PL115485B1 - Herbicide - Google Patents
Herbicide Download PDFInfo
- Publication number
- PL115485B1 PL115485B1 PL1979215175A PL21517579A PL115485B1 PL 115485 B1 PL115485 B1 PL 115485B1 PL 1979215175 A PL1979215175 A PL 1979215175A PL 21517579 A PL21517579 A PL 21517579A PL 115485 B1 PL115485 B1 PL 115485B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compound
- phenoxy
- trifluoromethyl
- pyridyloxy
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title claims description 21
- 239000004009 herbicide Substances 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 56
- 239000002253 acid Substances 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000004494 ethyl ester group Chemical group 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000013543 active substance Substances 0.000 claims description 4
- 239000000460 chlorine Chemical group 0.000 claims description 4
- 229910052801 chlorine Chemical group 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- PVLIZALAZYCFQL-UHFFFAOYSA-N ethyl 4-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]pent-2-enoate Chemical compound C1=CC(OC(C)C=CC(=O)OCC)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 PVLIZALAZYCFQL-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 101150065749 Churc1 gene Proteins 0.000 claims description 2
- 102100038239 Protein Churchill Human genes 0.000 claims description 2
- VWXFJOQVSIOQQS-UHFFFAOYSA-N butyl 4-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]pent-2-enoate Chemical compound C(CCC)OC(C=CC(C)OC1=CC=C(C=C1)OC1=NC=C(C=C1)C(F)(F)F)=O VWXFJOQVSIOQQS-UHFFFAOYSA-N 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- NYUYSUWSFOGXBX-UHFFFAOYSA-N methyl 4-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]pent-2-enoate Chemical compound C1=CC(OC(C)C=CC(=O)OC)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 NYUYSUWSFOGXBX-UHFFFAOYSA-N 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims 1
- 229910052709 silver Inorganic materials 0.000 claims 1
- 239000004332 silver Substances 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 36
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 235000013339 cereals Nutrition 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 239000002689 soil Substances 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- -1 can be used Inorganic materials 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000006482 condensation reaction Methods 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 244000068988 Glycine max Species 0.000 description 6
- 235000010469 Glycine max Nutrition 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 230000009036 growth inhibition Effects 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- 239000002671 adjuvant Substances 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 238000005507 spraying Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- LTYJAOIVBNCKIJ-UHFFFAOYSA-N 4-[4-[5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]pent-2-enoic acid Chemical compound C1=CC(OC(C)C=CC(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 LTYJAOIVBNCKIJ-UHFFFAOYSA-N 0.000 description 2
- 241000251468 Actinopterygii Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 244000075850 Avena orientalis Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 244000299507 Gossypium hirsutum Species 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229920001214 Polysorbate 60 Polymers 0.000 description 2
- 244000088415 Raphanus sativus Species 0.000 description 2
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 2
- 240000006394 Sorghum bicolor Species 0.000 description 2
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 2
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 2
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- JFOMAVKCSFUFND-UHFFFAOYSA-N ethyl 4-bromopent-2-enoate Chemical compound CCOC(=O)C=CC(C)Br JFOMAVKCSFUFND-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229910052736 halogen Chemical group 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 230000008929 regeneration Effects 0.000 description 2
- 238000011069 regeneration method Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 229920005552 sodium lignosulfonate Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- FQINMRMSOUJYLO-UHFFFAOYSA-N 2-(4-hydroxyphenoxy)pent-2-enoic acid Chemical class CCC=C(C(O)=O)OC1=CC=C(O)C=C1 FQINMRMSOUJYLO-UHFFFAOYSA-N 0.000 description 1
- UCVGDECDTPWFEH-UHFFFAOYSA-N 2-[5-(trifluoromethyl)pyridin-2-yl]oxyphenol Chemical compound OC1=CC=CC=C1OC1=CC=C(C(F)(F)F)C=N1 UCVGDECDTPWFEH-UHFFFAOYSA-N 0.000 description 1
