NO843735L - Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-amino-benzoesyrederivater - Google Patents
Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-amino-benzoesyrederivaterInfo
- Publication number
- NO843735L NO843735L NO843735A NO843735A NO843735L NO 843735 L NO843735 L NO 843735L NO 843735 A NO843735 A NO 843735A NO 843735 A NO843735 A NO 843735A NO 843735 L NO843735 L NO 843735L
- Authority
- NO
- Norway
- Prior art keywords
- group
- benzoic acid
- carbon atoms
- yield
- melting point
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 7
- RWZYAGGXGHYGMB-WGGUOBTBSA-N 2-aminobenzoic acid Chemical class NC1=CC=CC=C1[14C](O)=O RWZYAGGXGHYGMB-WGGUOBTBSA-N 0.000 title claims 4
- 230000001225 therapeutic effect Effects 0.000 title 1
- -1 piperazino group Chemical group 0.000 claims description 125
- 125000004432 carbon atom Chemical group C* 0.000 claims description 46
- 239000005711 Benzoic acid Substances 0.000 claims description 45
- 150000001875 compounds Chemical class 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 239000012954 diazonium Substances 0.000 claims description 10
- 150000001989 diazonium salts Chemical class 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 10
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- 150000007522 mineralic acids Chemical class 0.000 claims description 8
- 150000007524 organic acids Chemical class 0.000 claims description 8
- 235000005985 organic acids Nutrition 0.000 claims description 8
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000004122 cyclic group Chemical group 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 125000005505 thiomorpholino group Chemical group 0.000 claims description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 150000002828 nitro derivatives Chemical class 0.000 claims description 2
- 230000000269 nucleophilic effect Effects 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000002344 aminooxy group Chemical group [H]N([H])O[*] 0.000 claims 1
- 238000002844 melting Methods 0.000 description 160
- 230000008018 melting Effects 0.000 description 160
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 41
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000243 solution Substances 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 12
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 235000010288 sodium nitrite Nutrition 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- AWUSNAPJSJWXMU-UHFFFAOYSA-N 2-(azepan-1-yl)-5-chlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCCCCC1 AWUSNAPJSJWXMU-UHFFFAOYSA-N 0.000 description 4
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- QUEKGYQTRJVEQC-UHFFFAOYSA-N 2516-96-3 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1Cl QUEKGYQTRJVEQC-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- YXBGPWYFIJPTPK-UHFFFAOYSA-N 2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-5-nitrobenzoic acid Chemical compound O1CCOC11CCN(CC1)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] YXBGPWYFIJPTPK-UHFFFAOYSA-N 0.000 description 2
- HNTSIQICPWAIER-UHFFFAOYSA-N 2-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-5-nitrobenzoic acid Chemical compound C1N(CCC2CCCCC12)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] HNTSIQICPWAIER-UHFFFAOYSA-N 0.000 description 2
- DADPWHUJQRSREC-UHFFFAOYSA-N 2-(3,4,4a,5,6,7,8,8a-octahydro-1h-isoquinolin-2-yl)-5-aminobenzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CC2CCCCC2CC1 DADPWHUJQRSREC-UHFFFAOYSA-N 0.000 description 2
- QOJMMCVSGRDNJA-UHFFFAOYSA-N 2-(azepan-1-yl)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCCCCC1 QOJMMCVSGRDNJA-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- UNZIRKAVOTVSQE-UHFFFAOYSA-N 5-amino-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)benzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCC2(OCCO2)CC1 UNZIRKAVOTVSQE-UHFFFAOYSA-N 0.000 description 2
