PL58297B1 - - Google Patents
Download PDFInfo
- Publication number
- PL58297B1 PL58297B1 PL121307A PL12130767A PL58297B1 PL 58297 B1 PL58297 B1 PL 58297B1 PL 121307 A PL121307 A PL 121307A PL 12130767 A PL12130767 A PL 12130767A PL 58297 B1 PL58297 B1 PL 58297B1
- Authority
- PL
- Poland
- Prior art keywords
- viomycin
- salt
- substituted
- treated
- acid
- Prior art date
Links
- GXFAIFRPOKBQRV-GHXCTMGLSA-N viomycin Chemical class N1C(=O)\C(=C\NC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)C[C@@H](N)CCCN)CNC(=O)[C@@H]1[C@@H]1NC(=N)N[C@@H](O)C1 GXFAIFRPOKBQRV-GHXCTMGLSA-N 0.000 claims description 20
- 229950001272 viomycin Drugs 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 14
- OZKXLOZHHUHGNV-UHFFFAOYSA-N Viomycin Natural products NCCCC(N)CC(=O)NC1CNC(=O)C(=CNC(=O)N)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(NC1=O)C2CC(O)NC(=N)N2 OZKXLOZHHUHGNV-UHFFFAOYSA-N 0.000 claims description 13
- 108010015940 Viomycin Proteins 0.000 claims description 13
- -1 aliphatic monocarboxylic acid Chemical class 0.000 claims description 5
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 4
- 239000010452 phosphate Substances 0.000 claims description 4
- 239000002244 precipitate Substances 0.000 claims description 4
- 239000000047 product Substances 0.000 claims description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000004679 hydroxides Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910021645 metal ion Inorganic materials 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 125000005341 metaphosphate group Chemical group 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 229910052712 strontium Inorganic materials 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical class [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 claims 1
- 238000001914 filtration Methods 0.000 claims 1
- 239000002002 slurry Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 4
- AQONYROJHRNYQQ-QMAPKBLTSA-N (3s)-3,6-diamino-n-[(3s,6z,9s,12s,15s)-3-[(4s,6r)-2-amino-4-hydroxy-1,4,5,6-tetrahydropyrimidin-6-yl]-6-[(carbamoylamino)methylidene]-9,12-bis(hydroxymethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclohexadec-15-yl]hexanamide;sulfuric acid Chemical compound OS(O)(=O)=O.N1C(=O)\C(=C\NC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)C[C@@H](N)CCCN)CNC(=O)[C@@H]1[C@@H]1NC(N)=N[C@@H](O)C1 AQONYROJHRNYQQ-QMAPKBLTSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 238000012792 lyophilization process Methods 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- OURWKHLDAVYMGO-UHFFFAOYSA-N 7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid Chemical compound C=1C=NC2=C(C(=O)O)C=NN2C=1C1=CC=CS1 OURWKHLDAVYMGO-UHFFFAOYSA-N 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- ITHZDDVSAWDQPZ-UHFFFAOYSA-L barium acetate Chemical compound [Ba+2].CC([O-])=O.CC([O-])=O ITHZDDVSAWDQPZ-UHFFFAOYSA-L 0.000 description 1
- HLKMEIITONDPGG-UHFFFAOYSA-L barium(2+);2-hydroxypropanoate Chemical compound [Ba+2].CC(O)C([O-])=O.CC(O)C([O-])=O HLKMEIITONDPGG-UHFFFAOYSA-L 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL58297B1 true PL58297B1 (cs) | 1969-08-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69104991T2 (de) | Mometason-furoate-monohydrat, verfahren zu seiner herstellung und das enthaltende pharmazeutische zusammensetzungen. | |
| US4304734A (en) | 6-Amino-1-hydroxyhexylidene diphosphonic acid, salts and a process for production thereof | |
| DE1445154B2 (de) | 1,4-dihydro-1,8-naphthyridinderivate und ein verfahren zu ihrer herstellung | |
| DE2648971C2 (cs) | ||
| DE2258304A1 (de) | Neue 1,3-diphenyl-propanon-1 derivate und ihre salze beziehungsweise diese verbindungen enthaltende versuessungsmittel | |
| SU474974A3 (ru) | Способ получени трийодированных анилидов -метил-дикарбоновой кислоты | |
| PL58297B1 (cs) | ||
| DE2530139A1 (de) | N-acyl-1-aminoalkan-1,1-diphosphonsaeuren, deren herstellung und verwendung | |
| SU1128839A3 (ru) | Способ получени алкалоидов типа лейрозина | |
| Zetterström | Renewal of phosphate in bone minerals: I. Renewal rate of phosphate in relation to the solubility of the bone minerals | |
| DE2324130A1 (de) | Neue 2-substituierte adenosin-3',5'cyclomonophosphate | |
| PL57601B1 (cs) | ||
| US2348984A (en) | Sodium bismuth triglycollamate | |
| DE1938227A1 (de) | Verfahren zur Herstellung von Mono- und Dicarbomethoxybenzolsulfonaten | |
| US2653955A (en) | Cortisone esters and process | |
| US2830079A (en) | Mixed salts of 3, 4, 5, 6-tetraiodophthalic acid opaque to x-radiation | |
| US2654759A (en) | Derivatives of n-hydroxymethyl | |
| CA2635463A1 (en) | Novel phytic citrate compounds and process for preparing the same | |
| US2668852A (en) | Neutral calcium 4-aminosalicylate hemihydrate and preparation of the same | |
| US2890233A (en) | Iron-containing organic compounds | |
| US3082253A (en) | Complexes of tetracycline antibiotics and preparation of same | |
| DE876093C (de) | Verfahren zur Herstellung von Phosphorderivaten von Thiosemicarbazonen | |
| SU730276A3 (ru) | Способ получени водного железосодержащего препарата | |
| US1833506A (en) | Organic calcium phosphate and improved method of making same | |
| US3903136A (en) | Dihydroxyoleandiene diesters |