NO854050L - Fremgangsm¨te for fremstilling av purinderivater. - Google Patents
Fremgangsm¨te for fremstilling av purinderivater.Info
- Publication number
- NO854050L NO854050L NO854050A NO854050A NO854050L NO 854050 L NO854050 L NO 854050L NO 854050 A NO854050 A NO 854050A NO 854050 A NO854050 A NO 854050A NO 854050 L NO854050 L NO 854050L
- Authority
- NO
- Norway
- Prior art keywords
- compound
- formula
- amino
- methyl
- hydrogen
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 42
- 238000002360 preparation method Methods 0.000 title claims description 17
- 150000003212 purines Chemical class 0.000 title claims description 5
- 229940083251 peripheral vasodilators purine derivative Drugs 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 101
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 57
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 27
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 24
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 22
- 238000010992 reflux Methods 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- -1 alkanoyl halide Chemical class 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 15
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 12
- 235000019253 formic acid Nutrition 0.000 claims description 12
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- HANOSGYMKMNFON-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-2-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(N=C(N)N2)=O)=C2N1CC1=CC=CS1 HANOSGYMKMNFON-UHFFFAOYSA-N 0.000 claims description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 8
- 101100134925 Gallus gallus COR6 gene Chemical group 0.000 claims description 6
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 150000007530 organic bases Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- 239000007868 Raney catalyst Substances 0.000 claims description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 3
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 3
- 230000001476 alcoholic effect Effects 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 230000020477 pH reduction Effects 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- HJXJNSKEOFNHCU-UHFFFAOYSA-N thiohypobromous acid Chemical compound BrS HJXJNSKEOFNHCU-UHFFFAOYSA-N 0.000 claims description 2
- 239000000203 mixture Substances 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 27
- 125000001072 heteroaryl group Chemical group 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 16
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000002585 base Substances 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 10
- 238000004809 thin layer chromatography Methods 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000000538 analytical sample Substances 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 5
