PL81227B1 - Quinazoline derivatives [gb1349136a] - Google Patents
Quinazoline derivatives [gb1349136a] Download PDFInfo
- Publication number
- PL81227B1 PL81227B1 PL1970144794A PL14479470A PL81227B1 PL 81227 B1 PL81227 B1 PL 81227B1 PL 1970144794 A PL1970144794 A PL 1970144794A PL 14479470 A PL14479470 A PL 14479470A PL 81227 B1 PL81227 B1 PL 81227B1
- Authority
- PL
- Poland
- Prior art keywords
- preparation
- amino
- formula
- hydroxyethyl
- nitrate
- Prior art date
Links
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 title abstract 2
- -1 3 - Bis - (2 - hydroxyethyl)aminopropylamine dinitrate ester Chemical class 0.000 claims abstract description 29
- NHNBFGGVMKEFGY-UHFFFAOYSA-N nitrate group Chemical group [N+](=O)([O-])[O-] NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims abstract description 26
- 150000001412 amines Chemical class 0.000 claims abstract description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 6
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 5
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 57
- 238000002360 preparation method Methods 0.000 claims description 31
- 229910002651 NO3 Inorganic materials 0.000 claims description 27
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- UMDYVCIRLCISIS-UHFFFAOYSA-N 2,4,5-trimethoxyquinazoline Chemical compound COC1=NC(OC)=C2C(OC)=CC=CC2=N1 UMDYVCIRLCISIS-UHFFFAOYSA-N 0.000 claims description 3
- 229910004679 ONO2 Inorganic materials 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000002823 nitrates Chemical class 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- BWYJJZBRYSADRP-UHFFFAOYSA-N 2-methoxyquinazoline Chemical compound C1=CC=CC2=NC(OC)=NC=C21 BWYJJZBRYSADRP-UHFFFAOYSA-N 0.000 claims description 2
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 150000003254 radicals Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 claims description 2
- PENGSSGLKMRMBU-UHFFFAOYSA-N 3-(2-amino-6,7,8-trimethoxyquinazolin-4-yl)propane-1,2-diol Chemical compound OC(CC1=NC(=NC2=C(C(=C(C=C12)OC)OC)OC)N)CO PENGSSGLKMRMBU-UHFFFAOYSA-N 0.000 claims 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims 1
- QJPFKTLHFMUKGO-UHFFFAOYSA-N 4-bromo-6,7,8-trimethoxyquinazoline Chemical compound BrC1=NC=NC2=C(C(=C(C=C12)OC)OC)OC QJPFKTLHFMUKGO-UHFFFAOYSA-N 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 31
- 150000003839 salts Chemical class 0.000 abstract description 10
- 239000002253 acid Substances 0.000 abstract description 6
- 230000000802 nitrating effect Effects 0.000 abstract description 4
- 229910052799 carbon Inorganic materials 0.000 abstract description 3
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 2
- 238000006396 nitration reaction Methods 0.000 abstract description 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 2
- 208000001953 Hypotension Diseases 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 230000003257 anti-anginal effect Effects 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- 150000002440 hydroxy compounds Chemical class 0.000 abstract 1
- 208000021822 hypotensive Diseases 0.000 abstract 1
- 230000001077 hypotensive effect Effects 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000008024 pharmaceutical diluent Substances 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 25
- 230000008018 melting Effects 0.000 description 22
- 238000002844 melting Methods 0.000 description 22
- 239000000203 mixture Substances 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 11
- 238000000354 decomposition reaction Methods 0.000 description 11
- 229910017604 nitric acid Inorganic materials 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- RISDWKVWTPMBDJ-UHFFFAOYSA-N 2,4,5-triethoxyquinazoline Chemical class C(C)OC1=C2C(=NC(=NC2=CC=C1)OCC)OCC RISDWKVWTPMBDJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 239000003416 antiarrhythmic agent Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- ORRMRZIJVLFOOZ-UHFFFAOYSA-N 6,7,8-trimethoxy-1h-quinazolin-4-one Chemical compound COC1=C(OC)C(OC)=CC2=C1NC=NC2=O ORRMRZIJVLFOOZ-UHFFFAOYSA-N 0.000 description 1
