NZ208169A - N-substituted-4-amino-chromans and-chromenes and pharmaceutical compositions - Google Patents
N-substituted-4-amino-chromans and-chromenes and pharmaceutical compositionsInfo
- Publication number
- NZ208169A NZ208169A NZ208169A NZ20816984A NZ208169A NZ 208169 A NZ208169 A NZ 208169A NZ 208169 A NZ208169 A NZ 208169A NZ 20816984 A NZ20816984 A NZ 20816984A NZ 208169 A NZ208169 A NZ 208169A
- Authority
- NZ
- New Zealand
- Prior art keywords
- cyano
- compound according
- trans
- compound
- hydrogen
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 119
- -1 C1-6 alkoxycarbonvl Chemical group 0.000 claims description 43
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 27
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 25
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 19
- 125000003545 alkoxy group Chemical group 0.000 claims description 17
- 150000002431 hydrogen Chemical class 0.000 claims description 16
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 15
- 125000004429 atom Chemical group 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000004423 acyloxy group Chemical group 0.000 claims description 13
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 13
- 125000001072 heteroaryl group Chemical group 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 12
- 125000002950 monocyclic group Chemical group 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 10
- 239000005864 Sulphur Chemical group 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 239000012453 solvate Substances 0.000 claims description 10
- 125000001589 carboacyl group Chemical group 0.000 claims description 7
- 241000124008 Mammalia Species 0.000 claims description 6
- 230000003276 anti-hypertensive effect Effects 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 229910052760 oxygen Inorganic materials 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 206010020772 Hypertension Diseases 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000001624 naphthyl group Chemical group 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 238000011282 treatment Methods 0.000 claims description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 238000006467 substitution reaction Methods 0.000 claims description 4
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004685 alkoxythiocarbonyl group Chemical group 0.000 claims description 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 2
- 125000004691 alkyl thio carbonyl group Chemical group 0.000 claims description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 2
- 125000002883 imidazolyl group Chemical group 0.000 claims description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 2
- 125000001041 indolyl group Chemical group 0.000 claims description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 2
- IKYUBOYHSROPNZ-CABCVRRESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1h-pyrrole-2-carboxamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=CN1 IKYUBOYHSROPNZ-CABCVRRESA-N 0.000 claims description 2
- IELGGTVTYFUENY-QUCCMNQESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3,4,5-trimethoxybenzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)N[C@@H]2C3=CC(=CC=C3OC(C)(C)[C@H]2O)C#N)=C1 IELGGTVTYFUENY-QUCCMNQESA-N 0.000 claims description 2
- RHNPFPMYMQDLNI-CABCVRRESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]furan-2-carboxamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=CO1 RHNPFPMYMQDLNI-CABCVRRESA-N 0.000 claims description 2
- NKKCKJSBFWGGFR-RTWAWAEBSA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]naphthalene-1-carboxamide Chemical compound C1=CC=C2C(C(=O)N[C@@H]3C4=CC(=CC=C4OC([C@H]3O)(C)C)C#N)=CC=CC2=C1 NKKCKJSBFWGGFR-RTWAWAEBSA-N 0.000 claims description 2
- UEHYAWRPTHBZPN-CVEARBPZSA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyridine-2-carboxamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=CC=N1 UEHYAWRPTHBZPN-CVEARBPZSA-N 0.000 claims description 2
- 125000002971 oxazolyl group Chemical group 0.000 claims description 2
