OA11972A - Substituted phenoxyacetic acids. - Google Patents
Substituted phenoxyacetic acids. Download PDFInfo
- Publication number
- OA11972A OA11972A OA1200100338A OA1200100338A OA11972A OA 11972 A OA11972 A OA 11972A OA 1200100338 A OA1200100338 A OA 1200100338A OA 1200100338 A OA1200100338 A OA 1200100338A OA 11972 A OA11972 A OA 11972A
- Authority
- OA
- OAPI
- Prior art keywords
- fluoro
- phenoxy
- acetic acid
- benzylcarbamoyl
- bromo
- Prior art date
Links
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical class OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 title abstract description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 139
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 11
- -1 Cj-Cgalkoxy Chemical group 0.000 claims description 155
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 77
- 125000000217 alkyl group Chemical group 0.000 claims description 77
- 229960000583 acetic acid Drugs 0.000 claims description 62
- 239000001257 hydrogen Substances 0.000 claims description 59
- 229910052739 hydrogen Inorganic materials 0.000 claims description 59
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 58
- 229910052736 halogen Inorganic materials 0.000 claims description 55
- 150000002367 halogens Chemical class 0.000 claims description 55
- 239000000203 mixture Substances 0.000 claims description 55
- 125000003545 alkoxy group Chemical group 0.000 claims description 48
- 125000001153 fluoro group Chemical group F* 0.000 claims description 46
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 44
- 150000002431 hydrogen Chemical group 0.000 claims description 42
- 239000000460 chlorine Substances 0.000 claims description 36
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 35
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 33
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 26
- 229910052757 nitrogen Inorganic materials 0.000 claims description 25
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 23
- 125000003282 alkyl amino group Chemical group 0.000 claims description 22
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 22
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 22
- 229910052760 oxygen Inorganic materials 0.000 claims description 22
- 239000001301 oxygen Substances 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 239000005541 ACE inhibitor Substances 0.000 claims description 19
- 125000001072 heteroaryl group Chemical group 0.000 claims description 18
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 17
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 17
- 125000001246 bromo group Chemical group Br* 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 14
- HOFFXZBMYHZMTN-UHFFFAOYSA-N 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 HOFFXZBMYHZMTN-UHFFFAOYSA-N 0.000 claims description 13
- 229940044094 angiotensin-converting-enzyme inhibitor Drugs 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 13
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 12
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 12
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 12
- 229910052717 sulfur Inorganic materials 0.000 claims description 12
- 239000011593 sulfur Chemical group 0.000 claims description 12
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 claims description 12
- 125000002947 alkylene group Chemical group 0.000 claims description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 11
- 208000002249 Diabetes Complications Diseases 0.000 claims description 10
- 206010012655 Diabetic complications Diseases 0.000 claims description 10
- 125000005605 benzo group Chemical group 0.000 claims description 10
- PZUABNHIHMIRAO-UHFFFAOYSA-N ethyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 PZUABNHIHMIRAO-UHFFFAOYSA-N 0.000 claims description 10
- 238000004519 manufacturing process Methods 0.000 claims description 10
- 125000002757 morpholinyl group Chemical group 0.000 claims description 9
- 235000019000 fluorine Nutrition 0.000 claims description 8
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 claims description 8
- PGLZYJVSXDUOJJ-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-nitrophenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C([N+]([O-])=O)C=C1C(=O)NCC1=CC=C(Br)C=C1F PGLZYJVSXDUOJJ-UHFFFAOYSA-N 0.000 claims description 7
- XFJRLYVSMQTRMF-UHFFFAOYSA-N 2-[4-amino-2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound NC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1 XFJRLYVSMQTRMF-UHFFFAOYSA-N 0.000 claims description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 7
- LTOGMJNIFXKCMS-UHFFFAOYSA-N 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamothioyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=CC=CC([N+]([O-])=O)=C1 LTOGMJNIFXKCMS-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- YRZKYOFOFCQAJG-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-chlorophenoxy]acetate Chemical compound CCOC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F YRZKYOFOFCQAJG-UHFFFAOYSA-N 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- ZCAGEXZTORJQDZ-UHFFFAOYSA-N idd552 Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=NC2=C(F)C(F)=CC(F)=C2S1 ZCAGEXZTORJQDZ-UHFFFAOYSA-N 0.000 claims description 6
- 229940002612 prodrug Drugs 0.000 claims description 6
- 239000000651 prodrug Chemical group 0.000 claims description 6
- ZLIGBZRXAQNUFO-UHFFFAOYSA-N (2-{[(4-bromo-2-fluorobenzyl)amino]carbonyl}-5-chlorophenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F ZLIGBZRXAQNUFO-UHFFFAOYSA-N 0.000 claims description 5
- BJQBRXOZXULXEC-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamothioyl]-5-fluoro-4-methylphenoxy]acetic acid Chemical compound C1=C(F)C(C)=CC(C(=S)NCC=2C(=CC(Br)=CC=2)F)=C1OCC(O)=O BJQBRXOZXULXEC-UHFFFAOYSA-N 0.000 claims description 5
- HDYSFMQCZKXNCP-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-hydroxyphenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(O)C=C1C(=O)NCC1=CC=C(Br)C=C1F HDYSFMQCZKXNCP-UHFFFAOYSA-N 0.000 claims description 5
- AKYQRJAGXXZACK-UHFFFAOYSA-N 2-[5-fluoro-2-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methylcarbamothioyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=NC2=C(F)C(F)=CC(F)=C2S1 AKYQRJAGXXZACK-UHFFFAOYSA-N 0.000 claims description 5
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- 101710129690 Angiotensin-converting enzyme inhibitor Proteins 0.000 claims description 5
- 101710086378 Bradykinin-potentiating and C-type natriuretic peptides Proteins 0.000 claims description 5
- 208000032131 Diabetic Neuropathies Diseases 0.000 claims description 5
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 5
- 201000010099 disease Diseases 0.000 claims description 5
- QIIVXQRKYFRJCI-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4,5-difluorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(F)C=C1C(=O)NCC1=CC=C(Br)C=C1F QIIVXQRKYFRJCI-UHFFFAOYSA-N 0.000 claims description 4
- QNWFNORHWGKDRC-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-fluorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(F)C=C1C(=O)NCC1=CC=C(Br)C=C1F QNWFNORHWGKDRC-UHFFFAOYSA-N 0.000 claims description 4
- FJIZCSOCMULOCM-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-methoxyphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(OC)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F FJIZCSOCMULOCM-UHFFFAOYSA-N 0.000 claims description 4
- ZNTJBHNQMHKQRE-UHFFFAOYSA-N 2-[4-bromo-2-[(4-bromo-2-fluorophenyl)methylcarbamothioyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(Br)C=C1C(=S)NCC1=CC=C(Br)C=C1F ZNTJBHNQMHKQRE-UHFFFAOYSA-N 0.000 claims description 4
- YFOZTUGVUPJZQN-UHFFFAOYSA-N 2-[5-chloro-2-[[3-(trifluoromethyl)phenyl]methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=CC(C(F)(F)F)=C1 YFOZTUGVUPJZQN-UHFFFAOYSA-N 0.000 claims description 4
- DRXGHGSGESTSRR-UHFFFAOYSA-N 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamothioyl]-4-phenylphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(C=2C=CC=CC=2)C=C1C(=S)NCC1=CC=CC([N+]([O-])=O)=C1 DRXGHGSGESTSRR-UHFFFAOYSA-N 0.000 claims description 4
- RIWGNVAOPRSVNV-UHFFFAOYSA-N 2-[5-fluoro-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound C1=C([N+]([O-])=O)C(C)=CC=C1CNC(=O)C1=CC=C(F)C=C1OCC(O)=O RIWGNVAOPRSVNV-UHFFFAOYSA-N 0.000 claims description 4
- DPDOABOONBUWMC-UHFFFAOYSA-N 2-[5-fluoro-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=NC2=CC(C(F)(F)F)=CC=C2S1 DPDOABOONBUWMC-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 108010007859 Lisinopril Proteins 0.000 claims description 4
- ZSHDPGCEJWXJLC-UHFFFAOYSA-N N-methyl-N-naphthalen-2-yl-2,3-dioxoquinoxaline-6-sulfonamide Chemical group CN(c1ccc2ccccc2c1)S(=O)(=O)c1ccc2=NC(=O)C(=O)N=c2c1 ZSHDPGCEJWXJLC-UHFFFAOYSA-N 0.000 claims description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 4
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229960000830 captopril Drugs 0.000 claims description 4
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 claims description 4
- 150000001768 cations Chemical class 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- YNJOZKDLUBTLDQ-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluoro-4-morpholin-4-ylphenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=C(N2CCOCC2)C=C1C(=O)NCC1=CC=C(Br)C=C1F YNJOZKDLUBTLDQ-UHFFFAOYSA-N 0.000 claims description 4
- PROPWVFZYMARHF-UHFFFAOYSA-N ethyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamothioyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=CC=CC([N+]([O-])=O)=C1 PROPWVFZYMARHF-UHFFFAOYSA-N 0.000 claims description 4