- VQTMHRLFVXHMFU-UHFFFAOYSA-N 6,7,8-trimethoxyquinazolin-2-amine Chemical compound NC1=NC2=C(C(=C(C=C2C=N1)OC)OC)OC VQTMHRLFVXHMFU-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- JRLTTZUODKEYDH-UHFFFAOYSA-N 8-methylquinoline Chemical group C1=CN=C2C(C)=CC=CC2=C1 JRLTTZUODKEYDH-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- OMBRFUXPXNIUCZ-UHFFFAOYSA-N dioxidonitrogen(1+) Chemical compound O=[N+]=O OMBRFUXPXNIUCZ-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000001893 nitrooxy group Chemical group [O-][N+](=O)O* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000003260 vortexing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/94—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US87043969A | 1969-12-05 | 1969-12-05 | |
| SE1157870 | 1970-08-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81227B1 true PL81227B1 (en) | 1975-08-30 |
Family
ID=26655842
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970144794A PL81227B1 (en) | 1969-12-05 | 1970-12-03 | Quinazoline derivatives [gb1349136a] |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS4837035B1 (OSRAM) |
| AU (1) | AU5918873A (OSRAM) |
| BE (1) | BE759842R (OSRAM) |
| BG (2) | BG17598A3 (OSRAM) |
| CH (2) | CH552601A (OSRAM) |
| DE (1) | DE2059164A1 (OSRAM) |
| ES (1) | ES386121A1 (OSRAM) |
| FR (1) | FR2081329B2 (OSRAM) |
| GB (5) | GB1349140A (OSRAM) |
| HU (2) | HU162867B (OSRAM) |
| IE (1) | IE34780B1 (OSRAM) |
| IL (1) | IL35779A (OSRAM) |
| NL (1) | NL7017669A (OSRAM) |
| OA (1) | OA03536A (OSRAM) |
| PL (1) | PL81227B1 (OSRAM) |
| RO (2) | RO62626A (OSRAM) |
| SU (2) | SU449487A3 (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE793371A (fr) * | 1971-12-27 | 1973-06-27 | Sandoz Sa | Nouveaux derives de la 4-amino-quinazoline, leur preparation etmedicaments contenant ces |
| JPS5416626U (OSRAM) * | 1977-07-05 | 1979-02-02 | ||
| IE51802B1 (en) | 1979-12-03 | 1987-04-01 | Fujisawa Pharmaceutical Co | Quinazoline derivatives,processes for their preparation and pharmaceutical compositions containing them |
| US4510307A (en) * | 1980-08-20 | 1985-04-09 | Asahi Kasei Kogyo Kabushiki Kaisha | 6-Quinazolinesulfonyl derivatives and process for preparation thereof |
| US5614627A (en) * | 1993-09-10 | 1997-03-25 | Eisai Co., Ltd. | Quinazoline compounds |
| GB0307333D0 (en) * | 2003-03-29 | 2003-05-07 | Astrazeneca Ab | Therapeutic agent |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1199768A (en) * | 1966-10-31 | 1970-07-22 | Pfizer & Co C | Nitrogen Heterocycles and process for their preparation |
| US3470182A (en) * | 1967-02-09 | 1969-09-30 | Sandoz Ag | 4-amino-substituted quinazolines |
-
0
- BE BE759842D patent/BE759842R/xx active
-
1970
- 1970-11-23 CH CH1519173A patent/CH552601A/xx not_active IP Right Cessation
- 1970-11-23 CH CH1735770A patent/CH549581A/xx unknown
- 1970-12-02 GB GB3491073A patent/GB1349140A/en not_active Expired
- 1970-12-02 GB GB2616273A patent/GB1349137A/en not_active Expired
- 1970-12-02 GB GB3059973A patent/GB1349139A/en not_active Expired
- 1970-12-02 IE IE1541/70A patent/IE34780B1/xx unknown
- 1970-12-02 GB GB5722170A patent/GB1349136A/en not_active Expired
- 1970-12-02 DE DE19702059164 patent/DE2059164A1/de active Pending
- 1970-12-02 GB GB2616373A patent/GB1349138A/en not_active Expired
- 1970-12-03 NL NL7017669A patent/NL7017669A/xx unknown
- 1970-12-03 RO RO7000074396A patent/RO62626A/ro unknown
- 1970-12-03 HU HUSA2281A patent/HU162867B/hu unknown
- 1970-12-03 BG BG016189A patent/BG17598A3/xx unknown
- 1970-12-03 ES ES0386121A patent/ES386121A1/es not_active Expired
