NO764025L - - Google Patents
Info
- Publication number
- NO764025L NO764025L NO764025A NO764025A NO764025L NO 764025 L NO764025 L NO 764025L NO 764025 A NO764025 A NO 764025A NO 764025 A NO764025 A NO 764025A NO 764025 L NO764025 L NO 764025L
- Authority
- NO
- Norway
- Prior art keywords
- pyridine
- amino
- compound
- mono
- imidazo
- Prior art date
Links
- -1 hydroxy, sulfonamido Chemical group 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 42
- 150000001875 compounds Chemical class 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 27
- 125000003545 alkoxy group Chemical group 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 10
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 claims description 10
- 125000003282 alkyl amino group Chemical group 0.000 claims description 9
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 9
- 125000004414 alkyl thio group Chemical group 0.000 claims description 9
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 125000004423 acyloxy group Chemical group 0.000 claims description 7
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 7
- 150000002367 halogens Chemical group 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000001589 carboacyl group Chemical group 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 5
- 125000005596 alkyl carboxamido group Chemical group 0.000 claims description 5
- 125000005422 alkyl sulfonamido group Chemical group 0.000 claims description 5
- 125000005518 carboxamido group Chemical group 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000005059 halophenyl group Chemical group 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000011630 iodine Chemical group 0.000 claims description 3
- 229910052740 iodine Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- 238000006243 chemical reaction Methods 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 35
- 239000000047 product Substances 0.000 description 33
- 239000000243 solution Substances 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 238000001914 filtration Methods 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 150000003839 salts Chemical class 0.000 description 16
- VNHBYKHXBCYPBJ-UHFFFAOYSA-N 5-ethynylimidazo[1,2-a]pyridine Chemical compound C#CC1=CC=CC2=NC=CN12 VNHBYKHXBCYPBJ-UHFFFAOYSA-N 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- SYWSERLZKPGKDI-UHFFFAOYSA-N methyl n-(2-chloroacetyl)carbamate Chemical compound COC(=O)NC(=O)CCl SYWSERLZKPGKDI-UHFFFAOYSA-N 0.000 description 14
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 239000000725 suspension Substances 0.000 description 14
- 229910052751 metal Inorganic materials 0.000 description 13
- 239000002184 metal Substances 0.000 description 13
- 238000010992 reflux Methods 0.000 description 13
- 239000007787 solid Substances 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 239000000284 extract Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 9
- 230000008020 evaporation Effects 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000002253 acid Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 8
