PL121520B1 - Process for preparing n,n-disubstituted halogenacylamides - Google Patents
Process for preparing n,n-disubstituted halogenacylamides Download PDFInfo
- Publication number
- PL121520B1 PL121520B1 PL1977203537A PL20353777A PL121520B1 PL 121520 B1 PL121520 B1 PL 121520B1 PL 1977203537 A PL1977203537 A PL 1977203537A PL 20353777 A PL20353777 A PL 20353777A PL 121520 B1 PL121520 B1 PL 121520B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compound
- reaction
- chloroacetanilide
- product
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 146
- 238000000034 method Methods 0.000 claims description 89
- 150000001875 compounds Chemical class 0.000 claims description 86
- 238000006243 chemical reaction Methods 0.000 claims description 78
- 239000000047 product Substances 0.000 claims description 73
- -1 polyalkoxy Chemical group 0.000 claims description 70
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 53
- 239000006227 byproduct Substances 0.000 claims description 47
- 238000000926 separation method Methods 0.000 claims description 46
- 125000004432 carbon atom Chemical group C* 0.000 claims description 34
- 239000011541 reaction mixture Substances 0.000 claims description 26
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 claims description 25
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 25
- 239000012433 hydrogen halide Substances 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 23
- 239000001257 hydrogen Substances 0.000 claims description 23
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 23
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- PDQMMZXYWKOZHY-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(CCl)C(=O)CCl PDQMMZXYWKOZHY-UHFFFAOYSA-N 0.000 claims description 16
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 11
- HKPHPIREJKHECO-UHFFFAOYSA-N Amichlor Natural products CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 claims description 10
- 125000001188 haloalkyl group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 238000011084 recovery Methods 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- VTNQPKFIQCLBDU-UHFFFAOYSA-N Acetochlor Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1CC VTNQPKFIQCLBDU-UHFFFAOYSA-N 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 239000012535 impurity Substances 0.000 claims description 6
- GEBJACYJJFWANT-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-(2-ethyl-6-methylphenyl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(CCl)C(=O)CCl GEBJACYJJFWANT-UHFFFAOYSA-N 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 238000007701 flash-distillation Methods 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- LMSNZLCSZWZZGU-UHFFFAOYSA-N butan-1-ol;hydrochloride Chemical compound Cl.CCCCO LMSNZLCSZWZZGU-UHFFFAOYSA-N 0.000 claims description 3
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 3
- 125000006682 monohaloalkyl group Chemical group 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000005243 carbonyl alkyl group Chemical group 0.000 claims description 2
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical group Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 claims description 2
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 description 31
- 239000011230 binding agent Substances 0.000 description 31
- 239000003921 oil Substances 0.000 description 30
- 235000019198 oils Nutrition 0.000 description 30
- 238000002360 preparation method Methods 0.000 description 25
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 19
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- 150000002431 hydrogen Chemical class 0.000 description 14