- 1970-12-03 RO RO7000074397A patent/RO62627A/ro unknown
- 1970-12-03 PL PL1970144794A patent/PL81227B1/pl unknown
- 1970-12-03 HU HUSA2280A patent/HU162866B/hu unknown
- 1970-12-03 IL IL35779A patent/IL35779A/xx unknown
- 1970-12-04 FR FR7043720A patent/FR2081329B2/fr not_active Expired
- 1970-12-04 SU SU1785908A patent/SU449487A3/ru active
- 1970-12-04 OA OA54108A patent/OA03536A/xx unknown
- 1970-12-04 SU SU1785910A patent/SU439091A3/ru active
- 1970-12-13 BG BG017324A patent/BG17599A3/xx unknown
-
1972
- 1972-04-14 JP JP47037000A patent/JPS4837035B1/ja active Pending
-
1973
- 1973-08-13 AU AU59188/73A patent/AU5918873A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BG17598A3 (bg) | 1973-11-10 |
| HU162866B (OSRAM) | 1973-04-28 |
| HU162867B (OSRAM) | 1973-04-28 |
| BG17599A3 (bg) | 1973-11-10 |
| RO62627A (fr) | 1978-05-15 |
| CH552601A (de) | 1974-08-15 |
| RO62626A (fr) | 1978-05-15 |
| GB1349136A (en) | 1974-03-27 |
| SU449487A3 (ru) | 1974-11-05 |
| GB1349139A (en) | 1974-03-27 |
| BE759842R (fr) | 1971-06-03 |
| NL7017669A (OSRAM) | 1971-06-08 |
| GB1349140A (en) | 1974-03-27 |
| IL35779A (en) | 1974-06-30 |
| GB1349138A (en) | 1974-03-27 |
| JPS4837035B1 (OSRAM) | 1973-11-08 |
| OA03536A (fr) | 1971-03-30 |
| ES386121A1 (es) | 1973-12-16 |
| IE34780L (en) | 1971-06-05 |
| AU5918873A (en) | 1974-02-14 |
| IE34780B1 (en) | 1975-08-20 |
| GB1349137A (en) | 1974-03-27 |
| FR2081329B2 (OSRAM) | 1975-06-06 |
| FR2081329A2 (OSRAM) | 1971-12-03 |
| SU439091A3 (ru) | 1974-08-05 |
| DE2059164A1 (de) | 1971-06-09 |
| CH549581A (de) | 1974-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI113765B (fi) | Menetelmä uusien antiproliferatiivisten 5-substituoitujen kinatsoliiniyhdisteiden valmistamiseksi | |
| KR100331255B1 (ko) | 플루오로알콕시-치환된벤즈아미드및시클릭뉴클레오티드포스포디에스테라아제억제제로서의그의용도 | |
| US3702849A (en) | 4-(isoquinolin-1-yl) piperazine-1-carboxylic acid esters | |
| WO2004069791A2 (en) | Preparation of substituted quinazolines | |
| CZ413491A3 (en) | N-imidazolyl derivatives of bicyclic compounds and process for preparing thereof | |
| CZ4393A3 (en) | Quinazoline derivatives, process of their preparation and pharmaceutical compositions in which said derivatives are comprised | |
| KR100812586B1 (ko) | P38 키나아제 저해제로서 유용한 퀴나졸린 화합물 | |
| DK161327B (da) | Substituerede 2-piperazinopteridiner, fremgangsmaade til fremstilling deraf samt laegemidler indeholdende forbindelserne | |
| US4013665A (en) | Antiviral, substituted 1,3-dimethyl-1h-pyrazolo(3,4b)quinolines | |
| CZ294842B6 (cs) | Kyanoguanidiny, způsob jejich přípravy a použití a farmaceutické přípravky s jejich obsahem | |
| NZ232008A (en) | Condensed quinoline system compound and process of preparation thereof | |
| EP0387821B1 (de) | 2-Alkyl-4-arylmethylaminochinoline, ihre Verwendung und daraus hergestellte Arzneimittel | |
| NZ241868A (en) | 6,9-bis(substituted-amino)benzo[g]isoquinoline-5,10-diones, preparation and pharmaceutical compositions thereof | |
| PL81227B1 (en) | Quinazoline derivatives [gb1349136a] | |
| JP2007500689A (ja) | アミノキノリン誘導体およびアデノシンa3リガンドとしてのそれらの使用 | |
| JPH04182467A (ja) | ジアリールメトキシピペリジン誘導体 | |
| AU626541B2 (en) | Anti-tumour agents | |
| HU182662B (en) | Process for producing pyrimido-2-benzodiazepine derivatives | |
| WO1996010563A1 (en) | 2-aryl-4-quinolones as antitumor compounds | |
| DE2338669A1 (de) | Neue 4-aminochinazoline und verfahren zu ihrer herstellung | |
| US6680326B2 (en) | Polycyclic compounds | |
| CN116096708B (zh) | 用作用于疗法的蛋白激酶抑制剂的2-氧代-n-(4-(嘧啶-4-基氧基/硫基)苯基)-1,2-二氢吡啶-3-甲酰胺的衍生物 | |
| US3268529A (en) | 3-cyanoalkyl substituted 4-(3h)-quinazolinones | |
| Griffiths et al. | The chemistry of o-phenylene di-isothiocyanate. Part 1. Some reactions with N-nucleophiles | |
| US3632594A (en) | New n-substituted di-amidines derived from aromatic diamines and a process for their preparation |