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical group C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- CCZKQXORAMBPSJ-UHFFFAOYSA-N 5-phenylsulfanylpyridin-2-amine Chemical compound C1=NC(N)=CC=C1SC1=CC=CC=C1 CCZKQXORAMBPSJ-UHFFFAOYSA-N 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- 239000011343 solid material Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- IILMIZOAZZNMIV-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1S(=O)C1=CC=CC=C1 IILMIZOAZZNMIV-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- 150000003930 2-aminopyridines Chemical class 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- NSMJUFXKBVLUBB-UHFFFAOYSA-N 3-nitro-6-phenylsulfanylimidazo[1,2-a]pyridine Chemical compound C=1N2C([N+](=O)[O-])=CN=C2C=CC=1SC1=CC=CC=C1 NSMJUFXKBVLUBB-UHFFFAOYSA-N 0.000 description 3
- URBIZDKERKNRAY-UHFFFAOYSA-N 3-phenylsulfanylpyridin-2-amine Chemical compound NC1=NC=CC=C1SC1=CC=CC=C1 URBIZDKERKNRAY-UHFFFAOYSA-N 0.000 description 3
- ZXHIXCFNYQJPDO-UHFFFAOYSA-N 4-phenylsulfanylpyridine-2-carbohydrazide Chemical compound C1=NC(C(=O)NN)=CC(SC=2C=CC=CC=2)=C1 ZXHIXCFNYQJPDO-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- UJKWKNWJDWPCFW-UHFFFAOYSA-N 5-(4-nitrophenoxy)pyridine-2-carboxylic acid Chemical compound C1=NC(C(=O)O)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 UJKWKNWJDWPCFW-UHFFFAOYSA-N 0.000 description 3
- IVILGUFRMDBUEQ-UHFFFAOYSA-N 5-iodopyridin-2-amine Chemical compound NC1=CC=C(I)C=N1 IVILGUFRMDBUEQ-UHFFFAOYSA-N 0.000 description 3
- YSBJQFDQHNMAMC-UHFFFAOYSA-N 5-phenoxypyridin-2-amine Chemical compound C1=NC(N)=CC=C1OC1=CC=CC=C1 YSBJQFDQHNMAMC-UHFFFAOYSA-N 0.000 description 3
- RTZBQWCUCYYAFF-UHFFFAOYSA-N 6-phenylsulfanylimidazo[1,2-a]pyridin-2-amine Chemical compound C1=CC2=NC(N)=CN2C=C1SC1=CC=CC=C1 RTZBQWCUCYYAFF-UHFFFAOYSA-N 0.000 description 3
- FQUDASXDBKWXEE-UHFFFAOYSA-N 6-phenylsulfanylimidazo[1,2-a]pyridin-3-amine Chemical compound C=1N2C(N)=CN=C2C=CC=1SC1=CC=CC=C1 FQUDASXDBKWXEE-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- KYKIZOSPUQIILV-UHFFFAOYSA-N CC(=O)NN1C=CC=CC1N Chemical compound CC(=O)NN1C=CC=CC1N KYKIZOSPUQIILV-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- AEARPZNULDFPNQ-UHFFFAOYSA-N ethyl-carbamic acid methyl ester Chemical compound CCNC(=O)OC AEARPZNULDFPNQ-UHFFFAOYSA-N 0.000 description 3
- 238000004508 fractional distillation Methods 0.000 description 3
- 150000005234 imidazo[1,2-a]pyridines Chemical class 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- AZVVTQGWPFAASW-UHFFFAOYSA-N methyl n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1SC1=CC=CC=C1 AZVVTQGWPFAASW-UHFFFAOYSA-N 0.000 description 3
- CIBLQYOKJPBXQW-UHFFFAOYSA-N methyl n-[6-(benzenesulfonyl)imidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1S(=O)(=O)C1=CC=CC=C1 CIBLQYOKJPBXQW-UHFFFAOYSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- KXHYSOFGLHNYAF-UHFFFAOYSA-N 2,2,2-trifluoro-n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)acetamide Chemical compound C1=CC2=NC(NC(=O)C(F)(F)F)=CN2C=C1SC1=CC=CC=C1 KXHYSOFGLHNYAF-UHFFFAOYSA-N 0.000 description 2
- XYPISWUKQGWYGX-UHFFFAOYSA-N 2,2,2-trifluoroethaneperoxoic acid Chemical compound OOC(=O)C(F)(F)F XYPISWUKQGWYGX-UHFFFAOYSA-N 0.000 description 2