- RUKXEKOLJGCYPT-UHFFFAOYSA-N ethyl 2-[5-fluoro-2-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methylcarbamothioyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=NC2=C(F)C(F)=CC(F)=C2S1 RUKXEKOLJGCYPT-UHFFFAOYSA-N 0.000 claims description 4
- IXQLQDGUSWSVCR-UHFFFAOYSA-N ethyl 2-[5-fluoro-2-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methylcarbamoyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=NC2=C(F)C(F)=CC(F)=C2S1 IXQLQDGUSWSVCR-UHFFFAOYSA-N 0.000 claims description 4
- 229960002394 lisinopril Drugs 0.000 claims description 4
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 claims description 4
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims description 4
- VABIMMIJVWNHFI-UHFFFAOYSA-N (5-chloro-2-{[(3-nitrobenzyl)amino]carbonyl}phenoxy)acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 VABIMMIJVWNHFI-UHFFFAOYSA-N 0.000 claims description 3
- PKFIBQUBQLMCAA-UHFFFAOYSA-N 2-[2-[(3-nitrophenyl)methylcarbamoyl]-4-(trifluoromethoxy)phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(OC(F)(F)F)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 PKFIBQUBQLMCAA-UHFFFAOYSA-N 0.000 claims description 3
- ZVIJVQUZAFMKDP-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamothioyl]-4,5-difluorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(F)C=C1C(=S)NCC1=CC=C(Br)C=C1F ZVIJVQUZAFMKDP-UHFFFAOYSA-N 0.000 claims description 3
- MKYJWXIBUSTLQR-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-methoxyphenoxy]acetic acid Chemical compound COC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1 MKYJWXIBUSTLQR-UHFFFAOYSA-N 0.000 claims description 3
- RTVYLMOYEJCWKS-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-methylphenoxy]acetic acid Chemical compound CC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1 RTVYLMOYEJCWKS-UHFFFAOYSA-N 0.000 claims description 3
- VILIQBQRKXKVRC-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-propoxyphenoxy]acetic acid Chemical compound CCCOC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1 VILIQBQRKXKVRC-UHFFFAOYSA-N 0.000 claims description 3
- AQRVSBJPTIETHB-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-methylphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(C)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F AQRVSBJPTIETHB-UHFFFAOYSA-N 0.000 claims description 3
- VMDJMZLCXYDEJN-UHFFFAOYSA-N 2-[4-bromo-5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(Br)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 VMDJMZLCXYDEJN-UHFFFAOYSA-N 0.000 claims description 3
- XYVNXMLOWRSSKZ-UHFFFAOYSA-N 2-[5-chloro-2-[(2,6-difluorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=C(F)C=CC=C1F XYVNXMLOWRSSKZ-UHFFFAOYSA-N 0.000 claims description 3
- XCUJOTAIZCGZME-UHFFFAOYSA-N 2-[5-chloro-2-[(3,5-dimethoxyphenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound COC1=CC(OC)=CC(CNC(=O)C=2C(=CC(Cl)=CC=2)OCC(O)=O)=C1 XCUJOTAIZCGZME-UHFFFAOYSA-N 0.000 claims description 3
- IXKZEXYDDPKBHA-UHFFFAOYSA-N 2-[5-chloro-2-[(3-fluorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=CC(F)=C1 IXKZEXYDDPKBHA-UHFFFAOYSA-N 0.000 claims description 3
- QRFUWHJZABNGAP-UHFFFAOYSA-N 2-[5-chloro-2-[[4-(trifluoromethoxy)phenyl]methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(OC(F)(F)F)C=C1 QRFUWHJZABNGAP-UHFFFAOYSA-N 0.000 claims description 3
- KAKGITVNDMUJNY-UHFFFAOYSA-N 2-[5-chloro-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=NC2=CC(C(F)(F)F)=CC=C2S1 KAKGITVNDMUJNY-UHFFFAOYSA-N 0.000 claims description 3
- JMOWSLHICGJXMV-UHFFFAOYSA-N 2-[5-fluoro-4-methyl-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound C1=C(F)C(C)=CC(C(=O)NCC=2C=C(C=CC=2)[N+]([O-])=O)=C1OCC(O)=O JMOWSLHICGJXMV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- UXNKVDGMAAIZOF-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamothioyl]-5-fluoro-4-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=C(C)C=C1C(=S)NCC1=CC=C(Br)C=C1F UXNKVDGMAAIZOF-UHFFFAOYSA-N 0.000 claims description 3
- JCZUIWYXULSXSW-UHFFFAOYSA-N idd594 Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=CC=C(Br)C=C1F JCZUIWYXULSXSW-UHFFFAOYSA-N 0.000 claims description 3
- 230000001771 impaired effect Effects 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- AJDOUWBFADNZSF-UHFFFAOYSA-N prop-2-enyl 2-[4-acetamido-2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CC(=O)NC1=CC=C(OCC(=O)OCC=C)C(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1 AJDOUWBFADNZSF-UHFFFAOYSA-N 0.000 claims description 3
- CTPQRCYNPAZLQY-UHFFFAOYSA-N tert-butyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-nitrophenoxy]acetate Chemical compound CC(C)(C)OC(=O)COC1=CC=C([N+]([O-])=O)C=C1C(=O)NCC1=CC=C(Br)C=C1F CTPQRCYNPAZLQY-UHFFFAOYSA-N 0.000 claims description 3
- 125000004505 1,2,4-oxadiazol-5-yl group Chemical group O1N=CN=C1* 0.000 claims description 2
- 125000004510 1,3,4-oxadiazol-5-yl group Chemical group O1C=NN=C1* 0.000 claims description 2
- WLIJXMNMNJIVPE-UHFFFAOYSA-N 2-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)-5-chlorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(OCO2)C2=C1 WLIJXMNMNJIVPE-UHFFFAOYSA-N 0.000 claims description 2
- XBMXVKFFSUQAHB-UHFFFAOYSA-N 2-[2-(benzylcarbamoyl)-5-chlorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=CC=C1 XBMXVKFFSUQAHB-UHFFFAOYSA-N 0.000 claims description 2
- OTLXMBAPSLICJO-UHFFFAOYSA-N 2-[2-[(2-fluorophenyl)methylcarbamoyl]-4-propoxyphenoxy]acetic acid Chemical compound CCCOC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C(=CC=CC=2)F)=C1 OTLXMBAPSLICJO-UHFFFAOYSA-N 0.000 claims description 2
- FNEOEALAHYHEOA-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-3,5-difluorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=CC(F)=C1C(=O)NCC1=CC=C(Br)C=C1F FNEOEALAHYHEOA-UHFFFAOYSA-N 0.000 claims description 2
- PAOIFRPAIJVWIK-UHFFFAOYSA-N 2-[2-[(4-bromophenyl)methylcarbamoyl]-5-chlorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(Br)C=C1 PAOIFRPAIJVWIK-UHFFFAOYSA-N 0.000 claims description 2
- UFVBPBXMCFWIPR-UHFFFAOYSA-N 2-[2-[[3,5-bis(trifluoromethyl)phenyl]methylcarbamoyl]-5-chlorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 UFVBPBXMCFWIPR-UHFFFAOYSA-N 0.000 claims description 2
- VLEYDBHPFIGVCP-UHFFFAOYSA-N 2-[4-acetamido-2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound CC(=O)NC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1 VLEYDBHPFIGVCP-UHFFFAOYSA-N 0.000 claims description 2
- VCRJGDMIXXMMSM-UHFFFAOYSA-N 2-[4-cyano-5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(C#N)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 VCRJGDMIXXMMSM-UHFFFAOYSA-N 0.000 claims description 2
- UWRVTYXRWRFZLD-UHFFFAOYSA-N 2-[4-methyl-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound CC1=CC=C(OCC(O)=O)C(C(=O)NCC=2C=C(C=CC=2)[N+]([O-])=O)=C1 UWRVTYXRWRFZLD-UHFFFAOYSA-N 0.000 claims description 2
- CYOWQKBVRUBBNK-UHFFFAOYSA-N 2-[5-chloro-2-[(3,4-dichlorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(Cl)C(Cl)=C1 CYOWQKBVRUBBNK-UHFFFAOYSA-N 0.000 claims description 2
- RMZSPHFFJQNDLJ-UHFFFAOYSA-N 2-[5-chloro-2-[(4-chlorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(Cl)C=C1 RMZSPHFFJQNDLJ-UHFFFAOYSA-N 0.000 claims description 2
- YMULGAAOPQDOJO-UHFFFAOYSA-N 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]-4-phenylphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(C=2C=CC=CC=2)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 YMULGAAOPQDOJO-UHFFFAOYSA-N 0.000 claims description 2
- HXVKLSWIJQJFKH-UHFFFAOYSA-N 3-methylbutyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamothioyl]phenoxy]acetate Chemical compound CC(C)CCOC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=CC=CC([N+]([O-])=O)=C1 HXVKLSWIJQJFKH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 claims description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 238000011161 development Methods 0.000 claims description 2
- SYDLYRPUYXWHBG-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-methylsulfonylphenoxy]acetate Chemical compound CCOC(=O)COC1=CC(S(C)(=O)=O)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F SYDLYRPUYXWHBG-UHFFFAOYSA-N 0.000 claims description 2
- 230000001537 neural effect Effects 0.000 claims description 2
- JWWGTQBWBFBWEG-UHFFFAOYSA-N octyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamothioyl]phenoxy]acetate Chemical compound CCCCCCCCOC(=O)COC1=CC(F)=CC=C1C(=S)NCC1=CC=CC([N+]([O-])=O)=C1 JWWGTQBWBFBWEG-UHFFFAOYSA-N 0.000 claims description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 2
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 claims description 2
- 125000004495 thiazol-4-yl group Chemical group S1C=NC(=C1)* 0.000 claims description 2
- NVXFXLSOGLFXKQ-JMSVASOKSA-N (2s)-1-[(2r,4r)-5-ethoxy-2,4-dimethyl-5-oxopentanoyl]-2,3-dihydroindole-2-carboxylic acid Chemical compound C1=CC=C2N(C(=O)[C@H](C)C[C@@H](C)C(=O)OCC)[C@H](C(O)=O)CC2=C1 NVXFXLSOGLFXKQ-JMSVASOKSA-N 0.000 claims 3
- BIDNLKIUORFRQP-XYGFDPSESA-N (2s,4s)-4-cyclohexyl-1-[2-[[(1s)-2-methyl-1-propanoyloxypropoxy]-(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid Chemical compound C([P@@](=O)(O[C@H](OC(=O)CC)C(C)C)CC(=O)N1[C@@H](C[C@H](C1)C1CCCCC1)C(O)=O)CCCC1=CC=CC=C1 BIDNLKIUORFRQP-XYGFDPSESA-N 0.000 claims 3
- FHHHOYXPRDYHEZ-COXVUDFISA-N Alacepril Chemical compound CC(=O)SC[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(O)=O)CC1=CC=CC=C1 FHHHOYXPRDYHEZ-COXVUDFISA-N 0.000 claims 3
