NO841168L - Fremgangsmaate for fremstilling av pyrimidinderivater - Google Patents
Fremgangsmaate for fremstilling av pyrimidinderivaterInfo
- Publication number
- NO841168L NO841168L NO841168A NO841168A NO841168L NO 841168 L NO841168 L NO 841168L NO 841168 A NO841168 A NO 841168A NO 841168 A NO841168 A NO 841168A NO 841168 L NO841168 L NO 841168L
- Authority
- NO
- Norway
- Prior art keywords
- compound
- lower alkyl
- general formula
- dimethoxyphenyl
- dihydro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 53
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 title description 7
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical class C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 102
- -1 hydroxy, amino Chemical group 0.000 claims description 101
- 125000000217 alkyl group Chemical group 0.000 claims description 86
- 150000003839 salts Chemical class 0.000 claims description 69
- 229910052739 hydrogen Inorganic materials 0.000 claims description 32
- 239000001257 hydrogen Substances 0.000 claims description 32
- 125000003282 alkyl amino group Chemical group 0.000 claims description 25
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 24
- 239000004593 Epoxy Substances 0.000 claims description 23
- 150000002431 hydrogen Chemical class 0.000 claims description 23
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 21
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 125000003342 alkenyl group Chemical group 0.000 claims description 15
- 125000003118 aryl group Chemical group 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 150000002367 halogens Chemical class 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- IJJUENQVHOKTHU-UHFFFAOYSA-N C1=C(OC)C(OC)=CC=C1C(NC(=O)N1C)=CC1=NC1=C(C)C=C(C)C=C1C Chemical compound C1=C(OC)C(OC)=CC=C1C(NC(=O)N1C)=CC1=NC1=C(C)C=C(C)C=C1C IJJUENQVHOKTHU-UHFFFAOYSA-N 0.000 claims description 7
- 125000004076 pyridyl group Chemical group 0.000 claims description 7
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000000464 thioxo group Chemical group S=* 0.000 claims description 3
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 2
- NFHSJMMFPWGVHO-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-(2,4,6-trimethoxyphenyl)iminopyrimidin-2-one Chemical compound COC1=CC(OC)=CC(OC)=C1N=C1N(C)C(=O)N(C)C(C=2C=C(OC)C(OC)=CC=2)=C1 NFHSJMMFPWGVHO-UHFFFAOYSA-N 0.000 claims description 2
- YNLQYELKKUHQNR-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-2-ethoxy-3-methyl-n-(2,4,6-trimethylphenyl)pyrimidin-4-imine Chemical compound CN1C(OCC)=NC(C=2C=C(OC)C(OC)=CC=2)=CC1=NC1=C(C)C=C(C)C=C1C YNLQYELKKUHQNR-UHFFFAOYSA-N 0.000 claims description 2
- 125000005808 2,4,6-trimethoxyphenyl group Chemical group [H][#6]-1=[#6](-[#8]C([H])([H])[H])-[#6](-*)=[#6](-[#8]C([H])([H])[H])-[#6]([H])=[#6]-1-[#8]C([H])([H])[H] 0.000 claims 1
- WLUQFKLDOJWLIN-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=C(C)C=C(C)C=C1C WLUQFKLDOJWLIN-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 94
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 88
- 238000002329 infrared spectrum Methods 0.000 description 84
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 78
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 69
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 63
- 238000006243 chemical reaction Methods 0.000 description 39
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 38
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 34
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- 239000002244 precipitate Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 23
- KWVPRPSXBZNOHS-UHFFFAOYSA-N 2,4,6-Trimethylaniline Chemical compound CC1=CC(C)=C(N)C(C)=C1 KWVPRPSXBZNOHS-UHFFFAOYSA-N 0.000 description 21
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 19
- 238000001914 filtration Methods 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 239000011541 reaction mixture Substances 0.000 description 15
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 14
- 235000019341 magnesium sulphate Nutrition 0.000 description 14
- 238000003756 stirring Methods 0.000 description 13
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- RZYVZALRKACWRX-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-sulfanylidenepyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=S)N(C)C(=O)N1C RZYVZALRKACWRX-UHFFFAOYSA-N 0.000 description 11
