PL79131B1 - - Google Patents
Download PDFInfo
- Publication number
- PL79131B1 PL79131B1 PL1966117555A PL11755566A PL79131B1 PL 79131 B1 PL79131 B1 PL 79131B1 PL 1966117555 A PL1966117555 A PL 1966117555A PL 11755566 A PL11755566 A PL 11755566A PL 79131 B1 PL79131 B1 PL 79131B1
- Authority
- PL
- Poland
- Prior art keywords
- salt
- diamine
- dicyandimide
- mixture
- water
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 claims description 45
- 238000000034 method Methods 0.000 claims description 43
- -1 polymethylene chains Polymers 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 29
- 150000004985 diamines Chemical class 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 25
- 239000002904 solvent Substances 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 24
- 239000002184 metal Substances 0.000 claims description 24
- 239000011541 reaction mixture Substances 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 150000007522 mineralic acids Chemical class 0.000 claims description 13
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 12
- QWJNFFYFEKXZBF-UHFFFAOYSA-N cyanocyanamide Chemical compound N#CNC#N QWJNFFYFEKXZBF-UHFFFAOYSA-N 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 9
- 238000010438 heat treatment Methods 0.000 claims description 9
- 239000002244 precipitate Substances 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000001569 carbon dioxide Substances 0.000 claims description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 6
- 150000002736 metal compounds Chemical class 0.000 claims description 6
- 150000003751 zinc Chemical class 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 159000000007 calcium salts Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 239000012451 post-reaction mixture Substances 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims 1
- 239000012736 aqueous medium Substances 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 229910000000 metal hydroxide Inorganic materials 0.000 claims 1
- 150000004692 metal hydroxides Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 29
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- 239000011701 zinc Substances 0.000 description 6
- 229910052725 zinc Inorganic materials 0.000 description 6
- 238000001816 cooling Methods 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- PRKQVKDSMLBJBJ-UHFFFAOYSA-N ammonium carbonate Chemical compound N.N.OC(O)=O PRKQVKDSMLBJBJ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 150000001767 cationic compounds Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910001411 inorganic cation Inorganic materials 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- MVFSWZGHXYZHPP-UHFFFAOYSA-N 2-methylpropan-1-ol;toluene Chemical compound CC(C)CO.CC1=CC=CC=C1 MVFSWZGHXYZHPP-UHFFFAOYSA-N 0.000 description 1
- FMRLDPWIRHBCCC-UHFFFAOYSA-L Zinc carbonate Chemical compound [Zn+2].[O-]C([O-])=O FMRLDPWIRHBCCC-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- BIVUUOPIAYRCAP-UHFFFAOYSA-N aminoazanium;chloride Chemical compound Cl.NN BIVUUOPIAYRCAP-UHFFFAOYSA-N 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- LIAWOTKNAVAKCX-UHFFFAOYSA-N hydrazine;dihydrochloride Chemical compound Cl.Cl.NN LIAWOTKNAVAKCX-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
- Industrial Gases (AREA)
- Polyamides (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB50340/65A GB1152243A (en) | 1965-11-26 | 1965-11-26 | Process for the Manufacture of Polymeric Diguanides |
| GB5034066 | 1966-11-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL79131B1 true PL79131B1 (enFirst) | 1975-06-30 |
Family
ID=26266663
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1966117555A PL79131B1 (enFirst) | 1965-11-26 | 1966-11-24 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3428576A (enFirst) |
| BE (1) | BE689993A (enFirst) |
| CS (1) | CS172294B2 (enFirst) |
| DK (1) | DK118715B (enFirst) |
| FR (1) | FR1503055A (enFirst) |
| GB (1) | GB1152243A (enFirst) |
| NL (1) | NL150132B (enFirst) |
| NO (1) | NO124543B (enFirst) |
| PL (1) | PL79131B1 (enFirst) |
| SE (1) | SE304864B (enFirst) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1407258A (en) * | 1972-12-18 | 1975-09-24 | Ici Ltd | Water treatment |
| US4452849A (en) * | 1981-02-03 | 1984-06-05 | Ciba-Geigy Corporation | Phosphonic acid salts, their preparation and their use for fireproofing organic fibre material |