- IFYLTXNCFVRALQ-OALUTQOASA-N Ceronapril Chemical compound O([C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)P(O)(=O)CCCCC1=CC=CC=C1 IFYLTXNCFVRALQ-OALUTQOASA-N 0.000 claims 3
- 108010061435 Enalapril Proteins 0.000 claims 3
- UWWDHYUMIORJTA-HSQYWUDLSA-N Moexipril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC(OC)=C(OC)C=C2C1)C(O)=O)CC1=CC=CC=C1 UWWDHYUMIORJTA-HSQYWUDLSA-N 0.000 claims 3
- XRKXJJYSKUIIEN-LLVKDONJSA-N Pivopril Chemical compound CC(C)(C)C(=O)SC[C@@H](C)C(=O)N(CC(O)=O)C1CCCC1 XRKXJJYSKUIIEN-LLVKDONJSA-N 0.000 claims 3
- VXFJYXUZANRPDJ-WTNASJBWSA-N Trandopril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](C[C@H]2CCCC[C@@H]21)C(O)=O)CC1=CC=CC=C1 VXFJYXUZANRPDJ-WTNASJBWSA-N 0.000 claims 3
- 229950007884 alacepril Drugs 0.000 claims 3
- 229950005749 ceronapril Drugs 0.000 claims 3
- 229960005025 cilazapril Drugs 0.000 claims 3
- HHHKFGXWKKUNCY-FHWLQOOXSA-N cilazapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H]1C(N2[C@@H](CCCN2CCC1)C(O)=O)=O)CC1=CC=CC=C1 HHHKFGXWKKUNCY-FHWLQOOXSA-N 0.000 claims 3
- 229960005227 delapril Drugs 0.000 claims 3
- WOUOLAUOZXOLJQ-MBSDFSHPSA-N delapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N(CC(O)=O)C1CC2=CC=CC=C2C1)CC1=CC=CC=C1 WOUOLAUOZXOLJQ-MBSDFSHPSA-N 0.000 claims 3
- 229960000873 enalapril Drugs 0.000 claims 3
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 claims 3
- 229960002490 fosinopril Drugs 0.000 claims 3
- 229950009810 indolapril Drugs 0.000 claims 3
- AXTCRUUITQKBAV-KBPBESRZSA-N libenzapril Chemical compound OC(=O)CN1C(=O)[C@@H](N[C@@H](CCCCN)C(O)=O)CCC2=CC=CC=C21 AXTCRUUITQKBAV-KBPBESRZSA-N 0.000 claims 3
- 229950001218 libenzapril Drugs 0.000 claims 3
- 229960005170 moexipril Drugs 0.000 claims 3
- 229950008492 pentopril Drugs 0.000 claims 3
- 229950008688 pivopril Drugs 0.000 claims 3
- 229960001455 quinapril Drugs 0.000 claims 3
- JSDRRTOADPPCHY-HSQYWUDLSA-N quinapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)CC1=CC=CC=C1 JSDRRTOADPPCHY-HSQYWUDLSA-N 0.000 claims 3
- FLSLEGPOVLMJMN-YSSFQJQWSA-N quinaprilat Chemical compound C([C@H](N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)C(O)=O)CC1=CC=CC=C1 FLSLEGPOVLMJMN-YSSFQJQWSA-N 0.000 claims 3
- 229960001007 quinaprilat Drugs 0.000 claims 3
- 229960003401 ramipril Drugs 0.000 claims 3
- HDACQVRGBOVJII-JBDAPHQKSA-N ramipril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](C[C@@H]2CCC[C@@H]21)C(O)=O)CC1=CC=CC=C1 HDACQVRGBOVJII-JBDAPHQKSA-N 0.000 claims 3
- 229960002909 spirapril Drugs 0.000 claims 3
- 108700035424 spirapril Proteins 0.000 claims 3
- HRWCVUIFMSZDJS-SZMVWBNQSA-N spirapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2(C1)SCCS2)C(O)=O)CC1=CC=CC=C1 HRWCVUIFMSZDJS-SZMVWBNQSA-N 0.000 claims 3
- FMMDBLMCSDRUPA-BPUTZDHNSA-N spiraprilat Chemical compound C([C@H](N[C@@H](C)C(=O)N1[C@@H](CC2(C1)SCCS2)C(O)=O)C(O)=O)CC1=CC=CC=C1 FMMDBLMCSDRUPA-BPUTZDHNSA-N 0.000 claims 3
- 229950006297 spiraprilat Drugs 0.000 claims 3
- 108700006892 spiraprilat Proteins 0.000 claims 3
- 229960002769 zofenopril Drugs 0.000 claims 3
- IAIDUHCBNLFXEF-MNEFBYGVSA-N zofenopril Chemical compound C([C@@H](C)C(=O)N1[C@@H](C[C@@H](C1)SC=1C=CC=CC=1)C(O)=O)SC(=O)C1=CC=CC=C1 IAIDUHCBNLFXEF-MNEFBYGVSA-N 0.000 claims 3
- XPCFTKFZXHTYIP-PMACEKPBSA-N Benazepril Chemical compound C([C@@H](C(=O)OCC)N[C@@H]1C(N(CC(O)=O)C2=CC=CC=C2CC1)=O)CC1=CC=CC=C1 XPCFTKFZXHTYIP-PMACEKPBSA-N 0.000 claims 2
- SGPGESCZOCHFCL-UHFFFAOYSA-N Tilisolol hydrochloride Chemical compound [Cl-].C1=CC=C2C(=O)N(C)C=C(OCC(O)C[NH2+]C(C)(C)C)C2=C1 SGPGESCZOCHFCL-UHFFFAOYSA-N 0.000 claims 2
- 229960004530 benazepril Drugs 0.000 claims 2
- BSHDUMDXSRLRBI-JOYOIKCWSA-N rentiapril Chemical compound SCCC(=O)N1[C@H](C(=O)O)CS[C@@H]1C1=CC=CC=C1O BSHDUMDXSRLRBI-JOYOIKCWSA-N 0.000 claims 2
- 125000001766 1,2,4-oxadiazol-3-yl group Chemical group [H]C1=NC(*)=NO1 0.000 claims 1
- 125000004518 1,2,5-thiadiazol-3-yl group Chemical group S1N=C(C=N1)* 0.000 claims 1
- HXAKCRYWCZHQSN-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-(trifluoromethyl)phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(C(F)(F)F)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F HXAKCRYWCZHQSN-UHFFFAOYSA-N 0.000 claims 1
- YGSXYQRXWUFBJS-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-methylsulfonylphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(S(=O)(=O)C)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F YGSXYQRXWUFBJS-UHFFFAOYSA-N 0.000 claims 1
- ONOWGEZFRVVOQF-UHFFFAOYSA-N 2-[5-chloro-2-[(4-methoxyphenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound C1=CC(OC)=CC=C1CNC(=O)C1=CC=C(Cl)C=C1OCC(O)=O ONOWGEZFRVVOQF-UHFFFAOYSA-N 0.000 claims 1
- NTGIAPVUCADTBR-UHFFFAOYSA-N 2-[5-chloro-2-[[3-fluoro-5-(trifluoromethyl)phenyl]methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(Cl)=CC=C1C(=O)NCC1=CC(F)=CC(C(F)(F)F)=C1 NTGIAPVUCADTBR-UHFFFAOYSA-N 0.000 claims 1
- YTCQYMCDHKZLCQ-UHFFFAOYSA-N 2-[5-fluoro-4-methyl-2-[(3-nitrophenyl)methylcarbamothioyl]phenoxy]acetic acid Chemical compound C1=C(F)C(C)=CC(C(=S)NCC=2C=C(C=CC=2)[N+]([O-])=O)=C1OCC(O)=O YTCQYMCDHKZLCQ-UHFFFAOYSA-N 0.000 claims 1
- YTFFFDWBVTZTOF-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-methylsulfanylphenoxy]acetate Chemical compound CCOC(=O)COC1=CC(SC)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F YTFFFDWBVTZTOF-UHFFFAOYSA-N 0.000 claims 1
- 125000004500 isothiazol-4-yl group Chemical group S1N=CC(=C1)* 0.000 claims 1
- 125000004501 isothiazol-5-yl group Chemical group S1N=CC=C1* 0.000 claims 1
- 125000004287 oxazol-2-yl group Chemical group [H]C1=C([H])N=C(*)O1 0.000 claims 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 25
- 238000003786 synthesis reaction Methods 0.000 abstract description 9
- 230000015572 biosynthetic process Effects 0.000 abstract description 7
- 230000001684 chronic effect Effects 0.000 abstract description 7
- 239000003814 drug Substances 0.000 abstract description 5
- 206010012601 diabetes mellitus Diseases 0.000 abstract description 4
- 229940124597 therapeutic agent Drugs 0.000 abstract 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 370
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 213
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 171
- 229940093499 ethyl acetate Drugs 0.000 description 123
- 235000019439 ethyl acetate Nutrition 0.000 description 123
- 239000000243 solution Substances 0.000 description 116
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 114
- 238000005481 NMR spectroscopy Methods 0.000 description 108
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 88
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 80
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 69
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- 239000007787 solid Substances 0.000 description 58
- 239000012044 organic layer Substances 0.000 description 44
- 238000003756 stirring Methods 0.000 description 39
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 36
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 36
- 239000011780 sodium chloride Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- 229920006395 saturated elastomer Polymers 0.000 description 35
- 229910001868 water Inorganic materials 0.000 description 30
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 28
- 229910052938 sodium sulfate Inorganic materials 0.000 description 28
- 235000011152 sodium sulphate Nutrition 0.000 description 28
- 239000007832 Na2SO4 Substances 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 25
- 239000000725 suspension Substances 0.000 description 23
- 239000002253 acid Substances 0.000 description 21
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 18
- 235000019341 magnesium sulphate Nutrition 0.000 description 18
- 238000000746 purification Methods 0.000 description 18
- RTQOFJWBJNVJEO-UHFFFAOYSA-N (4-bromo-2-fluorophenyl)methylazanium;chloride Chemical compound Cl.NCC1=CC=C(Br)C=C1F RTQOFJWBJNVJEO-UHFFFAOYSA-N 0.000 description 17
- 238000003820 Medium-pressure liquid chromatography Methods 0.000 description 17
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 16
- 125000000623 heterocyclic group Chemical group 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical class OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 13
- 239000000543 intermediate Substances 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- 238000001816 cooling Methods 0.000 description 12
- 239000000843 powder Substances 0.000 description 12
- 101150041968 CDC13 gene Proteins 0.000 description 11
- MRIXVKKOHPQOFK-UHFFFAOYSA-N 4-methoxysalicylic acid Chemical compound COC1=CC=C(C(O)=O)C(O)=C1 MRIXVKKOHPQOFK-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 10
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- TTZOLDXHOCCNMF-UHFFFAOYSA-N 4-fluoro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1O TTZOLDXHOCCNMF-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 description 9
- 102000016912 Aldehyde Reductase Human genes 0.000 description 8
- 108010053754 Aldehyde reductase Proteins 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- LWXFCZXRFBUOOR-UHFFFAOYSA-N 4-chloro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1O LWXFCZXRFBUOOR-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 102000004316 Oxidoreductases Human genes 0.000 description 6
- 108090000854 Oxidoreductases Proteins 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000003288 aldose reductase inhibitor Substances 0.000 description 6
- 229940090865 aldose reductase inhibitors used in diabetes Drugs 0.000 description 6