- JBFXUEXTFAJUSA-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-3-methyl-1h-pyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1 JBFXUEXTFAJUSA-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 230000036772 blood pressure Effects 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- 239000012312 sodium hydride Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methyl urea Chemical compound CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 7
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 7
- 150000003230 pyrimidines Chemical class 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- DCEGRFKPBZZMGE-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-3-methyl-4-sulfanylidene-1h-pyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=S)N(C)C(=O)N1 DCEGRFKPBZZMGE-UHFFFAOYSA-N 0.000 description 6
- MGJKQDOBUOMPEZ-UHFFFAOYSA-N N,N'-dimethylurea Chemical compound CNC(=O)NC MGJKQDOBUOMPEZ-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- BHSYONGONOKNAI-UHFFFAOYSA-N ethyl 3-(3,4-dimethoxyphenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C(OC)C(OC)=C1 BHSYONGONOKNAI-UHFFFAOYSA-N 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- HNBBMGXWVDKYSV-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1h-pyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)NC(=O)N1 HNBBMGXWVDKYSV-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 230000003276 anti-hypertensive effect Effects 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000003177 cardiotonic effect Effects 0.000 description 4
- 230000018044 dehydration Effects 0.000 description 4
- 238000006297 dehydration reaction Methods 0.000 description 4
- 239000000825 pharmaceutical preparation Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 238000010998 test method Methods 0.000 description 4
- 230000000304 vasodilatating effect Effects 0.000 description 4
- HDILJLGDCHICLC-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1C HDILJLGDCHICLC-UHFFFAOYSA-N 0.000 description 3
- OYGHXRNCHYRYRR-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-ethyl-3-methyl-4-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CN1C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=CC1=NC1=C(C)C=C(C)C=C1C OYGHXRNCHYRYRR-UHFFFAOYSA-N 0.000 description 3
- OEMVORBXRCANQF-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-methylpyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)NC(=O)N1C OEMVORBXRCANQF-UHFFFAOYSA-N 0.000 description 3
- XIWACCQPMUVSKC-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-3-methyl-1-propylpyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)N(CCC)C(C=2C=C(OC)C(OC)=CC=2)=C1 XIWACCQPMUVSKC-UHFFFAOYSA-N 0.000 description 3
- VTGPBXIGZNZSBJ-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-3-methyl-2-propan-2-yloxypyrimidine-4-thione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=S)N(C)C(OC(C)C)=N1 VTGPBXIGZNZSBJ-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000003973 alkyl amines Chemical class 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 210000001772 blood platelet Anatomy 0.000 description 3
- 230000003727 cerebral blood flow Effects 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 210000001105 femoral artery Anatomy 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical group CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 3
- 150000008512 pyrimidinediones Chemical class 0.000 description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- IRCRFJUIGMASDZ-UHFFFAOYSA-N 1,3-dimethyl-4-phenyl-6-sulfanylidenepyrimidin-2-one Chemical compound S=C1N(C)C(=O)N(C)C(C=2C=CC=CC=2)=C1 IRCRFJUIGMASDZ-UHFFFAOYSA-N 0.000 description 2
- ZEXLLQDNQFSHJE-UHFFFAOYSA-N 1,3-dimethyl-4-pyridin-3-yl-6-sulfanylidenepyrimidin-2-one Chemical compound S=C1N(C)C(=O)N(C)C(C=2C=NC=CC=2)=C1 ZEXLLQDNQFSHJE-UHFFFAOYSA-N 0.000 description 2
- XPIAHJOLVVSCQH-UHFFFAOYSA-N 1,3-dimethyl-4-sulfanylidene-6-(2,3,4-trimethoxyphenyl)pyrimidin-2-one Chemical compound COC1=C(OC)C(OC)=CC=C1C1=CC(=S)N(C)C(=O)N1C XPIAHJOLVVSCQH-UHFFFAOYSA-N 0.000 description 2
- CHQUSPSYBGOASD-UHFFFAOYSA-N 1,3-dimethyl-4-sulfanylidene-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-one Chemical compound COC1=C(OC)C(OC)=CC(C=2N(C(=O)N(C)C(=S)C=2)C)=C1 CHQUSPSYBGOASD-UHFFFAOYSA-N 0.000 description 2
- PMKLUUOSOUESOS-UHFFFAOYSA-N 1,3-dimethyl-4-sulfanylidenepyrimidin-2-one Chemical compound CN1C=CC(=S)N(C)C1=O PMKLUUOSOUESOS-UHFFFAOYSA-N 0.000 description 2
- WNESBIIIERSULU-UHFFFAOYSA-N 1,3-dimethyl-6-(2,3,4-trimethoxyphenyl)pyrimidine-2,4-dione Chemical compound COC1=C(OC)C(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1C WNESBIIIERSULU-UHFFFAOYSA-N 0.000 description 2