- NMPVEAUIHMEAQP-UHFFFAOYSA-N 2-Bromoacetaldehyde Chemical compound BrCC=O NMPVEAUIHMEAQP-UHFFFAOYSA-N 0.000 description 2
- LPQDHCJJOIRCCG-UHFFFAOYSA-N 2-[2-[(4-methylphenyl)sulfonylamino]-6-phenylsulfanyl-2h-pyridin-1-yl]acetamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1N(CC(N)=O)C(SC=2C=CC=CC=2)=CC=C1 LPQDHCJJOIRCCG-UHFFFAOYSA-N 0.000 description 2
- CEOQHPBLFQNPAH-UHFFFAOYSA-N 2-methyl-5-(4-nitrophenoxy)pyridine Chemical compound C1=NC(C)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 CEOQHPBLFQNPAH-UHFFFAOYSA-N 0.000 description 2
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 2
- RSPUASGMQNERBH-UHFFFAOYSA-N 4-methyl-n-(6-phenylsulfanylpyridin-2-yl)benzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC=CC(SC=2C=CC=CC=2)=N1 RSPUASGMQNERBH-UHFFFAOYSA-N 0.000 description 2
- YCBGNJRJPYQNLG-UHFFFAOYSA-N 5-(4-nitrophenoxy)pyridin-2-amine Chemical compound C1=NC(N)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1 YCBGNJRJPYQNLG-UHFFFAOYSA-N 0.000 description 2
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical compound NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 2
- UNZUDRAJUWZDNT-UHFFFAOYSA-N 6-bromo-3-nitroimidazo[1,2-a]pyridine Chemical compound C1=CC(Br)=CN2C([N+](=O)[O-])=CN=C21 UNZUDRAJUWZDNT-UHFFFAOYSA-N 0.000 description 2
- FXPMFQUOGYGTAM-UHFFFAOYSA-N 6-bromoimidazo[1,2-a]pyridine Chemical compound C1=C(Br)C=CC2=NC=CN21 FXPMFQUOGYGTAM-UHFFFAOYSA-N 0.000 description 2
- DHLUJPLHLZJUBW-UHFFFAOYSA-N 6-methylpyridin-3-ol Chemical compound CC1=CC=C(O)C=N1 DHLUJPLHLZJUBW-UHFFFAOYSA-N 0.000 description 2
- IAKSFXUGSZVVJO-UHFFFAOYSA-N 6-phenylsulfanylpyridin-2-amine Chemical compound NC1=CC=CC(SC=2C=CC=CC=2)=N1 IAKSFXUGSZVVJO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000000507 anthelmentic effect Effects 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 2
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 2
- MOYNSIBKNVTMAO-UHFFFAOYSA-N methyl N-(2-chloroacetyl)-N-ethylcarbamate Chemical compound CCN(C(=O)CCl)C(=O)OC MOYNSIBKNVTMAO-UHFFFAOYSA-N 0.000 description 2
- ITNJZFIGWOBSJR-UHFFFAOYSA-N methyl n-(6-phenylsulfanylimidazo[1,2-a]pyridin-3-yl)carbamate Chemical compound C=1N2C(NC(=O)OC)=CN=C2C=CC=1SC1=CC=CC=C1 ITNJZFIGWOBSJR-UHFFFAOYSA-N 0.000 description 2
- SYVIZAUYJPLRNM-UHFFFAOYSA-N methyl n-(methylsulfanylmethyl)-n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)carbamate Chemical compound C1=CC2=NC(N(CSC)C(=O)OC)=CN2C=C1SC1=CC=CC=C1 SYVIZAUYJPLRNM-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- RZWQDAUIUBVCDD-UHFFFAOYSA-M sodium;benzenethiolate Chemical compound [Na+].[S-]C1=CC=CC=C1 RZWQDAUIUBVCDD-UHFFFAOYSA-M 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZDFBKZUDCQQKAC-UHFFFAOYSA-N 1-bromo-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C=C1 ZDFBKZUDCQQKAC-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- GZMVKXPKVWQQLO-UHFFFAOYSA-N 2-bromoimidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC(Br)=CN21 GZMVKXPKVWQQLO-UHFFFAOYSA-N 0.000 description 1
- CRZJPEIBPQWDGJ-UHFFFAOYSA-N 2-chloro-1,1-dimethoxyethane Chemical compound COC(CCl)OC CRZJPEIBPQWDGJ-UHFFFAOYSA-N 0.000 description 1
