1972-09-28 EG EG369/72A patent/EG11319A/xx active
- 1972-09-29 PL PL1972158007A patent/PL82658B1/pl unknown
- 1972-09-29 SU SU1832410A patent/SU489304A3/ru active
- 1972-09-29 RO RO72372A patent/RO59345A/ro unknown
- 1972-09-29 GB GB4505472A patent/GB1374324A/en not_active Expired
- 1972-09-29 DD DD165945A patent/DD99982A5/xx unknown
- 1972-09-29 DK DK483072A patent/DK153082C/da active
- 1972-09-29 CS CS6626A patent/CS161808B2/cs unknown
- 1972-09-29 DE DE2247765A patent/DE2247765C3/de not_active Expired
- 1972-09-29 IT IT29878/72A patent/IT968447B/it active
- 1972-09-29 BG BG021505A patent/BG25204A3/xx unknown
- 1972-09-29 IL IL40465A patent/IL40465A/xx unknown
- 1972-09-29 FR FR7234699A patent/FR2154768B1/fr not_active Expired
- 1972-09-29 CH CH1430972A patent/CH576931A5/xx not_active IP Right Cessation
- 1972-09-29 JP JP47097268A patent/JPS5110215B2/ja not_active Expired
- 1972-09-29 CA CA152,964A patent/CA972767A/en not_active Expired
- 1972-09-29 YU YU2463/72A patent/YU37305B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK153082C (da) | 1988-11-07 |
| CH576931A5 (https=) | 1976-06-30 |
| DK153082B (da) | 1988-06-13 |
| RO59345A (https=) | 1976-02-15 |
| GB1374324A (en) | 1974-11-20 |
| FR2154768A1 (https=) | 1973-05-11 |
| DD99982A5 (https=) | 1973-09-05 |
| IT968447B (it) | 1974-03-20 |
| JPS5110215B2 (https=) | 1976-04-02 |
| DE2247765B2 (de) | 1974-09-26 |
| NL158161B (nl) | 1978-10-16 |
| CA972767A (en) | 1975-08-12 |
| DE2247765C3 (de) | 1975-05-15 |
| YU246372A (en) | 1983-04-27 |
| IL40465A0 (en) | 1972-11-28 |
| FR2154768B1 (https=) | 1980-04-18 |
| EG11319A (en) | 1977-04-30 |
| YU37305B (en) | 1984-08-31 |
| NL7212983A (https=) | 1973-04-03 |
| DE2247765A1 (de) | 1973-05-03 |
| SU489304A3 (ru) | 1975-10-25 |
| IL40465A (en) | 1975-05-22 |
| BE789466A (fr) | 1973-03-29 |
| BG25204A3 (en) | 1978-08-10 |
| CS161808B2 (https=) | 1975-06-10 |
| JPS4840711A (https=) | 1973-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4327039A (en) | Process for the production of 3-amino-1-hydroxypropane-1,1-diphosphonic acid | |
| US3932542A (en) | Process for preparation of 2,5-dibromo-p-xylene | |
| GB2123416A (en) | Preparing haloalkyl arylalkanoate esters and arylalkanoic acids | |
| US4174347A (en) | Preparation of esters | |
| PL82658B1 (en) | Production of monohaloacyl halides[gb1374324a] | |
| US4044060A (en) | Process for preparing geminal dihalides | |
| US4056509A (en) | Preparation of benzyl cyanides | |
| US4057583A (en) | Process for the preparation of pinacolone | |
| US2726264A (en) | Alpha-halogenosulfamylacetophenones | |
| DE69015931T2 (de) | Verfahren zur Herstellung von 4-halogeno-2-alkoximino-3-oxo Fettsäuren. | |
| US4675447A (en) | Method for preparation of alkylsulfonyl alkylchlorobenzenes | |
| US4338467A (en) | Process for preparing arylacetaldehydes | |
| KR20050000540A (ko) | 4-페닐-4-옥소-2-부텐산 에스테르 유도체의 제조방법 | |
| US2764619A (en) | Preparation of 1, 1, 1-trihalo-2-chloro-2-methylalkanes | |
| HU204759B (en) | Process for producing chlorocarboxylic acid chlorides | |
| US3943170A (en) | Process for the preparation of halo-methylphosphinic acid halides | |
| US5132448A (en) | Preparation of α-chloro phosphorus ylides | |
| US3468900A (en) | Process for preparing isoxazole compounds | |
| US3928370A (en) | Process for making dialkyl pyridylphosphates | |
| GB2034713A (en) | Preparation of amenophenol ether | |
| KR920004603B1 (ko) | 2,2-디메톡시-2-페닐아세토페논의 제조방법 | |
| JP3945610B2 (ja) | フマル酸モノエステル類及びそのアルカリ金属塩類の製造方法 | |
| US5319094A (en) | Process for producing 2-alkyl-4-halo-5-formylimidazoles | |
| JPH05125017A (ja) | ピバリン酸クロロメチルエステルの製造法 | |
| US3201468A (en) | Preparation of alpha-isonitrosoketones by nitrosation of ketones |