PL82316B1 - - Google Patents
Download PDFInfo
- Publication number
- PL82316B1 PL82316B1 PL1972155188A PL15518872A PL82316B1 PL 82316 B1 PL82316 B1 PL 82316B1 PL 1972155188 A PL1972155188 A PL 1972155188A PL 15518872 A PL15518872 A PL 15518872A PL 82316 B1 PL82316 B1 PL 82316B1
- Authority
- PL
- Poland
- Prior art keywords
- compound
- general formula
- acid
- formula
- mixture
- Prior art date
Links
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 72
- 150000001875 compounds Chemical class 0.000 claims description 55
- 238000000034 method Methods 0.000 claims description 50
- 239000000203 mixture Substances 0.000 claims description 41
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 30
- 239000002904 solvent Substances 0.000 claims description 20
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 claims description 15
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Chemical compound [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 claims description 15
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 claims description 15
- 229910001958 silver carbonate Inorganic materials 0.000 claims description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- 229960002726 vincamine Drugs 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 238000002844 melting Methods 0.000 claims description 11
- 230000008018 melting Effects 0.000 claims description 11
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 9
- 239000008096 xylene Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000009467 reduction Effects 0.000 claims description 7
- 238000006722 reduction reaction Methods 0.000 claims description 7
- RXPRRQLKFXBCSJ-HLAWJBBLSA-N 16-epivincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-HLAWJBBLSA-N 0.000 claims description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 5
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 claims description 5
- 239000012458 free base Substances 0.000 claims description 5
- 230000000707 stereoselective effect Effects 0.000 claims description 5
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 229960001270 d- tartaric acid Drugs 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000001449 anionic compounds Chemical group 0.000 claims description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 2
- 238000005947 deacylation reaction Methods 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 229910001412 inorganic anion Inorganic materials 0.000 claims description 2
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 claims 8
- 238000005984 hydrogenation reaction Methods 0.000 claims 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 claims 1
- YONLFQNRGZXBBF-UHFFFAOYSA-N 2,3-dibenzoyloxybutanedioic acid Chemical group C=1C=CC=CC=1C(=O)OC(C(O)=O)C(C(=O)O)OC(=O)C1=CC=CC=C1 YONLFQNRGZXBBF-UHFFFAOYSA-N 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 125000002560 nitrile group Chemical group 0.000 claims 1
- 239000007800 oxidant agent Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000000921 elemental analysis Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000004071 biological effect Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- -1 hydroxy ester Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CFVZILWIXKITDD-UHFFFAOYSA-N 2-acetyloxyprop-2-enoic acid Chemical compound CC(=O)OC(=C)C(O)=O CFVZILWIXKITDD-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- LFSHREXVLSTLFB-UHFFFAOYSA-N 1-cyanoethenyl acetate Chemical compound CC(=O)OC(=C)C#N LFSHREXVLSTLFB-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000863486 Vinca minor Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000006477 desulfuration reaction Methods 0.000 description 1
- 230000023556 desulfurization Effects 0.000 description 1
- ASURECOXOZVQDX-UHFFFAOYSA-N dimethyl 4-ethyl-4-formylheptanedioate Chemical compound COC(=O)CCC(CC)(CCC(=O)OC)C=O ASURECOXOZVQDX-UHFFFAOYSA-N 0.000 description 1
