PL172930B1 - Sposób wytwarzania N,N-dwualkiloglukaminy i N,N-dwualkiloglukamina PL PL PL PL - Google Patents
Sposób wytwarzania N,N-dwualkiloglukaminy i N,N-dwualkiloglukamina PL PL PL PLInfo
- Publication number
- PL172930B1 PL172930B1 PL93298895A PL29889593A PL172930B1 PL 172930 B1 PL172930 B1 PL 172930B1 PL 93298895 A PL93298895 A PL 93298895A PL 29889593 A PL29889593 A PL 29889593A PL 172930 B1 PL172930 B1 PL 172930B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compound
- dialkylglucamine
- carbon atoms
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 90
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 49
- 150000001875 compounds Chemical class 0.000 claims abstract description 35
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 17
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims abstract description 12
- 150000002772 monosaccharides Chemical class 0.000 claims abstract description 10
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 9
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims abstract description 6
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 5
- 229910021653 sulphate ion Inorganic materials 0.000 claims abstract 5
- 238000006243 chemical reaction Methods 0.000 claims description 19
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical group OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 8
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical group [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 7
- 235000000346 sugar Nutrition 0.000 claims description 7
- WQZGKKKJIJFFOK-SVZMEOIVSA-N (+)-Galactose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O WQZGKKKJIJFFOK-SVZMEOIVSA-N 0.000 claims description 6
- 150000001204 N-oxides Chemical class 0.000 claims description 6
- 150000001720 carbohydrates Chemical group 0.000 claims description 6
- 150000002402 hexoses Chemical class 0.000 claims description 6
- 125000006357 methylene carbonyl group Chemical group [H]C([H])([*:1])C([*:2])=O 0.000 claims description 6
- 239000007800 oxidant agent Substances 0.000 claims description 6
- 150000003335 secondary amines Chemical class 0.000 claims description 6
- 238000000354 decomposition reaction Methods 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 230000035484 reaction time Effects 0.000 claims description 5
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical group CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 claims description 4
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical group [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 4
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 claims description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 4
- RFSUNEUAIZKAJO-VRPWFDPXSA-N D-Fructose Natural products OC[C@H]1OC(O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-VRPWFDPXSA-N 0.000 claims description 3
- WQZGKKKJIJFFOK-QTVWNMPRSA-N D-mannopyranose Chemical compound OC[C@H]1OC(O)[C@@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-QTVWNMPRSA-N 0.000 claims description 3
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 claims description 3
- 239000012670 alkaline solution Substances 0.000 claims description 2
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical group OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims 2
- 239000011575 calcium Substances 0.000 claims 2
- 229910052791 calcium Inorganic materials 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 239000004094 surface-active agent Substances 0.000 abstract description 10
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 2
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 abstract 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 abstract 1
- 150000001340 alkali metals Chemical class 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- 229960003237 betaine Drugs 0.000 abstract 1
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 239000000047 product Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 8