- MFVAUMXIVHUYOK-UHFFFAOYSA-N 5-amino-2-(azepan-1-yl)benzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCCCCC1 MFVAUMXIVHUYOK-UHFFFAOYSA-N 0.000 description 2
- MNKKPODCJXOTFM-UHFFFAOYSA-N 5-chloro-2-(4-methoxypiperidin-1-yl)benzoic acid Chemical compound C1CC(OC)CCN1C1=CC=C(Cl)C=C1C(O)=O MNKKPODCJXOTFM-UHFFFAOYSA-N 0.000 description 2
- HCXWVEFBJYGVAM-UHFFFAOYSA-N 5-chloro-2-morpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCOCC1 HCXWVEFBJYGVAM-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000037213 diet Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- BHQCQFFYRZLCQQ-UHFFFAOYSA-N (3alpha,5alpha,7alpha,12alpha)-3,7,12-trihydroxy-cholan-24-oic acid Natural products OC1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 BHQCQFFYRZLCQQ-UHFFFAOYSA-N 0.000 description 1
- NENLYAQPNATJSU-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline Chemical compound C1NCCC2CCCCC21 NENLYAQPNATJSU-UHFFFAOYSA-N 0.000 description 1
- KPKNTUUIEVXMOH-UHFFFAOYSA-N 1,4-dioxa-8-azaspiro[4.5]decane Chemical compound O1CCOC11CCNCC1 KPKNTUUIEVXMOH-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- ODSNARDHJFFSRH-UHFFFAOYSA-N 2,3,3a,4,5,6,7,7a-octahydro-1h-isoindole Chemical compound C1CCCC2CNCC21 ODSNARDHJFFSRH-UHFFFAOYSA-N 0.000 description 1
- NCSLSNBZPNXIBP-UHFFFAOYSA-N 2-(1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[d]azepin-3-yl)-5-aminobenzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCC2CCCCC2CC1 NCSLSNBZPNXIBP-UHFFFAOYSA-N 0.000 description 1
- JZGMTBXIAZMCBM-UHFFFAOYSA-N 2-(1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[d]azepin-3-yl)-5-bromobenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1N1CCC2CCCCC2CC1 JZGMTBXIAZMCBM-UHFFFAOYSA-N 0.000 description 1
- DRNZCKFDAGHCGO-UHFFFAOYSA-N 2-(1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[d]azepin-3-yl)-5-chlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCC2CCCCC2CC1 DRNZCKFDAGHCGO-UHFFFAOYSA-N 0.000 description 1
- XZDVFURWMBCIOX-UHFFFAOYSA-N 2-(1,2,4,5,5a,6,7,8,9,9a-decahydrobenzo[d]azepin-3-yl)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCC2CCCCC2CC1 XZDVFURWMBCIOX-UHFFFAOYSA-N 0.000 description 1
- BUSXHOIFZKTAFN-UHFFFAOYSA-N 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-aminobenzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CC2CCCCC2C1 BUSXHOIFZKTAFN-UHFFFAOYSA-N 0.000 description 1
- FZVHZMBTLAIRLJ-UHFFFAOYSA-N 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-chlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CC2CCCCC2C1 FZVHZMBTLAIRLJ-UHFFFAOYSA-N 0.000 description 1
- NXHPJMQPCZEENH-UHFFFAOYSA-N 2-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CC2CCCCC2C1 NXHPJMQPCZEENH-UHFFFAOYSA-N 0.000 description 1
- JDWVAQCMYYHYJY-UHFFFAOYSA-N 2-(1,4-dioxa-9-azaspiro[4.6]undecan-9-yl)-5-nitrobenzoic acid Chemical compound O1CCOC11CCN(CCC1)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] JDWVAQCMYYHYJY-UHFFFAOYSA-N 0.000 description 1
- ARCGWSIHHQVAJL-UHFFFAOYSA-N 2-(2-methylpiperidin-1-yl)-5-nitrobenzoic acid Chemical compound CC1CCCCN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O ARCGWSIHHQVAJL-UHFFFAOYSA-N 0.000 description 1
- HCVFLTYSLOFRCI-UHFFFAOYSA-N 2-(3,4,4a,5,6,7,8,8a-octahydro-1h-isoquinolin-2-yl)-5-chlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CC2CCCCC2CC1 HCVFLTYSLOFRCI-UHFFFAOYSA-N 0.000 description 1
- AASLSVODTGLLBH-UHFFFAOYSA-N 2-(3,5-dimethylmorpholin-4-yl)-5-nitrobenzoic acid Chemical compound CC1COCC(C)N1C1=CC=C([N+]([O-])=O)C=C1C(O)=O AASLSVODTGLLBH-UHFFFAOYSA-N 0.000 description 1
- RBARJOPUOKMYJM-UHFFFAOYSA-N 2-(3,5-dimethylpiperidin-1-yl)-5-nitrobenzoic acid Chemical compound C1C(C)CC(C)CN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O RBARJOPUOKMYJM-UHFFFAOYSA-N 0.000 description 1