- 239000002904 solvent Substances 0.000 description 12
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 11
- 239000000543 intermediate Substances 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000004817 gas chromatography Methods 0.000 description 9
- 244000248349 Citrus limon Species 0.000 description 8
- 235000005979 Citrus limon Nutrition 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- LBJVHMAYBNQJBK-UHFFFAOYSA-N N-(2,6-diethylphenyl)-2-chloroacetamide Chemical compound CCC1=CC=CC(CC)=C1NC(=O)CCl LBJVHMAYBNQJBK-UHFFFAOYSA-N 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 4
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 150000003335 secondary amines Chemical class 0.000 description 4
- 238000011282 treatment Methods 0.000 description 4
- 238000005292 vacuum distillation Methods 0.000 description 4
- HBQXJGRVUQPYLI-UHFFFAOYSA-N 2-chloro-n-(2-chloroethoxymethyl)-n-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COCCCl)C(=O)CCl HBQXJGRVUQPYLI-UHFFFAOYSA-N 0.000 description 3
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 239000004009 herbicide Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 150000003464 sulfur compounds Chemical class 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical compound ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- YHZUNJIVPRPTSP-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-(2,6-dimethylphenyl)acetamide Chemical compound CC1=CC=CC(C)=C1N(CCl)C(=O)CCl YHZUNJIVPRPTSP-UHFFFAOYSA-N 0.000 description 2
- VONWPEXRCLHKRJ-UHFFFAOYSA-N 2-chloro-n-phenylacetamide Chemical class ClCC(=O)NC1=CC=CC=C1 VONWPEXRCLHKRJ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- DJISHEFMVWCDIS-UHFFFAOYSA-N CCC1=CC=CC(=C1N(COCC2CCCO2)C(=O)CCl)C Chemical compound CCC1=CC=CC(=C1N(COCC2CCCO2)C(=O)CCl)C DJISHEFMVWCDIS-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 235000019501 Lemon oil Nutrition 0.000 description 2
- GZSGVBVDFWXXJS-UHFFFAOYSA-N N-(2-tert-butyl-6-methylphenyl)-2-chloro-N-(chloromethyl)acetamide Chemical compound C(C)(C)(C)C1=C(N(C(CCl)=O)CCl)C(=CC=C1)C GZSGVBVDFWXXJS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229960001413 acetanilide Drugs 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 2
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 239000010501 lemon oil Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- LZTWZTJRHMRGGK-UHFFFAOYSA-N 1-chloropropan-2-yl 4-methylbenzenesulfonate Chemical compound ClCC(C)OS(=O)(=O)C1=CC=C(C)C=C1 LZTWZTJRHMRGGK-UHFFFAOYSA-N 0.000 description 1
- SXVRSCIZJBGJGB-UHFFFAOYSA-N 1-chloropropan-2-ylbenzene Chemical compound ClCC(C)C1=CC=CC=C1 SXVRSCIZJBGJGB-UHFFFAOYSA-N 0.000 description 1
- ARXJGSRGQADJSQ-UHFFFAOYSA-N 1-methoxypropan-2-ol Chemical compound COCC(C)O ARXJGSRGQADJSQ-UHFFFAOYSA-N 0.000 description 1
- OCGBWVFAINFRDF-UHFFFAOYSA-N 2,2-dichloro-N-(2,4,6-triethylphenyl)acetamide Chemical compound C(C)C1=C(NC(C(Cl)Cl)=O)C(=CC(=C1)CC)CC OCGBWVFAINFRDF-UHFFFAOYSA-N 0.000 description 1
- ZDEDKPUCVXYTFY-UHFFFAOYSA-N 2,2-dichloro-N-(chloromethyl)-N-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(CCl)C(=O)C(Cl)Cl ZDEDKPUCVXYTFY-UHFFFAOYSA-N 0.000 description 1
- KCGIDLAPQCJTSY-UHFFFAOYSA-N 2,2-dichloro-n-(2,6-diethylphenyl)-n-(methoxymethyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)C(Cl)Cl KCGIDLAPQCJTSY-UHFFFAOYSA-N 0.000 description 1
- XJEVHMGJSYVQBQ-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-amine Chemical class C1=CC=C2C(N)CCC2=C1 XJEVHMGJSYVQBQ-UHFFFAOYSA-N 0.000 description 1
- RXTJLDXSGNEJIT-UHFFFAOYSA-N 2,3-dihydro-1h-inden-4-amine Chemical class NC1=CC=CC2=C1CCC2 RXTJLDXSGNEJIT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- LUZLJVVCYVXQTC-UHFFFAOYSA-N 2-bromo-n-(2-tert-butyl-6-methylphenyl)-n-(methoxymethyl)acetamide Chemical compound COCN(C(=O)CBr)C1=C(C)C=CC=C1C(C)(C)C LUZLJVVCYVXQTC-UHFFFAOYSA-N 0.000 description 1