- -1 cationic quaternary ammonium salts Chemical class 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- YHJIBZIWMKJSHX-WJFTUGDTSA-N (2r,3r,4r,5s)-6-[dodecyl(methyl)amino]hexane-1,2,3,4,5-pentol Chemical compound CCCCCCCCCCCCN(C)C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO YHJIBZIWMKJSHX-WJFTUGDTSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229940089960 chloroacetate Drugs 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- CLHYKAZPWIRRRD-UHFFFAOYSA-N 1-hydroxypropane-1-sulfonic acid Chemical compound CCC(O)S(O)(=O)=O CLHYKAZPWIRRRD-UHFFFAOYSA-N 0.000 description 3
- NWCDMXQXMFQWBQ-BWURLWDLSA-N C(C)(=O)O.C(CCCCCCCCCCC)N(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C Chemical compound C(C)(=O)O.C(CCCCCCCCCCC)N(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C NWCDMXQXMFQWBQ-BWURLWDLSA-N 0.000 description 3
- TTZMPOZCBFTTPR-UHFFFAOYSA-N O=P1OCO1 Chemical compound O=P1OCO1 TTZMPOZCBFTTPR-UHFFFAOYSA-N 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- FOCAUTSVDIKZOP-UHFFFAOYSA-M chloroacetate Chemical compound [O-]C(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-M 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- OTJZGDPURDIUPD-BJKADDSPSA-N n-methyl-n-[(2s,3r,4r,5r)-2,3,4,5,6-pentahydroxyhexyl]dodecan-1-amine oxide Chemical compound CCCCCCCCCCCC[N+](C)([O-])C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO OTJZGDPURDIUPD-BJKADDSPSA-N 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- DDLBHIIDBLGOTE-UHFFFAOYSA-N 3-chloro-2-hydroxypropane-1-sulfonic acid Chemical compound ClCC(O)CS(O)(=O)=O DDLBHIIDBLGOTE-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 2
- 239000002280 amphoteric surfactant Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- INHCSSUBVCNVSK-UHFFFAOYSA-L lithium sulfate Chemical compound [Li+].[Li+].[O-]S([O-])(=O)=O INHCSSUBVCNVSK-UHFFFAOYSA-L 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ZDPHROOEEOARMN-UHFFFAOYSA-N undecanoic acid Chemical compound CCCCCCCCCCC(O)=O ZDPHROOEEOARMN-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- YYTSGNJTASLUOY-UHFFFAOYSA-N 1-chloropropan-2-ol Chemical compound CC(O)CCl YYTSGNJTASLUOY-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- FHHPEPGEFKOMOF-UHFFFAOYSA-N 2-hydroxy-1,3,2lambda5-dioxaphosphetane 2-oxide Chemical compound OP1(=O)OCO1 FHHPEPGEFKOMOF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000001166 anti-perspirative effect Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 239000003213 antiperspirant Substances 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 238000002143 fast-atom bombardment mass spectrum Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000002303 glucose derivatives Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000003020 moisturizing effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- TZLNJNUWVOGZJU-UHFFFAOYSA-M sodium;3-chloro-2-hydroxypropane-1-sulfonate Chemical compound [Na+].ClCC(O)CS([O-])(=O)=O TZLNJNUWVOGZJU-UHFFFAOYSA-M 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C291/00—Compounds containing carbon and nitrogen and having functional groups not covered by groups C07C201/00 - C07C281/00
- C07C291/02—Compounds containing carbon and nitrogen and having functional groups not covered by groups C07C201/00 - C07C281/00 containing nitrogen-oxide bonds
- C07C291/04—Compounds containing carbon and nitrogen and having functional groups not covered by groups C07C201/00 - C07C281/00 containing nitrogen-oxide bonds containing amino-oxide bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/02—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of hydrogen atoms by amino groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/10—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
- C07C229/12—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings to carbon atoms of acyclic carbon skeletons
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/13—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/14—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Emulsifying, Dispersing, Foam-Producing Or Wetting Agents (AREA)