- FOBPTJZYDGNHLR-UHFFFAOYSA-N diphosphorus Chemical compound P#P FOBPTJZYDGNHLR-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000006345 epimerization reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- NGJIJGCJRNAGHK-UHFFFAOYSA-N methyl 2-acetyloxyprop-2-enoate Chemical compound COC(=O)C(=C)OC(C)=O NGJIJGCJRNAGHK-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- SUBJHSREKVAVAR-UHFFFAOYSA-N sodium;methanol;methanolate Chemical compound [Na+].OC.[O-]C SUBJHSREKVAVAR-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI430A HU163143B (en:Method) | 1971-05-07 | 1971-05-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82316B1 true PL82316B1 (en:Method) | 1975-10-31 |
Family
ID=11000865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1972155188A PL82316B1 (en:Method) | 1971-05-07 | 1972-05-05 |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3755333A (en:Method) |
| JP (2) | JPS587636B1 (en:Method) |
| AT (1) | AT326838B (en:Method) |
| BE (1) | BE782973A (en:Method) |
| BG (1) | BG22840A3 (en:Method) |
| CA (1) | CA998051A (en:Method) |
| CH (1) | CH588490A5 (en:Method) |
| CS (1) | CS163277B2 (en:Method) |
| DD (1) | DD97889A5 (en:Method) |
| DK (1) | DK140283B (en:Method) |
| EG (1) | EG10514A (en:Method) |
| FI (1) | FI53823C (en:Method) |
| FR (1) | FR2143657B1 (en:Method) |
| GB (1) | GB1369934A (en:Method) |
| HU (1) | HU163143B (en:Method) |
| IL (1) | IL39304A (en:Method) |
| NL (1) | NL145859B (en:Method) |
| PL (1) | PL82316B1 (en:Method) |
| RO (3) | RO62705A7 (en:Method) |
| SE (1) | SE400288B (en:Method) |
| SU (1) | SU460626A3 (en:Method) |
| YU (1) | YU35022B (en:Method) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2176516B1 (en:Method) * | 1972-03-22 | 1975-03-14 | Synthelabo | |
| FR2179620B1 (en:Method) * | 1972-04-14 | 1975-12-26 | Roussel Uclaf | |
| FR2192107A1 (en) * | 1972-04-20 | 1974-02-08 | Sandoz Sa | Vincamine and apovincamine synthesis - via novel inters |
| FR2228479B1 (en:Method) * | 1973-05-07 | 1976-05-14 | Synthelabo | |
| FR2276048A1 (fr) * | 1974-06-27 | 1976-01-23 | Synthelabo | Nouveaux esters du cyclohexanol, leurs sels, leur preparation et les medicaments qui les renferment |
| HU171165B (hu) * | 1974-11-26 | 1977-11-28 | Richter Gedeon Vegyeszet | Sposob poluchenija proizvodnykh oktagidro-indolo-skobka-2,3-a-skobka zakryta-kinolizina |
| AU499923B2 (en) * | 1975-06-27 | 1979-05-03 | Richter Gedeon Vegyeszeti Gyar N | Indoloquinolizine derivatives & their production |
| HU175527B (hu) * | 1977-03-28 | 1980-08-28 | Richter Gedeon Vegyeszet | Sposob dlja totalsinteze slozhnykh efirov apovinkaminnojj kisloty i gomologov |
| US4131058A (en) * | 1977-10-06 | 1978-12-26 | R. A. Pearson Company | End tab folding mechanism for cartons |
| US4315011A (en) * | 1978-07-12 | 1982-02-09 | Richter Gedeon Vegyeszeti Gyar Rt. | 1-Alkyl-9-bromohexahydroindolo quinolizium salts and use thereof to increase blood flow |
| FR2459799A1 (fr) * | 1979-06-22 | 1981-01-16 | Synthelabo | Synthese de la ()-vincamine |
| HU181495B (en) * | 1979-05-31 | 1983-07-28 | Richter Gedeon Vegyeszet | Process for producing hydroxy-imino-eburnane derivatives |
| US4446139A (en) * | 1979-05-31 | 1984-05-01 | Richter Gedeon Vegyeszeti Gyar R.T. | Hexahydroindoloquinolizinium and octahydroindoloquinolizine esters, and method of increasing blood flow in an animal with hydroxyamino-eburnane derivatives |
| EP0025069B1 (de) * | 1979-09-06 | 1982-06-16 | Kali-Chemie Pharma GmbH | Neues Pentylspartein-Salz, dieses enthaltendes Arzneimittel und Verfahren zur Herstellung eines solchen Arzneimittels |
| IT1132307B (it) * | 1980-08-04 | 1986-07-02 | Mora Paolo Corvi | Procedimento per la sintesi di vincamina ed alcaloidi indolici correlati |
| HU186891B (en) * | 1981-06-12 | 1985-10-28 | Richter Gedeon Vegyeszet | Process for producing esters of apovincaminic acid |
| HU182380B (en) * | 1981-09-30 | 1983-12-28 | Richter Gedeon Vegyeszet | Process for producing esters of vincaminic acid |
| JPS6149779U (en:Method) * | 1984-09-04 | 1986-04-03 | ||
| JPS61154283U (en:Method) * | 1985-03-18 | 1986-09-25 | ||