- QSKPIOLLBIHNAC-UHFFFAOYSA-N 2-chloro-acetaldehyde Chemical compound ClCC=O QSKPIOLLBIHNAC-UHFFFAOYSA-N 0.000 description 1
- OKDGRDCXVWSXDC-UHFFFAOYSA-N 2-chloropyridine Chemical class ClC1=CC=CC=N1 OKDGRDCXVWSXDC-UHFFFAOYSA-N 0.000 description 1
- SDSBDQCXPSOHTP-UHFFFAOYSA-N 2-iodoimidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC(I)=CN21 SDSBDQCXPSOHTP-UHFFFAOYSA-N 0.000 description 1
- LIYGDLOJVBHOBO-UHFFFAOYSA-N 2-methyl-1h-pyridin-2-ol Chemical compound CC1(O)NC=CC=C1 LIYGDLOJVBHOBO-UHFFFAOYSA-N 0.000 description 1
- DWBYVHWWZMMIOT-UHFFFAOYSA-N 2-phenylsulfanylpyridine Chemical compound C=1C=CC=NC=1SC1=CC=CC=C1 DWBYVHWWZMMIOT-UHFFFAOYSA-N 0.000 description 1
- WYDBFRQNRYIZSL-UHFFFAOYSA-N 3-nitroimidazo[1,2-a]pyridine Chemical compound C1=CC=CN2C([N+](=O)[O-])=CN=C21 WYDBFRQNRYIZSL-UHFFFAOYSA-N 0.000 description 1
- ONBQLBVFTYYJJR-UHFFFAOYSA-N 3-phenylsulfanylpyridine Chemical compound C=1C=CN=CC=1SC1=CC=CC=C1 ONBQLBVFTYYJJR-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- ATVRGZFHKLCSLX-UHFFFAOYSA-N 4-phenylsulfanylpyridin-2-amine Chemical compound C1=NC(N)=CC(SC=2C=CC=CC=2)=C1 ATVRGZFHKLCSLX-UHFFFAOYSA-N 0.000 description 1
- JYIVVGNJAKRKAH-UHFFFAOYSA-N 5-(benzenesulfinyl)pyridin-2-amine Chemical compound C1=NC(N)=CC=C1S(=O)C1=CC=CC=C1 JYIVVGNJAKRKAH-UHFFFAOYSA-N 0.000 description 1
- CHGPGGVRNQQHKG-UHFFFAOYSA-N 5-(benzenesulfonyl)pyridin-2-amine Chemical compound C1=NC(N)=CC=C1S(=O)(=O)C1=CC=CC=C1 CHGPGGVRNQQHKG-UHFFFAOYSA-N 0.000 description 1
- BYOLYFPLXBUWLT-UHFFFAOYSA-N 8-phenylsulfanylimidazo[1,2-a]pyridin-2-amine Chemical compound C12=NC(N)=CN2C=CC=C1SC1=CC=CC=C1 BYOLYFPLXBUWLT-UHFFFAOYSA-N 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 208000006968 Helminthiasis Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229920001938 Vegetable gum Polymers 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 235000021463 dry cake Nutrition 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- MXEIFGRJRCYUDJ-UHFFFAOYSA-N ethyl 4-chloropyridine-2-carboxylate Chemical compound CCOC(=O)C1=CC(Cl)=CC=N1 MXEIFGRJRCYUDJ-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- UDULKYNJASPYFM-UHFFFAOYSA-N ethyl n-(6-phenylsulfanyl-1h-imidazo[4,5-b]pyridin-2-yl)carbamate Chemical compound C=1N=C2NC(NC(=O)OCC)=NC2=CC=1SC1=CC=CC=C1 UDULKYNJASPYFM-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 244000000013 helminth Species 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- QBBGFCIQSVEQEG-UHFFFAOYSA-N methyl 4-(6-aminopyridin-3-yl)sulfanylbenzoate Chemical compound C1=CC(C(=O)OC)=CC=C1SC1=CC=C(N)N=C1 QBBGFCIQSVEQEG-UHFFFAOYSA-N 0.000 description 1
- UAKHHYJFODTKTJ-UHFFFAOYSA-N methyl N-[4-(6-aminopyridin-3-yl)sulfanylphenyl]carbamate Chemical compound C1=CC(NC(=O)OC)=CC=C1SC1=CC=C(N)N=C1 UAKHHYJFODTKTJ-UHFFFAOYSA-N 0.000 description 1
- FAUQQIHSFKRWJJ-UHFFFAOYSA-N methyl n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)-n-propylcarbamate Chemical compound C1=CC2=NC(N(C(=O)OC)CCC)=CN2C=C1SC1=CC=CC=C1 FAUQQIHSFKRWJJ-UHFFFAOYSA-N 0.000 description 1
- TVDFZKMJIIWKDO-UHFFFAOYSA-N methyl n-(7-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)carbamate Chemical compound C=1C2=NC(NC(=O)OC)=CN2C=CC=1SC1=CC=CC=C1 TVDFZKMJIIWKDO-UHFFFAOYSA-N 0.000 description 1