- 238000005859 coupling reaction Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000003112 inhibitor Substances 0.000 description 6
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 229960004889 salicylic acid Drugs 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 229960001866 silicon dioxide Drugs 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- DLZXLCHQWOZGSE-UHFFFAOYSA-N (3-nitrophenyl)methylazanium;chloride Chemical compound Cl.NCC1=CC=CC([N+]([O-])=O)=C1 DLZXLCHQWOZGSE-UHFFFAOYSA-N 0.000 description 5
- RLTFBWCBGIZCDQ-UHFFFAOYSA-N (4-bromo-2-fluorophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1F RLTFBWCBGIZCDQ-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- 235000011054 acetic acid Nutrition 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000002648 combination therapy Methods 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 150000004665 fatty acids Chemical class 0.000 description 5
- 239000000796 flavoring agent Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- FCNDTIGRBPWKJB-UHFFFAOYSA-N methyl 5-bromo-4-fluoro-2-methoxybenzoate Chemical compound COC(=O)C1=CC(Br)=C(F)C=C1OC FCNDTIGRBPWKJB-UHFFFAOYSA-N 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 5
- 235000015320 potassium carbonate Nutrition 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000003765 sweetening agent Substances 0.000 description 5
- 125000001544 thienyl group Chemical group 0.000 description 5
- 229940124549 vasodilator Drugs 0.000 description 5
- 239000003071 vasodilator agent Substances 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- SJDBLQBTGDUWEB-UHFFFAOYSA-N 4-fluoro-2-hydroxybenzoyl chloride Chemical compound OC1=CC(F)=CC=C1C(Cl)=O SJDBLQBTGDUWEB-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 4
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- PJURKRPHVUPSAN-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluoro-4-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=C(C)C=C1C(=O)NCC1=CC=C(Br)C=C1F PJURKRPHVUPSAN-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 235000003599 food sweetener Nutrition 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 125000005842 heteroatom Chemical group 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- UOUJAWSLYKLPQS-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-hydroxy-5-methylbenzamide Chemical compound C1=C(F)C(C)=CC(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1O UOUJAWSLYKLPQS-UHFFFAOYSA-N 0.000 description 4
- 230000007823 neuropathy Effects 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 125000004076 pyridyl group Chemical group 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000000600 sorbitol Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 239000000080 wetting agent Substances 0.000 description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 3
- WIFYDCQQZFUIJL-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluoro-4-methylphenoxy]acetic acid Chemical compound C1=C(F)C(C)=CC(C(=O)NCC=2C(=CC(Br)=CC=2)F)=C1OCC(O)=O WIFYDCQQZFUIJL-UHFFFAOYSA-N 0.000 description 3
- JMXDFFYEGLOZLN-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F JMXDFFYEGLOZLN-UHFFFAOYSA-N 0.000 description 3
- HNYMLXYADOZCNY-UHFFFAOYSA-N 2-hydroxy-5-(trifluoromethoxy)benzoic acid Chemical compound OC(=O)C1=CC(OC(F)(F)F)=CC=C1O HNYMLXYADOZCNY-UHFFFAOYSA-N 0.000 description 3
- VHCJSVNQEBEVMO-UHFFFAOYSA-N 2-hydroxy-5-propoxybenzoic acid Chemical compound CCCOC1=CC=C(O)C(C(O)=O)=C1 VHCJSVNQEBEVMO-UHFFFAOYSA-N 0.000 description 3
- VDGDYKMPCCUGGY-UHFFFAOYSA-N 3-[(4-bromo-2-fluorophenyl)methyl]-7-methoxy-1,3-benzoxazine-2,4-dione Chemical compound C=1C(OC)=CC=C(C2=O)C=1OC(=O)N2CC1=CC=C(Br)C=C1F VDGDYKMPCCUGGY-UHFFFAOYSA-N 0.000 description 3
- SVDBAQXYKRERDD-UHFFFAOYSA-N 3-methylbutyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CC(C)CCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 SVDBAQXYKRERDD-UHFFFAOYSA-N 0.000 description 3
- MQLYXCLFKUAMQJ-UHFFFAOYSA-N 4,5,7-trifluoro-2-methyl-1,3-benzothiazole Chemical compound FC1=CC(F)=C2SC(C)=NC2=C1F MQLYXCLFKUAMQJ-UHFFFAOYSA-N 0.000 description 3
- VGHVHAAEFPKLGC-UHFFFAOYSA-N 4-fluoro-2-hydroxy-n-[(3-nitrophenyl)methyl]-5-phenylbenzamide Chemical compound OC1=CC(F)=C(C=2C=CC=CC=2)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 VGHVHAAEFPKLGC-UHFFFAOYSA-N 0.000 description 3
- GBWKCZYUHSAALB-UHFFFAOYSA-N 4-fluoro-2-methoxy-5-methylbenzoic acid Chemical compound COC1=CC(F)=C(C)C=C1C(O)=O GBWKCZYUHSAALB-UHFFFAOYSA-N 0.000 description 3
- AGPGMMDCEXORHU-UHFFFAOYSA-N 4-fluoro-2-methoxy-5-methylbenzonitrile Chemical compound COC1=CC(F)=C(C)C=C1C#N AGPGMMDCEXORHU-UHFFFAOYSA-N 0.000 description 3
- ZQAONLLGBKCQIA-UHFFFAOYSA-N 4-fluoro-2-methoxy-5-morpholin-4-ylbenzoic acid Chemical compound C1=C(C(O)=O)C(OC)=CC(F)=C1N1CCOCC1 ZQAONLLGBKCQIA-UHFFFAOYSA-N 0.000 description 3
- AJOOCGAVXMXLLF-UHFFFAOYSA-N 5-bromo-4-fluoro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(Br)=C(F)C=C1O AJOOCGAVXMXLLF-UHFFFAOYSA-N 0.000 description 3
- DHLRZZROPUQGLE-UHFFFAOYSA-N 5-cyano-4-fluoro-2-methoxybenzoic acid Chemical compound COC1=CC(F)=C(C#N)C=C1C(O)=O DHLRZZROPUQGLE-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- 206010007749 Cataract diabetic Diseases 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 3
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 208000017442 Retinal disease Diseases 0.000 description 3
- 206010038923 Retinopathy Diseases 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 3
- 229960005069 calcium Drugs 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 201000007025 diabetic cataract Diseases 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- BRQUQDPDYGZFHV-UHFFFAOYSA-N ethyl 2-[4-bromo-2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC=C(Br)C=C1C(=O)NCC1=CC=C(Br)C=C1F BRQUQDPDYGZFHV-UHFFFAOYSA-N 0.000 description 3
- 235000013355 food flavoring agent Nutrition 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- FBPFZTCFMRRESA-UHFFFAOYSA-N hexane-1,2,3,4,5,6-hexol Chemical compound OCC(O)C(O)C(O)C(O)CO FBPFZTCFMRRESA-UHFFFAOYSA-N 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 229940057995 liquid paraffin Drugs 0.000 description 3
- POKDIMSCQLGJQE-UHFFFAOYSA-N methyl 2-hydroxy-5-prop-2-enoxybenzoate Chemical compound COC(=O)C1=CC(OCC=C)=CC=C1O POKDIMSCQLGJQE-UHFFFAOYSA-N 0.000 description 3
- KBBBDZRTEJJXDW-UHFFFAOYSA-N methyl 4-fluoro-2-methoxy-5-morpholin-4-ylbenzoate Chemical compound C1=C(OC)C(C(=O)OC)=CC(N2CCOCC2)=C1F KBBBDZRTEJJXDW-UHFFFAOYSA-N 0.000 description 3
- MRCLDOBIXNDRPL-UHFFFAOYSA-N methyl 4-fluoro-2-methoxy-5-phenylbenzoate Chemical compound C1=C(OC)C(C(=O)OC)=CC(C=2C=CC=CC=2)=C1F MRCLDOBIXNDRPL-UHFFFAOYSA-N 0.000 description 3
- QAKBRDYVORNEJW-UHFFFAOYSA-N octyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CCCCCCCCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 QAKBRDYVORNEJW-UHFFFAOYSA-N 0.000 description 3
- 239000004006 olive oil Substances 0.000 description 3
- 235000008390 olive oil Nutrition 0.000 description 3
- 230000036961 partial effect Effects 0.000 description 3
- 238000012552 review Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- CIUYJYRQKYGNQP-UHFFFAOYSA-N (3-nitrophenyl)methanamine Chemical compound NCC1=CC=CC([N+]([O-])=O)=C1 CIUYJYRQKYGNQP-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- YSZMPUHDCYUHMM-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-chlorophenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(Cl)C=C1C(=O)NCC1=CC=C(Br)C=C1F YSZMPUHDCYUHMM-UHFFFAOYSA-N 0.000 description 2
- GICVZCQDVFVIOE-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-methylsulfanylphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(SC)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F GICVZCQDVFVIOE-UHFFFAOYSA-N 0.000 description 2
- YJJIWTLISGTJJD-UHFFFAOYSA-N 2-[4-bromo-2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(Br)C=C1C(=O)NCC1=CC=C(Br)C=C1F YJJIWTLISGTJJD-UHFFFAOYSA-N 0.000 description 2
- RREODNYNAPILHF-UHFFFAOYSA-N 2-amino-3,4,6-trifluorobenzenethiol;hydrochloride Chemical compound Cl.NC1=C(F)C(F)=CC(F)=C1S RREODNYNAPILHF-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- FKWWBYTUEOSJCJ-UHFFFAOYSA-N 4,6-difluoro-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid Chemical compound OC(=O)C1C=CC(F)=CC1(O)F FKWWBYTUEOSJCJ-UHFFFAOYSA-N 0.000 description 2
- BSADKPVNUKJJRM-UHFFFAOYSA-N 4-fluoro-2-hydroxy-n-[(3-nitrophenyl)methyl]benzamide Chemical compound OC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 BSADKPVNUKJJRM-UHFFFAOYSA-N 0.000 description 2
- AENLWCZPYXRVIC-UHFFFAOYSA-N 4-fluoro-2-hydroxy-n-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]benzamide Chemical compound OC1=CC(F)=CC=C1C(=O)NCC1=NC2=C(F)C(F)=CC(F)=C2S1 AENLWCZPYXRVIC-UHFFFAOYSA-N 0.000 description 2
- BNELZNXETORJHL-UHFFFAOYSA-N 4-fluoro-2-methoxy-5-methylaniline Chemical compound COC1=CC(F)=C(C)C=C1N BNELZNXETORJHL-UHFFFAOYSA-N 0.000 description 2
- UAYBZGPPKNZTPR-UHFFFAOYSA-N 4-fluoro-2-methoxy-5-phenylbenzoic acid Chemical compound C1=C(C(O)=O)C(OC)=CC(F)=C1C1=CC=CC=C1 UAYBZGPPKNZTPR-UHFFFAOYSA-N 0.000 description 2
- UKOPBOUVEJMKNZ-UHFFFAOYSA-N 4-fluoro-2-methoxy-n-[(3-nitrophenyl)methyl]-5-phenylbenzamide Chemical compound COC1=CC(F)=C(C=2C=CC=CC=2)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 UKOPBOUVEJMKNZ-UHFFFAOYSA-N 0.000 description 2
- NJESAXZANHETJV-UHFFFAOYSA-N 4-methylsalicylic acid Chemical compound CC1=CC=C(C(O)=O)C(O)=C1 NJESAXZANHETJV-UHFFFAOYSA-N 0.000 description 2
