NO764378L - - Google Patents
Info
- Publication number
- NO764378L NO764378L NO764378A NO764378A NO764378L NO 764378 L NO764378 L NO 764378L NO 764378 A NO764378 A NO 764378A NO 764378 A NO764378 A NO 764378A NO 764378 L NO764378 L NO 764378L
- Authority
- NO
- Norway
- Prior art keywords
- coating
- tin
- intermediate coating
- manganese
- antimony
- Prior art date
Links
- 238000000576 coating method Methods 0.000 claims description 76
- 239000011248 coating agent Substances 0.000 claims description 66
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 54
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 54
- 229910052719 titanium Inorganic materials 0.000 claims description 53
- 239000010936 titanium Substances 0.000 claims description 53
- 238000000034 method Methods 0.000 claims description 35
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 25
- 229910052751 metal Inorganic materials 0.000 claims description 21
- 239000002184 metal Substances 0.000 claims description 21
- 239000000758 substrate Substances 0.000 claims description 21
- 229910052718 tin Inorganic materials 0.000 claims description 21
- 150000001463 antimony compounds Chemical class 0.000 claims description 18
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 claims description 17
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 12
- 238000009713 electroplating Methods 0.000 claims description 9
- 229910052787 antimony Inorganic materials 0.000 claims description 7
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 7
- 238000001035 drying Methods 0.000 claims description 7
- 238000005868 electrolysis reaction Methods 0.000 claims description 7
- 235000007079 manganese sulphate Nutrition 0.000 claims description 6
- 239000011702 manganese sulphate Substances 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 150000002697 manganese compounds Chemical class 0.000 claims description 5
- 229940099596 manganese sulfate Drugs 0.000 claims description 5
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 claims description 5
- 239000012298 atmosphere Substances 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 3
- 229910045601 alloy Inorganic materials 0.000 claims description 3
- 239000000956 alloy Substances 0.000 claims description 3
- 239000004411 aluminium Substances 0.000 claims description 3
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- 238000010422 painting Methods 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052721 tungsten Inorganic materials 0.000 claims description 3
- 239000010937 tungsten Substances 0.000 claims description 3
- 229910052726 zirconium Inorganic materials 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 30
- 238000010304 firing Methods 0.000 description 14
- 239000010410 layer Substances 0.000 description 14
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 239000000463 material Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 229910052697 platinum Inorganic materials 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 229910000410 antimony oxide Inorganic materials 0.000 description 6
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical class [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 6
- 229910001887 tin oxide Inorganic materials 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- DAMJCWMGELCIMI-UHFFFAOYSA-N benzyl n-(2-oxopyrrolidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CCNC1=O DAMJCWMGELCIMI-UHFFFAOYSA-N 0.000 description 5
- YADSGOSSYOOKMP-UHFFFAOYSA-N lead dioxide Inorganic materials O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 5
- 229910000978 Pb alloy Inorganic materials 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000003792 electrolyte Substances 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 238000011835 investigation Methods 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000001680 brushing effect Effects 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 238000007598 dipping method Methods 0.000 description 3
- 239000002019 doping agent Substances 0.000 description 3
- 238000004070 electrodeposition Methods 0.000 description 3
- 238000005363 electrowinning Methods 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- -1 SbCl^ Chemical class 0.000 description 2