- 238000011321 prophylaxis Methods 0.000 claims description 2
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 2
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 125000004306 triazinyl group Chemical group 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims 2
- 125000006624 (C1-C6) alkoxycarbonylamino group Chemical group 0.000 claims 1
- ZPTXVIWXGDGGTD-SJORKVTESA-N 3,4-dichloro-n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]benzamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=C(Cl)C(Cl)=C1 ZPTXVIWXGDGGTD-SJORKVTESA-N 0.000 claims 1
- FZBBUIVMCCYQOP-MSOLQXFVSA-N 4-cyano-n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]benzamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=C(C#N)C=C1 FZBBUIVMCCYQOP-MSOLQXFVSA-N 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- UDKMBTMJEMCASL-MOPGFXCFSA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1h-indole-3-carboxamide Chemical compound C1=CC=C2C(C(=O)N[C@@H]3C4=CC(=CC=C4OC([C@H]3O)(C)C)C#N)=CNC2=C1 UDKMBTMJEMCASL-MOPGFXCFSA-N 0.000 claims 1
- RPRYCBAKTKJULK-SJORKVTESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-3-nitrobenzamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=CC([N+]([O-])=O)=C1 RPRYCBAKTKJULK-SJORKVTESA-N 0.000 claims 1
- PVYVTVQCCNZQPD-SJORKVTESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]benzamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=CC=C1 PVYVTVQCCNZQPD-SJORKVTESA-N 0.000 claims 1
- CLISGILMMMJRBY-CABCVRRESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]furan-3-carboxamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C=1C=COC=1 CLISGILMMMJRBY-CABCVRRESA-N 0.000 claims 1
- YURIMYIITRIILT-RTWAWAEBSA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]naphthalene-2-carboxamide Chemical compound C1=CC=CC2=CC(C(=O)N[C@@H]3C4=CC(=CC=C4OC([C@H]3O)(C)C)C#N)=CC=C21 YURIMYIITRIILT-RTWAWAEBSA-N 0.000 claims 1
- QHPCXWSMZVKSDD-CVEARBPZSA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]pyridine-3-carboxamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=CN=C1 QHPCXWSMZVKSDD-CVEARBPZSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 17
- 241000700159 Rattus Species 0.000 description 12
- 238000000034 method Methods 0.000 description 11
- 239000002253 acid Substances 0.000 description 9
- 230000036772 blood pressure Effects 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 229910001868 water Inorganic materials 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 238000005481 NMR spectroscopy Methods 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000001819 mass spectrum Methods 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- QVDYYQXUNAQSNI-UHFFFAOYSA-N ethyl acetate;pentane Chemical compound CCCCC.CCOC(C)=O QVDYYQXUNAQSNI-UHFFFAOYSA-N 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- LKXADRQJLNYNQL-UHFFFAOYSA-N 2h-chromen-3-ol Chemical compound C1=CC=C2OCC(O)=CC2=C1 LKXADRQJLNYNQL-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 150000008371 chromenes Chemical class 0.000 description 3
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- APHWBGUCQBONMO-MNOVXSKESA-N (3s,4r)-4-amino-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile Chemical compound C1=C(C#N)C=C2[C@@H](N)[C@H](O)C(C)(C)OC2=C1 APHWBGUCQBONMO-MNOVXSKESA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical compound OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- BIIBYWQGRFWQKM-JVVROLKMSA-N (2S)-N-[4-(cyclopropylamino)-3,4-dioxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4,4-dimethylpentanamide Chemical compound CC(C)(C)C[C@@H](C(NC(C[C@H](CCN1)C1=O)C(C(NC1CC1)=O)=O)=O)NC(/C=C/C(C=CC(Cl)=C1)=C1Cl)=O BIIBYWQGRFWQKM-JVVROLKMSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 1
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 1