- VALKDZRQDQUGAS-UHFFFAOYSA-N methyl n-(methoxymethyl)-n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)carbamate Chemical compound C1=CC2=NC(N(C(=O)OC)COC)=CN2C=C1SC1=CC=CC=C1 VALKDZRQDQUGAS-UHFFFAOYSA-N 0.000 description 1
- OWHGHKZLZMSKMX-UHFFFAOYSA-N methyl n-(methylsulfinylmethyl)-n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)carbamate Chemical compound C1=CC2=NC(N(CS(C)=O)C(=O)OC)=CN2C=C1SC1=CC=CC=C1 OWHGHKZLZMSKMX-UHFFFAOYSA-N 0.000 description 1
- ZZABQVDUASFZDG-UHFFFAOYSA-N methyl n-[6-(3-acetamidophenyl)sulfonylimidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1S(=O)(=O)C1=CC=CC(NC(C)=O)=C1 ZZABQVDUASFZDG-UHFFFAOYSA-N 0.000 description 1
- YMMUMACWFBVBPY-UHFFFAOYSA-N methyl n-[6-(3-methylsulfinylphenyl)sulfinylimidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1S(=O)C1=CC=CC(S(C)=O)=C1 YMMUMACWFBVBPY-UHFFFAOYSA-N 0.000 description 1
- XSDFFYSIZAWOCT-UHFFFAOYSA-N methyl n-[6-(4-aminophenyl)sulfanylimidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1SC1=CC=C(N)C=C1 XSDFFYSIZAWOCT-UHFFFAOYSA-N 0.000 description 1
- VIWNAYMXSXRUPG-UHFFFAOYSA-N methyl n-[6-(4-hydroxyphenyl)sulfanylimidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1SC1=CC=C(O)C=C1 VIWNAYMXSXRUPG-UHFFFAOYSA-N 0.000 description 1
- RQLATXIDVPRBRQ-UHFFFAOYSA-N methyl n-[6-(4-nitrophenoxy)imidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1OC1=CC=C([N+]([O-])=O)C=C1 RQLATXIDVPRBRQ-UHFFFAOYSA-N 0.000 description 1
- JKDCOIDJYDOGCQ-UHFFFAOYSA-N methyl n-[6-(4-nitrophenyl)sulfanylimidazo[1,2-a]pyridin-2-yl]carbamate Chemical compound C1=CC2=NC(NC(=O)OC)=CN2C=C1SC1=CC=C([N+]([O-])=O)C=C1 JKDCOIDJYDOGCQ-UHFFFAOYSA-N 0.000 description 1
- DVMCTZFJCDXCCZ-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]-n-(2-methoxyethyl)carbamate Chemical compound C1=CC2=NC(N(C(=O)OC)CCOC)=CN2C=C1S(=O)C1=CC=CC=C1 DVMCTZFJCDXCCZ-UHFFFAOYSA-N 0.000 description 1
- PYLWQVBZWKBREI-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]-n-(2-methylsulfanylethyl)carbamate Chemical compound C1=CC2=NC(N(CCSC)C(=O)OC)=CN2C=C1S(=O)C1=CC=CC=C1 PYLWQVBZWKBREI-UHFFFAOYSA-N 0.000 description 1
- XQRTYVAAFYANOP-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]-n-[(4-chlorophenyl)methyl]carbamate Chemical compound C=1N2C=C(S(=O)C=3C=CC=CC=3)C=CC2=NC=1N(C(=O)OC)CC1=CC=C(Cl)C=C1 XQRTYVAAFYANOP-UHFFFAOYSA-N 0.000 description 1
- HUNRTZQRSSCGBD-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]-n-[(4-methoxyphenyl)methyl]carbamate Chemical compound C=1N2C=C(S(=O)C=3C=CC=CC=3)C=CC2=NC=1N(C(=O)OC)CC1=CC=C(OC)C=C1 HUNRTZQRSSCGBD-UHFFFAOYSA-N 0.000 description 1
- RTPUMZFHXSATEZ-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]-n-[3-(dimethylamino)propyl]carbamate Chemical compound C1=CC2=NC(N(CCCN(C)C)C(=O)OC)=CN2C=C1S(=O)C1=CC=CC=C1 RTPUMZFHXSATEZ-UHFFFAOYSA-N 0.000 description 1
- SHCFDDGNWZAYOF-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-2-yl]-n-propan-2-ylcarbamate Chemical compound C1=CC2=NC(N(C(C)C)C(=O)OC)=CN2C=C1S(=O)C1=CC=CC=C1 SHCFDDGNWZAYOF-UHFFFAOYSA-N 0.000 description 1