- UTTPUMOOQSNOHH-UHFFFAOYSA-N 2-amino-6-chloro-5-nitro-1h-pyrimidin-4-one Chemical compound NC1=NC(=O)C([N+]([O-])=O)=C(Cl)N1 UTTPUMOOQSNOHH-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 229910004298 SiO 2 Inorganic materials 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 239000013067 intermediate product Substances 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 150000002832 nitroso derivatives Chemical class 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- VBWACOJLJYUFKJ-UHFFFAOYSA-N 2-amino-6-chloro-1h-pyrimidin-4-one Chemical compound NC1=NC(O)=CC(Cl)=N1 VBWACOJLJYUFKJ-UHFFFAOYSA-N 0.000 description 3
- KBQIJULVUFJCMD-UHFFFAOYSA-N 2-amino-6-chloro-1h-pyrimidin-4-one;hydrate Chemical compound O.NC1=NC(=O)C=C(Cl)N1 KBQIJULVUFJCMD-UHFFFAOYSA-N 0.000 description 3
- RTFXTKZURZECQR-UHFFFAOYSA-N 2-amino-8-bromo-9-(thiophen-2-ylmethyl)-3h-purin-6-one Chemical compound BrC1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 RTFXTKZURZECQR-UHFFFAOYSA-N 0.000 description 3
- XGUKQMNJZJKOAB-UHFFFAOYSA-N 2-amino-9-(thiophen-2-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 XGUKQMNJZJKOAB-UHFFFAOYSA-N 0.000 description 3
- FLFZMCJIHCDWKG-UHFFFAOYSA-N 2-nitrosopyrimidine Chemical compound O=NC1=NC=CC=N1 FLFZMCJIHCDWKG-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 101710101148 Probable 6-oxopurine nucleoside phosphorylase Proteins 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 102000030764 Purine-nucleoside phosphorylase Human genes 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- LBFAAYMITJMZOC-UHFFFAOYSA-N methyl n-(sulfanylidenemethylidene)carbamate Chemical compound COC(=O)N=C=S LBFAAYMITJMZOC-UHFFFAOYSA-N 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 150000003585 thioureas Chemical class 0.000 description 3
- YKBGVTZYEHREMT-KVQBGUIXSA-N 2'-deoxyguanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 YKBGVTZYEHREMT-KVQBGUIXSA-N 0.000 description 2
- RRHCYHMIRJNBBE-UHFFFAOYSA-N 2,5-diamino-6-(thiophen-2-ylmethylamino)-1h-pyrimidin-4-one Chemical compound NC1=NC(O)=C(N)C(NCC=2SC=CC=2)=N1 RRHCYHMIRJNBBE-UHFFFAOYSA-N 0.000 description 2
- DPDYTYOWSIRPMB-UHFFFAOYSA-N 2,8-diamino-9-benzyl-3h-purin-6-one Chemical compound NC1=NC(C(N=C(N)N2)=O)=C2N1CC1=CC=CC=C1 DPDYTYOWSIRPMB-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- FWGSCBXLUQAPSJ-UHFFFAOYSA-N 2-amino-9-(pyridin-3-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CN=C1 FWGSCBXLUQAPSJ-UHFFFAOYSA-N 0.000 description 2
- IZJOIOLODSTRKQ-UHFFFAOYSA-N 2-amino-9-(thiophen-3-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC=1C=CSC=1 IZJOIOLODSTRKQ-UHFFFAOYSA-N 0.000 description 2
- UQOKRDJILZMZKU-UHFFFAOYSA-N 2-nitropyrimidine Chemical compound [O-][N+](=O)C1=NC=CC=N1 UQOKRDJILZMZKU-UHFFFAOYSA-N 0.000 description 2
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 2
- UUYYBUQXUBNWBO-UHFFFAOYSA-N 6-chloro-9-[(2,5-dimethylthiophen-3-yl)methyl]purin-2-amine Chemical compound S1C(C)=CC(CN2C3=NC(N)=NC(Cl)=C3N=C2)=C1C UUYYBUQXUBNWBO-UHFFFAOYSA-N 0.000 description 2
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 208000023275 Autoimmune disease Diseases 0.000 description 2
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 2