- Saccharide Compounds (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB929210133A GB9210133D0 (en) | 1992-05-11 | 1992-05-11 | Carbohydrate-derived surfactants |
| GB929210094A GB9210094D0 (en) | 1992-05-11 | 1992-05-11 | Carbohydrate-derived surfactants |
| GB939304273A GB9304273D0 (en) | 1993-03-03 | 1993-03-03 | Carbohydrate derived surfactants |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL298895A1 PL298895A1 (en) | 1994-01-24 |
| PL172930B1 true PL172930B1 (pl) | 1997-12-31 |
Family
ID=27266175
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL93298895A PL172930B1 (pl) | 1992-05-11 | 1993-05-11 | Sposób wytwarzania N,N-dwualkiloglukaminy i N,N-dwualkiloglukamina PL PL PL PL |
Country Status (22)
| Country | Link |
|---|---|
| US (2) | US5523478A (Direct) |
| EP (1) | EP0569904B1 (Direct) |
| JP (1) | JP3347393B2 (Direct) |
| CN (1) | CN1086739A (Direct) |
| AT (1) | ATE151069T1 (Direct) |
| AU (1) | AU657219B2 (Direct) |
| CA (1) | CA2095879A1 (Direct) |
| CZ (1) | CZ85793A3 (Direct) |
| DE (1) | DE69309341T2 (Direct) |
| DK (1) | DK0569904T3 (Direct) |
| ES (1) | ES2102549T3 (Direct) |
| GB (1) | GB2266889B (Direct) |
| GR (1) | GR3023261T3 (Direct) |
| HU (1) | HU219982B (Direct) |
| IN (1) | IN186296B (Direct) |
| MX (1) | MX9302729A (Direct) |
| MY (1) | MY109032A (Direct) |
| NO (1) | NO931716L (Direct) |
| NZ (1) | NZ247601A (Direct) |
| PH (1) | PH30986A (Direct) |
| PL (1) | PL172930B1 (Direct) |
| SK (1) | SK45593A3 (Direct) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2713638A1 (fr) * | 1993-12-14 | 1995-06-16 | Vegatec Sarl | Nouveaux tensioactifs glycosidiques et zwitterioniques, leurs procédés de synthèse et leurs études physico-chimiques. |
| JPH11507953A (ja) * | 1996-04-18 | 1999-07-13 | ザ、プロクター、エンド、ギャンブル、カンパニー | 置換アミンの合成 |
| US6281176B1 (en) | 1999-12-03 | 2001-08-28 | Albemarle Corporation | Process for producing betaine/amine oxide mixtures |
| US20060100127A1 (en) * | 2004-11-11 | 2006-05-11 | Meier Ingrid K | N,N-dialkylpolyhydroxyalkylamines |
| CN100496692C (zh) * | 2007-06-21 | 2009-06-10 | 北京服装学院 | 糖基季胺盐型阳离子表面活性剂、制法及应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2016963A (en) * | 1932-09-27 | 1935-10-08 | Du Pont | Product comprising glucamines and related substances |
| US2016962A (en) * | 1932-09-27 | 1935-10-08 | Du Pont | Process for producing glucamines and related products |
| US2016956A (en) * | 1932-11-04 | 1935-10-08 | Du Pont | Amino derivatives and process of preparing them |
| US2060851A (en) * | 1935-09-13 | 1936-11-17 | Du Pont | Chemical compounds |
| BE425071A (Direct) * | 1936-12-14 | |||
| DE2063423A1 (en) * | 1970-12-23 | 1972-09-21 | Rewo Chemische Fabrik GmbH, 6497 Stemau | Betaine - contg surfactant mixtures - prepd from tert amines and halocarboxylic or halosulphonic acids or sultones |
| DE3915121A1 (de) * | 1989-05-09 | 1990-11-15 | Huels Chemische Werke Ag | Neue n-alkylglykaminoverbindungen sowie ein verfahren zur herstellung und ihre verwendung |
| US5099065A (en) * | 1990-02-27 | 1992-03-24 | Kao Corporation | Betaine compound and detergent composition |
-
1993
- 1993-05-10 IN IN464DE1993 patent/IN186296B/en unknown
- 1993-05-10 MX MX9302729A patent/MX9302729A/es not_active IP Right Cessation
- 1993-05-10 EP EP93107555A patent/EP0569904B1/en not_active Expired - Lifetime
- 1993-05-10 DK DK93107555.0T patent/DK0569904T3/da active
- 1993-05-10 CA CA002095879A patent/CA2095879A1/en not_active Abandoned
- 1993-05-10 DE DE69309341T patent/DE69309341T2/de not_active Expired - Fee Related
- 1993-05-10 AT AT93107555T patent/ATE151069T1/de not_active IP Right Cessation
- 1993-05-10 HU HU9301355A patent/HU219982B/hu not_active IP Right Cessation
- 1993-05-10 ES ES93107555T patent/ES2102549T3/es not_active Expired - Lifetime
- 1993-05-11 MY MYPI93000866A patent/MY109032A/en unknown
- 1993-05-11 CN CN93107067A patent/CN1086739A/zh active Pending
- 1993-05-11 AU AU38524/93A patent/AU657219B2/en not_active Ceased
- 1993-05-11 NZ NZ247601A patent/NZ247601A/en not_active IP Right Cessation