- CBIBVLLVSJJBCF-UHFFFAOYSA-N 1,3-dimethyl-6-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-dione Chemical compound COC1=C(OC)C(OC)=CC(C=2N(C(=O)N(C)C(=O)C=2)C)=C1 CBIBVLLVSJJBCF-UHFFFAOYSA-N 0.000 description 2
- HEXINJDAGJAXRK-UHFFFAOYSA-N 1,3-dimethyl-6-pyridin-3-ylpyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)N(C)C(C=2C=NC=CC=2)=C1 HEXINJDAGJAXRK-UHFFFAOYSA-N 0.000 description 2
- CRQONYLOAMLBSG-UHFFFAOYSA-N 1-benzyl-6-(3,4-dimethoxyphenyl)-3-methyl-4-sulfanylidenepyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=S)N(C)C(=O)N1CC1=CC=CC=C1 CRQONYLOAMLBSG-UHFFFAOYSA-N 0.000 description 2
- CQXGREZVBUSLNH-UHFFFAOYSA-N 1-benzyl-6-(3,4-dimethoxyphenyl)-3-methylpyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1CC1=CC=CC=C1 CQXGREZVBUSLNH-UHFFFAOYSA-N 0.000 description 2
- FNSAKXLEFPFZOM-UHFFFAOYSA-N 2,4,6-trimethoxyaniline Chemical compound COC1=CC(OC)=C(N)C(OC)=C1 FNSAKXLEFPFZOM-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical compound CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 2
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- FXMIXLJKIUMQTP-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-1,3-dimethyl-6-sulfanylidenepyrimidin-2-one Chemical compound S=C1N(C)C(=O)N(C)C(C=2C=C(Cl)C(Cl)=CC=2)=C1 FXMIXLJKIUMQTP-UHFFFAOYSA-N 0.000 description 2
- ANAWTBRBLCXKCQ-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-diethyl-6-sulfanylidenepyrimidin-2-one Chemical compound S=C1N(CC)C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=C1 ANAWTBRBLCXKCQ-UHFFFAOYSA-N 0.000 description 2
- ZNVXYGFZHASVGH-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1-methyl-3-propyl-6-sulfanylidenepyrimidin-2-one Chemical compound S=C1N(C)C(=O)N(CCC)C(C=2C=C(OC)C(OC)=CC=2)=C1 ZNVXYGFZHASVGH-UHFFFAOYSA-N 0.000 description 2
- JGGIARBPNMBCTI-UHFFFAOYSA-N 4-(4-methoxy-2-methylphenyl)-1,3-dimethyl-6-sulfanylidenepyrimidin-2-one Chemical compound CC1=CC(OC)=CC=C1C1=CC(=S)N(C)C(=O)N1C JGGIARBPNMBCTI-UHFFFAOYSA-N 0.000 description 2
- YJRGOHWPVGSLQY-UHFFFAOYSA-N 4-(4-methoxyphenyl)-1,3-dimethyl-6-sulfanylidenepyrimidin-2-one Chemical compound C1=CC(OC)=CC=C1C1=CC(=S)N(C)C(=O)N1C YJRGOHWPVGSLQY-UHFFFAOYSA-N 0.000 description 2
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 2
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 2
- ARJCNFXNMGIFKS-UHFFFAOYSA-N 5-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CN(C)C(=O)N(C)C1=O ARJCNFXNMGIFKS-UHFFFAOYSA-N 0.000 description 2
- OCOGKLFVDHVPTO-UHFFFAOYSA-N 6-(3,4-dichlorophenyl)-1,3-dimethylpyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)N(C)C(C=2C=C(Cl)C(Cl)=CC=2)=C1 OCOGKLFVDHVPTO-UHFFFAOYSA-N 0.000 description 2
- KECAXAAONUDRCK-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1,3-diethylpyrimidine-2,4-dione Chemical compound O=C1N(CC)C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=C1 KECAXAAONUDRCK-UHFFFAOYSA-N 0.000 description 2
- ATRGEBAUUJQLMP-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-ethyl-3-methyl-4-sulfanylidenepyrimidin-2-one Chemical compound S=C1N(C)C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=C1 ATRGEBAUUJQLMP-UHFFFAOYSA-N 0.000 description 2
- HPSKCNHPKYEDOD-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-ethyl-3-methylpyrimidine-2,4-dione Chemical compound O=C1N(C)C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=C1 HPSKCNHPKYEDOD-UHFFFAOYSA-N 0.000 description 2
- RBWCASAPRHDPOA-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-methyl-4-(2,4,6-trimethylanilino)pyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1)C)=CC1=NC1=C(C)C=C(C)C=C1C RBWCASAPRHDPOA-UHFFFAOYSA-N 0.000 description 2
- AAQKHFBCCKMUBH-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-methyl-4-sulfanylidenepyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=S)NC(=O)N1C AAQKHFBCCKMUBH-UHFFFAOYSA-N 0.000 description 2
- LFROOKWGDXVTJG-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-3-methyl-1-(oxiran-2-ylmethyl)pyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1CC1OC1 LFROOKWGDXVTJG-UHFFFAOYSA-N 0.000 description 2
- XJNCABGYPVGREZ-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-3-methyl-2-propan-2-yloxypyrimidin-4-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=O)N(C)C(OC(C)C)=N1 XJNCABGYPVGREZ-UHFFFAOYSA-N 0.000 description 2
- PYACXZRHEGGRLC-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-4-sulfanylidene-1h-pyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(=S)NC(=O)N1 PYACXZRHEGGRLC-UHFFFAOYSA-N 0.000 description 2