- 241001432959 Chernes Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 210000001744 T-lymphocyte Anatomy 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 230000028993 immune response Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- GXHYIFCRBFLFJV-UHFFFAOYSA-N n-[2-amino-4-oxo-6-(thiophen-2-ylmethylamino)-1h-pyrimidin-5-yl]formamide Chemical compound NC1=NC(O)=C(NC=O)C(NCC=2SC=CC=2)=N1 GXHYIFCRBFLFJV-UHFFFAOYSA-N 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- UVCDLICHQNGTDQ-UHFFFAOYSA-N (2-methylthiophen-3-yl)methanamine Chemical compound CC=1SC=CC=1CN UVCDLICHQNGTDQ-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- SWZNXCABBUKIPZ-UHFFFAOYSA-N (3-methylthiophen-2-yl)methanamine Chemical compound CC=1C=CSC=1CN SWZNXCABBUKIPZ-UHFFFAOYSA-N 0.000 description 1
- CKQHNKAVFNDGMK-UHFFFAOYSA-N (4-methylthiophen-2-yl)methanamine Chemical compound CC1=CSC(CN)=C1 CKQHNKAVFNDGMK-UHFFFAOYSA-N 0.000 description 1
- NUOZTFAOKMVNAU-UHFFFAOYSA-N (4-methylthiophen-3-yl)methanamine Chemical compound CC1=CSC=C1CN NUOZTFAOKMVNAU-UHFFFAOYSA-N 0.000 description 1
- XCBYYXLOEBELSB-UHFFFAOYSA-N (5-methylthiophen-2-yl)methanamine Chemical compound CC1=CC=C(CN)S1 XCBYYXLOEBELSB-UHFFFAOYSA-N 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- YFEQTUUFQKDATK-UHFFFAOYSA-N 1,3-thiazol-4-ylmethanamine Chemical class NCC1=CSC=N1 YFEQTUUFQKDATK-UHFFFAOYSA-N 0.000 description 1
- WHTPXNOFEHTZAD-UHFFFAOYSA-N 1-benzothiophen-3-ylmethanamine Chemical compound C1=CC=C2C(CN)=CSC2=C1 WHTPXNOFEHTZAD-UHFFFAOYSA-N 0.000 description 1
- YKBGVTZYEHREMT-UHFFFAOYSA-N 2'-deoxyguanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1CC(O)C(CO)O1 YKBGVTZYEHREMT-UHFFFAOYSA-N 0.000 description 1
- QPLJYAKLSCXZSF-UHFFFAOYSA-N 2,2,2-trichloroethyl carbamate Chemical compound NC(=O)OCC(Cl)(Cl)Cl QPLJYAKLSCXZSF-UHFFFAOYSA-N 0.000 description 1
- FNHDYMUTPWGWOS-UHFFFAOYSA-N 2,8-diamino-9-(1-benzothiophen-3-ylmethyl)-3h-purin-6-one Chemical compound C1=CC=C2C(CN3C4=C(C(NC(N)=N4)=O)N=C3N)=CSC2=C1 FNHDYMUTPWGWOS-UHFFFAOYSA-N 0.000 description 1
- OLBVURXVSQVSRV-UHFFFAOYSA-N 2,8-diamino-9-(2-thiophen-2-ylethyl)-3h-purine-6-thione Chemical compound NC1=NC(C(NC(N)=N2)=S)=C2N1CCC1=CC=CS1 OLBVURXVSQVSRV-UHFFFAOYSA-N 0.000 description 1
- NYGYCWXHKOAMBG-UHFFFAOYSA-N 2,8-diamino-9-(furan-2-ylmethyl)-3h-purin-6-one;hydrochloride Chemical compound Cl.NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=CC=CO1 NYGYCWXHKOAMBG-UHFFFAOYSA-N 0.000 description 1
- QHVQPAAULQUWLA-UHFFFAOYSA-N 2,8-diamino-9-(pyridin-3-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=CC=CN=C1 QHVQPAAULQUWLA-UHFFFAOYSA-N 0.000 description 1
- KDXSWYYLKBNAER-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-3-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC=1C=CSC=1 KDXSWYYLKBNAER-UHFFFAOYSA-N 0.000 description 1
- AJNMPHPNOVEHBF-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-3-ylmethyl)-3h-purine-6-thione Chemical compound NC1=NC(C(NC(N)=N2)=S)=C2N1CC=1C=CSC=1 AJNMPHPNOVEHBF-UHFFFAOYSA-N 0.000 description 1
- NMXRHXGJJDANLN-UHFFFAOYSA-N 2,8-diamino-9-[(3-methylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound C1=CSC(CN2C3=C(C(NC(N)=N3)=O)N=C2N)=C1C NMXRHXGJJDANLN-UHFFFAOYSA-N 0.000 description 1