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 239000010970 precious metal Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- 229910001339 C alloy Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 229910006404 SnO 2 Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- GZMKWMMWAHQTHD-UHFFFAOYSA-L [Mn++].OS([O-])(=O)=O.OS([O-])(=O)=O Chemical compound [Mn++].OS([O-])(=O)=O.OS([O-])(=O)=O GZMKWMMWAHQTHD-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000004210 cathodic protection Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- JFBJUMZWZDHTIF-UHFFFAOYSA-N chlorine chlorite Inorganic materials ClOCl=O JFBJUMZWZDHTIF-UHFFFAOYSA-N 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005238 degreasing Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- RJGHQTVXGKYATR-UHFFFAOYSA-L dibutyl(dichloro)stannane Chemical compound CCCC[Sn](Cl)(Cl)CCCC RJGHQTVXGKYATR-UHFFFAOYSA-L 0.000 description 1
- QBWXYICYWNSGPT-UHFFFAOYSA-L dichlorotin pentahydrate Chemical compound O.O.O.O.O.Cl[Sn]Cl QBWXYICYWNSGPT-UHFFFAOYSA-L 0.000 description 1
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical class Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012799 electrically-conductive coating Substances 0.000 description 1
- 238000004134 energy conservation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910001867 inorganic solvent Inorganic materials 0.000 description 1
- 239000003049 inorganic solvent Substances 0.000 description 1
- 239000011229 interlayer Substances 0.000 description 1
- HEPLMSKRHVKCAQ-UHFFFAOYSA-N lead nickel Chemical compound [Ni].[Pb] HEPLMSKRHVKCAQ-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000002161 passivation Methods 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000005488 sandblasting Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- OBBXFSIWZVFYJR-UHFFFAOYSA-L tin(2+);sulfate Chemical compound [Sn+2].[O-]S([O-])(=O)=O OBBXFSIWZVFYJR-UHFFFAOYSA-L 0.000 description 1
- 229910000375 tin(II) sulfate Inorganic materials 0.000 description 1
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical class [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B11/00—Electrodes; Manufacture thereof not otherwise provided for
- C25B11/04—Electrodes; Manufacture thereof not otherwise provided for characterised by the material
- C25B11/051—Electrodes formed of electrocatalysts on a substrate or carrier
- C25B11/073—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material
- C25B11/091—Electrodes formed of electrocatalysts on a substrate or carrier characterised by the electrocatalyst material consisting of at least one catalytic element and at least one catalytic compound; consisting of two or more catalytic elements or catalytic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrodes For Compound Or Non-Metal Manufacture (AREA)
- Electrolytic Production Of Metals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7714305A SE7714305L (sv) | 1976-12-28 | 1977-12-15 | Sekringsanordning vid festskruvar for lasbeslag |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/644,639 US4028215A (en) | 1975-12-29 | 1975-12-29 | Manganese dioxide electrode |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO764378L true NO764378L (it) | 1977-06-30 |
Family
ID=24585767
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO764378A NO764378L (it) | 1975-12-29 | 1976-12-28 |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US4028215A (it) |
| JP (1) | JPS5282679A (it) |
| AU (1) | AU500844B2 (it) |
| BE (1) | BE849888A (it) |
| BR (1) | BR7608761A (it) |
| CA (1) | CA1074190A (it) |
| DD (1) | DD129809A5 (it) |
| DE (1) | DE2657979A1 (it) |
| DK (1) | DK585776A (it) |
| FI (1) | FI763705A (it) |
| FR (1) | FR2336975A1 (it) |
| GB (1) | GB1562720A (it) |
| IN (1) | IN144771B (it) |
| IT (1) | IT1073997B (it) |
| MX (1) | MX144004A (it) |
| NO (1) | NO764378L (it) |
| RO (1) | RO71200A (it) |
| SE (1) | SE7614593L (it) |
| ZA (1) | ZA767664B (it) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2710802C3 (de) * | 1976-03-15 | 1980-04-03 | Diamond Shamrock Corp., Cleveland, Ohio (V.St.A.) | Verfahren zur Herstellung von Elektroden für Elektrolysezellen |
| EP0004386B1 (en) * | 1978-03-28 | 1982-11-24 | Diamond Shamrock Technologies S.A. | Electrodes for electrolytic processes, especially metal electrowinning |