- MSWKVHMWEIWAEL-UHFFFAOYSA-N 2-chloro-2-ethyl-n-(methoxymethyl)-n-phenylbutanamide Chemical compound CCC(Cl)(CC)C(=O)N(COC)C1=CC=CC=C1 MSWKVHMWEIWAEL-UHFFFAOYSA-N 0.000 description 1
- RYTQPUWOTCJNAD-UHFFFAOYSA-N 2-chloro-N-(2,4,6-triethylphenyl)acetamide Chemical compound CCC1=CC(CC)=C(NC(=O)CCl)C(CC)=C1 RYTQPUWOTCJNAD-UHFFFAOYSA-N 0.000 description 1
- GPMYOZZVMOXAMK-UHFFFAOYSA-N 2-chloro-N-(methoxymethyl)-N-(2,4,6-triethylphenyl)acetamide Chemical compound CCC1=CC(CC)=C(N(COC)C(=O)CCl)C(CC)=C1 GPMYOZZVMOXAMK-UHFFFAOYSA-N 0.000 description 1
- YUOGZFIPLSQKQU-UHFFFAOYSA-N 2-chloro-n-(2,6-diethylphenyl)-n-(ethoxymethyl)acetamide Chemical compound CCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YUOGZFIPLSQKQU-UHFFFAOYSA-N 0.000 description 1
- CHAOBIBLXFPGKD-UHFFFAOYSA-N 2-chloro-n-(2,6-diethylphenyl)-n-(propan-2-yloxymethyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COC(C)C)C(=O)CCl CHAOBIBLXFPGKD-UHFFFAOYSA-N 0.000 description 1
- YJKIMPGVENGVLV-UHFFFAOYSA-N 2-chloro-n-(2,6-diethylphenyl)-n-(propoxymethyl)acetamide Chemical compound CCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YJKIMPGVENGVLV-UHFFFAOYSA-N 0.000 description 1
- IYLMCARCSCXVNP-UHFFFAOYSA-N 2-chloro-n-(2,6-dimethylphenyl)-n-(propan-2-yloxymethyl)acetamide Chemical compound CC(C)OCN(C(=O)CCl)C1=C(C)C=CC=C1C IYLMCARCSCXVNP-UHFFFAOYSA-N 0.000 description 1
- HYLMBRRGONHTAL-UHFFFAOYSA-N 2-chloro-n-(2-ethylphenyl)butanamide Chemical compound CCC(Cl)C(=O)NC1=CC=CC=C1CC HYLMBRRGONHTAL-UHFFFAOYSA-N 0.000 description 1
- KDAONRFIZGAYNS-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-methylacetamide Chemical compound ClCN(C)C(=O)CCl KDAONRFIZGAYNS-UHFFFAOYSA-N 0.000 description 1
- PCJKDSWECWZMRV-UHFFFAOYSA-N 2-chloro-n-(chloromethyl)-n-phenylacetamide Chemical compound ClCC(=O)N(CCl)C1=CC=CC=C1 PCJKDSWECWZMRV-UHFFFAOYSA-N 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- ZWVJJSRZESDBCW-UHFFFAOYSA-N C(CCC)C(C(=O)NC1=CC=CC=C1C)Cl Chemical compound C(CCC)C(C(=O)NC1=CC=CC=C1C)Cl ZWVJJSRZESDBCW-UHFFFAOYSA-N 0.000 description 1
- OXYUNIBVXOPFRW-UHFFFAOYSA-N CC1=C(C(=CC=C1)C(C)(C)C)N(COCC2CC2)C(=O)CCl Chemical compound CC1=C(C(=CC=C1)C(C)(C)C)N(COCC2CC2)C(=O)CCl OXYUNIBVXOPFRW-UHFFFAOYSA-N 0.000 description 1
- AGGYIXBFJUGWRC-UHFFFAOYSA-N CC1=CC=CC(C)=C1N(C(=O)CCl)COC1CCCCC1 Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)COC1CCCCC1 AGGYIXBFJUGWRC-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000000254 damaging effect Effects 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 239000003344 environmental pollutant Substances 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 125000006348 halo alkyl alkoxy alkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- IQQROELYZODUGM-UHFFFAOYSA-N n,2-dichloro-n-methylacetamide Chemical compound CN(Cl)C(=O)CCl IQQROELYZODUGM-UHFFFAOYSA-N 0.000 description 1
- KGMBZDZHRAFLBY-UHFFFAOYSA-N n-(butoxymethyl)-n-(2-tert-butyl-6-methylphenyl)-2-chloroacetamide Chemical compound CCCCOCN(C(=O)CCl)C1=C(C)C=CC=C1C(C)(C)C KGMBZDZHRAFLBY-UHFFFAOYSA-N 0.000 description 1
- VULHYRAYXYTONQ-UHFFFAOYSA-N n-phenylmethanimine Chemical class C=NC1=CC=CC=C1 VULHYRAYXYTONQ-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000005554 pickling Methods 0.000 description 1
- 239000005648 plant growth regulator Substances 0.000 description 1
- 231100000719 pollutant Toxicity 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000011027 product recovery Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000002910 solid waste Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Treatment Of Liquids With Adsorbents In General (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75527976A | 1976-12-29 | 1976-12-29 | |