- IBEZMJMQYVIOCV-UHFFFAOYSA-N 2,8-diamino-9-thiophen-2-yl-1H-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1C1=CC=CS1 IBEZMJMQYVIOCV-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- UKOXTIWIKNTMGX-UHFFFAOYSA-N 2-amino-5-nitro-6-(pyridin-3-ylmethylamino)-1h-pyrimidin-4-one Chemical compound NC1=NC(O)=C([N+]([O-])=O)C(NCC=2C=NC=CC=2)=N1 UKOXTIWIKNTMGX-UHFFFAOYSA-N 0.000 description 1
- PREHWLIZVPFWFS-UHFFFAOYSA-N 2-amino-8-bromo-9-(furan-2-ylmethyl)-3h-purin-6-one Chemical compound BrC1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CO1 PREHWLIZVPFWFS-UHFFFAOYSA-N 0.000 description 1
- CWQGUURMARPOSM-UHFFFAOYSA-N 2-amino-8-bromo-9-(pyridin-3-ylmethyl)-3h-purin-6-one Chemical compound BrC1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CN=C1 CWQGUURMARPOSM-UHFFFAOYSA-N 0.000 description 1
- KEZPNGRCBLGXDO-UHFFFAOYSA-N 2-amino-8-bromo-9-[(2-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2Br)=C1C KEZPNGRCBLGXDO-UHFFFAOYSA-N 0.000 description 1
- YBCJDBQVUIVSEG-UHFFFAOYSA-N 2-amino-8-bromo-9-[(5-ethylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound S1C(CC)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1Br YBCJDBQVUIVSEG-UHFFFAOYSA-N 0.000 description 1
- AHQUKPPEAVWGPM-UHFFFAOYSA-N 2-amino-8-sulfanylidene-9-(thiophen-2-ylmethyl)-3,7-dihydropurin-6-one Chemical compound S=C1NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 AHQUKPPEAVWGPM-UHFFFAOYSA-N 0.000 description 1
- AVGUPPFXTBXGOO-UHFFFAOYSA-N 2-amino-9-(1-benzothiophen-3-ylmethyl)-3h-purin-6-one Chemical compound C1=CC=C2C(CN3C=4N=C(NC(=O)C=4N=C3)N)=CSC2=C1 AVGUPPFXTBXGOO-UHFFFAOYSA-N 0.000 description 1
- VZDSMYDMHAIMIF-UHFFFAOYSA-N 2-amino-9-(1-benzothiophen-3-ylmethyl)-8-bromo-3h-purin-6-one Chemical compound C1=CC=C2C(CN3C=4N=C(NC(=O)C=4N=C3Br)N)=CSC2=C1 VZDSMYDMHAIMIF-UHFFFAOYSA-N 0.000 description 1
- YIESXWHNAVYZRL-UHFFFAOYSA-N 2-amino-9-(furan-2-ylmethyl)-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1CC1=CC=CO1 YIESXWHNAVYZRL-UHFFFAOYSA-N 0.000 description 1
- ZMKXIOIMNRMMNU-UHFFFAOYSA-N 2-amino-9-(furan-3-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC=1C=COC=1 ZMKXIOIMNRMMNU-UHFFFAOYSA-N 0.000 description 1
- YWDAJVWTHBUPME-UHFFFAOYSA-N 2-amino-9-(pyridin-2-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CC=N1 YWDAJVWTHBUPME-UHFFFAOYSA-N 0.000 description 1
- AHAAXBSDIBQKNA-UHFFFAOYSA-N 2-amino-9-(thiophen-2-ylmethyl)-3,7-dihydropurine-6,8-dione Chemical compound O=C1NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 AHAAXBSDIBQKNA-UHFFFAOYSA-N 0.000 description 1
- NZGJOZPYJVYWIX-UHFFFAOYSA-N 2-amino-9-[(2,5-dimethylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C(C)=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2)=C1C NZGJOZPYJVYWIX-UHFFFAOYSA-N 0.000 description 1
- CSRIGUNBCXUPSC-UHFFFAOYSA-N 2-amino-9-[(2-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2)=C1C CSRIGUNBCXUPSC-UHFFFAOYSA-N 0.000 description 1
- DSQAJRAGTMCJAH-UHFFFAOYSA-N 2-amino-9-[(3-methylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound C1=CSC(CN2C3=C(C(NC(N)=N3)=O)N=C2)=C1C DSQAJRAGTMCJAH-UHFFFAOYSA-N 0.000 description 1