- VTXNOVCTHUBABW-UHFFFAOYSA-N 3,4-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C(Cl)=C1 VTXNOVCTHUBABW-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BHMZHLVLASSMIX-UHFFFAOYSA-N COC1=CC=C(C=C1)S[PH2]=S Chemical class COC1=CC=C(C=C1)S[PH2]=S BHMZHLVLASSMIX-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 238000001321 HNCO Methods 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940124538 antidiuretic agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000004658 aryl carbonyl amino group Chemical group 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000006243 carbonyl protecting group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- VZWXIQHBIQLMPN-UHFFFAOYSA-N chromane Chemical compound C1=CC=C2CCCOC2=C1 VZWXIQHBIQLMPN-UHFFFAOYSA-N 0.000 description 1
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000005224 heteroarylcarbonylamino group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- GBKMQCYVHBYTGQ-SJORKVTESA-N n-[(3s,4r)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4-hydroxybenzamide Chemical compound N([C@@H]1C2=CC(=CC=C2OC([C@H]1O)(C)C)C#N)C(=O)C1=CC=C(O)C=C1 GBKMQCYVHBYTGQ-SJORKVTESA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000004928 piperidonyl group Chemical group 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- DOYOPBSXEIZLRE-UHFFFAOYSA-N pyrrole-3-carboxylic acid Natural products OC(=O)C=1C=CNC=1 DOYOPBSXEIZLRE-UHFFFAOYSA-N 0.000 description 1
- 125000004929 pyrrolidonyl group Chemical group N1(C(CCC1)=O)* 0.000 description 1
- 230000000452 restraining effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- WORJEOGGNQDSOE-ASTXPPQBSA-N trichloro(deuterio)methane;trideuterio(deuteriooxy)methane Chemical compound [2H]C(Cl)(Cl)Cl.[2H]OC([2H])([2H])[2H] WORJEOGGNQDSOE-ASTXPPQBSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
- C07D311/68—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4 with nitrogen atoms directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Heart & Thoracic Surgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838313687A GB8313687D0 (en) | 1983-05-18 | 1983-05-18 | Active compounds |
| GB838334418A GB8334418D0 (en) | 1983-12-23 | 1983-12-23 | Active compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ208169A true NZ208169A (en) | 1987-08-31 |
Family
ID=26286157
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ208169A NZ208169A (en) | 1983-05-18 | 1984-05-16 | N-substituted-4-amino-chromans and-chromenes and pharmaceutical compositions |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4571406A (enExample) |
| EP (1) | EP0126311B1 (enExample) |
| JP (1) | JPH0631211B2 (enExample) |
| AU (1) | AU569513B2 (enExample) |
| CA (1) | CA1236458A (enExample) |
| DE (1) | DE3479726D1 (enExample) |
| ES (1) | ES532582A0 (enExample) |
| GR (1) | GR79976B (enExample) |
| IE (1) | IE57982B1 (enExample) |
| NZ (1) | NZ208169A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4943582A (en) * | 1986-05-03 | 1990-07-24 | Beecham Group P.L.C. | Active compounds |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3486354T2 (de) * | 1983-05-18 | 1995-03-30 | Beecham Group Plc | Chroman- und Chromenderivate. |
| DE3475786D1 (de) * | 1983-09-01 | 1989-02-02 | Beecham Group Plc | Chromanol derivatives |
| EP0138134B1 (en) * | 1983-10-13 | 1989-04-19 | Beecham Group Plc | Chroman derivatives |
| GB8419515D0 (en) * | 1984-07-31 | 1984-09-05 | Beecham Group Plc | Treatment |
| GB8419516D0 (en) * | 1984-07-31 | 1984-09-05 | Beecham Group Plc | Treatment |
| GB8513369D0 (en) * | 1985-05-28 | 1985-07-03 | Beecham Group Plc | Treatment |
| DE3682331D1 (de) | 1985-06-08 | 1991-12-12 | Beecham Group Plc | Pyrano(3,2-c)pyridinderivate, verfahren und zwischenprodukte zu ihrer herstellung und diese enthaltende pharmazeutische zubereitungen. |
| GB8521857D0 (en) * | 1985-09-03 | 1985-10-09 | Beecham Group Plc | Active compounds |
| GB8610911D0 (en) * | 1986-05-03 | 1986-06-11 | Beecham Group Plc | Active compounds |
| IL88035A0 (en) * | 1987-10-27 | 1989-06-30 | American Home Prod | Benzopyran derivatives,their preparation and pharmaceutical compositions containing them |
| CA1308108C (en) * | 1987-10-27 | 1992-09-29 | Dominick A. Quagliato | Antihypertensive benzopyran derivatives |
| GB8800199D0 (en) * | 1988-01-06 | 1988-02-10 | Beecham Group Plc | Pharmaceutical preparation |