| US4243503A (en) * | 1978-08-29 | 1981-01-06 | Diamond Shamrock Corporation | Method and electrode with admixed fillers |
| US4265728A (en) * | 1978-11-03 | 1981-05-05 | Diamond Shamrock Corporation | Method and electrode with manganese dioxide coating |
| FR2460343A1 (fr) * | 1979-06-29 | 1981-01-23 | Solvay | Cathode pour la production electrolytique d'hydrogene |
| DE2928910A1 (de) * | 1979-06-29 | 1981-01-29 | Bbc Brown Boveri & Cie | Elektrode fuer die wasserelektrolyse |
| US4260470A (en) * | 1979-10-29 | 1981-04-07 | The International Nickel Company, Inc. | Insoluble anode for electrowinning metals |
| US4279705A (en) * | 1980-02-19 | 1981-07-21 | Kerr-Mcgee Corporation | Process for oxidizing a metal of variable valence by constant current electrolysis |
| US4315956A (en) * | 1980-04-21 | 1982-02-16 | National Mine Service Company | Process for depositing cobalt ondes on a refractory-coated platinum resistor coil |
| US4369105A (en) * | 1981-03-25 | 1983-01-18 | The Dow Chemical Company | Substituted cobalt oxide spinels |
| US4428805A (en) | 1981-08-24 | 1984-01-31 | The Dow Chemical Co. | Electrodes for oxygen manufacture |
| US4495046A (en) * | 1983-05-19 | 1985-01-22 | Union Oil Company Of California | Electrode containing thallium (III) oxide |
| GB8509384D0 (en) * | 1985-04-12 | 1985-05-15 | Marston Palmer Ltd | Electrode |
| US5451307A (en) * | 1985-05-07 | 1995-09-19 | Eltech Systems Corporation | Expanded metal mesh and anode structure |
| US5423961A (en) * | 1985-05-07 | 1995-06-13 | Eltech Systems Corporation | Cathodic protection system for a steel-reinforced concrete structure |
| US5421968A (en) * | 1985-05-07 | 1995-06-06 | Eltech Systems Corporation | Cathodic protection system for a steel-reinforced concrete structure |
| CH671408A5 (it) * | 1987-02-20 | 1989-08-31 | Bbc Brown Boveri & Cie | |
| US5501924A (en) * | 1995-06-07 | 1996-03-26 | Eveready Battery Company, Inc. | Alkaline cell having a cathode including a tin dioxide additive |
| CA2269545A1 (en) * | 1996-10-10 | 1998-04-16 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | Modified electrode material and its use |
| AU6615098A (en) | 1997-01-31 | 1998-08-25 | Merck Patent Gmbh | New manganese dioxide electrodes, process for producing the same and their use |
| US7247229B2 (en) * | 1999-06-28 | 2007-07-24 | Eltech Systems Corporation | Coatings for the inhibition of undesirable oxidation in an electrochemical cell |
| DE10016024A1 (de) | 2000-03-31 | 2001-10-04 | Merck Patent Gmbh | Aktives Anodenmaterial in elektrochemischen Zellen und Verfahren zu deren Herstellung |
| US6589405B2 (en) | 2000-05-15 | 2003-07-08 | Oleh Weres | Multilayer oxide coated valve metal electrode for water purification |
| JP2004514558A (ja) | 2000-11-30 | 2004-05-20 | メルク パテント ゲゼルシャフト ミット ベシュレンクテル ハフトング | 乳白色効果を有する粒子 |
| EP2055807B1 (en) * | 2007-10-31 | 2010-07-14 | Daiki Ataka Engineering Co., Ltd. | Oxygen Evolution Electrode |
| CN102659224A (zh) * | 2012-05-30 | 2012-09-12 | 北京师范大学 | 一种纳米涂层电极的制备方法及其应用 |
| CN111926349B (zh) * | 2020-09-09 | 2021-10-15 | 中南大学 | 一种湿法冶金用复合阳极及其制备方法和应用 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2631115A (en) * | 1949-08-06 | 1953-03-10 | Manganese Battery Corp | Electrodes for electrochemical cells |
| DE1567909B1 (de) * | 1965-12-07 | 1970-07-16 | Basf Ag | Titan-oder tantalhaltige Anode fuer horizontale Elektrolysezellen |
| US3616302A (en) * | 1967-02-27 | 1971-10-26 | Furerkawa Electric Co Ltd The | Insoluble anode for electrolysis and a method for its production |
| GB1206863A (en) * | 1968-04-02 | 1970-09-30 | Ici Ltd | Electrodes for electrochemical process |
| GB1277033A (en) * | 1968-12-13 | 1972-06-07 | Ici Ltd | Electrodes for electrochemical cells |
| US3654121A (en) * | 1968-12-23 | 1972-04-04 | Engelhard Min & Chem | Electrolytic anode |
| US3926773A (en) * | 1970-07-16 | 1975-12-16 | Conradty Fa C | Metal anode for electrochemical processes and method of making same |
| US3917518A (en) * | 1973-04-19 | 1975-11-04 | Diamond Shamrock Corp | Hypochlorite production |
| US3915837A (en) * | 1973-07-18 | 1975-10-28 | Jr Norman G Feige | Anode and method of production thereof |
| US3855084A (en) * | 1973-07-18 | 1974-12-17 | N Feige | Method of producing a coated anode |