- VCGCZCUHBXBDBW-UHFFFAOYSA-N methyl n-[6-(benzenesulfinyl)imidazo[1,2-a]pyridin-3-yl]carbamate Chemical compound C=1N2C(NC(=O)OC)=CN=C2C=CC=1S(=O)C1=CC=CC=C1 VCGCZCUHBXBDBW-UHFFFAOYSA-N 0.000 description 1
- COERLBKCQVFBJC-UHFFFAOYSA-N methyl n-[6-(benzenesulfonyl)imidazo[1,2-a]pyridin-2-yl]-n-ethylcarbamate Chemical compound C1=CC2=NC(N(C(=O)OC)CC)=CN2C=C1S(=O)(=O)C1=CC=CC=C1 COERLBKCQVFBJC-UHFFFAOYSA-N 0.000 description 1
- OQWINONDQWUBJI-UHFFFAOYSA-N methyl n-ethyl-n-(6-phenylsulfanylimidazo[1,2-a]pyridin-2-yl)carbamate Chemical compound C1=CC2=NC(N(C(=O)OC)CC)=CN2C=C1SC1=CC=CC=C1 OQWINONDQWUBJI-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DNYHXGNXXNUNHW-UHFFFAOYSA-N n,n-dimethylformamide;ethane Chemical compound CC.CN(C)C=O DNYHXGNXXNUNHW-UHFFFAOYSA-N 0.000 description 1
- AYEQJLOHMLYKAV-UHFFFAOYSA-N n-(4-sulfanylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S)C=C1 AYEQJLOHMLYKAV-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 208000014837 parasitic helminthiasis infectious disease Diseases 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- ZGJADVGJIVEEGF-UHFFFAOYSA-M potassium;phenoxide Chemical compound [K+].[O-]C1=CC=CC=C1 ZGJADVGJIVEEGF-UHFFFAOYSA-M 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical group OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- LEMQFBIYMVUIIG-UHFFFAOYSA-N trifluoroborane;hydrofluoride Chemical compound F.FB(F)F LEMQFBIYMVUIIG-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/42—Radicals substituted by singly-bound nitrogen atoms having hetero atoms attached to the substituent nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
- A61P33/10—Anthelmintics
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/38—Radicals substituted by singly-bound nitrogen atoms having only hydrogen or hydrocarbon radicals attached to the substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/86—Hydrazides; Thio or imino analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Tropical Medicine & Parasitology (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63903475A | 1975-12-09 | 1975-12-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO764025L true NO764025L (US06299757-20011009-C00006.png) | 1977-06-10 |
Family
ID=24562456
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO764025A NO764025L (US06299757-20011009-C00006.png) | 1975-12-09 | 1976-11-25 |
Country Status (25)
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4105767A (en) * | 1977-03-28 | 1978-08-08 | Merck & Co., Inc. | Imidazo [1,2-a] pyridines substituted with a thienyl, thiazolyl, or thiadiazolyl group |
| US4154835A (en) * | 1977-10-12 | 1979-05-15 | Merck & Co., Inc. | Anthelmintic imidazo [1,2-a] pyridines |
| US4250174A (en) * | 1979-05-02 | 1981-02-10 | Merck & Co., Inc. | 3-Substituted imidazo [1,2-A] pyridines |
| US4221796A (en) * | 1979-09-19 | 1980-09-09 | E. R. Squibb & Sons, Inc. | Substituted imidazolo-pyridines and method |
| ZA81219B (en) * | 1980-01-23 | 1982-01-27 | Schering Corp | Imidazo (1,2-a) pyridines ,process for their preparation and pharmaceutical compositions containing them |
| US4507481A (en) * | 1983-07-29 | 1985-03-26 | Pennwalt Corporation | Pyrrolo[1,2-a]imidazoles and imidazo[1,2-a]pyridines |
