PL59829B1 - - Google Patents
Download PDFInfo
- Publication number
- PL59829B1 PL59829B1 PL113237A PL11323766A PL59829B1 PL 59829 B1 PL59829 B1 PL 59829B1 PL 113237 A PL113237 A PL 113237A PL 11323766 A PL11323766 A PL 11323766A PL 59829 B1 PL59829 B1 PL 59829B1
- Authority
- PL
- Poland
- Prior art keywords
- parts
- formula
- dye
- naphthol
- aroylated
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 21
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 7
- 230000008878 coupling Effects 0.000 claims description 6
- 238000010168 coupling process Methods 0.000 claims description 6
- 238000005859 coupling reaction Methods 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 239000001045 blue dye Substances 0.000 claims description 2
- 150000001879 copper Chemical class 0.000 claims description 2
- 150000004699 copper complex Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims 2
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 claims 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 150000001412 amines Chemical class 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 238000010411 cooking Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- ZOZFMTULOYRWEL-UHFFFAOYSA-N (4-bromo-3,5-dimethylphenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC(C)=C(Br)C(C)=C1 ZOZFMTULOYRWEL-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- -1 mono Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL59829B1 true PL59829B1 (enExample) | 1970-02-26 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2342197C2 (de) | Reaktivfarbstoffe | |
| DE2614550B2 (de) | Neue Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose sowie natürlichen und synthetischen Polyamidsubstraten | |
| CH628669A5 (de) | Verfahren zur herstellung von reaktivfarbstoffen. | |
| US851444A (en) | Amido-oxy-sulfonic acid of phenylnaphthimidazol and process of making same. | |
| PL59829B1 (enExample) | ||
| US2714588A (en) | Copper-containing disazo dyestuffs | |
| EP0041919B1 (de) | Verfahren zur Herstellung von Amino-fluor-s-triazin-Farbstoffen | |
| US2220396A (en) | Metallized acid polyazo dyes | |
| US3321457A (en) | Water soluble dyes of the phenylazopyrazolone series containing a 2, 3-dichloro-6-quinoxalinylcarbonylamino substituent | |
| US2861066A (en) | Metallisable azo dyestuffs | |
| JPS61254550A (ja) | アゾ化合物の製造法 | |
| US1856796A (en) | Azo-dyestuffs containing chromium and process of making same | |
| PL49449B1 (enExample) | ||
| US714687A (en) | Process of making lakes from sulfur dyes. | |
| US628025A (en) | Blue-black wool-dye and process of making same. | |
| DE1245001B (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE845939C (de) | Verfahren zur Herstellung von wasserloeslichen Kondensationsprodukten | |
| PL93030B1 (enExample) | ||
| DE1136437B (de) | Verfahren zur Herstellung metallhaltiger Azofarbstoffe | |
| PL95893B1 (pl) | Sposob otrzymywania mieszanych azotowych barwnikow chromokompleksowych typ 1:2 | |
| JPS607078B2 (ja) | 1:2型コバルト錯塩染料による皮革または毛皮の染色法 | |
| DE1101657B (de) | Verfahren zur Herstellung von metallfreien Monoazofarbstoffen | |
| PL100857B1 (pl) | Sposob wytwarzania srodka do barwienia wlokien pochodzenia roslinnego oraz skory | |
| PL100887B1 (pl) | Sposob wytwarzania srodka do barwienia wlokien pochodzenia roslinnego oraz skory | |
| PL50148B1 (enExample) |