| US84454277A | 1977-10-26 | 1977-10-26 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL203537A1 PL203537A1 (pl) | 1979-06-04 |
| PL121520B1 true PL121520B1 (en) | 1982-05-31 |
Family
ID=27116061
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1977203537A PL121520B1 (en) | 1976-12-29 | 1977-12-29 | Process for preparing n,n-disubstituted halogenacylamides |
Country Status (30)
| Country | Link |
|---|---|
| JP (1) | JPS53101312A (show.php) |
| AR (1) | AR228123A1 (show.php) |
| AT (1) | AT359996B (show.php) |
| AU (1) | AU515013B2 (show.php) |
| BG (1) | BG31363A3 (show.php) |
| BR (2) | BR7708711A (show.php) |
| CA (1) | CA1140590A (show.php) |
| CH (1) | CH638489A5 (show.php) |
| DD (1) | DD134085A5 (show.php) |
| DE (1) | DE2758418A1 (show.php) |
| DK (1) | DK149196C (show.php) |
| ES (1) | ES465723A1 (show.php) |
| FR (1) | FR2376126A1 (show.php) |
| GB (1) | GB1587851A (show.php) |
| GR (1) | GR66096B (show.php) |
| IE (1) | IE46287B1 (show.php) |
| IL (1) | IL53711A0 (show.php) |
| IT (1) | IT1090371B (show.php) |
| LU (1) | LU78777A1 (show.php) |
| MX (1) | MX6258E (show.php) |
| MY (1) | MY8400362A (show.php) |
| NL (1) | NL7714405A (show.php) |
| NO (1) | NO147303C (show.php) |
| NZ (1) | NZ186106A (show.php) |
| PL (1) | PL121520B1 (show.php) |
| PT (1) | PT67465B (show.php) |
| RO (1) | RO83713B (show.php) |
| SE (1) | SE441182B (show.php) |
| TR (1) | TR19809A (show.php) |
| YU (1) | YU41581B (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU177876B (en) * | 1979-04-24 | 1982-01-28 | Nitrokemia Ipartelepek | Process for preparing 2,6-dialkyl-n-/alkoxy-methyl/-chloro-acetanilide derivatives |
| US4311858A (en) * | 1980-12-01 | 1982-01-19 | Monsanto Company | Process for producing N-(halomethyl) acyl-amides |
| DE3569523D1 (de) * | 1984-09-03 | 1989-05-24 | Ciba Geigy Ag | N-(substituted-alkyl) dichloroacetamide derivatives |
| CN116178199A (zh) * | 2022-12-04 | 2023-05-30 | 辽阳恒业化工有限公司 | 一种n-氯乙酰苯胺类除草剂的制备方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA867769A (en) * | 1971-04-06 | Farbenfabriken Bayer Aktiengesellschaft | Fluoracylamino-trichloromethyl-methane derivatives | |
| US2863752A (en) * | 1953-10-30 | 1958-12-09 | Monsanto Chemicals | Herbicides |
| US3287106A (en) * | 1963-11-15 | 1966-11-22 | Monsanto Co | Method for inhibiting the growth of grass type weeds |
| US3442945A (en) * | 1967-05-22 | 1969-05-06 | Monsanto Co | Phytotoxic alpha-halo-acetanilides |
| US3574746A (en) * | 1967-06-05 | 1971-04-13 | Monsanto Co | N-(cycloalken-1-yl) alpha-haloacetamides |
| DE1903198A1 (de) * | 1969-01-23 | 1970-08-06 | Basf Ag | Substituierte Anilide |
| US3547620A (en) * | 1969-01-23 | 1970-12-15 | Monsanto Co | N-(oxamethyl)alpha-halo-acetanilide herbicides |
| US3637847A (en) * | 1969-09-03 | 1972-01-25 | Monsanto Co | N-haloalkyl-anilides |
| BE795197A (fr) * | 1972-02-11 | 1973-08-09 | Ciba Geigy | Acylamines d'hydrocarbures bicycliques agissant sur la croissance des plantes |
-
1976
- 1976-12-29 ES ES465723A patent/ES465723A1/es not_active Expired
-
1977
- 1977-12-16 MX MX776727U patent/MX6258E/es unknown
- 1977-12-22 NZ NZ186106A patent/NZ186106A/xx unknown
- 1977-12-23 AU AU32015/77A patent/AU515013B2/en not_active Expired
- 1977-12-27 NL NL7714405A patent/NL7714405A/xx not_active Application Discontinuation
- 1977-12-28 PT PT67465A patent/PT67465B/pt unknown
- 1977-12-28 DD DD77202986A patent/DD134085A5/xx unknown
- 1977-12-28 BR BR7708711A patent/BR7708711A/pt unknown