| US3850764A (en) * | 1974-04-11 | 1974-11-26 | Corning Glass Works | Method of forming a solid tantalum capacitor |
| US3882002A (en) * | 1974-08-02 | 1975-05-06 | Hooker Chemicals Plastics Corp | Anode for electrolytic processes |
| US3986942A (en) * | 1974-08-02 | 1976-10-19 | Hooker Chemicals & Plastics Corporation | Electrolytic process and apparatus |
| US4040939A (en) * | 1975-12-29 | 1977-08-09 | Diamond Shamrock Corporation | Lead dioxide electrode |
-
1975
- 1975-12-29 US US05/644,639 patent/US4028215A/en not_active Expired - Lifetime
-
1976
- 1976-11-15 CA CA265,600A patent/CA1074190A/en not_active Expired
- 1976-12-16 MX MX167463A patent/MX144004A/es unknown
- 1976-12-21 DE DE19762657979 patent/DE2657979A1/de not_active Withdrawn
- 1976-12-24 JP JP15613576A patent/JPS5282679A/ja active Pending
- 1976-12-24 GB GB53998/76A patent/GB1562720A/en not_active Expired
- 1976-12-27 SE SE7614593A patent/SE7614593L/ not_active Application Discontinuation
- 1976-12-27 FI FI763705A patent/FI763705A/fi not_active Application Discontinuation
- 1976-12-28 IT IT52809/76A patent/IT1073997B/it active
- 1976-12-28 ZA ZA00767664A patent/ZA767664B/xx unknown
- 1976-12-28 BR BR7608761A patent/BR7608761A/pt unknown
- 1976-12-28 BE BE173660A patent/BE849888A/xx unknown
- 1976-12-28 FR FR7639250A patent/FR2336975A1/fr active Granted
- 1976-12-28 DD DD7600196656A patent/DD129809A5/xx unknown
- 1976-12-28 DK DK585776A patent/DK585776A/da unknown
- 1976-12-28 NO NO764378A patent/NO764378L/no unknown
- 1976-12-28 IN IN2276/CAL/76A patent/IN144771B/en unknown
- 1976-12-28 RO RO7688872A patent/RO71200A/ro unknown
- 1976-12-30 AU AU20971/76A patent/AU500844B2/en not_active Expired
-
1977
- 1977-05-23 US US05/799,591 patent/US4125449A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DD129809A5 (de) | 1978-02-08 |
| CA1074190A (en) | 1980-03-25 |
| AU500844B2 (en) | 1979-05-31 |
| FI763705A (it) | 1977-06-30 |
| GB1562720A (en) | 1980-03-12 |
| MX144004A (es) | 1981-08-18 |
| FR2336975A1 (fr) | 1977-07-29 |
| DE2657979A1 (de) | 1977-07-07 |
| IT1073997B (it) | 1985-04-17 |
| BE849888A (fr) | 1977-06-28 |
| JPS5282679A (en) | 1977-07-11 |
| AU2097176A (en) | 1978-07-06 |
| RO71200A (ro) | 1982-09-09 |
| ZA767664B (en) | 1978-02-22 |
| FR2336975B1 (it) | 1982-01-08 |
| US4125449A (en) | 1978-11-14 |
| DK585776A (da) | 1977-06-30 |
| SE7614593L (sv) | 1977-06-30 |
| US4028215A (en) | 1977-06-07 |
| IN144771B (it) | 1978-07-01 |
| BR7608761A (pt) | 1977-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO764378L (it) | ||
| US4243503A (en) | Method and electrode with admixed fillers | |
| KR100227556B1 (ko) | 전해 전극 | |
| US4331528A (en) | Coated metal electrode with improved barrier layer | |
| NO160933B (no) | Elektrode for elektrokjemiske prosesser, elektrokjemisk celle og fremgangsmaate til fremstilling av en elektrode tilbruk i en elektrolysecelle. | |
| NO137324B (no) | Fremgangsm}te for fremstilling av elektroder egnet til bruk i elektrolytiske prosesser. | |
| US4040939A (en) | Lead dioxide electrode | |
| US3926751A (en) | Method of electrowinning metals | |
| EP0014596B1 (en) | Method for producing electrodes having mixed metal oxide catalyst coatings | |
| US6231731B1 (en) | Electrolyzing electrode and process for the production thereof | |
| US4456518A (en) | Noble metal-coated cathode | |
| EP0027051B1 (en) | Coated metal electrode with improved barrier layer and methods of manufacture and use thereof | |
| CA1190186A (en) | Electrode with mixed oxide interface on valve metal base and stable outer coating | |
| Liu et al. | Effect of molar ratio of ruthenium and antimony on corrosion mechanism of Ti/Sn-Sb-RuOx electrode for zinc electrowinning | |
| NO793526L (no) | Elektrolysecelleelektrode og fremgangsmaate ved fremstilling derav | |
| US4208450A (en) | Transition metal oxide electrodes | |
| FI84496B (fi) | Anod foer anvaendning foer framstaellning av vaeteperoxidloesning och foerfarande foer framstaellning av anoden. | |
| JPS633031B2 (it) | ||
| JPS5822551B2 (ja) | 改良された電極の製造法 | |
| US3677917A (en) | Electrode coatings | |
| JPS6147231B2 (it) | ||
| US3969217A (en) | Electrolytic anode | |
| CA1112607A (en) | Transition metal oxide electrodes | |
| JP5456744B2 (ja) | 金属電解採取方法 | |
| JPH09157879A (ja) | 電解用電極およびその製造方法 |