- 1993-05-11 GB GB9309668A patent/GB2266889B/en not_active Expired - Fee Related
- 1993-05-11 SK SK455-93A patent/SK45593A3/sk unknown
- 1993-05-11 JP JP10950893A patent/JP3347393B2/ja not_active Expired - Fee Related
- 1993-05-11 NO NO93931716A patent/NO931716L/no unknown
- 1993-05-11 PH PH46170A patent/PH30986A/en unknown
- 1993-05-11 CZ CZ93857A patent/CZ85793A3/cs unknown
- 1993-05-11 PL PL93298895A patent/PL172930B1/pl unknown
-
1994
- 1994-11-16 US US08/340,801 patent/US5523478A/en not_active Expired - Fee Related
-
1996
- 1996-07-12 US US08/679,152 patent/US5710332A/en not_active Expired - Fee Related
-
1997
- 1997-04-22 GR GR970400926T patent/GR3023261T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CA2095879A1 (en) | 1993-11-12 |
| MY109032A (en) | 1996-11-30 |
| HUT67753A (en) | 1995-04-28 |
| JP3347393B2 (ja) | 2002-11-20 |
| US5523478A (en) | 1996-06-04 |
| PL298895A1 (en) | 1994-01-24 |
| SK45593A3 (en) | 1994-02-02 |
| DE69309341T2 (de) | 1997-08-07 |
| GB2266889B (en) | 1995-12-06 |
| EP0569904A2 (en) | 1993-11-18 |
| ATE151069T1 (de) | 1997-04-15 |
| US5710332A (en) | 1998-01-20 |
| NZ247601A (en) | 1995-11-27 |
| JPH06100505A (ja) | 1994-04-12 |
| PH30986A (en) | 1997-12-23 |
| MX9302729A (es) | 1994-08-31 |
| IN186296B (Direct) | 2001-07-28 |
| CN1086739A (zh) | 1994-05-18 |
| EP0569904B1 (en) | 1997-04-02 |
| NO931716D0 (no) | 1993-05-11 |
| AU657219B2 (en) | 1995-03-02 |
| AU3852493A (en) | 1993-11-18 |
| GB9309668D0 (en) | 1993-06-23 |
| GB2266889A (en) | 1993-11-17 |
| DK0569904T3 (da) | 1997-04-21 |
| HU219982B (hu) | 2001-10-28 |
| DE69309341D1 (de) | 1997-05-07 |
| HU9301355D0 (en) | 1993-09-28 |
| ES2102549T3 (es) | 1997-08-01 |
| EP0569904A3 (Direct) | 1994-01-12 |
| NO931716L (no) | 1993-11-12 |
| GR3023261T3 (en) | 1997-07-30 |
| CZ85793A3 (en) | 1995-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0102118B1 (en) | Cosmetic composition | |
| EP0258814B1 (en) | Surfactants coming from bi- or tri-carboxylic hydroxyacids | |
| DE3851096T2 (de) | Verfahren zur Herstellung einer Perboratbleichmittel enthaltenden wässerigen flüssigen Waschmittelzusammensetzung. | |
| EP0001006B1 (en) | Carboalkylated derivatives of acylated ethylene diamines, process for their preparation and surface-active compositions | |
| EP0510565B1 (en) | Surface-active agents derived from sulfosuccinic esters | |
| PL172930B1 (pl) | Sposób wytwarzania N,N-dwualkiloglukaminy i N,N-dwualkiloglukamina PL PL PL PL | |
| US5846923A (en) | Polyamphoteric phosphate ester surfactants | |
| US3394172A (en) | Perhydrates of nitrogen-containing phosphonic acids and process for their manufacture | |
| EP0746541B1 (en) | Taurine derivatives for use in cleanser compositions | |
| EP0011311B1 (en) | Alkyl glyceryl ether sulfate salts, process for their preparation and composition of matter containing them | |
| EP0209910B1 (en) | Surfactants derived from dicarboxylic hydroxyacids | |
| US2970160A (en) | Process for making amphoteric surface active agents | |
| EP0131908B1 (en) | Salt free phosphobetaines | |
| WO2000006679A1 (en) | Preparation of cationic surfactants containing ester group in molecules | |
| US2993918A (en) | Novel compositions of matter and methods for preparing them | |
| US5043099A (en) | Mono- and di-substituted (diphosphonoalkylamino methyl)-4-hydroxybenzenesulfonic acid | |
| DE2431031A1 (de) | Hydroxysulfobetaine, verfahren zu ihrer herstellung und ihre verwendung | |
| KR100579717B1 (ko) | 양이온성 당류계 계면활성제 및 그의 제조 방법 | |
| US2781358A (en) | Detergent acid salts of certain imidazolinium compounds | |
| CA1310657C (en) | Process for the manufacture of higher fatty monoglyceride monosulfate deterents | |
| US2849450A (en) | Manufacture of salts of alkyl acid sulfates in one step | |
| JPS61143347A (ja) | 新規なアミンアミド化合物含有界面活性剤組成物を製造する方法 | |
| US5763632A (en) | Process for making isethionate ester salts | |
| US2781381A (en) | Detergent sulphonic acid and sulphate salts of certain amphoteric detergents | |
| JP4342645B2 (ja) | イミダゾリン化合物の製造法 |