PL45016B1 - - Google Patents
Download PDFInfo
- Publication number
- PL45016B1 PL45016B1 PL45016A PL4501659A PL45016B1 PL 45016 B1 PL45016 B1 PL 45016B1 PL 45016 A PL45016 A PL 45016A PL 4501659 A PL4501659 A PL 4501659A PL 45016 B1 PL45016 B1 PL 45016B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- dye
- water
- cobalt
- aminophenol
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 2
- 239000010941 cobalt Substances 0.000 claims description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 2
- 150000001869 cobalt compounds Chemical class 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims 1
- 230000008878 coupling Effects 0.000 claims 1
- 238000010168 coupling process Methods 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 claims 1
- -1 diazo 5-nitro-2-aminophenol Chemical compound 0.000 claims 1
- 239000004922 lacquer Substances 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 239000000975 dye Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 7
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 3
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- CVQSVFTZCRZRBT-UHFFFAOYSA-N naphthalen-2-ylsulfamic acid Chemical compound C1=CC=CC2=CC(NS(=O)(=O)O)=CC=C21 CVQSVFTZCRZRBT-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 241000276498 Pollachius virens Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940044175 cobalt sulfate Drugs 0.000 description 1
- 229910000361 cobalt sulfate Inorganic materials 0.000 description 1
- KTVIXTQDYHMGHF-UHFFFAOYSA-L cobalt(2+) sulfate Chemical compound [Co+2].[O-]S([O-])(=O)=O KTVIXTQDYHMGHF-UHFFFAOYSA-L 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229940055237 sodium 1-naphthalenesulfonate Drugs 0.000 description 1
- 235000002639 sodium chloride Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL45016B1 true PL45016B1 (online.php) | 1961-08-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL45016B1 (online.php) | ||
| CH319237A (de) | Verfahren zur Herstellung neuer kobalthaltiger Azofarbstoffe | |
| JPS6215099B2 (online.php) | ||
| DE950149C (de) | VerAfahren zur Herstellung von schwermetallhaltigen Monoazofarbstoffen | |
| PL50959B1 (online.php) | ||
| DE927705C (de) | Verfahren zur Herstellung von chromhaltigen sulfonsaeuregruppenfreien Monoazofarbstoffen | |
| CH321751A (de) | Verfahren zur Herstellung eines kobalthaltigen Azofarbstoffes | |
| CH299202A (de) | Verfahren zur Herstellung eines Monoazofarbstoffes. | |
| GB465167A (en) | Manufacture of coloured lacquers and film-forming coating compositions | |
| DE1644309A1 (de) | Verfahren zur Herstellung von Mischkomplexazofarbtoffen vom Typ 1:2,die Kobalt enthalten | |
| CH299200A (de) | Verfahren zur Herstellung eines Monoazofarbstoffes. | |
| CH287104A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH313105A (de) | Verfahren zur Herstellung eines kupferhaltigen Polyazofarbstoffes der Stilbenreihe | |
| CH399636A (de) | Verfahren zur Herstellung von Farbstoffen der Tetrazaporphinreihe | |
| CH313107A (de) | Verfahren zur Herstellung eines kupferhaltigen Polyazofarbstoffes der Stilbenreihe | |
| PL51385B1 (online.php) | ||
| CH306995A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. | |
| CH287110A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH309418A (de) | Verfahren zur Herstellung eines metallhaltigen Azofarbstoffes. | |
| CH299201A (de) | Verfahren zur Herstellung eines Monoazofarbstoffes. | |
| CH353472A (de) | Verfahren zur Herstellung gemischter kobalthaltiger Monoazofabstoffe | |
| CH308775A (de) | Verfahren zur Herstellung eines chromhaltigen Monoazofarbstoffes. | |
| CH287106A (de) | Verfahren zur Herstellung eines chromhaltigen Azofarbstoffes. | |
| CH198340A (de) | Verfahren zur Darstellung eines Azofarbstoffes. | |
| CH268422A (de) | Verfahren zur Herstellung eines Chromierungsfarbstoffes. |