- JRUMJHROSCZUSI-UHFFFAOYSA-N 6-(4-methoxy-2-methylphenyl)-1,3-dimethylpyrimidine-2,4-dione Chemical compound CC1=CC(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1C JRUMJHROSCZUSI-UHFFFAOYSA-N 0.000 description 2
- GSEOPLSGDIWYPG-UHFFFAOYSA-N 6-(4-methoxyphenyl)-1,3-dimethylpyrimidine-2,4-dione Chemical compound C1=CC(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1C GSEOPLSGDIWYPG-UHFFFAOYSA-N 0.000 description 2
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- VPGRYOFKCNULNK-ACXQXYJUSA-N Deoxycorticosterone acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)COC(=O)C)[C@@]1(C)CC2 VPGRYOFKCNULNK-ACXQXYJUSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000004220 aggregation Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000000702 anti-platelet effect Effects 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 229940030600 antihypertensive agent Drugs 0.000 description 2
- 239000002220 antihypertensive agent Substances 0.000 description 2
- 229940127218 antiplatelet drug Drugs 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 208000026106 cerebrovascular disease Diseases 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 229960004486 desoxycorticosterone acetate Drugs 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 2
- 210000003191 femoral vein Anatomy 0.000 description 2
- 208000019622 heart disease Diseases 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- 229960001412 pentobarbital Drugs 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 229940124549 vasodilator Drugs 0.000 description 2
- 239000003071 vasodilator agent Substances 0.000 description 2
- 230000002861 ventricular Effects 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- DIVNUTGTTIRPQA-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1OC DIVNUTGTTIRPQA-UHFFFAOYSA-N 0.000 description 1
- YBBLOADPFWKNGS-UHFFFAOYSA-N 1,1-dimethylurea Chemical compound CN(C)C(N)=O YBBLOADPFWKNGS-UHFFFAOYSA-N 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- ZWAVGZYKJNOTPX-UHFFFAOYSA-N 1,3-diethylurea Chemical compound CCNC(=O)NCC ZWAVGZYKJNOTPX-UHFFFAOYSA-N 0.000 description 1
- QLTWHQKDTIUVOZ-UHFFFAOYSA-N 1,3-dimethyl-4-(2,3,4-trimethoxyphenyl)-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound COC1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=C(C)C=C(C)C=C1C QLTWHQKDTIUVOZ-UHFFFAOYSA-N 0.000 description 1
- OGZSNJQBAQUTBB-UHFFFAOYSA-N 1,3-dimethyl-4-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CC1=CC(C)=CC(C)=C1N=C1N(C)C(=O)N(C)C=C1 OGZSNJQBAQUTBB-UHFFFAOYSA-N 0.000 description 1
- DRQGFGGGEWJFTP-UHFFFAOYSA-N 1,3-dimethyl-4-(3,4,5-trimethoxyphenyl)-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound COC1=C(OC)C(OC)=CC(C=2N(C(=O)N(C)C(=NC=3C(=CC(C)=CC=3C)C)C=2)C)=C1 DRQGFGGGEWJFTP-UHFFFAOYSA-N 0.000 description 1
- VBRMMSYLLMEDTJ-UHFFFAOYSA-N 1,3-dimethyl-4-phenyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CC1=CC(C)=CC(C)=C1N=C1N(C)C(=O)N(C)C(C=2C=CC=CC=2)=C1 VBRMMSYLLMEDTJ-UHFFFAOYSA-N 0.000 description 1
- LLAPDLPYIYKTGQ-UHFFFAOYSA-N 1-aminoethyl Chemical group C[CH]N LLAPDLPYIYKTGQ-UHFFFAOYSA-N 0.000 description 1
- BYWNDUGWRRRWFW-UHFFFAOYSA-N 1-benzyl-6-(3,4-dimethoxyphenyl)-3-methyl-4-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)CC=2C=CC=CC=2)=CC1=NC1=C(C)C=C(C)C=C1C BYWNDUGWRRRWFW-UHFFFAOYSA-N 0.000 description 1
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- APLNAFMUEHKRLM-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)N=CN2 APLNAFMUEHKRLM-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- KTWCUGUUDHJVIH-UHFFFAOYSA-N 2-hydroxybenzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(N(O)C2=O)=O)=C3C2=CC=CC3=C1 KTWCUGUUDHJVIH-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XEFRNCLPPFDWAC-UHFFFAOYSA-N 3,4,5-trimethoxyaniline Chemical compound COC1=CC(N)=CC(OC)=C1OC XEFRNCLPPFDWAC-UHFFFAOYSA-N 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000002774 3,4-dimethoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C(OC([H])([H])[H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- FNFUDNIDDAUZDJ-UHFFFAOYSA-N 4-(3,4-dichlorophenyl)-1,3-dimethyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CC1=CC(C)=CC(C)=C1N=C1N(C)C(=O)N(C)C(C=2C=C(Cl)C(Cl)=CC=2)=C1 FNFUDNIDDAUZDJ-UHFFFAOYSA-N 0.000 description 1
- ZOLXODKWZIJBCA-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-diethyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CCN1C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=CC1=NC1=C(C)C=C(C)C=C1C ZOLXODKWZIJBCA-UHFFFAOYSA-N 0.000 description 1