- DIQJRFDFQZDOTB-UHFFFAOYSA-N 2-(3,5-dimethylthiomorpholin-4-yl)-5-nitrobenzoic acid Chemical compound CC1CSCC(C)N1C1=CC=C([N+]([O-])=O)C=C1C(O)=O DIQJRFDFQZDOTB-UHFFFAOYSA-N 0.000 description 1
- IVCXWVWJQYYSHS-UHFFFAOYSA-N 2-(3-azabicyclo[3.2.2]nonan-3-yl)-5-chlorobenzoic acid Chemical compound C12CN(CC(CC1)CC2)C1=C(C(=O)O)C=C(C=C1)Cl IVCXWVWJQYYSHS-UHFFFAOYSA-N 0.000 description 1
- WRLGOKFPAURMRC-UHFFFAOYSA-N 2-(3-azabicyclo[3.2.2]nonan-3-yl)-5-nitrobenzoic acid Chemical compound C12CN(CC(CC1)CC2)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] WRLGOKFPAURMRC-UHFFFAOYSA-N 0.000 description 1
- QOEMYWHGIQIVQX-UHFFFAOYSA-N 2-(3-methylpiperidin-1-yl)-5-nitrobenzoic acid Chemical compound C1C(C)CCCN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O QOEMYWHGIQIVQX-UHFFFAOYSA-N 0.000 description 1
- PDGGKKIWCLVVRV-UHFFFAOYSA-N 2-(4-benzylpiperazin-1-yl)-5-nitrobenzoic acid hydrochloride Chemical compound Cl.C(C1=CC=CC=C1)N1CCN(CC1)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] PDGGKKIWCLVVRV-UHFFFAOYSA-N 0.000 description 1
- ZLASGXOTUKQSAT-UHFFFAOYSA-N 2-(4-ethoxycarbonylpiperazin-1-yl)-5-nitrobenzoic acid Chemical compound C1CN(C(=O)OCC)CCN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O ZLASGXOTUKQSAT-UHFFFAOYSA-N 0.000 description 1
- ZMRKWYMLWHYGLO-UHFFFAOYSA-N 2-(4-methoxypiperidin-1-yl)-5-nitrobenzoic acid Chemical compound C1CC(OC)CCN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O ZMRKWYMLWHYGLO-UHFFFAOYSA-N 0.000 description 1
- ISYLQMMLDFSLPI-UHFFFAOYSA-N 2-(4-methylpiperidin-1-yl)-5-nitrobenzoic acid Chemical compound C1CC(C)CCN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O ISYLQMMLDFSLPI-UHFFFAOYSA-N 0.000 description 1
- FDCUCRQWRNAOAT-UHFFFAOYSA-N 2-(5-ethyl-2-methylpiperidin-1-yl)-5-nitrobenzoic acid Chemical compound C1C(CC)CCC(C)N1C1=CC=C([N+]([O-])=O)C=C1C(O)=O FDCUCRQWRNAOAT-UHFFFAOYSA-N 0.000 description 1
- XCVVJJCXGYGILD-UHFFFAOYSA-N 2-(azepan-1-yl)-5-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1N1CCCCCC1 XCVVJJCXGYGILD-UHFFFAOYSA-N 0.000 description 1
- KWYLWYSUPXFVJH-UHFFFAOYSA-N 2-(azepan-1-yl)-5-methoxybenzoic acid Chemical compound COc1ccc(N2CCCCCC2)c(c1)C(O)=O KWYLWYSUPXFVJH-UHFFFAOYSA-N 0.000 description 1
- BUJFBAITAVQTIH-UHFFFAOYSA-N 2-(n-methylanilino)-5-nitrobenzoic acid Chemical compound C=1C=C([N+]([O-])=O)C=C(C(O)=O)C=1N(C)C1=CC=CC=C1 BUJFBAITAVQTIH-UHFFFAOYSA-N 0.000 description 1
- RBARJOPUOKMYJM-UWVGGRQHSA-N 2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-5-nitrobenzoic acid Chemical compound C[C@@H]1CN(C[C@H](C1)C)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] RBARJOPUOKMYJM-UWVGGRQHSA-N 0.000 description 1
- OFWGPDGSUXWDRC-AOOOYVTPSA-N 2-[(3s,5r)-3,5-dimethylpiperidin-1-yl]-5-hydroxybenzoic acid Chemical compound C1[C@@H](C)C[C@@H](C)CN1C1=CC=C(O)C=C1C(O)=O OFWGPDGSUXWDRC-AOOOYVTPSA-N 0.000 description 1
- QOSWBJPYTNETKC-UHFFFAOYSA-N 2-[4-(4-chlorophenyl)piperazin-1-yl]-5-nitrobenzoic acid hydrochloride Chemical compound Cl.ClC1=CC=C(C=C1)N1CCN(CC1)C1=C(C(=O)O)C=C(C=C1)[N+](=O)[O-] QOSWBJPYTNETKC-UHFFFAOYSA-N 0.000 description 1
- KPVQAYNICSKZLI-UHFFFAOYSA-N 2-[4-(furan-2-carbonyl)piperazin-1-yl]-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCN(C(=O)C=2OC=CC=2)CC1 KPVQAYNICSKZLI-UHFFFAOYSA-N 0.000 description 1
- SLJIKKRTQUDACV-UHFFFAOYSA-N 2-[benzyl(methyl)amino]-5-chlorobenzoic acid Chemical compound C=1C=C(Cl)C=C(C(O)=O)C=1N(C)CC1=CC=CC=C1 SLJIKKRTQUDACV-UHFFFAOYSA-N 0.000 description 1
- HCZNADAWKQXMGG-UHFFFAOYSA-N 2-[benzyl(methyl)amino]-5-nitrobenzoic acid Chemical compound C=1C=C([N+]([O-])=O)C=C(C(O)=O)C=1N(C)CC1=CC=CC=C1 HCZNADAWKQXMGG-UHFFFAOYSA-N 0.000 description 1
- UMQNWTHSAFNNEA-UHFFFAOYSA-N 2-[butyl(cyclohexyl)amino]-5-chlorobenzoic acid Chemical compound C=1C=C(Cl)C=C(C(O)=O)C=1N(CCCC)C1CCCCC1 UMQNWTHSAFNNEA-UHFFFAOYSA-N 0.000 description 1