- NANJQJRZYOVMLF-UHFFFAOYSA-N 5-chloro-2-hydroxybenzoyl chloride Chemical compound OC1=CC=C(Cl)C=C1C(Cl)=O NANJQJRZYOVMLF-UHFFFAOYSA-N 0.000 description 2
- NKBASRXWGAGQDP-UHFFFAOYSA-N 5-chlorosalicylic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1O NKBASRXWGAGQDP-UHFFFAOYSA-N 0.000 description 2
- GHDKGBKSHXMSSN-UHFFFAOYSA-N 5-cyano-4-fluoro-2-hydroxy-n-[(3-nitrophenyl)methyl]benzamide Chemical compound OC1=CC(F)=C(C#N)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 GHDKGBKSHXMSSN-UHFFFAOYSA-N 0.000 description 2
- XHYNRWNMTVZKQJ-UHFFFAOYSA-N 5-cyano-4-fluoro-2-methoxy-n-[(3-nitrophenyl)methyl]benzamide Chemical compound COC1=CC(F)=C(C#N)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 XHYNRWNMTVZKQJ-UHFFFAOYSA-N 0.000 description 2
- IZZIWIAOVZOBLF-UHFFFAOYSA-N 5-methoxysalicylic acid Chemical compound COC1=CC=C(O)C(C(O)=O)=C1 IZZIWIAOVZOBLF-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- 235000006491 Acacia senegal Nutrition 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 235000003911 Arachis Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 229910015845 BBr3 Inorganic materials 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 229920002274 Nalgene Polymers 0.000 description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- YASAKCUCGLMORW-UHFFFAOYSA-N Rosiglitazone Chemical compound C=1C=CC=NC=1N(C)CCOC(C=C1)=CC=C1CC1SC(=O)NC1=O YASAKCUCGLMORW-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000006619 Stille reaction Methods 0.000 description 2
- 238000006069 Suzuki reaction reaction Methods 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001323 aldoses Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000011260 aqueous acid Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000005620 boronic acid group Chemical class 0.000 description 2
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 229960001714 calcium phosphate Drugs 0.000 description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- OQKUQWVLTYDYFD-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-hydroxyphenoxy]acetate Chemical compound CCOC(=O)COC1=CC=C(O)C=C1C(=O)NCC1=CC=C(Br)C=C1F OQKUQWVLTYDYFD-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 2
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 2
- 208000017169 kidney disease Diseases 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- IIFCLXHRIYTHPV-UHFFFAOYSA-N methyl 2,4-dihydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C=C1O IIFCLXHRIYTHPV-UHFFFAOYSA-N 0.000 description 2
- FZKQUEIVRVGCHM-UHFFFAOYSA-N methyl 5-cyano-4-fluoro-2-methoxybenzoate Chemical compound COC(=O)C1=CC(C#N)=C(F)C=C1OC FZKQUEIVRVGCHM-UHFFFAOYSA-N 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- YCTDEDCOOLZRHU-UHFFFAOYSA-N n-(cyanomethyl)-4-fluoro-2-hydroxybenzamide Chemical class OC1=CC(F)=CC=C1C(=O)NCC#N YCTDEDCOOLZRHU-UHFFFAOYSA-N 0.000 description 2
- BYLJANABWJGKNV-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-2-hydroxy-5-nitrobenzamide Chemical compound OC1=CC=C([N+]([O-])=O)C=C1C(=O)NCC1=CC=C(Br)C=C1F BYLJANABWJGKNV-UHFFFAOYSA-N 0.000 description 2
- FLRCDMKZLOVNRJ-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-hydroxy-5-morpholin-4-ylbenzamide Chemical compound OC1=CC(F)=C(N2CCOCC2)C=C1C(=O)NCC1=CC=C(Br)C=C1F FLRCDMKZLOVNRJ-UHFFFAOYSA-N 0.000 description 2
- IYSUXBHYASIRHW-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-methoxy-5-methylbenzamide Chemical compound COC1=CC(F)=C(C)C=C1C(=O)NCC1=CC=C(Br)C=C1F IYSUXBHYASIRHW-UHFFFAOYSA-N 0.000 description 2
- KQIBSMPOHVEZSP-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-4-fluoro-2-methoxy-5-morpholin-4-ylbenzamide Chemical compound COC1=CC(F)=C(N2CCOCC2)C=C1C(=O)NCC1=CC=C(Br)C=C1F KQIBSMPOHVEZSP-UHFFFAOYSA-N 0.000 description 2
- 201000001119 neuropathy Diseases 0.000 description 2
- 125000005004 perfluoroethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 2
- 208000033808 peripheral neuropathy Diseases 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- HYAFETHFCAUJAY-UHFFFAOYSA-N pioglitazone Chemical compound N1=CC(CC)=CC=C1CCOC(C=C1)=CC=C1CC1C(=O)NC(=O)S1 HYAFETHFCAUJAY-UHFFFAOYSA-N 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 229960000819 sodium nitrite Drugs 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000000967 suction filtration Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- CCRMAATUKBYMPA-UHFFFAOYSA-N trimethyltin Chemical compound C[Sn](C)C.C[Sn](C)C CCRMAATUKBYMPA-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 230000029663 wound healing Effects 0.000 description 2
- DATZDABHSKRABS-UHFFFAOYSA-N (2,6-difluorophenyl)methanamine;hydrochloride Chemical compound Cl.NCC1=C(F)C=CC=C1F DATZDABHSKRABS-UHFFFAOYSA-N 0.000 description 1
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- IXHNFOOSLAWRBQ-UHFFFAOYSA-N (3,4-dichlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C(Cl)=C1 IXHNFOOSLAWRBQ-UHFFFAOYSA-N 0.000 description 1
- YGZJTYCCONJJGZ-UHFFFAOYSA-N (3,5-dimethoxyphenyl)methanamine Chemical compound COC1=CC(CN)=CC(OC)=C1 YGZJTYCCONJJGZ-UHFFFAOYSA-N 0.000 description 1
- QVSVMNXRLWSNGS-UHFFFAOYSA-N (3-fluorophenyl)methanamine Chemical compound NCC1=CC=CC(F)=C1 QVSVMNXRLWSNGS-UHFFFAOYSA-N 0.000 description 1
- ZGGHKIMDNBDHJB-NRFPMOEYSA-M (3R,5S)-fluvastatin sodium Chemical compound [Na+].C12=CC=CC=C2N(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 ZGGHKIMDNBDHJB-NRFPMOEYSA-M 0.000 description 1
- XRNVSPDQTPVECU-UHFFFAOYSA-N (4-bromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1 XRNVSPDQTPVECU-UHFFFAOYSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- COWZNYTZVVEEKO-UHFFFAOYSA-N (4-methoxyphenyl)methylazanium;chloride Chemical compound Cl.COC1=CC=C(CN)C=C1 COWZNYTZVVEEKO-UHFFFAOYSA-N 0.000 description 1
- KPOKOEWRTGFXDF-UHFFFAOYSA-N (5-bromo-2-fluorophenyl)methanamine;hydrochloride Chemical compound Cl.NCC1=CC(Br)=CC=C1F KPOKOEWRTGFXDF-UHFFFAOYSA-N 0.000 description 1
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 description 1
- 125000006528 (C2-C6) alkyl group Chemical group 0.000 description 1
- 125000006529 (C3-C6) alkyl group Chemical group 0.000 description 1
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- ZORQXIQZAOLNGE-UHFFFAOYSA-N 1,1-difluorocyclohexane Chemical compound FC1(F)CCCCC1 ZORQXIQZAOLNGE-UHFFFAOYSA-N 0.000 description 1
- ZILSBZLQGRBMOR-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethanamine Chemical compound NCC1=CC=C2OCOC2=C1 ZILSBZLQGRBMOR-UHFFFAOYSA-N 0.000 description 1
- JHHKWHVDJFQNNG-UHFFFAOYSA-N 1-bromo-4-fluoro-2-methoxy-5-methylbenzene Chemical compound COC1=CC(F)=C(C)C=C1Br JHHKWHVDJFQNNG-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- SJZATRRXUILGHH-UHFFFAOYSA-N 2,4,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=C(F)C=C1F SJZATRRXUILGHH-UHFFFAOYSA-N 0.000 description 1
- NJYBIFYEWYWYAN-UHFFFAOYSA-N 2,4-difluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1F NJYBIFYEWYWYAN-UHFFFAOYSA-N 0.000 description 1
- XUZLFWSITDPGPS-UHFFFAOYSA-N 2-(trifluoromethyl)benzenethiol hydrochloride Chemical compound Cl.FC(F)(F)C1=C(C=CC=C1)S XUZLFWSITDPGPS-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UTPMSWHUAYAZNH-UHFFFAOYSA-N 2-[2-[(3-nitrophenyl)methylcarbamothioyl]-4-(trifluoromethoxy)phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(OC(F)(F)F)C=C1C(=S)NCC1=CC=CC([N+]([O-])=O)=C1 UTPMSWHUAYAZNH-UHFFFAOYSA-N 0.000 description 1
- ZIPBDIIFUHDMMA-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamothioyl]-4-(trifluoromethoxy)phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(OC(F)(F)F)C=C1C(=S)NCC1=CC=C(Br)C=C1F ZIPBDIIFUHDMMA-UHFFFAOYSA-N 0.000 description 1
- WGSGKZOGUIHMBP-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-4-(trifluoromethyl)phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=C(C(F)(F)F)C=C1C(=O)NCC1=CC=C(Br)C=C1F WGSGKZOGUIHMBP-UHFFFAOYSA-N 0.000 description 1
- ZHTNQUJELPSJHR-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluoro-4-morpholin-4-ylphenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(N2CCOCC2)C=C1C(=O)NCC1=CC=C(Br)C=C1F ZHTNQUJELPSJHR-UHFFFAOYSA-N 0.000 description 1
- ZOVORMKZRSIBOR-UHFFFAOYSA-N 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=CC=C1C(=O)NCC1=CC=C(Br)C=C1F ZOVORMKZRSIBOR-UHFFFAOYSA-N 0.000 description 1
- DILISPNYIVRDBP-UHFFFAOYSA-N 2-[3-[2-(2-hydroxypropylamino)pyrimidin-4-yl]-2-naphthalen-2-ylimidazol-4-yl]acetonitrile Chemical compound OC(CNC1=NC=CC(=N1)N1C(=NC=C1CC#N)C1=CC2=CC=CC=C2C=C1)C DILISPNYIVRDBP-UHFFFAOYSA-N 0.000 description 1
- VYKFJTVDUDKMGQ-UHFFFAOYSA-N 2-[4-cyano-5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COc1cc(F)c(cc1C(=O)NCc1cccc(c1)[N+]([O-])=O)C#N.OC(=O)COc1cc(F)c(cc1C(=O)NCc1cccc(c1)[N+]([O-])=O)C#N VYKFJTVDUDKMGQ-UHFFFAOYSA-N 0.000 description 1
- HXSRZGGMRLUEJZ-UHFFFAOYSA-N 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]-4-phenylphenoxy]acetic acid Chemical compound OC(=O)COc1cc(F)c(cc1C(=O)NCc1cccc(c1)[N+]([O-])=O)-c1ccccc1.OC(=O)COc1cc(F)c(cc1C(=O)NCc1cccc(c1)[N+]([O-])=O)-c1ccccc1 HXSRZGGMRLUEJZ-UHFFFAOYSA-N 0.000 description 1
- USZZMEVMIKRDPR-UHFFFAOYSA-N 2-[5-fluoro-4-morpholin-4-yl-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC(F)=C(N2CCOCC2)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 USZZMEVMIKRDPR-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- ATACSYDDCNWCLV-UHFFFAOYSA-N 2-chloroacetic acid;sodium Chemical compound [Na].OC(=O)CCl ATACSYDDCNWCLV-UHFFFAOYSA-N 0.000 description 1
- RVTCUVDRZGLPGP-UHFFFAOYSA-N 2-ethylhexyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CCCCC(CC)COC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 RVTCUVDRZGLPGP-UHFFFAOYSA-N 0.000 description 1