- FEEKLNJLYCLBQQ-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-(3,4,5-trimethoxyphenyl)iminopyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=CC(OC)=C(OC)C(OC)=C1 FEEKLNJLYCLBQQ-UHFFFAOYSA-N 0.000 description 1
- JESTUYHZLFIPMX-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]pyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=NN=C(C)S1 JESTUYHZLFIPMX-UHFFFAOYSA-N 0.000 description 1
- OVMSARMOKXPXIT-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-[4-(oxiran-2-ylmethoxy)phenyl]iminopyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC(C=C1)=CC=C1OCC1OC1 OVMSARMOKXPXIT-UHFFFAOYSA-N 0.000 description 1
- JYPJMHOAVILUJX-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-phenyliminopyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=CC=CC=C1 JYPJMHOAVILUJX-UHFFFAOYSA-N 0.000 description 1
- YDQHQPXTKGSBSR-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-pyridin-3-yliminopyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=CC=CN=C1 YDQHQPXTKGSBSR-UHFFFAOYSA-N 0.000 description 1
- HLPXFJGUOUZTRN-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1,3-dimethyl-6-pyridin-3-yliminopyrimidin-2-one;dihydrochloride Chemical compound Cl.Cl.C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=CC=CN=C1 HLPXFJGUOUZTRN-UHFFFAOYSA-N 0.000 description 1
- SSQZHSBEWCXVPD-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1-methyl-3-propyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CN1C(=O)N(CCC)C(C=2C=C(OC)C(OC)=CC=2)=CC1=NC1=C(C)C=C(C)C=C1C SSQZHSBEWCXVPD-UHFFFAOYSA-N 0.000 description 1
- UCKYOPFRGDEHQZ-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-6-(2,6-dimethylphenyl)imino-1,3-dimethylpyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=C(C)C=CC=C1C UCKYOPFRGDEHQZ-UHFFFAOYSA-N 0.000 description 1
- JZGUVXACNGECJU-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-6-(4-hydroxyphenyl)imino-1,3-dimethylpyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=CC=C(O)C=C1 JZGUVXACNGECJU-UHFFFAOYSA-N 0.000 description 1
- ZIPJYOBWRFYGOE-UHFFFAOYSA-N 4-(4-chloro-2-methylphenyl)imino-6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=CC=C(Cl)C=C1C ZIPJYOBWRFYGOE-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- MBMQVQDDLMWWQA-UHFFFAOYSA-N 4-(4-methoxy-2-methylphenyl)-1,3-dimethyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound CC1=CC(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=C(C)C=C(C)C=C1C MBMQVQDDLMWWQA-UHFFFAOYSA-N 0.000 description 1
- ZWXDCCLPRUAAAU-UHFFFAOYSA-N 4-(4-methoxyphenyl)-1,3-dimethyl-6-(2,4,6-trimethylphenyl)iminopyrimidin-2-one Chemical compound C1=CC(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1=C(C)C=C(C)C=C1C ZWXDCCLPRUAAAU-UHFFFAOYSA-N 0.000 description 1
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- AGAWCGXBHJWZDS-UHFFFAOYSA-N 4-cyclohexylimino-6-(3,4-dimethoxyphenyl)-1,3-dimethylpyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C(N(C(=O)N1C)C)=CC1=NC1CCCCC1 AGAWCGXBHJWZDS-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ODVJGSHFTVCJAH-UHFFFAOYSA-N 5-(3,4-dimethoxyphenyl)-1,3-dimethyl-4-sulfanylidenepyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CN(C)C(=O)N(C)C1=S ODVJGSHFTVCJAH-UHFFFAOYSA-N 0.000 description 1
- VNMOFKAMZFOUMC-UHFFFAOYSA-N 5-(3,4-dimethoxyphenyl)-1h-pyrimidine-2,4-dione Chemical compound C1=C(OC)C(OC)=CC=C1C1=CNC(=O)NC1=O VNMOFKAMZFOUMC-UHFFFAOYSA-N 0.000 description 1
- HMPUHXCGUHDVBI-UHFFFAOYSA-N 5-methyl-1,3,4-thiadiazol-2-amine Chemical compound CC1=NN=C(N)S1 HMPUHXCGUHDVBI-UHFFFAOYSA-N 0.000 description 1
- DRKARPHBYYYRET-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1,3-dimethyl-4h-pyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CCN(C)C(=O)N1C DRKARPHBYYYRET-UHFFFAOYSA-N 0.000 description 1
- YEYAJVZEZRPQLN-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-ethyl-3-methyl-4-(2,4,6-trimethylphenyl)iminopyrimidin-2-one;hydrochloride Chemical compound Cl.CN1C(=O)N(CC)C(C=2C=C(OC)C(OC)=CC=2)=CC1=NC1=C(C)C=C(C)C=C1C YEYAJVZEZRPQLN-UHFFFAOYSA-N 0.000 description 1
- MGHYSSWGXFSVAW-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-4-(2,4,6-trimethylanilino)-1h-pyrimidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC(NC=2C(=CC(C)=CC=2C)C)=NC(=O)N1 MGHYSSWGXFSVAW-UHFFFAOYSA-N 0.000 description 1
- JQGWPWFIYKXWGQ-UHFFFAOYSA-N 6-(4-methoxyphenyl)-3-methyl-1h-pyrimidine-2,4-dione Chemical compound C1=CC(OC)=CC=C1C1=CC(=O)N(C)C(=O)N1 JQGWPWFIYKXWGQ-UHFFFAOYSA-N 0.000 description 1