- JFZJMSDDOOAOIV-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1 JFZJMSDDOOAOIV-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 240000001879 Digitalis lutea Species 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000380130 Ehrharta erecta Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 208000000474 Poliomyelitis Diseases 0.000 description 1
- 240000003461 Setaria viridis Species 0.000 description 1
- 235000002248 Setaria viridis Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- GJJAKJNPJXXMCY-UHFFFAOYSA-N [K].CC(C)=O Chemical compound [K].CC(C)=O GJJAKJNPJXXMCY-UHFFFAOYSA-N 0.000 description 1
- 238000012271 agricultural production Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 125000005599 alkyl carboxylate group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000012380 dealkylating agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PMPPQQUNLRNMEO-UHFFFAOYSA-N ethyl 4-[4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]pent-2-enoate Chemical compound C1=CC(OC(C)C=CC(=O)OCC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl PMPPQQUNLRNMEO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000003898 horticulture Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000002075 main ingredient Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000000442 meristematic effect Effects 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000017066 negative regulation of growth Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000001473 noxious effect Effects 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229920000259 polyoxyethylene lauryl ether Polymers 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4927278A JPS54144375A (en) | 1978-04-27 | 1978-04-27 | 4-(5-trifluoromethyl-2-pyridyloxy)phenoxyalkane derivative and herbicide containing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL215175A1 PL215175A1 (ref) | 1980-02-11 |
| PL115485B1 true PL115485B1 (en) | 1981-04-30 |
Family
ID=12826195
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1979215175A PL115485B1 (en) | 1978-04-27 | 1979-04-26 | Herbicide |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4216007A (ref) |
| JP (1) | JPS54144375A (ref) |
| AR (1) | AR222170A1 (ref) |
| BE (1) | BE875880A (ref) |
| BR (1) | BR7902469A (ref) |
| CA (1) | CA1100506A (ref) |
| CH (1) | CH638787A5 (ref) |
| DD (1) | DD143389A5 (ref) |
| DE (1) | DE2915686A1 (ref) |
| EG (1) | EG13630A (ref) |
| FR (1) | FR2424259A1 (ref) |
| GB (1) | GB2020651B (ref) |
| IT (1) | IT1162630B (ref) |
| NL (1) | NL7903209A (ref) |
| PL (1) | PL115485B1 (ref) |
| SU (1) | SU1190972A3 (ref) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| EP0021453B1 (en) * | 1977-08-12 | 1985-04-10 | Imperial Chemical Industries Plc | 2-chloro-5-trichloromethylpyridine |
| BR8005226A (pt) * | 1979-08-23 | 1981-03-04 | Du Pont | Composto herbicida, composicao e processo para o controle de vegetacao indesejavel, composicao e processo para o controle de er vas gramineas em plantas de folhas grandes e processo para preparar um composto herbicida |
| EP0040478A1 (en) * | 1980-05-15 | 1981-11-25 | Imperial Chemical Industries Plc | Process for preparing pyridine derivatives and intermediates useful in the process |
| JPS58146566A (ja) * | 1982-02-24 | 1983-09-01 | Maruko Seiyaku Kk | ピリジン誘導体 |
| US4529438A (en) * | 1982-03-23 | 1985-07-16 | Zoecon Corp. | Pyridyloxy-phenoxy-alkanoic acid esters and derivatives |
| US4477672A (en) * | 1982-08-06 | 1984-10-16 | Zoecon Corporation | Alkylsulfonyloxy substituted phenoxy alkanoic esters |
| US4483992A (en) * | 1982-08-06 | 1984-11-20 | Zoecon Corporation | Alkylthio substituted phenoxy alkanoic acid esters |
| US4448966A (en) * | 1982-08-06 | 1984-05-15 | Zoecon Corporation | Substituted 2-pyridyloxyphenoxy-alkanetriones |
| US4520199A (en) * | 1982-08-13 | 1985-05-28 | Zoecon Corporation | Alkoxy substituted phenoxy alkanoic acid esters |
| US4448965A (en) * | 1982-08-16 | 1984-05-15 | Zoecon Corporation | Substituted cycloalkanediones |
| US4499271A (en) * | 1982-08-20 | 1985-02-12 | Zoecon Corporation | 3-Phosphinyloxy-4-(substituted phenoxy)alkenoic acid esters |
| US4467092A (en) * | 1982-08-20 | 1984-08-21 | Zoecon Corporation | Carbamates and thiocarbamates of 3-hydroxy-4-pyridyloxyphenoxy alkanoic acid esters |
| US4469872A (en) * | 1982-08-20 | 1984-09-04 | Zoecon Corporation | Substituted pyridyloxyphenoxyhydroxyketones |
| US4508906A (en) * | 1982-09-30 | 1985-04-02 | Zoecon Corporation | 3-Amino-4-(2-pyridyloxy)phenoxyalkanoic and alkenoic acid esters |
| PL419522A1 (pl) | 2016-11-18 | 2017-06-19 | Creator Spółka Z Ograniczoną Odpowiedzialnością | Kontener |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2223894C3 (de) * | 1972-05-17 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Herbizide Mittel auf Basis von Phenoxycarbonsäurederivaten |
