NZ208490A - Built detergent bleach compositions containing mn(ii)ions - Google Patents
Built detergent bleach compositions containing mn(ii)ionsInfo
- Publication number
- NZ208490A NZ208490A NZ208490A NZ20849084A NZ208490A NZ 208490 A NZ208490 A NZ 208490A NZ 208490 A NZ208490 A NZ 208490A NZ 20849084 A NZ20849084 A NZ 20849084A NZ 208490 A NZ208490 A NZ 208490A
- Authority
- NZ
- New Zealand
- Prior art keywords
- acid
- mono
- bleaching
- peroxyphthalic
- manganese
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 35
- 239000007844 bleaching agent Substances 0.000 title claims description 22
- 239000003599 detergent Substances 0.000 title claims description 18
- 150000002500 ions Chemical class 0.000 title description 2
- 150000004965 peroxy acids Chemical class 0.000 claims description 26
- 238000004061 bleaching Methods 0.000 claims description 22
- -1 Manganese (II) ions Chemical class 0.000 claims description 18
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 18
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 claims description 16
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 14
- 238000005406 washing Methods 0.000 claims description 11
- 239000011572 manganese Substances 0.000 claims description 10
- 239000004094 surface-active agent Substances 0.000 claims description 10
- 239000003352 sequestering agent Substances 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- 239000000843 powder Substances 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052748 manganese Inorganic materials 0.000 claims description 7
- 230000000694 effects Effects 0.000 claims description 6
- 238000002474 experimental method Methods 0.000 claims description 6
- 238000012360 testing method Methods 0.000 claims description 6
- 241001122767 Theaceae Species 0.000 claims description 5
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 5
- 238000006555 catalytic reaction Methods 0.000 claims description 4
- 239000002738 chelating agent Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 159000000003 magnesium salts Chemical class 0.000 claims description 2
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 claims description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical group [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 claims description 2
- 229940081066 picolinic acid Drugs 0.000 claims 2
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 11
- 239000002585 base Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 239000000344 soap Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000012190 activator Substances 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 229910021653 sulphate ion Inorganic materials 0.000 description 4
- 239000004115 Sodium Silicate Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- 229960001922 sodium perborate Drugs 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 235000019832 sodium triphosphate Nutrition 0.000 description 3
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical group C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- 102000016938 Catalase Human genes 0.000 description 2
- 108010053835 Catalase Proteins 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 2
- 230000001627 detrimental effect Effects 0.000 description 2
- 238000007580 dry-mixing Methods 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 229910021645 metal ion Inorganic materials 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 235000020030 perry Nutrition 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- 229910021380 Manganese Chloride Inorganic materials 0.000 description 1
- GLFNIEUTAYBVOC-UHFFFAOYSA-L Manganese chloride Chemical compound Cl[Mn]Cl GLFNIEUTAYBVOC-UHFFFAOYSA-L 0.000 description 1
- 239000004902 Softening Agent Substances 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- KXEMXOYVVPLGSD-UHFFFAOYSA-N benzene-1,3-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC(C(=O)OO)=C1 KXEMXOYVVPLGSD-UHFFFAOYSA-N 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- WOWHHFRSBJGXCM-UHFFFAOYSA-M cetyltrimethylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+](C)(C)C WOWHHFRSBJGXCM-UHFFFAOYSA-M 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- BFGKITSFLPAWGI-UHFFFAOYSA-N chromium(3+) Chemical compound [Cr+3] BFGKITSFLPAWGI-UHFFFAOYSA-N 0.000 description 1