- JBKGOZGSAOGTMM-UHFFFAOYSA-N 2-amino-9-[(5-ethylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound S1C(CC)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1 JBKGOZGSAOGTMM-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- HVLUYXIJZLDNIS-UHFFFAOYSA-N 2-thiophen-2-ylethanamine Chemical compound NCCC1=CC=CS1 HVLUYXIJZLDNIS-UHFFFAOYSA-N 0.000 description 1
- OANLWIQYRRVBPY-UHFFFAOYSA-N 2-thiophen-3-ylethanamine Chemical compound NCCC=1C=CSC=1 OANLWIQYRRVBPY-UHFFFAOYSA-N 0.000 description 1
- KBWHYRUAHXHHFO-UHFFFAOYSA-N 3-(bromomethyl)thiophene Chemical compound BrCC=1C=CSC=1 KBWHYRUAHXHHFO-UHFFFAOYSA-N 0.000 description 1
- KTESLEPUDPKBQS-UHFFFAOYSA-N 3-(chloromethyl)-2,5-dimethylthiophene Chemical compound CC1=CC(CCl)=C(C)S1 KTESLEPUDPKBQS-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ZZEFHDRVGBYNKP-UHFFFAOYSA-N 5-methylthiophene-3-carbonitrile Chemical compound CC1=CC(C#N)=CS1 ZZEFHDRVGBYNKP-UHFFFAOYSA-N 0.000 description 1
- YZFUAIWTNMWSEP-UHFFFAOYSA-N 5-nitrosopyrimidine Chemical compound O=NC1=CN=CN=C1 YZFUAIWTNMWSEP-UHFFFAOYSA-N 0.000 description 1
- JBKJLIZMXQIUOD-UHFFFAOYSA-N 6-chloro-9-(furan-3-ylmethyl)purin-2-amine Chemical compound C12=NC(N)=NC(Cl)=C2N=CN1CC=1C=COC=1 JBKJLIZMXQIUOD-UHFFFAOYSA-N 0.000 description 1
- ARYJTYGVCCBDIN-UHFFFAOYSA-N 6-chloro-9-(thiophen-2-ylmethyl)purin-2-amine Chemical compound C12=NC(N)=NC(Cl)=C2N=CN1CC1=CC=CS1 ARYJTYGVCCBDIN-UHFFFAOYSA-N 0.000 description 1
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241000972773 Aulopiformes Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 238000005642 Gabriel synthesis reaction Methods 0.000 description 1
- 244000303040 Glycyrrhiza glabra Species 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- SGSSKEDGVONRGC-UHFFFAOYSA-N N(2)-methylguanine Chemical class O=C1NC(NC)=NC2=C1N=CN2 SGSSKEDGVONRGC-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- BRIOKNPDCPJCOD-UHFFFAOYSA-N [1,3]oxazolo[5,4-d]pyrimidine Chemical compound N1=CN=C2OC=NC2=C1 BRIOKNPDCPJCOD-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 210000003719 b-lymphocyte Anatomy 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- VGONTNSXDCQUGY-UHFFFAOYSA-N desoxyinosine Natural products C1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 VGONTNSXDCQUGY-UHFFFAOYSA-N 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- DFYIGRMVKIBMAE-UHFFFAOYSA-N ethenoxycarbamic acid Chemical compound OC(=O)NOC=C DFYIGRMVKIBMAE-UHFFFAOYSA-N 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- BDTDECDAHYOJRO-UHFFFAOYSA-N ethyl n-(sulfanylidenemethylidene)carbamate Chemical compound CCOC(=O)N=C=S BDTDECDAHYOJRO-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- NKKLCOFTJVNYAQ-UHFFFAOYSA-N formamidopyrimidine Chemical compound O=CNC1=CN=CN=C1 NKKLCOFTJVNYAQ-UHFFFAOYSA-N 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000007365 immunoregulation Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 229960003786 inosine Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000006626 methoxycarbonylamino group Chemical group 0.000 description 1