- GZSOVFNHSLRROK-UHFFFAOYSA-N 2-[butyl(cyclohexyl)amino]-5-nitrobenzoic acid Chemical compound C=1C=C([N+]([O-])=O)C=C(C(O)=O)C=1N(CCCC)C1CCCCC1 GZSOVFNHSLRROK-UHFFFAOYSA-N 0.000 description 1
- IGMFWKIEEYQDNZ-UHFFFAOYSA-N 2-[cyclohexyl(2-methylpropyl)amino]-5-nitrobenzoic acid Chemical compound C=1C=C([N+]([O-])=O)C=C(C(O)=O)C=1N(CC(C)C)C1CCCCC1 IGMFWKIEEYQDNZ-UHFFFAOYSA-N 0.000 description 1
- JUDOLFBMLDITFB-UHFFFAOYSA-N 2-[cyclohexyl(ethyl)amino]-5-nitrobenzoic acid Chemical compound C=1C=C([N+]([O-])=O)C=C(C(O)=O)C=1N(CC)C1CCCCC1 JUDOLFBMLDITFB-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 239000001763 2-hydroxyethyl(trimethyl)azanium Substances 0.000 description 1
- MRCONLVSTRNJQT-UHFFFAOYSA-N 2-morpholino-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCOCC1 MRCONLVSTRNJQT-UHFFFAOYSA-N 0.000 description 1
- 125000005977 3-phenylpropyloxy group Chemical group 0.000 description 1
- LEJHUEWYEKQILF-UHFFFAOYSA-N 4-chloro-5-nitro-2-piperidin-1-ylbenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C(Cl)C=C1N1CCCCC1 LEJHUEWYEKQILF-UHFFFAOYSA-N 0.000 description 1
- MRXKJRLANPTAOR-UHFFFAOYSA-N 5-amino-2-(1,4-dioxa-9-azaspiro[4.6]undecan-9-yl)benzoic acid Chemical compound NC=1C=CC(=C(C(=O)O)C=1)N1CCC2(OCCO2)CCC1 MRXKJRLANPTAOR-UHFFFAOYSA-N 0.000 description 1
- YILAZDUANQYWIV-UHFFFAOYSA-N 5-amino-2-(2-methylpiperidin-1-yl)benzoic acid Chemical compound CC1CCCCN1C1=CC=C(N)C=C1C(O)=O YILAZDUANQYWIV-UHFFFAOYSA-N 0.000 description 1
- YNMNQZPTYJZGID-UHFFFAOYSA-N 5-amino-2-(3,3,5,5-tetramethylpiperidin-1-yl)benzoic acid Chemical compound C1C(C)(C)CC(C)(C)CN1C1=CC=C(N)C=C1C(O)=O YNMNQZPTYJZGID-UHFFFAOYSA-N 0.000 description 1
- TYHRDGSAWMCTJR-UHFFFAOYSA-N 5-amino-2-(3,5-dimethylmorpholin-4-yl)benzoic acid Chemical compound CC1COCC(C)N1C1=CC=C(N)C=C1C(O)=O TYHRDGSAWMCTJR-UHFFFAOYSA-N 0.000 description 1
- MXCSFLXGBVGXGX-UHFFFAOYSA-N 5-amino-2-(3,5-dimethylthiomorpholin-4-yl)benzoic acid Chemical compound CC1CSCC(C)N1C1=CC=C(N)C=C1C(O)=O MXCSFLXGBVGXGX-UHFFFAOYSA-N 0.000 description 1
- NMKAXQCMKPCYAC-UHFFFAOYSA-N 5-amino-2-(3-azabicyclo[3.2.2]nonan-3-yl)benzoic acid Chemical compound NC=1C=CC(=C(C(=O)O)C=1)N1CC2CCC(C1)CC2 NMKAXQCMKPCYAC-UHFFFAOYSA-N 0.000 description 1
- HLHXVRSOPLAEAC-UHFFFAOYSA-N 5-amino-2-(3-methylpiperidin-1-ium-1-yl)benzoate Chemical compound C1C(C)CCCN1C1=CC=C(N)C=C1C(O)=O HLHXVRSOPLAEAC-UHFFFAOYSA-N 0.000 description 1
- WQUUUKBKWCVGSK-UHFFFAOYSA-N 5-amino-2-(4-benzylpiperazin-1-yl)benzoic acid hydrochloride Chemical compound Cl.NC=1C=CC(=C(C(=O)O)C1)N1CCN(CC1)CC1=CC=CC=C1 WQUUUKBKWCVGSK-UHFFFAOYSA-N 0.000 description 1
- FXOZKPCRGKAQAF-UHFFFAOYSA-N 5-amino-2-(4-ethoxycarbonylpiperazin-1-yl)benzoic acid Chemical compound C1CN(C(=O)OCC)CCN1C1=CC=C(N)C=C1C(O)=O FXOZKPCRGKAQAF-UHFFFAOYSA-N 0.000 description 1
- MLQUXRUGIUNMMH-UHFFFAOYSA-N 5-amino-2-(4-ethoxycarbonylpiperidin-1-yl)benzoic acid Chemical compound C1CC(C(=O)OCC)CCN1C1=CC=C(N)C=C1C(O)=O MLQUXRUGIUNMMH-UHFFFAOYSA-N 0.000 description 1
- QXZDFBVHQZWOJU-UHFFFAOYSA-N 5-amino-2-(4-methoxypiperidin-1-yl)benzoic acid Chemical compound C1CC(OC)CCN1C1=CC=C(N)C=C1C(O)=O QXZDFBVHQZWOJU-UHFFFAOYSA-N 0.000 description 1
- QECCLZCMMWNHHS-UHFFFAOYSA-N 5-amino-2-(4-methylpiperazin-1-yl)benzoic acid;hydrochloride Chemical compound Cl.C1CN(C)CCN1C1=CC=C(N)C=C1C(O)=O QECCLZCMMWNHHS-UHFFFAOYSA-N 0.000 description 1
- WLIBXILRXKJRAY-UHFFFAOYSA-N 5-amino-2-(4-methylpiperidin-1-ium-1-yl)benzoate Chemical compound C1CC(C)CCN1C1=CC=C(N)C=C1C(O)=O WLIBXILRXKJRAY-UHFFFAOYSA-N 0.000 description 1
- YHQOIAWXAVZVEQ-UHFFFAOYSA-N 5-amino-2-(4-phenylpiperazin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCN(C=2C=CC=CC=2)CC1 YHQOIAWXAVZVEQ-UHFFFAOYSA-N 0.000 description 1