- 229910001429 cobalt ion Inorganic materials 0.000 description 1
- 230000009918 complex formation Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- PSLWZOIUBRXAQW-UHFFFAOYSA-M dimethyl(dioctadecyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC PSLWZOIUBRXAQW-UHFFFAOYSA-M 0.000 description 1
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- ILHIHKRJJMKBEE-UHFFFAOYSA-N hydroperoxyethane Chemical compound CCOO ILHIHKRJJMKBEE-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- PIOZZBNFRIZETM-UHFFFAOYSA-L magnesium;2-carbonoperoxoylbenzoic acid;2-oxidooxycarbonylbenzoate Chemical compound [Mg+2].OOC(=O)C1=CC=CC=C1C([O-])=O.OOC(=O)C1=CC=CC=C1C([O-])=O PIOZZBNFRIZETM-UHFFFAOYSA-L 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 235000002867 manganese chloride Nutrition 0.000 description 1
- 239000011565 manganese chloride Substances 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 238000010944 pre-mature reactiony Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 229910001428 transition metal ion Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3932—Inorganic compounds or complexes
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838316760A GB8316760D0 (en) | 1983-06-20 | 1983-06-20 | Detergent bleach compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ208490A true NZ208490A (en) | 1986-05-09 |
Family
ID=10544514
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ208490A NZ208490A (en) | 1983-06-20 | 1984-06-13 | Built detergent bleach compositions containing mn(ii)ions |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4579678A (enFirst) |
| EP (1) | EP0131976B1 (enFirst) |
| JP (1) | JPS6023496A (enFirst) |
| AU (1) | AU549863B2 (enFirst) |
| BR (1) | BR8403005A (enFirst) |
| CA (1) | CA1226502A (enFirst) |
| DE (1) | DE3460980D1 (enFirst) |
| GB (2) | GB8316760D0 (enFirst) |
| GR (1) | GR82373B (enFirst) |
| NO (1) | NO842435L (enFirst) |
| NZ (1) | NZ208490A (enFirst) |
| PT (1) | PT78764B (enFirst) |
| TR (1) | TR22080A (enFirst) |
| ZA (1) | ZA844627B (enFirst) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ210398A (en) * | 1983-12-06 | 1986-11-12 | Unilever Plc | Detergent bleach composition containing a peroxide compound and a manganese compound |
| US4711748A (en) * | 1985-12-06 | 1987-12-08 | Lever Brothers Company | Preparation of bleach catalyst aggregates of manganese cation impregnated aluminosilicates by high velocity granulation |
| US5230820A (en) * | 1987-11-23 | 1993-07-27 | Ciba-Geigy Corporation | Storage-stable bleaching detergents containing bis-benzofuranyl fluoescent whitening agents |
| US5035825A (en) * | 1987-11-26 | 1991-07-30 | Ciba-Geigy Corporation | Stable bleaching detergents containing stilbene fluorescent whitening agents |
| US5326491A (en) * | 1989-04-28 | 1994-07-05 | Ciba-Geigy Corporation | Detergents containing certain sulfonated dibenzofuranylbiphenyls |
| MX9207050A (es) * | 1991-12-19 | 1993-06-01 | Ciba Geigy Ag | Dispersion de blanqueador estable durante el almacenamiento |
| CH684485A5 (de) * | 1992-11-17 | 1994-09-30 | Ciba Geigy Ag | Flüssigwaschmittel. |
| US5429769A (en) * | 1993-07-26 | 1995-07-04 | Lever Brothers Company, Division Of Conopco, Inc. | Peroxycarboxylic acids and manganese complex catalysts |
| JP3009471B2 (ja) * | 1994-04-07 | 2000-02-14 | ザ、プロクター、エンド、ギャンブル、カンパニー | 金属含有漂白触媒と酸化防止剤とを含む漂白組成物 |
| US5686014A (en) * | 1994-04-07 | 1997-11-11 | The Procter & Gamble Company | Bleach compositions comprising manganese-containing bleach catalysts |
| US5968881A (en) * | 1995-02-02 | 1999-10-19 | The Procter & Gamble Company | Phosphate built automatic dishwashing compositions comprising catalysts |
| DE69617209T2 (de) * | 1995-02-02 | 2002-07-25 | The Procter & Gamble Company, Cincinnati | Verfahren zur entfernung von teeflecken in geschirrspülern mit zusammensetzungen enthaltend kobalt (iii)- katalysator |
| WO1996023860A1 (en) * | 1995-02-02 | 1996-08-08 | The Procter & Gamble Company | Automatic dishwashing compositions comprising cobalt chelated catalysts |
| ATE203051T1 (de) * | 1995-06-16 | 2001-07-15 | Procter & Gamble | Maschinengeschirrspülmittel, die kobaltkatalysatoren enthalten |
| BR9609384A (pt) * | 1995-06-16 | 1999-05-18 | Procter & Gamble | Composições alvejantes compreendendo catalisadores de cobalto |