| US4478821A (en) * | 1982-01-26 | 1984-10-23 | The Gillette Company | Inhibition of body odor |
| GB2122612B (en) * | 1982-06-16 | 1985-09-25 | May & Baker Ltd | Cystamine derivatives |
| DE3542516A1 (de) * | 1985-12-02 | 1987-06-04 | Henkel Kgaa | Desinfektionsmittel |
| DE3702983A1 (de) * | 1986-06-09 | 1987-12-10 | Henkel Kgaa | Desinfektionsmittel und ihre verwendung zur haut- und schleimhautdesinfektion |
| DE3729530A1 (de) * | 1987-09-04 | 1989-03-16 | Degussa | Verfahren zur herstellung von 1,6-di(n(pfeil hoch)3(pfeil hoch)-cyano-n(pfeil hoch)1(pfeil hoch)-guanidino)hexan |
| DE3743374A1 (de) * | 1987-12-21 | 1989-06-29 | Henkel Kgaa | Verwendung von bisguanide enthaltenden zusammensetzungen gegen eier des madenwurms |
| US4891423A (en) * | 1989-03-20 | 1990-01-02 | Stockel Richard F | Polymeric biguanides |
| US4954636A (en) * | 1989-07-03 | 1990-09-04 | Gaf Chemicals Corporation | Antimicrobial polymeric bisbiguanides |
| GB9024133D0 (en) * | 1990-11-06 | 1990-12-19 | Ici Plc | Aqueous composition |
| JPH08510454A (ja) * | 1993-05-26 | 1996-11-05 | フレゼニウス、アーゲー | 抗感染症薬剤 |
| US5741886A (en) * | 1995-09-19 | 1998-04-21 | Stockel; Richard F. | End-capped polymeric biguanides |
| US5935518A (en) * | 1996-01-29 | 1999-08-10 | Bausch & Lomb Incorporated | Swimming pool treatment |
| AU721273B2 (en) | 1996-09-20 | 2000-06-29 | Bausch & Lomb Incorporated | Method and composition for rewetting contact lenses and relieving eye dryness |
| GB9827884D0 (en) | 1998-12-18 | 1999-02-10 | Zeneca Ltd | Process |
| EP1159140B1 (en) * | 1998-12-18 | 2004-02-25 | Avecia Limited | Ink-jet printing process using polymeric biguanides |
| US7678836B2 (en) * | 1999-11-04 | 2010-03-16 | Fxs Ventures, Llc | Method for rendering a contact lens wettable |
| US8557868B2 (en) | 2000-11-04 | 2013-10-15 | Fxs Ventures, Llc | Ophthalmic and contact lens solutions using low molecular weight amines |
| US20070104744A1 (en) * | 2000-11-08 | 2007-05-10 | Fxs Ventures, Llc | Ophthalmic and contact lens solutions containing forms of vitamin b |
| DK1339418T3 (da) | 2000-11-08 | 2009-12-14 | Fxs Ventures Llc | Forbedret ophthalmiske og kontaktlinseoplösninger indeholdende simple saccharider som konserverende forstærkere |
| US20060148665A1 (en) * | 2000-11-08 | 2006-07-06 | Bioconcept Laboratories | Ophthalmic and contact lens solutions containing forms of vitamin b |
| US9308264B2 (en) | 2000-11-08 | 2016-04-12 | Fxs Ventures, Llc | Ophthalmic contact lens solutions containing forms of vitamin B |
| GB0207655D0 (en) | 2002-04-02 | 2002-05-15 | Avecia Ltd | Compositions and processes |
| US20060073185A1 (en) * | 2002-12-13 | 2006-04-06 | Bausch & Lomb Incorporated | Method and composition for contact lenses |
| US20040204496A1 (en) * | 2003-04-11 | 2004-10-14 | Ammon Daniel M. | Disinfecting solutions effective against bacterial endospores |
| US20050118128A1 (en) * | 2003-12-01 | 2005-06-02 | Borazjani Roya N. | Disinfection efficacy of lens care regimen |
| US20050119141A1 (en) * | 2003-12-01 | 2005-06-02 | Irene Quenville | Stability enhancement of solutions containing antimicrobial agents |
| US20050118129A1 (en) * | 2003-12-01 | 2005-06-02 | Erning Xia | Gentle and enhanced preservative systems |
| US20050118058A1 (en) * | 2003-12-01 | 2005-06-02 | Erning Xia | Gentle preservative compositions for self-preserving solutions |
| US20050119221A1 (en) * | 2003-12-01 | 2005-06-02 | Erning Xia | Use of a cationic polysaccharide to enhance biocidal efficacies |
| US6936640B2 (en) * | 2003-12-04 | 2005-08-30 | Alcon, Inc. | Biguanide/quaternary ammonium containing copolymeric biocides and use thereof in pharmaceutical compositions |
| US20050266095A1 (en) * | 2004-06-01 | 2005-12-01 | Erning Xia | Gentle preservative compositions |
| US20060292105A1 (en) * | 2005-06-28 | 2006-12-28 | Lever O W Jr | Topical preservative compositions |
| US20070149428A1 (en) * | 2005-12-14 | 2007-06-28 | Bausch & Lomb Incorporated | Method of Packaging a Lens |
| US20070203039A1 (en) * | 2005-12-21 | 2007-08-30 | Roya Borazjani | Method for cleaning and maintaining contact lenses and related system and kit |
| US20070142321A1 (en) * | 2005-12-21 | 2007-06-21 | Roya Borazjani | Method for preventing growth of bacteria on contact lenses with eye drops |