| US5021432A (en) * | 1988-04-26 | 1991-06-04 | Yoshitomi Pharmaceutical Industries, Ltd. | Benzopyran compound and its pharmaceutical use |
| US4988723A (en) * | 1988-06-02 | 1991-01-29 | Fujisawa Pharmaceutical Co., Ltd. | Benzopyran derivatives and their use as anti-hypertensives |
| NZ230711A (en) * | 1988-09-23 | 1990-10-26 | Ortho Pharma Corp | Substituted thienopyrans as antihypertensive agents |
| US4992435A (en) * | 1988-09-23 | 1991-02-12 | Ortho Pharmaceutical Corporation | Substituted thienopyrans as antihypertensive agents |
| US5298512A (en) * | 1989-04-07 | 1994-03-29 | Pfizer Inc. | Substituted chromans and their use in the treatment of asthma, arthritis and related diseases |
| ES2030627A6 (es) * | 1990-11-28 | 1992-11-01 | Uriach & Cia Sa J | Procedimiento para la obtencion de compuestos benzopiranicos. |
| US5624954A (en) * | 1991-06-13 | 1997-04-29 | Smithkline Beecham P.L.C. | Benzo- and pyridopyran derivatives having anxiolytic and anti-convulsant activity |
| GB9112721D0 (en) * | 1991-06-13 | 1991-07-31 | Smithkline Beecham Plc | Novel treatment |
| US5453421A (en) * | 1992-09-11 | 1995-09-26 | E. R. Squibb & Sons, Inc. | Aryl and heterocyclic substituted propenamide derivatives |
| GR1002276B (el) * | 1992-10-08 | 1996-05-02 | Smithkline Beecham P.L.C. | Παραγωγα βενζοπυρανιου τα οποια κεκτηνται δραση κνς. |
| SK281507B6 (sk) * | 1992-11-30 | 2001-04-09 | Smithkline Beecham Plc | Použitie benzopyránových analógov, benzopyránové analógy, spôsob ich prípravy a farmaceutický prostriedok s ich obsahom |
| AP360A (en) * | 1992-12-04 | 1994-09-07 | Smithkline Beecham Plc | Benzo-and pyridopyran derivatives having anxiolytic and anticonvulsant activity. |
| US20010021780A1 (en) * | 1992-12-11 | 2001-09-13 | Smithkline Beecham P.L.C. | Pharmaceutical composition containing bicyclic type compounds |
| PT673374E (pt) * | 1992-12-11 | 2000-07-31 | Smithkline Beecham Plc | Composicao farmaceutica contendo compostos do tipo biciclico |
| WO1994013656A1 (en) * | 1992-12-11 | 1994-06-23 | Smithkline Beecham Plc | Bicyclic compounds with pharmaceutical activity |
| US5837702A (en) * | 1993-10-07 | 1998-11-17 | Bristol-Myers Squibb Co. | 4-arylamino-benzopyran and related compounds |
| SI0764157T1 (en) * | 1994-06-10 | 2002-06-30 | Smithkline Beecham Plc | Benzopyrans and their use as therapeutic agents |
| JPH10501256A (ja) * | 1994-06-10 | 1998-02-03 | スミスクライン・ビーチャム・パブリック・リミテッド・カンパニー | C−4アミド置換化合物およびその治療剤としての使用 |
| GB9411635D0 (en) * | 1994-06-10 | 1994-08-03 | Smithkline Beecham Plc | Novel treatment |
| US5574049A (en) * | 1994-07-22 | 1996-11-12 | Sandoz Ltd. | 2,2-dialkyl- and 2,2-dialkyl-3,4-dihydro-3-hydroxy-2H-1-benzopyrans |
| US5612323A (en) * | 1995-06-07 | 1997-03-18 | Bristol-Myers Squibb Company | Phosphinic ester substituted benzopyran derivatives |
| US5869478A (en) * | 1995-06-07 | 1999-02-09 | Bristol-Myers Squibb Company | Sulfonamido substituted benzopyran derivatives |
| US5629429A (en) * | 1995-06-07 | 1997-05-13 | Bristol-Myers Squibb Company | Process for preparing 4-arylamino-benzopyran and related compounds |
| US5612370A (en) * | 1995-06-07 | 1997-03-18 | Bristol-Myers Squibb Company | Phenylglycine and phenylalaninen amido benzopyran derivatives |
| BRPI0519013A2 (pt) * | 2004-12-13 | 2009-11-03 | Lilly Co Eli | composto ou esteroisÈmeros únicos, misturas de esteroisÈmeros, sais, tautÈmeros ou pró-drogas destes farmaceuticamente aceitáveis, composição farmacêutica, e, uso de um composto |
| US20110016548A1 (en) * | 2009-07-16 | 2011-01-20 | University Of Southern California | Control of endogenous dnmt1 gene expression by exogenous binary regulatory systems |
| IN2014DN10669A (enExample) | 2012-07-03 | 2015-08-28 | Proximagen Ltd | |
| GB201304814D0 (en) * | 2013-03-15 | 2013-05-01 | Proximagen Ltd | Pro-drug compounds |
| CN110183460A (zh) * | 2019-04-30 | 2019-08-30 | 四川轻化工大学 | 绵萆薢菲类化合物及应用和提取方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1495526A (en) * | 1974-05-31 | 1977-12-21 | Beecham Group Ltd | Chroman derivatives |
| GB1509853A (en) * | 1976-01-27 | 1978-05-04 | Beecham Group Ltd | 4-amino-3-hydroxy-6-nitrobenzo-pyrans |