- VHWYCFISAQVCCP-UHFFFAOYSA-N methoxymethanol Chemical compound COCO VHWYCFISAQVCCP-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- CZPIFUKBPKTEBW-UHFFFAOYSA-N methyl n-[5-amino-7-(thiophen-2-ylmethylamino)-[1,3]oxazolo[5,4-d]pyrimidin-2-yl]carbamate Chemical compound N1=C(N)N=C2OC(NC(=O)OC)=NC2=C1NCC1=CC=CS1 CZPIFUKBPKTEBW-UHFFFAOYSA-N 0.000 description 1
- HZHKILXEHNVAGQ-UHFFFAOYSA-N methyl n-[[2-amino-4-oxo-6-(thiophen-2-ylmethylamino)-1h-pyrimidin-5-yl]carbamothioyl]carbamate Chemical compound N1=C(N)NC(=O)C(NC(=S)NC(=O)OC)=C1NCC1=CC=CS1 HZHKILXEHNVAGQ-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 150000004682 monohydrates Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- 206010028417 myasthenia gravis Diseases 0.000 description 1
- OOPUOUDGOMMYFX-UHFFFAOYSA-N n,5-dimethylthiophen-3-amine Chemical compound CNC1=CSC(C)=C1 OOPUOUDGOMMYFX-UHFFFAOYSA-N 0.000 description 1
- DCARUSOBDOKFAW-UHFFFAOYSA-N n-[2-amino-4-oxo-6-(thiophen-3-ylmethylamino)-1h-pyrimidin-5-yl]formamide Chemical compound N1C(N)=NC(=O)C(NC=O)=C1NCC1=CSC=C1 DCARUSOBDOKFAW-UHFFFAOYSA-N 0.000 description 1
- ILUJLVQQODYZIH-UHFFFAOYSA-N n-[2-amino-6-(furan-2-ylmethylamino)-4-oxo-1h-pyrimidin-5-yl]formamide Chemical compound NC1=NC(O)=C(NC=O)C(NCC=2OC=CC=2)=N1 ILUJLVQQODYZIH-UHFFFAOYSA-N 0.000 description 1
- QZOXGUAYKVINCV-UHFFFAOYSA-N n-[8-acetamido-6-oxo-9-(thiophen-2-ylmethyl)-3h-purin-2-yl]acetamide Chemical compound CC(=O)NC1=NC(C(NC(NC(C)=O)=N2)=O)=C2N1CC1=CC=CS1 QZOXGUAYKVINCV-UHFFFAOYSA-N 0.000 description 1
- VOTRSJZDUJWNGN-UHFFFAOYSA-N n-methyl-1-benzothiophen-2-amine Chemical compound C1=CC=C2SC(NC)=CC2=C1 VOTRSJZDUJWNGN-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 1
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical class NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 235000019515 salmon Nutrition 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- DUDAKCCDHRNMDJ-UHFFFAOYSA-N thiophen-3-ylmethanamine Chemical compound NCC=1C=CSC=1 DUDAKCCDHRNMDJ-UHFFFAOYSA-N 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO892780A NO892780D0 (no) | 1984-10-12 | 1989-07-05 | Nye (oksazolo(5,4-d)pyrimidin-2-yl)karbamater. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US66015284A | 1984-10-12 | 1984-10-12 | |
| US06/767,202 US4772606A (en) | 1985-08-22 | 1985-08-22 | Purine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO854050L true NO854050L (no) | 1986-04-14 |
Family
ID=27097992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO854050A NO854050L (no) | 1984-10-12 | 1985-10-11 | Fremgangsm¨te for fremstilling av purinderivater. |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP0178178A3 (el) |
| KR (1) | KR860003255A (el) |
| AU (1) | AU584126B2 (el) |
| CA (1) | CA1260934A (el) |
| DK (1) | DK458485A (el) |
| ES (2) | ES8609328A1 (el) |
| FI (1) | FI853891L (el) |
| GR (1) | GR852468B (el) |
| HU (1) | HU197747B (el) |
| IL (1) | IL76546A (el) |
| NO (1) | NO854050L (el) |
| NZ (1) | NZ213798A (el) |
| OA (1) | OA08120A (el) |
| PH (1) | PH22811A (el) |