- 1977-12-28 CA CA000294001A patent/CA1140590A/en not_active Expired
- 1977-12-28 RO RO92701A patent/RO83713B/ro unknown
- 1977-12-28 BR BR7708771A patent/BR7708771A/pt unknown
- 1977-12-28 AT AT935977A patent/AT359996B/de not_active IP Right Cessation
- 1977-12-28 BG BG038247A patent/BG31363A3/xx unknown
- 1977-12-28 JP JP15750477A patent/JPS53101312A/ja active Granted
- 1977-12-28 IL IL53711A patent/IL53711A0/xx not_active IP Right Cessation
- 1977-12-28 DE DE19772758418 patent/DE2758418A1/de active Granted
- 1977-12-28 AR AR270542A patent/AR228123A1/es active
- 1977-12-28 LU LU78777A patent/LU78777A1/xx unknown
- 1977-12-28 NO NO774478A patent/NO147303C/no unknown
- 1977-12-28 GB GB53977/77A patent/GB1587851A/en not_active Expired
- 1977-12-28 DK DK582177A patent/DK149196C/da active
- 1977-12-28 GR GR55054A patent/GR66096B/el unknown
- 1977-12-28 CH CH1612577A patent/CH638489A5/de not_active IP Right Cessation
- 1977-12-28 IT IT31350/77A patent/IT1090371B/it active
- 1977-12-28 YU YU3142/77A patent/YU41581B/xx unknown
- 1977-12-28 FR FR7739526A patent/FR2376126A1/fr active Granted
- 1977-12-29 SE SE7714872A patent/SE441182B/sv not_active IP Right Cessation
- 1977-12-29 PL PL1977203537A patent/PL121520B1/pl not_active IP Right Cessation
- 1977-12-29 IE IE2631/77A patent/IE46287B1/en not_active IP Right Cessation
-
1979
- 1979-12-28 TR TR19809A patent/TR19809A/xx unknown
-
1984
- 1984-12-30 MY MY362/84A patent/MY8400362A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0003344A1 (de) | Verfahren zur Herstellung von Fluorbenzolen | |
| JPH0262854A (ja) | 置換フェノキシアセトアルデヒドオキシム類の製造方法 | |
| US4496736A (en) | Process for the preparation of carboxylic acids and N-tert.-alkylamines | |
| PL121520B1 (en) | Process for preparing n,n-disubstituted halogenacylamides | |
| EP0361486B1 (de) | Fluorhaltige Monomere, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP4363402A1 (en) | A process for the preparation of 2-nitro-4-(methylsulfonyl)benzoic acid | |
| JP2891647B2 (ja) | 有機スルフィド化合物及びその製造方法 | |
| EP0057889A1 (de) | Verfahren zur Herstellung von 1-Alkyl-2-chlor-5-nitro-4-benzol-sulfonsäuren | |
| EP0317882B1 (de) | Fluorhaltige Verbindungen auf Basis von 4,4'-Bis [2-(4-hydroxy-phenyl) hexafluorisopropyl] diphenylether, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| US5594149A (en) | Process for producing 1,3-dialkyl-2-imidazolidinone | |
| EP0481316B1 (de) | Verfahren zur Herstellung von 2,2-Bis-(aminophenyl)-propan | |
| US5565602A (en) | Production of thiolcarbamates | |
| DE4426133A1 (de) | Verfahren zur Herstellung von aromatischen fluorierten Verbindungen und neue Diamide | |
| DE3300821A1 (de) | Verfahren zur herstellung von 3,3'- oder 3,4'-diaminobenzophenon | |
| US7282610B2 (en) | Method of producing aromatic amine compound having alkylthio group | |
| US4010160A (en) | Process for the manufacture of 1,3-bis-(β-ethylhexyl)-5-amino-5-methyl-hexahydropyrimidine | |
| EP0242551B1 (de) | Verfahren zur Herstellung von Diaziridinen und Produkte daraus | |
| JPH027945B2 (show.php) | ||
| EP0173201A1 (de) | Verfahren zur Herstellung aromatischer Bromverbindungen | |
| SU1486053A3 (ru) | Способ получени 2-галоацетамидов | |
| EP1548012A2 (de) | Verfahren zur Herstellung von Phenylenbisoxazolinen | |
| EP0663394B1 (en) | Process for preparing 5-aminodihydropyrrole, intermediate thereof and process for preparing said intermediate | |
| CH653322A5 (de) | Verfahren zur herstellung von phenylethanolaminen. | |
| US3030361A (en) | Butyrolactone derivatives | |
| US3405183A (en) | Aralkanols and process for their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Decisions on the lapse of the protection rights |
Effective date: 20060312 |