| US20070148127A1 (en) * | 2005-12-22 | 2007-06-28 | Heiler David J | Antimicrobial ophthalmic treatment system and method |
| US20070196329A1 (en) * | 2006-01-20 | 2007-08-23 | Erning Xia | Disinfection efficacy of lens care regimen for rigid gas permeable contact lenses |
| DE102006020644A1 (de) * | 2006-04-28 | 2007-10-31 | Bayer Innovation Gmbh | Antiseptikahaltige Silikonelastomere |
| US7897553B2 (en) | 2006-10-23 | 2011-03-01 | Bausch & Lomb Incorporated | Biguanide composition with low terminal amine |
| US8759321B2 (en) * | 2007-06-13 | 2014-06-24 | Bausch & Lomb Incorporated | Ophthalmic composition with hyaluronic acid and polymeric biguanide |
| EP2468927A1 (en) | 2010-12-21 | 2012-06-27 | Basf Se | Composition for metal electroplating comprising leveling agent |
| SG190931A1 (en) | 2010-12-21 | 2013-07-31 | Basf Se | Composition for metal electroplating comprising leveling agent |
| US8829053B2 (en) | 2011-12-07 | 2014-09-09 | Rochal Industries Llp | Biocidal compositions and methods of using the same |
| GB2603950B (en) | 2021-02-22 | 2025-04-23 | Reckitt & Colman Overseas Hygiene Home Ltd | Effervescent germicidal compositions |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2325586A (en) * | 1940-03-21 | 1943-08-03 | Du Pont | Polymeric guanidines and process for preparing the same |
| US2643232A (en) * | 1949-08-22 | 1953-06-23 | Ici Ltd | Polymeric diguanides |
-
1965
- 1965-11-26 GB GB50340/65A patent/GB1152243A/en not_active Expired
-
1966
- 1966-11-16 NO NO165606A patent/NO124543B/no unknown
- 1966-11-17 US US595005A patent/US3428576A/en not_active Expired - Lifetime
- 1966-11-21 BE BE689993D patent/BE689993A/xx unknown
- 1966-11-22 NL NL666616418A patent/NL150132B/xx not_active IP Right Cessation
- 1966-11-24 PL PL1966117555A patent/PL79131B1/pl unknown
- 1966-11-24 DK DK609866AA patent/DK118715B/da unknown
- 1966-11-25 FR FR85109A patent/FR1503055A/fr not_active Expired
- 1966-11-25 CS CS7511A patent/CS172294B2/cs unknown
- 1966-11-25 SE SE16172/66A patent/SE304864B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL150132B (nl) | 1976-07-15 |
| NL6616418A (enFirst) | 1967-05-29 |
| DK118715B (da) | 1970-09-28 |
| BE689993A (enFirst) | 1967-05-22 |
| US3428576A (en) | 1969-02-18 |
| DE1620938B2 (de) | 1975-11-06 |
| FR1503055A (fr) | 1967-11-24 |
| NO124543B (enFirst) | 1972-05-02 |
| DE1620938A1 (de) | 1970-09-24 |
| CS172294B2 (enFirst) | 1976-12-29 |
| GB1152243A (en) | 1969-05-14 |
| SE304864B (enFirst) | 1968-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL79131B1 (enFirst) | ||
| US4217292A (en) | Process for making amine molybdates | |
| NO841910L (no) | Fremgangsmaate for fremstilling av n-fosfonometylglycin | |
| EP0687282A1 (de) | Verfahren zur herstellung von umsetzungsprodukten aus polyasparaginsäureimid und aminosäuren und ihre verwendung | |
| JP3243835B2 (ja) | 新規なアミド系化合物 | |
| US2544071A (en) | Diethylenetrimelamine and method | |
| KR930005446B1 (ko) | 2-알콕시-n-(1-아자비사이클로[2.2.2]옥탄-3-일)아미노 벤즈아미드의 제조방법 | |
| US2829164A (en) | Method of making pentachloroaniline and certain new n-substituted pentachloroanilines and alkyl tetrachloro analogs | |
| US2464247A (en) | Preparation of guanidine sulfates | |
| GB2090843A (en) | Substituted Polyarylethersulphone Copolymers | |
| US3149010A (en) | Composition comprising a hydrazine and a hydrazinum polyhydrodecaborate | |
| DK149473B (da) | Fremgangsmaade til fremstilling af aminomethan-phosphonsyrer | |
| US3254094A (en) | 3-imino-2, 1-benzisothiazoles | |
| JPS60232209A (ja) | 逆浸透膜、流延液及び製法 | |
| JPH048098B2 (enFirst) | ||
| US5451682A (en) | Method for synthesizing 5-aminotetrazole | |
| US3197442A (en) | Polyamide resins from dialkali metal dipyridyl compounds | |
| US4093657A (en) | Process for preparing monomer of bile acid sequestrant polymer | |
| US2953600A (en) | Phenol-hydrazinium inner salts | |
| Georgopoulou et al. | Synthesis and characterisation of chelating polycarboxylate ligands capable of forming intermolecular, complementary triple hydrogen bonds | |
| US2548231A (en) | Preparation of acylcarbamyl-guanidines | |
| DE2216925A1 (de) | Pyrazinderivate und Verfahren zu ihrer Herstellung | |
| JP2834557B2 (ja) | トリメルカプト―s―トリアジンのナトリウム塩の水溶液、その製造法および該溶液からなる供給形 | |
| US665879A (en) | Piperazin quinate and process of making same. | |
| DE69604878T2 (de) | Herstellung von Alkansulfonamiden mit niedrigen Ammonium-Restverunreinigungen |