PL81442B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81442B1 PL81442B1 PL15174671A PL15174671A PL81442B1 PL 81442 B1 PL81442 B1 PL 81442B1 PL 15174671 A PL15174671 A PL 15174671A PL 15174671 A PL15174671 A PL 15174671A PL 81442 B1 PL81442 B1 PL 81442B1
- Authority
- PL
- Poland
- Prior art keywords
- general formula
- amino
- ethanol
- phosphoric acid
- yield
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- 229940049706 benzodiazepine Drugs 0.000 claims description 4
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 7
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical class NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- BOMADHYBXMKSDN-UHFFFAOYSA-N CNC1=C(C=C(C=C1)Cl)C(=NCCO)C2=CC=CC=C2 Chemical compound CNC1=C(C=C(C=C1)Cl)C(=NCCO)C2=CC=CC=C2 BOMADHYBXMKSDN-UHFFFAOYSA-N 0.000 description 2
- WPNMLCMTDCANOZ-UHFFFAOYSA-N [5-chloro-2-(methylamino)phenyl]-phenylmethanone Chemical compound CNC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 WPNMLCMTDCANOZ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- ZWWWYOKRVNYQHF-UHFFFAOYSA-N 2,3-dihydro-1h-1,2-benzodiazepine Chemical class C1=CCNNC2=CC=CC=C21 ZWWWYOKRVNYQHF-UHFFFAOYSA-N 0.000 description 1
- DRRPSTDRWJZCBV-UHFFFAOYSA-N 2-[[(2-amino-5-chlorophenyl)-phenylmethylidene]amino]ethanol Chemical compound NC1=CC=C(Cl)C=C1C(=NCCO)C1=CC=CC=C1 DRRPSTDRWJZCBV-UHFFFAOYSA-N 0.000 description 1
- -1 2-amino halide Chemical class 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000001557 benzodiazepines Chemical class 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 150000004908 diazepines Chemical class 0.000 description 1
- HVBMYHDTXIDFKE-UHFFFAOYSA-N diethyl hydrogen phosphate;ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O.CCOP(O)(=O)OCC HVBMYHDTXIDFKE-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920000137 polyphosphoric acid Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 229940001470 psychoactive drug Drugs 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DD15158570 | 1970-11-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81442B1 true PL81442B1 (enFirst) | 1975-08-30 |
Family
ID=5483205
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL15174671A PL81442B1 (enFirst) | 1970-11-25 | 1971-11-23 |
Country Status (3)
| Country | Link |
|---|---|
| PL (1) | PL81442B1 (enFirst) |
| RO (1) | RO62251A (enFirst) |
| YU (1) | YU34480B (enFirst) |
-
1971
- 1971-11-02 YU YU277871A patent/YU34480B/xx unknown
- 1971-11-09 RO RO6869371A patent/RO62251A/ro unknown
- 1971-11-23 PL PL15174671A patent/PL81442B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RO62251A (enFirst) | 1977-05-15 |
| YU277871A (en) | 1979-02-28 |
| YU34480B (en) | 1979-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| WO2002018390A1 (en) | Process for preparation of hydrates of olanzapine and their conversion into crystalline forms of olanzapine | |
| HU194238B (en) | Process for preparing ortho-condensed pyrrole derivatives and pharmaceuticals comprising the same | |
| HU178593B (en) | Process for producing 3-hydroxy-6-phenyl-1,2,3,4-tetrahydro-1,5-benzodiazocine derivatives | |
| US3080364A (en) | 3, 6, 8-triketopyrimido [5, 4-] 1, 4-thiazines and process | |
| CA2368815A1 (en) | Novel synthesis and crystallization of piperazine ring-containing compounds | |
| SU442601A1 (ru) | Способ получени производных азепина | |
| GB2123817A (en) | 4-hydroxy-3-quinoline-carboxylic acid derivatives | |
| PL81442B1 (enFirst) | ||
| HRP20050039A2 (en) | Crystal forms of olanzapine and processes for their preparation | |
| KR940003759B1 (ko) | 4-oh 퀴놀린 카르복실산 유도체의 제조방법 | |
| SU725563A3 (ru) | Способ получени производных имидазо/1,5-а//1,4/диазепина или их солей | |
| SU755785A1 (ru) | Способ получения бензотиено (3,2-ь)-бензотиофена или его 2,7—дйзамещенных производных 1 2 | |
| US3567745A (en) | 2-(2-azido-n-methylacetamido)-5-chloro-benzophenone | |
| JPS61178970A (ja) | 新規2−置換された1,4−ベンゾジアゼピンの製法 | |
| KR910000417B1 (ko) | 1,7-디하이드로-피롤로[3,4-e][1,4]디아제핀-2(3H)-온 유도체의 제조방법 | |
| US3256335A (en) | Method of making 5h-dibenzo [a, d] cyclohepten-5-ones | |
| KR100856133B1 (ko) | 아토르바스타틴의 개선된 제조방법 | |
| GB1594907A (en) | Isoquinoline derivatives | |
| JP2734096B2 (ja) | 1,4―ベンゾジアゼピン誘導体の製造方法 | |
| JP4420606B2 (ja) | 6−アリール−4H−s−トリアゾロ[3,4−c]−チエノ[2,3−e]−1,4−ジアゼピンの調製方法 | |
| KR100280925B1 (ko) | 2-니트로티오잔톤의 제조방법 | |
| JPH029572B2 (enFirst) | ||
| SU366615A1 (ru) | СССРПриоритет 08.V.1970, № р 2022503.0, ФРГ 23.IX.1970, № Р 2046848.8, ФРГОпубликовано 16.1.1973. Бюллетень № 7 Дата опубликовани описани 11.VI.1973М. Кл. С 07f 9/50 С 07d 53/06УДК 547.341.07(088.8) | |
| SU436496A3 (ru) | Способ получения производных бензодиазепина | |
| AT395155B (de) | Verfahren zur herstellung von neuen imidazo(1,5-a)(1,4)diazepinverbindungen |