- ZYLJRULCPWPINV-UHFFFAOYSA-N 5-amino-2-(4-phenylpiperidin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCC(C=2C=CC=CC=2)CC1 ZYLJRULCPWPINV-UHFFFAOYSA-N 0.000 description 1
- LMYWMYGRWGMFEA-UHFFFAOYSA-N 5-amino-2-(4-propan-2-ylpiperidin-1-yl)benzoic acid Chemical compound C1CC(C(C)C)CCN1C1=CC=C(N)C=C1C(O)=O LMYWMYGRWGMFEA-UHFFFAOYSA-N 0.000 description 1
- UZISGXPDDOVJGK-UHFFFAOYSA-N 5-amino-2-(5-ethyl-2-methylpiperidin-1-yl)benzoic acid Chemical compound C1C(CC)CCC(C)N1C1=CC=C(N)C=C1C(O)=O UZISGXPDDOVJGK-UHFFFAOYSA-N 0.000 description 1
- QSXVNKWWRYKSDG-UHFFFAOYSA-N 5-amino-2-(n-methylanilino)benzoic acid Chemical compound C=1C=C(N)C=C(C(O)=O)C=1N(C)C1=CC=CC=C1 QSXVNKWWRYKSDG-UHFFFAOYSA-N 0.000 description 1
- PEPUMPQTKIHPMR-AOOOYVTPSA-N 5-amino-2-[(3s,5r)-3,5-dimethylpiperidin-1-yl]benzoic acid Chemical compound C1[C@@H](C)C[C@@H](C)CN1C1=CC=C(N)C=C1C(O)=O PEPUMPQTKIHPMR-AOOOYVTPSA-N 0.000 description 1
- PEPUMPQTKIHPMR-UWVGGRQHSA-N 5-amino-2-[(3s,5s)-3,5-dimethylpiperidin-1-yl]benzoic acid Chemical compound C1[C@@H](C)C[C@H](C)CN1C1=CC=C(N)C=C1C(O)=O PEPUMPQTKIHPMR-UWVGGRQHSA-N 0.000 description 1
- QMZTYNRPSCTBLK-UHFFFAOYSA-N 5-amino-2-[4-(4-chlorophenyl)piperazin-1-yl]benzoic acid hydrochloride Chemical compound Cl.NC=1C=CC(=C(C(=O)O)C1)N1CCN(CC1)C1=CC=C(C=C1)Cl QMZTYNRPSCTBLK-UHFFFAOYSA-N 0.000 description 1
- UXCYIXFTBMSQHX-UHFFFAOYSA-N 5-amino-2-[4-(furan-2-carbonyl)piperazin-1-yl]benzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCN(C(=O)C=2OC=CC=2)CC1 UXCYIXFTBMSQHX-UHFFFAOYSA-N 0.000 description 1
- KSYAFXYGXVBRIG-UHFFFAOYSA-N 5-amino-2-[benzyl(methyl)amino]benzoic acid Chemical compound C=1C=C(N)C=C(C(O)=O)C=1N(C)CC1=CC=CC=C1 KSYAFXYGXVBRIG-UHFFFAOYSA-N 0.000 description 1
- AMBYEYBIHLSTKG-UHFFFAOYSA-N 5-amino-2-[butyl(cyclohexyl)amino]benzoic acid Chemical compound C=1C=C(N)C=C(C(O)=O)C=1N(CCCC)C1CCCCC1 AMBYEYBIHLSTKG-UHFFFAOYSA-N 0.000 description 1
- WRBVVDFSVHXIKG-UHFFFAOYSA-N 5-amino-2-[cyclohexyl(2-methylpropyl)amino]benzoic acid Chemical compound C=1C=C(N)C=C(C(O)=O)C=1N(CC(C)C)C1CCCCC1 WRBVVDFSVHXIKG-UHFFFAOYSA-N 0.000 description 1
- YRLMNDKLBAGNJP-UHFFFAOYSA-N 5-amino-2-[cyclohexyl(ethyl)amino]benzoic acid Chemical compound C=1C=C(N)C=C(C(O)=O)C=1N(CC)C1CCCCC1 YRLMNDKLBAGNJP-UHFFFAOYSA-N 0.000 description 1
- XHGJRPHMWRRIDE-UHFFFAOYSA-N 5-amino-2-morpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCOCC1 XHGJRPHMWRRIDE-UHFFFAOYSA-N 0.000 description 1
- TVZSCEWHFAKJOE-UHFFFAOYSA-N 5-amino-2-pyrrolidin-1-ylbenzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCCC1 TVZSCEWHFAKJOE-UHFFFAOYSA-N 0.000 description 1
- HTDMMZILJVIOAE-UHFFFAOYSA-N 5-amino-2-thiomorpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC(N)=CC=C1N1CCSCC1 HTDMMZILJVIOAE-UHFFFAOYSA-N 0.000 description 1
- QBZVDIRFIDFVQA-UHFFFAOYSA-N 5-bromo-2-(2-methylpiperidin-1-yl)benzoic acid Chemical compound CC1CCCCN1C1=CC=C(Br)C=C1C(O)=O QBZVDIRFIDFVQA-UHFFFAOYSA-N 0.000 description 1
- JGJCZZGVSPAUQF-UHFFFAOYSA-N 5-bromo-2-(4-methoxypiperidin-1-yl)benzoic acid Chemical compound C1CC(OC)CCN1C1=CC=C(Br)C=C1C(O)=O JGJCZZGVSPAUQF-UHFFFAOYSA-N 0.000 description 1
- SENIBCRWPOSZED-UHFFFAOYSA-N 5-chloro-2-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCC2(OCCO2)CC1 SENIBCRWPOSZED-UHFFFAOYSA-N 0.000 description 1
- YICVYUJJEFQXJV-UHFFFAOYSA-N 5-chloro-2-(1,4-dioxa-9-azaspiro[4.6]undecan-9-yl)benzoic acid Chemical compound OC(=O)C1=C(C=CC(Cl)=C1)N1CCCC2(CC1)OCCO2 YICVYUJJEFQXJV-UHFFFAOYSA-N 0.000 description 1
- ZPUQGJHIGUYDTP-UHFFFAOYSA-N 5-chloro-2-(2-methylpiperidin-1-yl)benzoic acid Chemical compound CC1CCCCN1C1=CC=C(Cl)C=C1C(O)=O ZPUQGJHIGUYDTP-UHFFFAOYSA-N 0.000 description 1
- OVZVMGBCOKCLBR-UHFFFAOYSA-N 5-chloro-2-(3,3,5,5-tetramethylpiperidin-1-yl)benzoic acid Chemical compound C1C(C)(C)CC(C)(C)CN1C1=CC=C(Cl)C=C1C(O)=O OVZVMGBCOKCLBR-UHFFFAOYSA-N 0.000 description 1