- QZBQQHUYQKGPLQ-UHFFFAOYSA-N 2-ethylhexyl 2-chloroacetate Chemical compound CCCCC(CC)COC(=O)CCl QZBQQHUYQKGPLQ-UHFFFAOYSA-N 0.000 description 1
- OCIYTBZXTFPSPI-UHFFFAOYSA-N 2-fluoro-4-(trifluoromethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(C(F)(F)F)C=C1F OCIYTBZXTFPSPI-UHFFFAOYSA-N 0.000 description 1
- WQUZBERVMUEJTD-UHFFFAOYSA-N 2-hydroxy-5-(trifluoromethoxy)benzaldehyde Chemical compound OC1=CC=C(OC(F)(F)F)C=C1C=O WQUZBERVMUEJTD-UHFFFAOYSA-N 0.000 description 1
- AAUQLHHARJUJEH-UHFFFAOYSA-N 2-hydroxy-5-methoxybenzoic acid Natural products COC1=CC=CC(O)=C1C(O)=O AAUQLHHARJUJEH-UHFFFAOYSA-N 0.000 description 1
- DLGBEGBHXSAQOC-UHFFFAOYSA-N 2-hydroxy-5-methylbenzoic acid Chemical compound CC1=CC=C(O)C(C(O)=O)=C1 DLGBEGBHXSAQOC-UHFFFAOYSA-N 0.000 description 1
- UOPCPHJGGRTYNC-UHFFFAOYSA-N 2-methoxy-4-methylsulfanylbenzoic acid Chemical compound COC1=CC(SC)=CC=C1C(O)=O UOPCPHJGGRTYNC-UHFFFAOYSA-N 0.000 description 1
- FGYYIVKAIAIAAO-UHFFFAOYSA-N 2-methoxyethyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound COCCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 FGYYIVKAIAIAAO-UHFFFAOYSA-N 0.000 description 1
- SVLBINWLZIVRJX-UHFFFAOYSA-N 2-methoxyethyl 2-chloroacetate Chemical compound COCCOC(=O)CCl SVLBINWLZIVRJX-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- PGHNTDHYQFRGFY-UHFFFAOYSA-N 3-amino-5-(trifluoromethyl)benzenethiol;hydrochloride Chemical compound Cl.NC1=CC(S)=CC(C(F)(F)F)=C1 PGHNTDHYQFRGFY-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- IEJOONSLOGAXNO-UHFFFAOYSA-N 5-bromo-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1O IEJOONSLOGAXNO-UHFFFAOYSA-N 0.000 description 1
- PEIGETRPPZVBHT-UHFFFAOYSA-N 5-methoxy-2-methyl-4-nitroaniline Chemical compound COC1=CC(N)=C(C)C=C1[N+]([O-])=O PEIGETRPPZVBHT-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- FDVBHUXZXNQCCM-UHFFFAOYSA-N 6,6-ditert-butyl-4-methylcyclohexa-2,4-dien-1-ol Chemical compound CC1=CC(C(C)(C)C)(C(C)(C)C)C(O)C=C1 FDVBHUXZXNQCCM-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 102000008873 Angiotensin II receptor Human genes 0.000 description 1
- 108050000824 Angiotensin II receptor Proteins 0.000 description 1
- XUKUURHRXDUEBC-KAYWLYCHSA-N Atorvastatin Chemical compound C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CC[C@@H](O)C[C@@H](O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-KAYWLYCHSA-N 0.000 description 1
- XUKUURHRXDUEBC-UHFFFAOYSA-N Atorvastatin Natural products C=1C=CC=CC=1C1=C(C=2C=CC(F)=CC=2)N(CCC(O)CC(O)CC(O)=O)C(C(C)C)=C1C(=O)NC1=CC=CC=C1 XUKUURHRXDUEBC-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 239000002083 C09CA01 - Losartan Substances 0.000 description 1
- 239000004072 C09CA03 - Valsartan Substances 0.000 description 1
- 239000002947 C09CA04 - Irbesartan Substances 0.000 description 1
- GAUCPQAWWFIAJV-UHFFFAOYSA-N CC(C)CCC(Cl)C(O)=O Chemical compound CC(C)CCC(Cl)C(O)=O GAUCPQAWWFIAJV-UHFFFAOYSA-N 0.000 description 1
- VRZYTJVHYGTHDR-UHFFFAOYSA-N CCOC(=O)COC1=CC(F)=C(C=2C=CC=CC=2)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 Chemical compound CCOC(=O)COC1=CC(F)=C(C=2C=CC=CC=2)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 VRZYTJVHYGTHDR-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 206010007559 Cardiac failure congestive Diseases 0.000 description 1
- KPSRODZRAIWAKH-JTQLQIEISA-N Ciprofibrate Natural products C1=CC(OC(C)(C)C(O)=O)=CC=C1[C@H]1C(Cl)(Cl)C1 KPSRODZRAIWAKH-JTQLQIEISA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 208000007342 Diabetic Nephropathies Diseases 0.000 description 1
- 208000032781 Diabetic cardiomyopathy Diseases 0.000 description 1
- 206010012689 Diabetic retinopathy Diseases 0.000 description 1
- 206010012692 Diabetic uveitis Diseases 0.000 description 1
- 101100391174 Dictyostelium discoideum forC gene Proteins 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 208000010201 Exanthema Diseases 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- HEMJJKBWTPKOJG-UHFFFAOYSA-N Gemfibrozil Chemical compound CC1=CC=C(C)C(OCCCC(C)(C)C(O)=O)=C1 HEMJJKBWTPKOJG-UHFFFAOYSA-N 0.000 description 1
- FAEKWTJYAYMJKF-QHCPKHFHSA-N GlucoNorm Chemical compound C1=C(C(O)=O)C(OCC)=CC(CC(=O)N[C@@H](CC(C)C)C=2C(=CC=CC=2)N2CCCCC2)=C1 FAEKWTJYAYMJKF-QHCPKHFHSA-N 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 229940121710 HMGCoA reductase inhibitor Drugs 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 101000836540 Homo sapiens Aldo-keto reductase family 1 member B1 Proteins 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 229940124761 MMP inhibitor Drugs 0.000 description 1
- IBAQFPQHRJAVAV-ULAWRXDQSA-N Miglitol Chemical compound OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO IBAQFPQHRJAVAV-ULAWRXDQSA-N 0.000 description 1
- PCZOHLXUXFIOCF-UHFFFAOYSA-N Monacolin X Natural products C12C(OC(=O)C(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 PCZOHLXUXFIOCF-UHFFFAOYSA-N 0.000 description 1
- 101100384355 Mus musculus Ctnnbip1 gene Proteins 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N Pd(PPh3)4 Substances [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 229910002666 PdCl2 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- TUZYXOIXSAXUGO-UHFFFAOYSA-N Pravastatin Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(O)C=C21 TUZYXOIXSAXUGO-UHFFFAOYSA-N 0.000 description 1
- 229940123924 Protein kinase C inhibitor Drugs 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- RYMZZMVNJRMUDD-UHFFFAOYSA-N SJ000286063 Natural products C12C(OC(=O)C(C)(C)CC)CC(C)C=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 RYMZZMVNJRMUDD-UHFFFAOYSA-N 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- ZSJLQEPLLKMAKR-UHFFFAOYSA-N Streptozotocin Natural products O=NN(C)C(=O)NC1C(O)OC(CO)C(O)C1O ZSJLQEPLLKMAKR-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- YKNZTUQUXUXTLE-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(C(F)(F)F)=C1 YKNZTUQUXUXTLE-UHFFFAOYSA-N 0.000 description 1
- ADHUUMWSWNPEMZ-UHFFFAOYSA-N [3-fluoro-5-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC(F)=CC(C(F)(F)F)=C1 ADHUUMWSWNPEMZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229960002632 acarbose Drugs 0.000 description 1
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- PWUBONDMIMDOQY-UHFFFAOYSA-N acetonitrile;hydrochloride Chemical compound Cl.CC#N PWUBONDMIMDOQY-UHFFFAOYSA-N 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 239000005456 alcohol based solvent Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 239000003888 alpha glucosidase inhibitor Substances 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229940035674 anesthetics Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 125000005418 aryl aryl group Chemical group 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 238000011914 asymmetric synthesis Methods 0.000 description 1
- 229960005370 atorvastatin Drugs 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N bensulfuron-methyl Chemical compound COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- KXNQKOAQSGJCQU-UHFFFAOYSA-N benzo[e][1,3]benzothiazole Chemical compound C1=CC=C2C(N=CS3)=C3C=CC2=C1 KXNQKOAQSGJCQU-UHFFFAOYSA-N 0.000 description 1
- WMUIZUWOEIQJEH-UHFFFAOYSA-N benzo[e][1,3]benzoxazole Chemical compound C1=CC=C2C(N=CO3)=C3C=CC2=C1 WMUIZUWOEIQJEH-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 1
- 125000004540 benzothiazol-5-yl group Chemical group S1C=NC2=C1C=CC(=C2)* 0.000 description 1
- 229960000516 bezafibrate Drugs 0.000 description 1
- IIBYAHWJQTYFKB-UHFFFAOYSA-N bezafibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1CCNC(=O)C1=CC=C(Cl)C=C1 IIBYAHWJQTYFKB-UHFFFAOYSA-N 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- XWTRLCQXBZHASU-UHFFFAOYSA-N butyl 2-[5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CCCCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 XWTRLCQXBZHASU-UHFFFAOYSA-N 0.000 description 1
- YJRGMUWRPCPLNH-UHFFFAOYSA-N butyl 2-chloroacetate Chemical compound CCCCOC(=O)CCl YJRGMUWRPCPLNH-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 229960005110 cerivastatin Drugs 0.000 description 1
- SEERZIQQUAZTOL-ANMDKAQQSA-N cerivastatin Chemical compound COCC1=C(C(C)C)N=C(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC(O)=O)=C1C1=CC=C(F)C=C1 SEERZIQQUAZTOL-ANMDKAQQSA-N 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229960002174 ciprofibrate Drugs 0.000 description 1
- KPSRODZRAIWAKH-UHFFFAOYSA-N ciprofibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1C1C(Cl)(Cl)C1 KPSRODZRAIWAKH-UHFFFAOYSA-N 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 210000000695 crystalline len Anatomy 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- IBFHBLOKQVCABG-UHFFFAOYSA-N cyclohexyl 2-chloroacetate Chemical compound ClCC(=O)OC1CCCCC1 IBFHBLOKQVCABG-UHFFFAOYSA-N 0.000 description 1
- QQKNSPHAFATFNQ-UHFFFAOYSA-N darglitazone Chemical compound CC=1OC(C=2C=CC=CC=2)=NC=1CCC(=O)C(C=C1)=CC=C1CC1SC(=O)NC1=O QQKNSPHAFATFNQ-UHFFFAOYSA-N 0.000 description 1
- 229950006689 darglitazone Drugs 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 208000033679 diabetic kidney disease Diseases 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 1
- 239000000890 drug combination Substances 0.000 description 1
- 208000017574 dry cough Diseases 0.000 description 1