| JPS6283088U (en:Method) * | 1985-11-14 | 1987-05-27 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3454583A (en) * | 1965-07-19 | 1969-07-08 | Us Health Education & Welfare | Synthesis of vincamine |
| US3542796A (en) * | 1969-07-07 | 1970-11-24 | Miles Lab | Certain hexahydro-1,12-trimethylene-indolo(2,3-a)quinolizines |
-
1971
- 1971-05-07 HU HURI430A patent/HU163143B/hu unknown
-
1972
- 1972-04-25 EG EG166/72A patent/EG10514A/xx active
- 1972-04-25 IL IL39304A patent/IL39304A/en unknown
- 1972-04-26 GB GB1946773A patent/GB1369934A/en not_active Expired
- 1972-04-28 FR FR7215376A patent/FR2143657B1/fr not_active Expired
- 1972-05-01 CA CA140,932A patent/CA998051A/en not_active Expired
- 1972-05-02 US US00249492A patent/US3755333A/en not_active Expired - Lifetime
- 1972-05-03 BE BE782973A patent/BE782973A/xx not_active IP Right Cessation
- 1972-05-04 FI FI1269/72A patent/FI53823C/fi active
- 1972-05-04 SE SE7205901A patent/SE400288B/xx unknown
- 1972-05-04 YU YU1170/72A patent/YU35022B/xx unknown
- 1972-05-05 CH CH669672A patent/CH588490A5/xx not_active IP Right Cessation
- 1972-05-05 SU SU1783305A patent/SU460626A3/ru active
- 1972-05-05 CS CS3051A patent/CS163277B2/cs unknown
- 1972-05-05 PL PL1972155188A patent/PL82316B1/pl unknown
- 1972-05-05 DK DK224272AA patent/DK140283B/da unknown
- 1972-05-05 AT AT391472A patent/AT326838B/de not_active IP Right Cessation
- 1972-05-06 RO RO7200079743A patent/RO62705A7/ro unknown
- 1972-05-06 RO RO70791A patent/RO59092A/ro unknown
- 1972-05-06 RO RO7200079742A patent/RO62704A/ro unknown
- 1972-05-06 JP JP47044947A patent/JPS587636B1/ja active Granted
- 1972-05-06 BG BG020416A patent/BG22840A3/xx unknown
- 1972-05-08 NL NL727206174A patent/NL145859B/xx not_active IP Right Cessation
- 1972-05-08 DD DD162803A patent/DD97889A5/xx unknown
-
1981
- 1981-05-12 JP JP56070246A patent/JPS5827276B2/ja not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL82316B1 (en:Method) | ||
| Kuehne et al. | Studies in biomimetic alkaloid syntheses. 13. Total syntheses of racemic aspidofractine, pleiocarpine, pleiocarpinine, kopsinine, N-methylkopsanone, and kopsanone | |
| GB2149408A (en) | 1,25-dihydroxyvitamin d2 compounds and methods for their preparation | |
| JPH0610189B2 (ja) | 10−オキソビタミンd類似体 | |
| SE446003B (sv) | Mellanprodukter for framstellning av hydroxiaminoeburnanderivat | |
| US4045443A (en) | Organic compounds | |
| Toke et al. | Synthesis of yohimbines. I. Total synthesis of alloyohimbine and. alpha.-yohimbine and their epimers. Revised structure of natural alloyohimbine | |
| US4087438A (en) | Thieno[3,4-d]furoxan and process for its preparation | |
| Bakasse et al. | Cephalosporins from glycinic esters. 1. Total synthesis of the cephamycin framework | |
| HRP980175A2 (en) | Process for preparing o-(3-amino-2-hydroxy-propyl)-hydroxymic acid halides | |
| US3428639A (en) | Preparation of ergot alkaloids | |
| GB2036744A (en) | Eburnane derivatives | |
| SU1189348A3 (ru) | Способ получени сложных эфиров алкоксивинкаминовой кислоты и/или сложных эфиров алкоксиаповинкаминовой кислоты или их эпимеров,рацематов,оптически активных изомеров или их кислотных физиологически приемлемых солей | |
| US4314939A (en) | Process for the preparation of 15-hydroxyimino-E-homoeburnane and intermediates therefor | |
| US4123535A (en) | Psychostimulating 14-amino-14,15-dihydroeburnamenines | |
| US4322350A (en) | Process for the synthesis of leurosine and of its derivatives | |
| CN118530084B (zh) | 一种催化[4+2]环加成合成手性桥联双环内酯的方法 | |
| PL89681B1 (en:Method) | ||
| CN111662287B (zh) | 5-叔丁基-4-乙基-3-甲基-二氢-3h-咪唑并吡啶-(4h)-二甲酸基酯制法 | |
| SU683626A3 (ru) | Способ получени дегидропенициллинов | |
| CH658059A5 (de) | Verfahren zur herstellung von 10-brom-vincaminen. | |
| HU201073B (en) | Process for producing cristalline intermediates for antibiotics | |
| KR100474228B1 (ko) | 파크리탁셀의분리방법 | |
| US2957877A (en) | New process for the preparation of organic alkaloid-like compounds | |
| FI64136B (fi) | Foerfarande foer framstaellning av d-2-(6-metoxi-2-naftyl)-propionsyra |