- TZCYLJGNWDVJRA-UHFFFAOYSA-N 6-chloro-1-hydroxybenzotriazole Chemical compound C1=C(Cl)C=C2N(O)N=NC2=C1 TZCYLJGNWDVJRA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 102100026735 Coagulation factor VIII Human genes 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 101000911390 Homo sapiens Coagulation factor VIII Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical class NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N N-butylamine Natural products CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 1
- 241000700157 Rattus norvegicus Species 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000016571 aggressive behavior Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 125000000637 arginyl group Chemical class N[C@@H](CCCNC(N)=N)C(=O)* 0.000 description 1
- 230000004872 arterial blood pressure Effects 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 210000001168 carotid artery common Anatomy 0.000 description 1
- 210000000269 carotid artery external Anatomy 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- SIWICBKMMHBCSU-UHFFFAOYSA-N ethyl 3-(3,4-dichlorophenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C(Cl)C(Cl)=C1 SIWICBKMMHBCSU-UHFFFAOYSA-N 0.000 description 1
- ISFGZMZPNNGHQH-UHFFFAOYSA-N ethyl 3-(4-methoxy-3-methylphenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C(OC)C(C)=C1 ISFGZMZPNNGHQH-UHFFFAOYSA-N 0.000 description 1
- KRAHENMBSVAAHD-UHFFFAOYSA-N ethyl 3-(4-methoxyphenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C(OC)C=C1 KRAHENMBSVAAHD-UHFFFAOYSA-N 0.000 description 1
- IEORXFCOYQQQQA-UHFFFAOYSA-N ethyl 3-oxo-3-(2,3,4-trimethoxyphenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC=C(OC)C(OC)=C1OC IEORXFCOYQQQQA-UHFFFAOYSA-N 0.000 description 1
- VEYNISLTHXQSGU-UHFFFAOYSA-N ethyl 3-oxo-3-(3,4,5-trimethoxyphenyl)propanoate Chemical compound CCOC(=O)CC(=O)C1=CC(OC)=C(OC)C(OC)=C1 VEYNISLTHXQSGU-UHFFFAOYSA-N 0.000 description 1
- APQGYFNHIWMRIJ-UHFFFAOYSA-N ethyl 3-oxo-3-pyridin-3-ylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CN=C1 APQGYFNHIWMRIJ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910003480 inorganic solid Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 210000005240 left ventricle Anatomy 0.000 description 1
- RSHAOIXHUHAZPM-UHFFFAOYSA-N magnesium hydride Chemical compound [MgH2] RSHAOIXHUHAZPM-UHFFFAOYSA-N 0.000 description 1
- 229910012375 magnesium hydride Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000006533 methyl amino methyl group Chemical group [H]N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- PXSXRABJBXYMFT-UHFFFAOYSA-N n-hexylhexan-1-amine Chemical compound CCCCCCNCCCCCC PXSXRABJBXYMFT-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940100684 pentylamine Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000000106 platelet aggregation inhibitor Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 210000003752 saphenous vein Anatomy 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- PIEPQKCYPFFYMG-UHFFFAOYSA-N tris acetate Chemical compound CC(O)=O.OCC(N)(CO)CO PIEPQKCYPFFYMG-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/20—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D239/22—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Cardiology (AREA)
- Veterinary Medicine (AREA)
- Heart & Thoracic Surgery (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838308290A GB8308290D0 (en) | 1983-03-25 | 1983-03-25 | Pyrimidinone derivatives |
| GB838315542A GB8315542D0 (en) | 1983-06-07 | 1983-06-07 | Pyrimidinone derivatives |
| GB838327859A GB8327859D0 (en) | 1983-10-18 | 1983-10-18 | Pyrimidine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO841168L true NO841168L (no) | 1984-09-26 |
Family
ID=27262023
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO841168A NO841168L (no) | 1983-03-25 | 1984-03-23 | Fremgangsmaate for fremstilling av pyrimidinderivater |
Country Status (13)
| Country | Link |
|---|---|
| US (3) | US4612376A (da) |
| EP (1) | EP0123402B1 (da) |
| KR (1) | KR840008333A (da) |
| CA (1) | CA1256107A (da) |
| DE (1) | DE3473875D1 (da) |
| DK (1) | DK160492C (da) |
| ES (2) | ES530916A0 (da) |
| FI (1) | FI841128A (da) |
| GR (1) | GR81758B (da) |
| HU (1) | HU195195B (da) |
| NO (1) | NO841168L (da) |
| PH (1) | PH22022A (da) |
| SU (2) | SU1349698A3 (da) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4612376A (en) * | 1983-03-25 | 1986-09-16 | Fujisawa Pharmaceutical Co., Ltd. | Substituted-3,4-dihydro-4-(2,4,6-trimethoxyphenylimino)-2(1H)-pyrimidones useful as cardiotonic, antihypertensive, cerebrovascular vasodilator and anti-platelet agent |
| US4598149A (en) * | 1984-03-02 | 1986-07-01 | Merck & Co., Inc. | 3-amino-2-hydroxypropyl of pyrimidin-4-one useful as antihypertensive, cardioprotective, antiarrythmic, and antianginal agents |