| PT (1) | PT81293B (el) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ228645A (en) * | 1988-04-11 | 1991-09-25 | Iaf Biochem Int | 1,3-dioxolane derivatives substituted in the 5th position by a purine or pyrimidine radical; treatment of viral infections |
| DE69031337T2 (de) * | 1989-02-27 | 1998-03-05 | Biocryst | 9-substituierte-8-unsubstituierte-9-deazaguanine |
| US4939252A (en) * | 1989-04-20 | 1990-07-03 | Hoffmann-La Roche Inc. | Novel intermediates for the preparation of Carbovir |
| IL94390A (en) * | 1989-05-30 | 1996-03-31 | Merck & Co Inc | The 6-membered trans-nitrogen-containing heterocycles are compressed with imidazo and pharmaceutical preparations containing them |
| US5217983A (en) * | 1992-03-27 | 1993-06-08 | Du Pont Merck Pharmaceutical Company | (N-benzyl) acetaldehyde bicyclic heterocycles useful as topical antiinflammatories |
| US5272169A (en) * | 1992-03-27 | 1993-12-21 | The Dupont Merck Pharmaceutical Company | (N-benzyl) acetaldehyde bicyclic heterocycles useful as topical antiinflammatories |
| JPH10507171A (ja) * | 1994-10-05 | 1998-07-14 | カイロサイエンス・リミテッド | Ｐｎｐインヒビターとしてのプリンおよびグアニン化合物 |
| DE19501482A1 (de) * | 1995-01-19 | 1996-07-25 | Bayer Ag | 2,9-disubstituierte Purin-6-one |
| GB9520364D0 (en) * | 1995-10-05 | 1995-12-06 | Chiroscience Ltd | Compouundds |
| GB9520363D0 (en) * | 1995-10-05 | 1995-12-06 | Chiroscience Ltd | Compounds |
| DE19541264A1 (de) * | 1995-11-06 | 1997-05-07 | Bayer Ag | Purin-6-on-derivate |
| EP2336133A1 (en) | 2001-10-30 | 2011-06-22 | Conforma Therapeutics Corporation | Purine analogs having HSP90-inhibiting activity |
| BRPI0414533A (pt) | 2003-09-18 | 2006-11-07 | Conforma Therapeutics Corp | composto, composição farmacêutica, e, métodos para inibir um hsp90 e para tratar um indivìduo tendo um distúrbio mediado por hsp90 |
| CA2602257A1 (en) * | 2005-03-30 | 2006-10-05 | Conforma Therapeutics Corporation | Alkynyl pyrrolopyrimidines and related analogs as hsp90-inhibitors |
| EP2773207B1 (en) * | 2011-10-31 | 2018-03-07 | Merck Sharp & Dohme Corp. | Aminopyrimidinones as interleukin receptor-associated kinase inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2844578A (en) * | 1955-09-14 | 1958-07-22 | Du Pont | Pyrimidine derivatives |
-
1985
- 1985-10-02 IL IL76546A patent/IL76546A/xx unknown
- 1985-10-04 AU AU48292/85A patent/AU584126B2/en not_active Ceased
- 1985-10-07 FI FI853891A patent/FI853891L/fi not_active Application Discontinuation
- 1985-10-08 DK DK458485A patent/DK458485A/da not_active Application Discontinuation
- 1985-10-10 CA CA000492727A patent/CA1260934A/en not_active Expired
- 1985-10-10 PH PH32916A patent/PH22811A/en unknown
- 1985-10-11 OA OA58702A patent/OA08120A/xx unknown
- 1985-10-11 EP EP85307283A patent/EP0178178A3/en not_active Withdrawn
- 1985-10-11 NO NO854050A patent/NO854050L/no unknown
- 1985-10-11 NZ NZ213798A patent/NZ213798A/xx unknown
- 1985-10-11 GR GR852468A patent/GR852468B/el unknown
- 1985-10-11 ES ES547805A patent/ES8609328A1/es not_active Expired
- 1985-10-11 PT PT81293A patent/PT81293B/pt not_active IP Right Cessation
- 1985-10-11 HU HU853956A patent/HU197747B/hu not_active IP Right Cessation