| US5703034A (en) * | 1995-10-30 | 1997-12-30 | The Procter & Gamble Company | Bleach catalyst particles |
| ATE305720T1 (de) * | 1998-10-19 | 2005-10-15 | Saraya Co Ltd | Bakterizide desinfizierende peressigsäure- zusammensetzung |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156654A (en) * | 1961-06-19 | 1964-11-10 | Shell Oil Co | Bleaching |
| US3372125A (en) * | 1965-11-15 | 1968-03-05 | Peter Strong & Company Inc | Denture cleanser |
| GB1182143A (en) * | 1966-03-01 | 1970-02-25 | United States Borax Chem | Bleaching Compositions and Methods. |
| FI64639C (fi) * | 1978-09-27 | 1983-12-12 | Unilever Nv | Bleknings- och rengoeringskomposition |
| DD141844B1 (de) * | 1978-12-28 | 1982-04-28 | Rudolf Opitz | Bleichmittel |
| DE2942557C2 (de) * | 1979-10-22 | 1983-01-27 | Siemens AG, 1000 Berlin und 8000 München | Richtantennenanordnung bzw. Richtantenne für einen Störsender |
| WO1983000088A1 (en) * | 1981-06-29 | 1983-01-20 | Biomedics Inc | Chemotherapeutic agent and tracer composition and system for use thereof |
| GR76237B (enFirst) * | 1981-08-08 | 1984-08-04 | Procter & Gamble | |
| US4481129A (en) * | 1981-12-23 | 1984-11-06 | Lever Brothers Company | Bleach compositions |
| US4478733A (en) * | 1982-12-17 | 1984-10-23 | Lever Brothers Company | Detergent compositions |
-
1983
- 1983-06-20 GB GB838316760A patent/GB8316760D0/en active Pending
-
1984
- 1984-06-08 DE DE8484200812T patent/DE3460980D1/de not_active Expired
- 1984-06-08 EP EP84200812A patent/EP0131976B1/en not_active Expired
- 1984-06-13 US US06/619,974 patent/US4579678A/en not_active Expired - Fee Related
- 1984-06-13 CA CA000456447A patent/CA1226502A/en not_active Expired
- 1984-06-13 NZ NZ208490A patent/NZ208490A/en unknown
- 1984-06-14 GR GR75022A patent/GR82373B/el unknown
- 1984-06-15 TR TR22080A patent/TR22080A/xx unknown
- 1984-06-15 JP JP59123557A patent/JPS6023496A/ja active Granted
- 1984-06-18 AU AU29469/84A patent/AU549863B2/en not_active Ceased
- 1984-06-18 NO NO84842435A patent/NO842435L/no unknown
- 1984-06-19 BR BR8403005A patent/BR8403005A/pt not_active IP Right Cessation
- 1984-06-19 GB GB08415631A patent/GB2141754B/en not_active Expired
- 1984-06-19 PT PT78764A patent/PT78764B/pt unknown
- 1984-06-19 ZA ZA844627A patent/ZA844627B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB2141754B (en) | 1986-11-12 |
| PT78764B (en) | 1986-11-13 |
| CA1226502A (en) | 1987-09-08 |
| AU2946984A (en) | 1985-01-03 |
| EP0131976B1 (en) | 1986-10-15 |
| GB2141754A (en) | 1985-01-03 |
| PT78764A (en) | 1984-07-01 |
| JPS6126958B2 (enFirst) | 1986-06-23 |
| BR8403005A (pt) | 1985-05-28 |
| JPS6023496A (ja) | 1985-02-06 |
| ZA844627B (en) | 1986-01-29 |
| NO842435L (no) | 1984-12-21 |
| TR22080A (tr) | 1986-03-17 |
| GB8415631D0 (en) | 1984-07-25 |
| US4579678A (en) | 1986-04-01 |
| DE3460980D1 (en) | 1986-11-20 |
| EP0131976A1 (en) | 1985-01-23 |
| AU549863B2 (en) | 1986-02-20 |
| GR82373B (enFirst) | 1984-12-13 |
| GB8316760D0 (en) | 1983-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0145090B1 (en) | Detergent bleach compositions | |
| EP0132860B1 (en) | Detergent bleach compositions | |
| US4579678A (en) | Detergent bleach compositions | |
| CA1231653A (en) | Bleaching and cleaning composition | |
| US5246612A (en) | Machine dishwashing composition containing peroxygen bleach, manganese complex and enzymes | |
| CA1241156A (en) | Bleaching compositions | |
| GB2112034A (en) | Bleach compositions | |
| JPH05263098A (ja) | 漂白活性体 | |
| JPH07122076B2 (ja) | 漂白剤の活性化 | |
| HUT74484A (en) | Enzymatic bleach composition | |
| EP0237111A2 (en) | Detergent bleach composition, bleaching compositions and bleach activators | |
| JPH06121933A (ja) | マンガン触媒 | |
| EP0111964B1 (en) | Detergent compositions | |
| EP0145091B1 (en) | Detergent bleach compositions | |
| JP2001504883A (ja) | 洗剤中の漂白活性化剤としてのアセトニトリル誘導体 | |
| US6221824B1 (en) | Process for the production of compounded acetonitrile derivatives | |
| JP2000501758A (ja) | 酵素漂白系を含む漂白および洗浄剤 | |
| US6432901B2 (en) | Bleach catalysts | |
| EP0693116B1 (en) | Composition and process for inhibiting dye transfer | |
| EP0157483A1 (en) | Peroxide activation | |
| US20080261852A1 (en) | Bleach Reinforcer Combination for Use in Washing and Cleaning Agents | |
| GB2141755A (en) | Detergent bleach compositions |