| US4649142A (en) * | 1984-06-25 | 1987-03-10 | Fujisawa Pharmaceutical Co., Ltd. | 3,4-dihydro-1,3-disubstituted-6-(substituted phenylimino)-2(1H)-pyrimidinone useful as cardiotonic agent and anti-allergic agent |
| US4708958A (en) * | 1986-09-24 | 1987-11-24 | G. D. Searle & Co. | 6-(imidazolyphenyl)-4-iminopyrimidinones useful as hypotensive agents |
| US5521315A (en) * | 1993-01-12 | 1996-05-28 | Cell Therapeutics, Inc. | Olefin substituted long chain compounds |
| IT1270122B (it) * | 1994-10-04 | 1997-04-28 | Ist Superiore Sanita | 6-benzil-4-ossopirimidine sostituite, processo per la loro preparazione e composizioni farmaceutiche che le contengono |
| US6244121B1 (en) * | 1998-03-06 | 2001-06-12 | Applied Materials, Inc. | Sensor device for non-intrusive diagnosis of a semiconductor processing system |
| KR20110010824A (ko) | 2003-01-14 | 2011-02-07 | 아레나 파마슈티칼스, 인크. | 대사 조절제로서의 １,２,３-삼치환된 아릴 및 헤테로아릴 유도체, 및 당뇨병 및 고혈당증을 비롯한 이에 관련된 장애의 예방 및 치료 |
| JP4920410B2 (ja) | 2003-07-14 | 2012-04-18 | アリーナ ファーマシューティカルズ， インコーポレイテッド | 代謝モジュレーターとしての縮合アリールおよびヘテロアリール誘導体ならびに代謝に関連する障害の予防および治療 |
| DOP2006000009A (es) | 2005-01-13 | 2006-08-15 | Arena Pharm Inc | Procedimiento para preparar eteres de pirazolo [3,4-d] pirimidina |
| NZ565955A (en) | 2005-08-22 | 2011-08-26 | Melior Pharmaceuticals I Inc | Methods and formulations for modulating lyn kinase activity and treating related disorders |
| NZ579227A (en) * | 2007-02-20 | 2012-11-30 | Melior Pharmaceuticals I Inc | Methods of identifying activators of lyn kinase |
| BRPI0813167A2 (pt) * | 2007-07-23 | 2014-12-23 | Melior Discovery Inc | Usos de uma composição e de um agente para modular a atividade e/ou a expressão de irs-1 e/ou akt, e, composto |
| US8552184B2 (en) * | 2008-07-03 | 2013-10-08 | Melior Pharmaceuticals I, Inc. | Compounds and methods for treating disorders related to glucose metabolism |
| WO2011017296A1 (en) * | 2009-08-04 | 2011-02-10 | Schering Corporation | 4, 5, 6-trisubstituted pyrimidine derivatives as factor ixa inhibitors |
| EP3378854B1 (en) | 2010-01-27 | 2022-12-21 | Arena Pharmaceuticals, Inc. | Processes for the preparation of (r)-2-(7-(4-cyclopentyl-3-(trifluoromethyl)benzyloxy)-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid and salts thereof |
| US10894787B2 (en) | 2010-09-22 | 2021-01-19 | Arena Pharmaceuticals, Inc. | Modulators of the GPR119 receptor and the treatment of disorders related thereto |
| US10183949B2 (en) | 2014-08-29 | 2019-01-22 | The University Of Tokyo | Pyrimidinone derivative having autotaxin-inhibitory activity |
| WO2016031987A1 (ja) * | 2014-08-29 | 2016-03-03 | 国立大学法人東京大学 | オートタキシン阻害活性を有するピリミジノン誘導体 |
| MX2021011472A (es) | 2015-01-06 | 2022-08-17 | Arena Pharm Inc | Metodos de condiciones de tratamiento relacionadas con el receptor s1p1. |
| KR102603199B1 (ko) | 2015-06-22 | 2023-11-16 | 아레나 파마슈티칼스, 인크. | Ｓ1ｐ1 수용체-관련 장애에서의 사용을 위한 (ｒ)-2-(7-(4-시클로펜틸-3-(트리플루오로메틸)벤질옥시)-1,2,3,4-테트라히드로시클로-펜타[ｂ]인돌-3-일)아세트산 (화합물 1)의 결정성 ｌ-아르기닌 염 |
| WO2018151873A1 (en) | 2017-02-16 | 2018-08-23 | Arena Pharmaceuticals, Inc. | Compounds and methods for treatment of primary biliary cholangitis |
| WO2018191166A1 (en) | 2017-04-10 | 2018-10-18 | Melior Pharmaceuticals I, Inc. | Treatment of adipocytes |
| CN109053589A (zh) * | 2018-09-30 | 2018-12-21 | 浙江师范大学 | 4-亚胺基四氢嘧啶-2-酮类化合物的制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1296371A (da) * | 1969-02-26 | 1972-11-15 | ||
| AU1108070A (en) * | 1969-03-06 | 1971-08-12 | Imperial Chemical Industries Limited | Pyrimidine derivatives |
| GB1336138A (en) * | 1969-12-10 | 1973-11-07 | Ici Ltd | Process for the production of pyrimidine derivatives |
| US3923807A (en) * | 1973-09-10 | 1975-12-02 | Takeda Chemical Industries Ltd | 6-Aminouracil derivatives |
| JPS5053381A (da) * | 1973-09-20 | 1975-05-12 | ||
| US4208366A (en) * | 1978-10-31 | 1980-06-17 | E. I. Du Pont De Nemours And Company | Process for preparing a nonwoven web |
| DE2847693A1 (de) * | 1978-11-03 | 1980-05-22 | Hoechst Ag | Verfahren zur herstellung von pyrimido-(6,1-a)-isochinolin-2-onen |
| US4612376A (en) * | 1983-03-25 | 1986-09-16 | Fujisawa Pharmaceutical Co., Ltd. | Substituted-3,4-dihydro-4-(2,4,6-trimethoxyphenylimino)-2(1H)-pyrimidones useful as cardiotonic, antihypertensive, cerebrovascular vasodilator and anti-platelet agent |
-
1984
- 1984-03-12 US US06/588,902 patent/US4612376A/en not_active Expired - Fee Related