| IT1173196B (it) * | 1984-02-02 | 1987-06-18 | Bellon Roger Schoum Rbs Pharma | Composti imidazopiridinici farmacologicamente attivi |
| US5214138A (en) * | 1989-12-20 | 1993-05-25 | Case Western Reserve University | Imidazopyridinium compound and processes for isolating, identifying, and chemically synthesizing same |
| EP0471236B1 (en) * | 1990-07-30 | 1995-03-15 | Takeda Chemical Industries, Ltd. | Imidazopyridine derivatives and their use |
| US6358971B1 (en) | 1998-05-20 | 2002-03-19 | Eli Lilly And Company | Anti-viral compounds |
| CZ289425B6 (cs) * | 1998-05-20 | 2002-01-16 | Eli Lilly And Company | Imidazo[1,2-a] pyridinové sloučeniny, jejich pouľití a farmaceutický přípravek s jejich obsahem |
| DE10117184A1 (de) * | 2001-04-05 | 2002-10-17 | Gruenenthal Gmbh | Substituierte Imidazol[1,2-a]-pyridin-3-yl-amid- und -aminverbindungen |
| ATE438400T1 (de) * | 2004-03-19 | 2009-08-15 | Warner Lambert Co | Imidazopyridin- und imidazopyrimidin-derivate als antibakterielle mittel |
| ATE462697T1 (de) * | 2004-08-12 | 2010-04-15 | Amgen Inc | Bisaryl-sulfonamide |
| CA2689514C (en) * | 2007-06-05 | 2015-09-29 | Takeda Pharmaceutical Company Limited | Heterobicyclic compounds as kinase inhibitors |
| WO2009026254A1 (en) * | 2007-08-17 | 2009-02-26 | Icagen, Inc. | Heterocycles as potassium channel modulators |
| US8431608B2 (en) | 2007-08-17 | 2013-04-30 | Icagen Inc. | Heterocycles as potassium channel modulators |
| US8324395B2 (en) * | 2007-08-23 | 2012-12-04 | Takeda Pharmaceutical Company Limited | Heterocyclic compound and use thereof |
| JP5350247B2 (ja) * | 2007-08-29 | 2013-11-27 | 武田薬品工業株式会社 | 複素環化合物およびその用途 |
| JPWO2009128520A1 (ja) * | 2008-04-18 | 2011-08-04 | 塩野義製薬株式会社 | Ｐｉ３ｋ阻害活性を有する複素環化合物 |
| WO2009136663A1 (en) * | 2008-05-08 | 2009-11-12 | Takeda Pharmaceutical Company Limited | Fused heterocyclic derivatives and use thereof |
| WO2010064611A1 (ja) * | 2008-12-01 | 2010-06-10 | 武田薬品工業株式会社 | 複素環化合物およびその用途 |
| JO3101B1 (ar) | 2008-12-02 | 2017-09-20 | Takeda Pharmaceuticals Co | مشتقات بنزوثيازول كعوامل مضادة للسرطان |
| NZ713361A (en) | 2009-08-17 | 2017-06-30 | Memorial Sloan Kettering Cancer Center | Heat shock protein binding compounds, compositions, and methods for making and using same |
| EP3143013B1 (en) | 2014-05-13 | 2019-12-18 | Memorial Sloan Kettering Cancer Center | Hsp70 modulators and methods for making and using the same |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3701780A (en) * | 1970-09-18 | 1972-10-31 | Merck & Co Inc | Imidazo(1,2-a)pyridines |
| JPS5124517B1 (US06299757-20011009-C00006.png) * | 1971-03-15 | 1976-07-24 |
-
1976
- 1976-08-26 US US05/718,652 patent/US4096264A/en not_active Expired - Lifetime
- 1976-11-22 FI FI763343A patent/FI763343A/fi not_active Application Discontinuation
- 1976-11-24 SE SE7613128A patent/SE430504B/xx unknown
- 1976-11-24 DK DK529276A patent/DK529276A/da not_active Application Discontinuation
- 1976-11-25 NL NL7613160A patent/NL7613160A/xx not_active Application Discontinuation
- 1976-11-25 NO NO764025A patent/NO764025L/no unknown
- 1976-11-29 IL IL51024A patent/IL51024A/xx unknown
- 1976-11-29 NZ NZ182756A patent/NZ182756A/xx unknown