- 239000003974 emollient agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- VDDXQSUSMHZCLS-UHFFFAOYSA-N ethenyl trifluoromethanesulfonate Chemical class FC(F)(F)S(=O)(=O)OC=C VDDXQSUSMHZCLS-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- ZLQFPAUWSNJZCN-UHFFFAOYSA-N ethyl 2-[2-[(2-fluorophenyl)methylcarbamoyl]-4-propoxyphenoxy]acetate Chemical compound CCCOC1=CC=C(OCC(=O)OCC)C(C(=O)NCC=2C(=CC=CC=2)F)=C1 ZLQFPAUWSNJZCN-UHFFFAOYSA-N 0.000 description 1
- URGNQYFLFRGDOM-UHFFFAOYSA-N ethyl 2-[2-[(4-bromo-2-fluorophenyl)methylcarbamoyl]-5-fluorophenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F URGNQYFLFRGDOM-UHFFFAOYSA-N 0.000 description 1
- LYGHQUXAVDJQOC-UHFFFAOYSA-N ethyl 2-[2-[benzyl(fluoro)carbamoyl]-4-propoxyphenoxy]acetate Chemical compound CCCOC1=CC=C(OCC(=O)OCC)C(C(=O)N(F)CC=2C=CC=CC=2)=C1 LYGHQUXAVDJQOC-UHFFFAOYSA-N 0.000 description 1
- GAOLOQCSMNEVHA-UHFFFAOYSA-N ethyl 2-[4-cyano-5-fluoro-2-[(3-nitrophenyl)methylcarbamoyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=CC(F)=C(C#N)C=C1C(=O)NCC1=CC=CC([N+]([O-])=O)=C1 GAOLOQCSMNEVHA-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 201000005884 exanthem Diseases 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229960002297 fenofibrate Drugs 0.000 description 1
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 1
- 229940125753 fibrate Drugs 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 229960003765 fluvastatin Drugs 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 229960003627 gemfibrozil Drugs 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- WIGIZIANZCJQQY-RUCARUNLSA-N glimepiride Chemical compound O=C1C(CC)=C(C)CN1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)N[C@@H]2CC[C@@H](C)CC2)C=C1 WIGIZIANZCJQQY-RUCARUNLSA-N 0.000 description 1
- 229960004346 glimepiride Drugs 0.000 description 1
- ZJJXGWJIGJFDTL-UHFFFAOYSA-N glipizide Chemical compound C1=NC(C)=CN=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZJJXGWJIGJFDTL-UHFFFAOYSA-N 0.000 description 1
- 229960001381 glipizide Drugs 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000002471 hydroxymethylglutaryl coenzyme A reductase inhibitor Substances 0.000 description 1
- 201000001421 hyperglycemia Diseases 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 1
- 229960000367 inositol Drugs 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 229940125396 insulin Drugs 0.000 description 1
- 230000037041 intracellular level Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229960002198 irbesartan Drugs 0.000 description 1
- YCPOHTHPUREGFM-UHFFFAOYSA-N irbesartan Chemical compound O=C1N(CC=2C=CC(=CC=2)C=2C(=CC=CC=2)C=2[N]N=NN=2)C(CCCC)=NC21CCCC2 YCPOHTHPUREGFM-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 206010023365 keratopathy Diseases 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003446 ligand Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229960004773 losartan Drugs 0.000 description 1
- KJJZZJSZUJXYEA-UHFFFAOYSA-N losartan Chemical compound CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=2C(=CC=CC=2)C=2[N]N=NN=2)C=C1 KJJZZJSZUJXYEA-UHFFFAOYSA-N 0.000 description 1
- 229960004844 lovastatin Drugs 0.000 description 1
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 description 1
- QLJODMDSTUBWDW-UHFFFAOYSA-N lovastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CC(C)C=C21 QLJODMDSTUBWDW-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 1
- 229960003105 metformin Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 description 1
- 229960001110 miglitol Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- VQXVBMDJNYKKTM-UHFFFAOYSA-N n-(2-bromophenyl)-2-(4-fluorophenoxy)propanamide Chemical compound C=1C=CC=C(Br)C=1NC(=O)C(C)OC1=CC=C(F)C=C1 VQXVBMDJNYKKTM-UHFFFAOYSA-N 0.000 description 1
- YBTCEXFXKMSNNW-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-2-hydroxy-4-methoxybenzamide Chemical compound OC1=CC(OC)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F YBTCEXFXKMSNNW-UHFFFAOYSA-N 0.000 description 1
- KDVIKYLMTHIRMW-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-2-hydroxy-4-methylsulfanylbenzamide Chemical compound OC1=CC(SC)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F KDVIKYLMTHIRMW-UHFFFAOYSA-N 0.000 description 1
- HJKMWCZPFRDKOR-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-2-methoxy-4-methylsulfanylbenzamide Chemical compound COC1=CC(SC)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F HJKMWCZPFRDKOR-UHFFFAOYSA-N 0.000 description 1
- VZJROVUTHONRGF-UHFFFAOYSA-N n-[(4-bromo-2-fluorophenyl)methyl]-4-chloro-2-hydroxybenzamide Chemical compound OC1=CC(Cl)=CC=C1C(=O)NCC1=CC=C(Br)C=C1F VZJROVUTHONRGF-UHFFFAOYSA-N 0.000 description 1
- 210000005036 nerve Anatomy 0.000 description 1
- 208000004235 neutropenia Diseases 0.000 description 1
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 1
- BOPGDPNILDQYTO-NNYOXOHSSA-N nicotinamide-adenine dinucleotide Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NNYOXOHSSA-N 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- GYCKQBWUSACYIF-UHFFFAOYSA-N o-hydroxybenzoic acid ethyl ester Natural products CCOC(=O)C1=CC=CC=C1O GYCKQBWUSACYIF-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- NNXMXUSTTDFBDE-UHFFFAOYSA-N octyl 2-chloroacetate Chemical compound CCCCCCCCOC(=O)CCl NNXMXUSTTDFBDE-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 229960005095 pioglitazone Drugs 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 229960002965 pravastatin Drugs 0.000 description 1
- TUZYXOIXSAXUGO-PZAWKZKUSA-N pravastatin Chemical compound C1=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(O)=O)[C@H]2[C@@H](OC(=O)[C@@H](C)CC)C[C@H](O)C=C21 TUZYXOIXSAXUGO-PZAWKZKUSA-N 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 239000003881 protein kinase C inhibitor Substances 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 229960002354 repaglinide Drugs 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 210000001525 retina Anatomy 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 229960004586 rosiglitazone Drugs 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 210000003497 sciatic nerve Anatomy 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229960002855 simvastatin Drugs 0.000 description 1
- RYMZZMVNJRMUDD-HGQWONQESA-N simvastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)C(C)(C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 RYMZZMVNJRMUDD-HGQWONQESA-N 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000001593 sorbitan monooleate Substances 0.000 description 1
- 235000011069 sorbitan monooleate Nutrition 0.000 description 1
- 229940035049 sorbitan monooleate Drugs 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- ZSJLQEPLLKMAKR-GKHCUFPYSA-N streptozocin Chemical compound O=NN(C)C(=O)N[C@H]1[C@@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O ZSJLQEPLLKMAKR-GKHCUFPYSA-N 0.000 description 1
- 229960001052 streptozocin Drugs 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- KDZASNPOEXNJBZ-UHFFFAOYSA-N thieno[2,3-d][1,2]thiazole Chemical compound S1N=CC2=C1C=CS2 KDZASNPOEXNJBZ-UHFFFAOYSA-N 0.000 description 1
- ONCNIMLKGZSAJT-UHFFFAOYSA-N thieno[3,2-b]furan Chemical compound S1C=CC2=C1C=CO2 ONCNIMLKGZSAJT-UHFFFAOYSA-N 0.000 description 1
- VJYJJHQEVLEOFL-UHFFFAOYSA-N thieno[3,2-b]thiophene Chemical compound S1C=CC2=C1C=CS2 VJYJJHQEVLEOFL-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- LUBHDINQXIHVLS-UHFFFAOYSA-N tolrestat Chemical compound OC(=O)CN(C)C(=S)C1=CC=CC2=C(C(F)(F)F)C(OC)=CC=C21 LUBHDINQXIHVLS-UHFFFAOYSA-N 0.000 description 1
- 229960003069 tolrestat Drugs 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- OVCXRBARSPBVMC-UHFFFAOYSA-N triazolopyridine Chemical compound C=1N2C(C(C)C)=NN=C2C=CC=1C=1OC=NC=1C1=CC=C(F)C=C1 OVCXRBARSPBVMC-UHFFFAOYSA-N 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- AISMNBXOJRHCIA-UHFFFAOYSA-N trimethylazanium;bromide Chemical compound Br.CN(C)C AISMNBXOJRHCIA-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- GXPHKUHSUJUWKP-UHFFFAOYSA-N troglitazone Chemical compound C1CC=2C(C)=C(O)C(C)=C(C)C=2OC1(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O GXPHKUHSUJUWKP-UHFFFAOYSA-N 0.000 description 1
- 229960001641 troglitazone Drugs 0.000 description 1
- GXPHKUHSUJUWKP-NTKDMRAZSA-N troglitazone Natural products C([C@@]1(OC=2C(C)=C(C(=C(C)C=2CC1)O)C)C)OC(C=C1)=CC=C1C[C@H]1SC(=O)NC1=O GXPHKUHSUJUWKP-NTKDMRAZSA-N 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- 229960004699 valsartan Drugs 0.000 description 1
- SJSNUMAYCRRIOM-QFIPXVFZSA-N valsartan Chemical compound C1=CC(CN(C(=O)CCCC)[C@@H](C(C)C)C(O)=O)=CC=C1C1=CC=CC=C1C1=NN=N[N]1 SJSNUMAYCRRIOM-QFIPXVFZSA-N 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/60—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/30—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having the nitrogen atom of the carboxamide group bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/28—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton
- C07C237/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atom of at least one of the carboxamide groups bound to a carbon atom of a non-condensed six-membered aromatic ring of the carbon skeleton having carbon atoms of carboxamide groups, amino groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/57—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and carboxyl groups, other than cyano groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/44—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton
- C07C317/46—Sulfones; Sulfoxides having sulfone or sulfoxide groups and carboxyl groups bound to the same carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/50—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton
- C07C323/62—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and carboxyl groups bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
- C07C327/38—Amides of thiocarboxylic acids
- C07C327/48—Amides of thiocarboxylic acids having carbon atoms of thiocarboxamide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/16—Systems containing only non-condensed rings with a six-membered ring the ring being unsaturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Diabetes (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Engineering & Computer Science (AREA)
- Public Health (AREA)
- Obesity (AREA)
- Endocrinology (AREA)
- Hematology (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Emergency Medicine (AREA)
- Urology & Nephrology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US14106899P | 1999-06-25 | 1999-06-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| OA11972A true OA11972A (en) | 2006-04-18 |
Family
ID=22494031
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| OA1200100338A OA11972A (en) | 1999-06-25 | 2000-06-23 | Substituted phenoxyacetic acids. |
Country Status (24)
| Country | Link |
|---|---|
| US (4) | US6420426B1 (pl) |
| EP (1) | EP1198451A2 (pl) |
| JP (1) | JP2003503381A (pl) |
| KR (1) | KR20020013936A (pl) |
| CN (1) | CN1364153A (pl) |
| AP (1) | AP2001002377A0 (pl) |
| AU (1) | AU5886900A (pl) |
| BG (1) | BG106351A (pl) |
| BR (1) | BR0011928A (pl) |
| CA (1) | CA2385798A1 (pl) |
| CZ (1) | CZ20014637A3 (pl) |
| EE (1) | EE200100708A (pl) |
| HU (1) | HUP0202384A3 (pl) |
| IL (1) | IL147197A0 (pl) |
| MX (1) | MXPA02003123A (pl) |
| NO (1) | NO20016272L (pl) |
| NZ (1) | NZ516290A (pl) |
| OA (1) | OA11972A (pl) |
| PL (1) | PL355857A1 (pl) |
| SK (1) | SK19152001A3 (pl) |
| TN (1) | TNSN00139A1 (pl) |
| TR (1) | TR200200619T2 (pl) |
| WO (1) | WO2001000566A2 (pl) |
| ZA (1) | ZA200200300B (pl) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2385798A1 (en) * | 1999-06-25 | 2001-01-04 | Michael C. Van Zandt | Substituted phenoxyacetic acids |
| US6958355B2 (en) | 2000-04-24 | 2005-10-25 | Aryx Therapeutics, Inc. | Materials and methods for the treatment of diabetes, hyperlipidemia, hypercholesterolemia, and atherosclerosis |
| US6680387B2 (en) | 2000-04-24 | 2004-01-20 | Aryx Therapeutics | Materials and methods for the treatment of diabetes, hyperlipidemia, hypercholesterolemia, and atherosclerosis |
| US6768008B2 (en) * | 2000-04-24 | 2004-07-27 | Aryx Therapeutics | Materials and methods for the treatment of diabetes, hyperlipidemia, hypercholesterolemia, and atherosclerosis |
| KR100356374B1 (ko) * | 2000-09-14 | 2002-10-19 | 사회복지법인삼성생명공익재단(삼성서울병원) | 안지오텐신 전환효소 억제제의 부작용으로 발생하는마른기침을 저해하기 위한 철분을 포함하는 기침 저해조성물 |
| WO2002024689A1 (en) | 2000-09-21 | 2002-03-28 | Aryx Therapeutics | Isoxazolidine compounds useful in the treatment of diabetes, hyperlipidemia, and atherosclerosis |
| HRP20031002A2 (en) * | 2001-06-07 | 2004-06-30 | Lilly Co Eli | Modulators of peroxisome proliferator activated receptors (ppar) |
| ES2297382T3 (es) | 2003-02-14 | 2008-05-01 | Eli Lilly And Company | Derivados de sulfonamida como moduladores de ppar. |
| BRPI0409914A (pt) * | 2003-04-30 | 2006-04-25 | Inst For Pharm Discovery Inc | ácidos carboxìlicos substituìdos |
| DE602005025755D1 (de) | 2004-06-04 | 2011-02-17 | Teva Pharma | Irbesartan enthaltende pharmazeutische zusammensetzung |
| EP1805136A1 (en) * | 2004-10-28 | 2007-07-11 | The Institutes for Pharmaceutical Discovery, LLC | Substituted phenylalkanoic acids |
| GB0427603D0 (en) * | 2004-12-16 | 2005-01-19 | Novartis Ag | Organic compounds |
| US10640457B2 (en) | 2009-12-10 | 2020-05-05 | The Trustees Of Columbia University In The City Of New York | Histone acetyltransferase activators and uses thereof |
| EP2654428B1 (en) | 2010-12-22 | 2018-02-14 | The Trustees of Columbia University in the City of New York | Histone acetyltransferase modulators and usese thereof |
| WO2018002673A1 (en) | 2016-07-01 | 2018-01-04 | N4 Pharma Uk Limited | Novel formulations of angiotensin ii receptor antagonists |
| CN109289696B (zh) * | 2018-10-29 | 2022-03-22 | 天津先光化工有限公司 | 一种咪唑啉两性表面活性剂的制备方法 |
| CN114790139B (zh) * | 2021-01-26 | 2024-06-18 | 江苏中旗科技股份有限公司 | 一种以2-氯-4-氨基溴苯为原料合成2-氯-4-氟苯甲酸的方法 |
| CN114790133B (zh) * | 2021-01-26 | 2024-06-18 | 江苏中旗科技股份有限公司 | 一种以2-氯-4-氨基苯腈为原料合成2-氯-4-氟苯甲酸的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0218728A1 (en) | 1985-04-03 | 1987-04-22 | Yamanouchi Pharmaceutical Co. Ltd. | Phenylene derivatives |
| JPH04297466A (ja) | 1990-06-22 | 1992-10-21 | Nippon Shinyaku Co Ltd | テトラゾール誘導体及び医薬 |
| EP0664788A1 (de) * | 1992-10-16 | 1995-08-02 | Byk Nederland BV | Substituierte ethanolaminester |
| GB9511694D0 (en) * | 1995-06-09 | 1995-08-02 | Fujisawa Pharmaceutical Co | Benzamide derivatives |
| CA2385798A1 (en) * | 1999-06-25 | 2001-01-04 | Michael C. Van Zandt | Substituted phenoxyacetic acids |
-
2000
- 2000-06-23 CA CA002385798A patent/CA2385798A1/en not_active Abandoned
- 2000-06-23 BR BR0011928-8A patent/BR0011928A/pt not_active IP Right Cessation
- 2000-06-23 IL IL14719700A patent/IL147197A0/xx unknown
- 2000-06-23 JP JP2001506979A patent/JP2003503381A/ja active Pending
- 2000-06-23 AU AU58869/00A patent/AU5886900A/en not_active Abandoned
- 2000-06-23 MX MXPA02003123A patent/MXPA02003123A/es unknown
- 2000-06-23 PL PL00355857A patent/PL355857A1/pl not_active Application Discontinuation
- 2000-06-23 KR KR1020017016636A patent/KR20020013936A/ko not_active Withdrawn
- 2000-06-23 US US09/603,817 patent/US6420426B1/en not_active Expired - Fee Related
- 2000-06-23 EP EP00944834A patent/EP1198451A2/en not_active Withdrawn
- 2000-06-23 AP APAP/P/2001/002377A patent/AP2001002377A0/en unknown
- 2000-06-23 CZ CZ20014637A patent/CZ20014637A3/cs unknown
- 2000-06-23 EE EEP200100708A patent/EE200100708A/xx unknown
- 2000-06-23 TR TR2002/00619T patent/TR200200619T2/xx unknown
- 2000-06-23 TN TNTNSN00139A patent/TNSN00139A1/fr unknown
- 2000-06-23 HU HU0202384A patent/HUP0202384A3/hu unknown
- 2000-06-23 WO PCT/US2000/017377 patent/WO2001000566A2/en not_active Ceased
- 2000-06-23 SK SK1915-2001A patent/SK19152001A3/sk unknown
- 2000-06-23 NZ NZ516290A patent/NZ516290A/xx unknown
- 2000-06-23 CN CN00809446A patent/CN1364153A/zh active Pending
- 2000-06-23 OA OA1200100338A patent/OA11972A/en unknown
-
2001
- 2001-12-20 NO NO20016272A patent/NO20016272L/no not_active Application Discontinuation
-
2002
- 2002-01-14 ZA ZA200200300A patent/ZA200200300B/xx unknown
- 2002-01-25 BG BG06351A patent/BG106351A/bg unknown
- 2002-07-16 US US10/195,964 patent/US20030036558A1/en not_active Abandoned
-
2003
- 2003-09-12 US US10/662,135 patent/US7189749B2/en not_active Expired - Fee Related
-
2007
- 2007-03-13 US US11/685,336 patent/US20070161631A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| HUP0202384A3 (en) | 2003-03-28 |
| BG106351A (bg) | 2002-09-30 |
| IL147197A0 (en) | 2002-08-14 |
| EE200100708A (et) | 2003-02-17 |
| PL355857A1 (pl) | 2004-05-31 |
| HUP0202384A2 (hu) | 2002-11-28 |
| CN1364153A (zh) | 2002-08-14 |
| KR20020013936A (ko) | 2002-02-21 |
| EP1198451A2 (en) | 2002-04-24 |
| NZ516290A (en) | 2004-03-26 |
| TNSN00139A1 (fr) | 2005-11-10 |
| NO20016272L (no) | 2002-01-17 |
| US7189749B2 (en) | 2007-03-13 |
| US6420426B1 (en) | 2002-07-16 |
| WO2001000566A3 (en) | 2002-02-07 |
| JP2003503381A (ja) | 2003-01-28 |
| ZA200200300B (en) | 2003-08-27 |
| CZ20014637A3 (cs) | 2002-04-17 |
| US20030036558A1 (en) | 2003-02-20 |
| AP2001002377A0 (en) | 2001-12-31 |
| SK19152001A3 (sk) | 2002-06-04 |
| CA2385798A1 (en) | 2001-01-04 |
| WO2001000566A2 (en) | 2001-01-04 |
| NO20016272D0 (no) | 2001-12-20 |
| US20050239849A1 (en) | 2005-10-27 |
| AU5886900A (en) | 2001-01-31 |
| TR200200619T2 (tr) | 2003-01-21 |
| MXPA02003123A (es) | 2003-08-20 |
| BR0011928A (pt) | 2002-04-09 |
| US20070161631A1 (en) | 2007-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20070161631A1 (en) | Substituted Phenoxyacetic Acids | |
| US7772237B2 (en) | Thio-substituted tricyclic and bicyclic aromatic methanesulfinyl derivatives | |
| US20020177594A1 (en) | Inhibitors of histone deacetylase | |
| WO2006088705A1 (en) | Terphenyl guanidines as [beta symbol] -secretase inhibitors | |
| CZ293706B6 (cs) | Cyklické deriváty amidů acylaminokyselin substituované thioskupinou a způsob jejich přípravy | |
| HU211138A9 (en) | Therapeutic amides | |
| CA2984974C (en) | Indenoindole derivatives, pharmaceutically acceptable salts or optical isomers thereof, preparation method for same, and pharmaceutical compositions containing same as active ingredient for preventing or treating viral diseases | |
| CA2523714A1 (en) | Substituted carboxylic acids | |
| EP1907347A2 (en) | Compounds with activity at retinoic acid receptors | |
| CA2499213A1 (en) | Aromatic liver x-receptor modulators | |
| JP2006511564A (ja) | 抗炎症剤、免疫調節剤及び増殖抑制剤としてシクロアルケンジカルボン酸化合物 | |
| JP4859828B2 (ja) | チオ−置換ビアリールメタンスルティニル誘導体 | |
| EP0398179A1 (en) | Rhodanine derivatives and pharmaceutical compositions | |
| US8071604B2 (en) | Thio-substituted arylmethanesulfinyl derivatives | |
| KR100223231B1 (ko) | 아닐린 및 벤질아민으로부터 얻어진 벤질셀레노벤즈아미드 및 그 제조 방법 | |
| CN120923445A (zh) | 作为nlrp3炎性小体抑制剂的酰胺类化合物 | |
| CN121991023A (zh) | 苯基噻吩类化合物及其制备方法和应用 | |
| KR20120035684A (ko) | IKK-β 억제제로서 신규 티아졸리디논 화합물 및 그의 제조방법 | |
| EP1589016A1 (en) | Thio-substituted tricyclic and bicyclic aromatic methanesulfinyl derivatives | |
| JPH05170751A (ja) | チアゾリン誘導体 | |
| CN105566323A (zh) | 吡啶并吡嗪类化合物、其制备方法及医药用途 |