- YJDAJXYFNXRAFL-UHFFFAOYSA-N 5-chloro-2-(3,5-dimethylmorpholin-4-yl)benzoic acid Chemical compound CC1COCC(C)N1C1=CC=C(Cl)C=C1C(O)=O YJDAJXYFNXRAFL-UHFFFAOYSA-N 0.000 description 1
- GSFBMSHQWXSKGP-UHFFFAOYSA-N 5-chloro-2-(3,5-dimethylthiomorpholin-4-yl)benzoic acid Chemical compound CC1CSCC(C)N1C1=CC=C(Cl)C=C1C(O)=O GSFBMSHQWXSKGP-UHFFFAOYSA-N 0.000 description 1
- VYUIBEZXJBXHKB-UHFFFAOYSA-N 5-chloro-2-(3-methylpiperidin-1-yl)benzoic acid Chemical compound C1C(C)CCCN1C1=CC=C(Cl)C=C1C(O)=O VYUIBEZXJBXHKB-UHFFFAOYSA-N 0.000 description 1
- AVJODSRLMMOBFK-UHFFFAOYSA-N 5-chloro-2-(4-ethoxycarbonylpiperazin-1-yl)benzoic acid Chemical compound C1CN(C(=O)OCC)CCN1C1=CC=C(Cl)C=C1C(O)=O AVJODSRLMMOBFK-UHFFFAOYSA-N 0.000 description 1
- UZVFXYNDMSDNBT-UHFFFAOYSA-N 5-chloro-2-(4-ethoxycarbonylpiperidin-1-yl)benzoic acid Chemical compound C1CC(C(=O)OCC)CCN1C1=CC=C(Cl)C=C1C(O)=O UZVFXYNDMSDNBT-UHFFFAOYSA-N 0.000 description 1
- XINDWSVEMLWQDS-UHFFFAOYSA-N 5-chloro-2-(4-methylpiperazin-1-yl)benzoic acid hydrochloride Chemical compound Cl.ClC=1C=CC(=C(C(=O)O)C1)N1CCN(CC1)C XINDWSVEMLWQDS-UHFFFAOYSA-N 0.000 description 1
- KVGVZWDWWULCOZ-UHFFFAOYSA-N 5-chloro-2-(4-methylpiperidin-1-yl)benzoic acid Chemical compound C1CC(C)CCN1C1=CC=C(Cl)C=C1C(O)=O KVGVZWDWWULCOZ-UHFFFAOYSA-N 0.000 description 1
- BAZIZDFWLLCYMR-UHFFFAOYSA-N 5-chloro-2-(4-phenylpiperazin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCN(C=2C=CC=CC=2)CC1 BAZIZDFWLLCYMR-UHFFFAOYSA-N 0.000 description 1
- OSJSLLRQIYEWKN-UHFFFAOYSA-N 5-chloro-2-(4-phenylpiperidin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCC(C=2C=CC=CC=2)CC1 OSJSLLRQIYEWKN-UHFFFAOYSA-N 0.000 description 1
- KTGQRSBFFISBHO-UHFFFAOYSA-N 5-chloro-2-(4-propan-2-ylpiperidin-1-yl)benzoic acid Chemical compound C1CC(C(C)C)CCN1C1=CC=C(Cl)C=C1C(O)=O KTGQRSBFFISBHO-UHFFFAOYSA-N 0.000 description 1
- BUGQENBPTWBGAJ-UHFFFAOYSA-N 5-chloro-2-(5-ethyl-2-methylpiperidin-1-yl)benzoic acid Chemical compound C1C(CC)CCC(C)N1C1=CC=C(Cl)C=C1C(O)=O BUGQENBPTWBGAJ-UHFFFAOYSA-N 0.000 description 1
- OCHGCLDQVKXWFT-UHFFFAOYSA-N 5-chloro-2-(n-methylanilino)benzoic acid Chemical compound C=1C=C(Cl)C=C(C(O)=O)C=1N(C)C1=CC=CC=C1 OCHGCLDQVKXWFT-UHFFFAOYSA-N 0.000 description 1
- ITNCLVAQRUEBAM-UWVGGRQHSA-N 5-chloro-2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]benzoic acid Chemical compound ClC=1C=CC(=C(C(=O)O)C=1)N1C[C@H](C[C@@H](C1)C)C ITNCLVAQRUEBAM-UWVGGRQHSA-N 0.000 description 1
- ITNCLVAQRUEBAM-AOOOYVTPSA-N 5-chloro-2-[(3s,5r)-3,5-dimethylpiperidin-1-yl]benzoic acid Chemical compound C1[C@@H](C)C[C@@H](C)CN1C1=CC=C(Cl)C=C1C(O)=O ITNCLVAQRUEBAM-AOOOYVTPSA-N 0.000 description 1
- REOJABRWMFBZPQ-UHFFFAOYSA-N 5-chloro-2-[4-(4-chlorophenyl)piperazin-1-yl]benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCN(C=2C=CC(Cl)=CC=2)CC1 REOJABRWMFBZPQ-UHFFFAOYSA-N 0.000 description 1
- DCDJBUPTNBXDFF-UHFFFAOYSA-N 5-chloro-2-[4-(furan-2-carbonyl)piperazin-1-yl]benzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCN(C(=O)C=2OC=CC=2)CC1 DCDJBUPTNBXDFF-UHFFFAOYSA-N 0.000 description 1
- RLUBLRQPRBPJGQ-UHFFFAOYSA-N 5-chloro-2-[cyclohexyl(2-methylpropyl)amino]benzoic acid Chemical compound C=1C=C(Cl)C=C(C(O)=O)C=1N(CC(C)C)C1CCCCC1 RLUBLRQPRBPJGQ-UHFFFAOYSA-N 0.000 description 1
- YPIWHNJUZNQZCD-UHFFFAOYSA-N 5-chloro-2-[cyclohexyl(ethyl)amino]benzoic acid Chemical compound C=1C=C(Cl)C=C(C(O)=O)C=1N(CC)C1CCCCC1 YPIWHNJUZNQZCD-UHFFFAOYSA-N 0.000 description 1
- XRSRSDLVOFVSFT-UHFFFAOYSA-N 5-chloro-2-morpholin-4-ylbenzamide Chemical compound NC(=O)C1=CC(Cl)=CC=C1N1CCOCC1 XRSRSDLVOFVSFT-UHFFFAOYSA-N 0.000 description 1
- LEMIJOINGPOVQV-UHFFFAOYSA-N 5-chloro-2-pyrrolidin-1-ylbenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCCC1 LEMIJOINGPOVQV-UHFFFAOYSA-N 0.000 description 1