- 1985-10-12 KR KR1019850007507A patent/KR860003255A/ko not_active IP Right Cessation
-
1986
- 1986-04-01 ES ES553606A patent/ES8801273A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| HUT40131A (en) | 1986-11-28 |
| DK458485A (da) | 1986-04-13 |
| FI853891L (fi) | 1986-04-13 |
| NZ213798A (en) | 1989-01-06 |
| IL76546A (en) | 1988-12-30 |
| ES553606A0 (es) | 1987-12-16 |
| ES8609328A1 (es) | 1986-09-01 |
| CA1260934A (en) | 1989-09-26 |
| KR860003255A (ko) | 1986-05-21 |
| IL76546A0 (en) | 1986-02-28 |
| PH22811A (en) | 1988-12-27 |
| ES8801273A1 (es) | 1987-12-16 |
| EP0178178A3 (en) | 1987-08-12 |
| EP0178178A2 (en) | 1986-04-16 |
| PT81293B (pt) | 1988-02-17 |
| HU197747B (en) | 1989-05-29 |
| FI853891A0 (fi) | 1985-10-07 |
| ES547805A0 (es) | 1986-09-01 |
| DK458485D0 (da) | 1985-10-08 |
| AU584126B2 (en) | 1989-05-18 |
| OA08120A (fr) | 1987-03-31 |
| AU4829285A (en) | 1986-04-17 |
| PT81293A (en) | 1985-11-01 |
| GR852468B (el) | 1986-02-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4772606A (en) | Purine derivatives | |
| DE60101158T2 (de) | 8-chinolinxanthin and 8-isochinolinxanthin derivate als pde 5 inhibitoren | |
| US5866702A (en) | Purine inhibitors of cyclin dependent kinase 2 | |
| Robins | Potential purine antagonists. I. Synthesis of some 4, 6-substituted pyrazolo [3, 4-d] pyrimidines1 | |
| NO854050L (no) | Fremgangsm¨te for fremstilling av purinderivater. | |
| JP2896532B2 (ja) | 新規なピリミジン誘導体およびその製造方法 | |
| WO2011082098A1 (en) | Lysine and arginine methyltransferase inhibitors for treating cancer | |
| EP1784402A1 (en) | PYRROLO[3,2-c]PYRIDINE DERIVATIVES AND PROCESSES FOR THE PREPARATION THEREOF | |
| CA1293727C (en) | 9-deazaguanines | |
| US4952693A (en) | Oxazolo-pyrimidine derivatives | |
| NO180587B (no) | Fremgangsmåte for fremstilling av 5-substituerte pyrrolo(2,3-d)pyrimidiner | |
| NO180049B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive 9-substituerte-8-usubstituerte-9-deazaguaniner | |
| CN108349975B (zh) | 4H-吡唑并[1,5-α]苯并咪唑类化合物晶型及其制备方法和中间体 | |
| NO164542B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyrazolo(3,4-d)-pyrimidinderivater. | |
| EP0053789B1 (en) | 2-pyridinecarboxamide derivative, process for preparing same and pharmaceutical composition, useful as an anti-allergic agent | |
| WO2003106459A1 (en) | Amide substituted xanthine derivatives with gluconeogenesis modulating activity | |
| Brown | Improved syntheses in the pyrimidine series. IV. N‐methyl derivatives of 4: 5‐diaminopyrimidine | |
| US6919337B2 (en) | 8-Quinolinxanthine and 8-isoquinolinxanthine derivatives as PDE 5 inhibitors | |
| Nieto et al. | Synthesis and pharmacological evaluation of novel substituted 9-deazaxanthines as A2B receptor antagonists | |
| US5281708A (en) | 9-Substituted-8-halo or -8-hydroxy-9-deazaguanines as inhibitors of PNP | |
| JPS61137886A (ja) | プリン誘導体 | |
| CA1289138C (en) | Intermediates for purine derivatives | |
| US5051429A (en) | "Pyrimidine derivatives" | |
| US7361661B2 (en) | 8-quinolinxanthine and 8-isoquinolinxanthine derivatives as PDE 5 inhibitors | |
| CS264281B2 (cs) | Způsob výroby purinových derivátů |