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| US4115102A (en) * | 1974-10-17 | 1978-09-19 | Ishihara Sangyo Kaisha, Ltd. | Pyridyl compound, herbicidal composition containing the same and method of use thereof |
| US4105435A (en) * | 1975-10-29 | 1978-08-08 | Ishihara Sangyo Kaisha Ltd. | Herbicidal compound, herbicidal composition containing the same, and method of use thereof |
| JPS52131540A (en) * | 1976-04-14 | 1977-11-04 | Ishihara Sangyo Kaisha Ltd | Phenoxyvaleric acid derivatives and herbicides therefrom |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| CA1247625A (en) * | 1977-07-22 | 1988-12-28 | Howard Johnston | Trifluoromethyl pyridinyloxyphenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| JPS5461182A (en) * | 1977-10-20 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-phenoxy-5-trifluoromethylpyridine compounds |
-
1978
- 1978-04-27 JP JP4927278A patent/JPS54144375A/ja active Granted
-
1979
- 1979-04-16 EG EG227/79A patent/EG13630A/xx active
- 1979-04-18 DE DE19792915686 patent/DE2915686A1/de active Granted
- 1979-04-20 GB GB7913834A patent/GB2020651B/en not_active Expired
- 1979-04-23 BR BR7902469A patent/BR7902469A/pt unknown
- 1979-04-24 NL NL7903209A patent/NL7903209A/xx not_active Application Discontinuation
- 1979-04-26 CH CH394479A patent/CH638787A5/fr not_active IP Right Cessation
- 1979-04-26 CA CA326,449A patent/CA1100506A/en not_active Expired
- 1979-04-26 BE BE0/194858A patent/BE875880A/xx not_active IP Right Cessation
- 1979-04-26 IT IT48846/79A patent/IT1162630B/it active
- 1979-04-26 AR AR276322A patent/AR222170A1/es active
- 1979-04-26 PL PL1979215175A patent/PL115485B1/pl unknown
- 1979-04-26 SU SU792761754A patent/SU1190972A3/ru active
- 1979-04-27 DD DD79212572A patent/DD143389A5/de unknown
- 1979-04-27 FR FR7910864A patent/FR2424259A1/fr active Granted
- 1979-04-27 US US06/034,039 patent/US4216007A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EG13630A (en) | 1982-09-30 |
| AR222170A1 (es) | 1981-04-30 |
| IT1162630B (it) | 1987-04-01 |
| GB2020651B (en) | 1982-07-28 |
| FR2424259A1 (fr) | 1979-11-23 |
| JPS54144375A (en) | 1979-11-10 |
| NL7903209A (nl) | 1979-10-30 |
| BE875880A (fr) | 1979-08-16 |
| IT7948846A0 (it) | 1979-04-26 |
| DE2915686C2 (ref) | 1988-09-22 |
| JPS6341906B2 (ref) | 1988-08-19 |
| US4216007A (en) | 1980-08-05 |
| BR7902469A (pt) | 1979-10-30 |
| CA1100506A (en) | 1981-05-05 |
| GB2020651A (en) | 1979-11-21 |
| PL215175A1 (ref) | 1980-02-11 |
| CH638787A5 (fr) | 1983-10-14 |
| FR2424259B1 (ref) | 1983-12-30 |
| DD143389A5 (de) | 1980-08-20 |
| SU1190972A3 (ru) | 1985-11-07 |
| DE2915686A1 (de) | 1979-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL110908B1 (en) | Herbicide | |
| US4231787A (en) | Herbicidal compound, herbicidal composition containing the same, and method of use thereof | |
| US4134751A (en) | Herbicidal compound, herbicidal composition containing the same and method of use thereof | |
| PL115485B1 (en) | Herbicide | |
| US4420436A (en) | 2-Substituted 5-phenoxyphenylphosphonic acid derivatives | |
| EP0239414B1 (en) | N-benzyl-2-(4-fluoro-3-trifluoromethylphenoxy) butanoic amide and herbicidal composition containing the same | |
| DK154074B (da) | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt | |
| JPH0161083B2 (ref) | ||
| US4108629A (en) | Herbicidal use of esters of aminohalopyridyloxy acids | |
| PL114468B1 (en) | Herbicide | |
| EP0288275A2 (en) | Phenoxypropionic acid derivatives for use as herbicides | |
| EP0023725B1 (en) | Diphenyl ether derivatives, process for preparing the same and herbicidal compositions containing the same | |
| US4493730A (en) | Phenoxypyridine useful as a herbicide | |
| JPS6055075B2 (ja) | ピラゾ−ル系リン酸エステル類、その製造法および殺虫殺ダニ剤 | |
| EP0034012A2 (en) | 2-nitro-5-(substituted-phenoxy) phenylalkanone oxime and imine derivatives as herbicides | |
| US4140520A (en) | 3,5-Dichloropyridyl-2-oxy-phenoxy malonic acids and derivatives and herbicidal use thereof | |
| EP0028277B1 (en) | Substituted diphenyl ethers, herbicidal compositions containing them and method of combating weeds | |
| US4340765A (en) | 4-Phenoxy-2-butene derivatives as plant growth regulators | |
| EP0065287A2 (en) | N-containing heterocyclic ring-substituted O-arylphosphate derivatives, preparation thereof, and insecticides containing said derivatives | |
| CN101348464B (zh) | 二卤代丙烯类化合物及其制备方法和用途 | |
| JPH0526781B2 (ref) | ||
| CS245772B2 (en) | Herbicide agent | |
| CA1089873A (en) | Phenoxy-phenoxy valeric acids and derivatives thereof | |
| US5207819A (en) | Phenoxypropionic acid ester derivatives | |
| US4824470A (en) | 2-(1-(5-Halothienylmethoxyimino)ethyl-3-hydroxy-5-(tetrahydro-2H-thiopyranyl)-cyclohex-2-en-1-one herbicides |