- YLTYULRTQLHZNV-UHFFFAOYSA-N 5-chloro-2-thiomorpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1N1CCSCC1 YLTYULRTQLHZNV-UHFFFAOYSA-N 0.000 description 1
- RQRBLTZTXJRFDD-UHFFFAOYSA-N 5-hexoxy-2-piperidin-1-ylbenzoic acid Chemical compound OC(=O)C1=CC(OCCCCCC)=CC=C1N1CCCCC1 RQRBLTZTXJRFDD-UHFFFAOYSA-N 0.000 description 1
- CYPOVTAFMRLRCW-UHFFFAOYSA-N 5-nitro-2,4-di(piperidin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C(N2CCCCC2)C=C1N1CCCCC1 CYPOVTAFMRLRCW-UHFFFAOYSA-N 0.000 description 1
- UNEAUOPNMFUVEC-UHFFFAOYSA-N 5-nitro-2-(3,3,5,5-tetramethylpiperidin-1-yl)benzoic acid Chemical compound C1C(C)(C)CC(C)(C)CN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O UNEAUOPNMFUVEC-UHFFFAOYSA-N 0.000 description 1
- PFHJMRRYUIYQTH-UHFFFAOYSA-N 5-nitro-2-(4-phenylpiperazin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCN(C=2C=CC=CC=2)CC1 PFHJMRRYUIYQTH-UHFFFAOYSA-N 0.000 description 1
- TUIBWENOIVPIAT-UHFFFAOYSA-N 5-nitro-2-(4-phenylpiperidin-1-yl)benzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCC(C=2C=CC=CC=2)CC1 TUIBWENOIVPIAT-UHFFFAOYSA-N 0.000 description 1
- CHSOARKRVYSVQB-UHFFFAOYSA-N 5-nitro-2-(4-propan-2-ylpiperidin-1-yl)benzoic acid Chemical compound C1CC(C(C)C)CCN1C1=CC=C([N+]([O-])=O)C=C1C(O)=O CHSOARKRVYSVQB-UHFFFAOYSA-N 0.000 description 1
- BFGCALKAENBFBV-UHFFFAOYSA-N 5-nitro-2-thiomorpholin-4-ylbenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1N1CCSCC1 BFGCALKAENBFBV-UHFFFAOYSA-N 0.000 description 1
- BJOSCVBMMPNMLK-UHFFFAOYSA-N 5-phenylmethoxy-2-piperidin-1-ylbenzoic acid Chemical compound C=1C=C(N2CCCCC2)C(C(=O)O)=CC=1OCC1=CC=CC=C1 BJOSCVBMMPNMLK-UHFFFAOYSA-N 0.000 description 1
- MTNNQFXOHFKDAR-UHFFFAOYSA-N 6-bromo-6-nitrocyclohexa-2,4-diene-1-carboxylic acid Chemical class OC(=O)C1C=CC=CC1(Br)[N+]([O-])=O MTNNQFXOHFKDAR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 239000004380 Cholic acid Substances 0.000 description 1
- 235000019743 Choline chloride Nutrition 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical class NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- BHQCQFFYRZLCQQ-OELDTZBJSA-N cholic acid Chemical compound C([C@H]1C[C@H]2O)[C@H](O)CC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CC[C@H]([C@@H](CCC(O)=O)C)[C@@]2(C)[C@@H](O)C1 BHQCQFFYRZLCQQ-OELDTZBJSA-N 0.000 description 1
- 235000019416 cholic acid Nutrition 0.000 description 1
- 229960002471 cholic acid Drugs 0.000 description 1
- SGMZJAMFUVOLNK-UHFFFAOYSA-M choline chloride Chemical compound [Cl-].C[N+](C)(C)CCO SGMZJAMFUVOLNK-UHFFFAOYSA-M 0.000 description 1
- 229960003178 choline chloride Drugs 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- KXGVEGMKQFWNSR-UHFFFAOYSA-N deoxycholic acid Natural products C1CC2CC(O)CCC2(C)C2C1C1CCC(C(CCC(O)=O)C)C1(C)C(O)C2 KXGVEGMKQFWNSR-UHFFFAOYSA-N 0.000 description 1
- WLXALCKAKGDNAT-UHFFFAOYSA-N diazoethane Chemical compound CC=[N+]=[N-] WLXALCKAKGDNAT-UHFFFAOYSA-N 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002897 heparin Drugs 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000003516 hyperlipidaemic effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 235000005152 nicotinamide Nutrition 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/205—Radicals derived from carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
- C07C243/24—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids
- C07C243/38—Hydrazines having nitrogen atoms of hydrazine groups acylated by carboxylic acids with acylating carboxyl groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19803016650 DE3016650A1 (de) | 1979-07-13 | 1980-04-30 | Neue 2-amino-benzoesaeure-derivate, deren herstellung und deren verwendung als arzneimittel oder zwischenprodukte |
Publications (1)
Publication Number | Publication Date |
---|---|
NO843735L true NO843735L (no) | 1981-01-14 |