| DE3064286D1 (en) * | 1979-09-28 | 1983-08-25 | Beecham Group Plc | Chromanol derivatives, a process for their preparation and a pharmaceutical composition comprising them |
| DE3064285D1 (en) * | 1979-09-28 | 1983-08-25 | Beecham Group Plc | Chromanol derivatives, a process for their preparation and a pharmaceutical composition comprising them |
| EP0046652B1 (en) * | 1980-08-21 | 1985-05-22 | Beecham Group Plc | Chromanol derivatives, their production and pharmaceutical compositions containing them |
| ATE23718T1 (de) * | 1981-09-25 | 1986-12-15 | Beecham Group Plc | Benzopyran-verbindungen mit pharmazeutischer wirkung. |
| EP0095316B1 (en) * | 1982-05-21 | 1986-12-03 | Beecham Group Plc | Pharmaceutically active aminobenzopyrans |
| DE3486354T2 (de) * | 1983-05-18 | 1995-03-30 | Beecham Group Plc | Chroman- und Chromenderivate. |
-
1984
- 1984-04-21 EP EP84104524A patent/EP0126311B1/en not_active Expired
- 1984-04-21 DE DE8484104524T patent/DE3479726D1/de not_active Expired
- 1984-05-16 AU AU28081/84A patent/AU569513B2/en not_active Expired
- 1984-05-16 NZ NZ208169A patent/NZ208169A/en unknown
- 1984-05-16 US US06/610,623 patent/US4571406A/en not_active Expired - Lifetime
- 1984-05-16 CA CA000454467A patent/CA1236458A/en not_active Expired
- 1984-05-17 IE IE1229/84A patent/IE57982B1/en not_active IP Right Cessation
- 1984-05-17 GR GR74749A patent/GR79976B/el unknown
- 1984-05-17 ES ES532582A patent/ES532582A0/es active Granted
- 1984-05-18 JP JP59098929A patent/JPH0631211B2/ja not_active Expired - Lifetime
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4943582A (en) * | 1986-05-03 | 1990-07-24 | Beecham Group P.L.C. | Active compounds |
| US5075460A (en) * | 1986-05-03 | 1991-12-24 | Beecham Group Plc | Epoxybenzopyrans |
Also Published As
| Publication number | Publication date |
|---|---|
| ES8601180A1 (es) | 1985-10-16 |
| ES532582A0 (es) | 1985-10-16 |
| EP0126311B1 (en) | 1989-09-13 |
| US4571406A (en) | 1986-02-18 |
| CA1236458A (en) | 1988-05-10 |
| IE57982B1 (en) | 1993-06-02 |
| AU2808184A (en) | 1984-11-22 |
| GR79976B (enExample) | 1984-10-31 |
| JPS59219278A (ja) | 1984-12-10 |
| EP0126311A3 (en) | 1987-05-27 |
| EP0126311A2 (en) | 1984-11-28 |
| IE841229L (en) | 1984-11-18 |
| JPH0631211B2 (ja) | 1994-04-27 |
| AU569513B2 (en) | 1988-02-04 |
| DE3479726D1 (de) | 1989-10-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ208169A (en) | N-substituted-4-amino-chromans and-chromenes and pharmaceutical compositions | |
| EP0139992B1 (en) | Chromanol derivatives | |
| EP0250077B1 (en) | Pharmacologically active benzopyranes | |
| Bergmann et al. | Synthesis and antihypertensive activity of 4-(1, 2-dihydro-2-oxo-1-pyridyl)-2H-1-benzopyrans and related compounds, new potassium channel activators | |
| US4812459A (en) | Anti-hypertensive pyranopyridine compounds | |
| US4831050A (en) | Pyrrolidinyl benzopyrans as hypotensive agents | |
| EP0076075B1 (en) | Pharmaceutically active benzopyran compounds | |
| US4782083A (en) | 3,4-dihydro-2H-1-benzopyrans useful as anti-hypertensive agents | |
| US4496565A (en) | Chromans and chromenes, compositions and hypertensive method | |
| US4631282A (en) | Antihypertensive chromans and chromenes | |
| US4616021A (en) | Chroman derivatives | |
| WO1987007607A1 (en) | PYRANO (3,2-c) PYRIDINE DERIVATIVES, PROCESS FOR THEIR PREPARATION AND PHARMACEUTICAL COMPOSITIONS CONTAINING THEM | |
| EP0168619B1 (en) | N-acylated di- or tetrahydronaphthalenamines, and antihypertensive compositions containing them | |
| EP0218373B1 (en) | Chroman derivatives and analogues having antihypertensive activity | |
| US5189047A (en) | 2-oxo-1,2-(dihydropyridyl)-2h-1-benzopyrans | |
| US5843989A (en) | C4 -amide substituted compounds and their use as therapeutic agents | |
| US5210234A (en) | Benzopyran intermediates | |
| WO1991009031A1 (en) | Trifluoromethyl substituted compounds and a pharmaceutical composition | |
| EP0516658A1 (en) | Benzopyrans having pharmacological activity | |
| JPH0631212B2 (ja) | クロマノ−ル誘導体、その製法及びそれを含む医薬組成物 |