- 1984-03-14 DE DE8484301741T patent/DE3473875D1/de not_active Expired
- 1984-03-14 EP EP84301741A patent/EP0123402B1/en not_active Expired
- 1984-03-14 PH PH30400A patent/PH22022A/en unknown
- 1984-03-14 GR GR74104A patent/GR81758B/el unknown
- 1984-03-20 KR KR1019840001414A patent/KR840008333A/ko not_active Application Discontinuation
- 1984-03-21 FI FI841128A patent/FI841128A/fi not_active Application Discontinuation
- 1984-03-21 CA CA000450076A patent/CA1256107A/en not_active Expired
- 1984-03-23 ES ES530916A patent/ES530916A0/es active Granted
- 1984-03-23 NO NO841168A patent/NO841168L/no unknown
- 1984-03-23 DK DK166884A patent/DK160492C/da active IP Right Grant
- 1984-03-23 SU SU843718401A patent/SU1349698A3/ru active
- 1984-03-23 HU HU841170A patent/HU195195B/hu not_active IP Right Cessation
- 1984-11-30 ES ES538190A patent/ES538190A0/es active Granted
-
1985
- 1985-03-28 SU SU853892541A patent/SU1436872A3/ru active
-
1986
- 1986-06-05 US US06/870,826 patent/US4746664A/en not_active Expired - Fee Related
-
1988
- 1988-03-25 US US07/173,584 patent/US4824851A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES8505972A1 (es) | 1985-06-16 |
| SU1349698A3 (ru) | 1987-10-30 |
| PH22022A (en) | 1988-05-13 |
| KR840008333A (ko) | 1984-12-14 |
| CA1256107A (en) | 1989-06-20 |
| DK160492C (da) | 1991-08-26 |
| US4824851A (en) | 1989-04-25 |
| FI841128A (fi) | 1984-09-26 |
| US4612376A (en) | 1986-09-16 |
| ES8601922A1 (es) | 1985-11-01 |
| ES530916A0 (es) | 1985-06-16 |
| FI841128A0 (fi) | 1984-03-21 |
| SU1436872A3 (ru) | 1988-11-07 |
| US4746664A (en) | 1988-05-24 |
| DE3473875D1 (en) | 1988-10-13 |
| EP0123402A2 (en) | 1984-10-31 |
| DK160492B (da) | 1991-03-18 |
| EP0123402B1 (en) | 1988-09-07 |
| HU195195B (en) | 1988-04-28 |
| GR81758B (da) | 1984-12-12 |
| EP0123402A3 (en) | 1985-09-18 |
| DK166884D0 (da) | 1984-03-23 |
| ES538190A0 (es) | 1985-11-01 |
| DK166884A (da) | 1984-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO841168L (no) | Fremgangsmaate for fremstilling av pyrimidinderivater | |
| JP2896532B2 (ja) | 新規なピリミジン誘導体およびその製造方法 | |
| US4725600A (en) | Pyrimidine compounds having activity as a cardiotonic anti-hypertensive cerebrovascular vasodilator and anti-platelet aggregation agent | |
| EP0163599B1 (en) | Pyrimidopyrimidine derivatives, processes for producing them, pharmaceutical compositions containing them and their use as anti-allergic agents | |
| US4818756A (en) | 2-pyrimidinyl-1-piperazine derivatives, processes for their preparation and medicaments containing them | |
| US3037980A (en) | Pyrrolopyrimidine vasodilators and method of making them | |
| AU2004272283B9 (en) | 2,4 di (hetero) -arylamino-pyrimidine derivatives as ZAP-70 and/or Syk inhibitors | |
| CA2014760A1 (en) | Chemical compounds | |
| SE440079B (sv) | Substituerade 5-(2-imidazolin-2-yl)-aminopyrimidiner och farmaceutisk komposition | |
| JPS6136831B2 (da) | ||
| NO177054B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive aminopyrimidinderivater | |
| EP0084250B1 (en) | 6-(substituted phenyl)-4,5-dihydro-3-(2h)-pyridazinone compounds and processes for their preparation | |
| HU228457B1 (en) | Substituted aza- and diazacycloheptane and cyclooctane derivatives, use thereof, pharmaceutical compositions containing there of | |
| CZ9797A3 (en) | Triazole derivative, process of its preparation and pharmaceutical composition containing thereof | |
| EP0077983B1 (en) | Triazine derivatives, processes for preparation thereof and pharmaceutical compositions comprising the same | |
| SU1232145A3 (ru) | Способ получени производных пиримидона или их фармацевтически приемлемых солей | |
| Winn et al. | 2-(Alkylamino) nicotinic acid and analogs. Potent angiotensin II antagonists | |
| DK165744B (da) | Thienopyrimidinderivater, fremgangsmaader til fremstilling deraf og farmaceutiske praeparater | |
| SE448876B (sv) | Inre salter av sulfoxi-triazinium-, -pyrimidinium- och -pyridiniumhydroxid och sett att framstella dessa | |
| DK156722B (da) | Analogifremgangsmaade til fremstilling af 2-piperazinopyrimidinderivater | |
| US4666915A (en) | 2-anilino-1,6-dihydro-6-oxo-5-pyrimidine-carboxylic acid derivatives, process for the preparation thereof, and antiallergic agent containing the same | |
| EP0244352B1 (en) | Pyrido[4,3-d]pyrimidine derivatives | |
| HU201059B (en) | Process for producing 6-oxo-pyridazine derivatives and pharmaceutical compositions containing them | |
| JPH0546340B2 (da) | ||
| DD220780A5 (de) | Verfahren zur herstellung von 5-subst.-(1,2,4) triazolo (1,5-c) pryimidin-2-aminen |