Family
ID=6101342
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO843735A NO843735L (no) | 1980-04-30 | 1984-09-19 | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-amino-benzoesyrederivater |
Country Status (5)
Country | Link |
---|---|
EP (1) | EP0063826B1 (es) |
DE (1) | DE3069781D1 (es) |
ES (3) | ES8202803A1 (es) |
HU (1) | HU186675B (es) |
NO (1) | NO843735L (es) |
Families Citing this family (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB9326232D0 (en) * | 1993-12-23 | 1994-02-23 | Zeneca Ltd | Chemical compounds |
GB9326373D0 (en) * | 1993-12-23 | 1994-02-23 | Zeneca Ltd | Chemical compounds |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3936467A (en) * | 1968-03-27 | 1976-02-03 | Ciba-Geigy Corporation | Hydroxyalkylenimino-phenyl-acetic acids |
-
1980
- 1980-06-28 EP EP82104991A patent/EP0063826B1/de not_active Expired
- 1980-06-28 DE DE8282104991T patent/DE3069781D1/de not_active Expired
- 1980-07-11 HU HU801085A patent/HU186675B/hu unknown
-
1981
- 1981-05-05 ES ES501883A patent/ES8202803A1/es not_active Expired
- 1981-05-05 ES ES501884A patent/ES501884A0/es active Granted
- 1981-05-05 ES ES501882A patent/ES8202802A1/es not_active Expired
-
1984
- 1984-09-19 NO NO843735A patent/NO843735L/no unknown
Also Published As
Publication number | Publication date |
---|---|
ES501883A0 (es) | 1982-03-01 |
ES8202804A1 (es) | 1982-03-01 |
DE3069781D1 (en) | 1985-01-17 |
ES501882A0 (es) | 1982-03-01 |
HU186675B (en) | 1985-09-30 |
ES8202802A1 (es) | 1982-03-01 |
ES8202803A1 (es) | 1982-03-01 |
EP0063826B1 (de) | 1984-12-05 |
ES501884A0 (es) | 1982-03-01 |
EP0063826A2 (de) | 1982-11-03 |
EP0063826A3 (en) | 1982-12-29 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4507303A (en) | Succinimide derivatives, compositions and method of use | |
US4746667A (en) | Pharmaceutical composition containing 2-(2-benzimidazolyl thiomethyl) pyridine | |
US4430343A (en) | Benzimidazole derivatives, process for the preparation thereof and pharmaceutical composition containing the same | |
EP0109562A1 (en) | Succinimide derivatives and their production | |
JPS6056973A (ja) | 鎮静作用の弱い抗ヒスタミン剤 | |
NO310070B1 (no) | Benzo[g]kinolinderivater, fremstilling herav, farmasöytiske midler og preparater inneholdende disse samt anvendelse av derivatene for fremstilling av medikamenter | |
DD200152A5 (de) | Verfahren zur herstellung neuer 2-aminobenzoesaeure-derivate | |
NO760054L (es) | ||
NO820047L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive karboksylsyreamider | |
CH636099A5 (de) | Verfahren zur herstellung von piperidinopropanolderivaten. | |
DD149804A5 (de) | Verfahren zur herstellung von neuen indolderivaten | |
CS236668B2 (en) | Manufacturing process of aralkylamides 2-substituted aminophenylalkancarboxyle and amino-3-pyridylalkancarboxyl acides | |
EP0250361B1 (de) | Disubstituierte Piperazine | |
US4110455A (en) | 6-aryl-s-triazolo-(4,3-a)-pyrido-(2,3-f)-1,4-diazepines | |
DD254201A5 (de) | Verfahren zur herstellung von phenoxy-substituierten beta-carbolinderivaten | |
US4515944A (en) | 1,5-Diphenyl-2-haloalkylpyrazolin-3-one intermediates | |
NO843735L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-amino-benzoesyrederivater | |
NO138660B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive nye 3-(piperazinalkyl)-2,4-kinazolindioner | |
US4654349A (en) | Anti-allergic methods using pyrazolo(1,5-A)pyridines | |
JPS6130588A (ja) | ベンゾ〔c〕〔1,8〕ナフチリジン、その製造方法及びその使用、並びにこれらの化合物を含有する調製剤 | |
US3822267A (en) | 1 substituted 4 piperazino cycloalkylthiazoles | |
DK159850B (da) | Analogifremgangsmaade til fremstilling af phenyledddikesyrederivater | |
NO881899L (no) | Nye 2-aminoalkyl-4-benzyl-1-(2h)-ftalazino-derivater. | |
KR840002235B1 (ko) | 2-아미노-벤조산 유도체의 제조방법 | |
US3998955A (en) | Antihypertensive compositions |