- 1976-11-30 AU AU20102/76A patent/AU505045B2/en not_active Expired
- 1976-12-01 CH CH1513176A patent/CH626362A5/de not_active IP Right Cessation
- 1976-12-01 AR AR265695A patent/AR222960A1/es active
- 1976-12-02 PT PT65915A patent/PT65915B/pt unknown
- 1976-12-03 ES ES453947A patent/ES453947A1/es not_active Expired
- 1976-12-06 AT AT901876A patent/AT361475B/de not_active IP Right Cessation
- 1976-12-07 FR FR7636779A patent/FR2334357A1/fr active Granted
- 1976-12-07 PH PH19211A patent/PH12259A/en unknown
- 1976-12-07 CA CA267,311A patent/CA1084930A/en not_active Expired
- 1976-12-07 GB GB51010/76A patent/GB1524589A/en not_active Expired
- 1976-12-07 BE BE173014A patent/BE849123A/xx not_active IP Right Cessation
- 1976-12-07 GR GR52346A patent/GR62009B/el unknown
- 1976-12-08 DE DE19762655681 patent/DE2655681A1/de not_active Ceased
- 1976-12-08 PL PL1976194238A patent/PL103751B1/pl unknown
- 1976-12-08 ZA ZA00767331A patent/ZA767331B/xx unknown
- 1976-12-09 JP JP51147227A patent/JPS5273896A/ja active Granted
- 1976-12-09 OA OA56008A patent/OA05506A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5273896A (en) | 1977-06-21 |
| BE849123A (fr) | 1977-06-07 |
| IL51024A0 (en) | 1977-01-31 |
| PH12259A (en) | 1978-12-12 |
| GB1524589A (en) | 1978-09-13 |
| DK529276A (da) | 1977-06-10 |
| NZ182756A (en) | 1979-11-01 |
| JPS6126545B2 (US06299757-20011009-C00006.png) | 1986-06-20 |
| CH626362A5 (US06299757-20011009-C00006.png) | 1981-11-13 |
| SE7613128L (sv) | 1977-06-10 |
| SE430504B (sv) | 1983-11-21 |
| AR222960A1 (es) | 1981-07-15 |
| AT361475B (de) | 1981-03-10 |
| DE2655681A1 (de) | 1977-06-16 |
| IL51024A (en) | 1981-12-31 |
| CA1084930A (en) | 1980-09-02 |
| AU2010276A (en) | 1978-06-08 |
| NL7613160A (nl) | 1977-06-13 |
| PT65915A (en) | 1977-01-01 |
| ES453947A1 (es) | 1978-03-01 |
| PL103751B1 (pl) | 1979-07-31 |
| FI763343A (US06299757-20011009-C00006.png) | 1977-06-10 |
| GR62009B (en) | 1979-02-15 |
| PT65915B (en) | 1978-11-07 |
| FR2334357B1 (US06299757-20011009-C00006.png) | 1982-10-15 |
| OA05506A (fr) | 1981-04-30 |
| ATA901876A (de) | 1980-08-15 |
| FR2334357A1 (fr) | 1977-07-08 |
| ZA767331B (en) | 1978-07-26 |
| AU505045B2 (en) | 1979-11-08 |
| US4096264A (en) | 1978-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO764025L (US06299757-20011009-C00006.png) | ||
| NO170727B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzopyran-derivater | |
| KR900003496B1 (ko) | 티에닐 축합 피라졸 유도체의 제조방법 | |
| US5891895A (en) | Hydroxypyridine derivatives their production and use | |
| Heber et al. | The vilsmeier reaction in the synthesis of 3‐substituted [1] benzopyrano [4, 3‐b] pyridin‐5‐ones. An unusual pyridine ring closure | |
| Haas et al. | The synthesis of pyridine derivatives from 3‐formylchromone | |
| US6015905A (en) | Process for the preparation of 2-(6-substituted pyrid-2-yloxymethyl) phenylacetate | |
| CN116987112A (zh) | 制备氨基嘧啶衍生物的改善方法 | |
| CA2584307A1 (en) | Indane amides with antiproliferative activity | |
| Miyamoto et al. | Pyridonecarboxylic acids as antibacterial agents. VIII. An alternative synthesis of enoxacin via fluoronicotinic acid derivatives | |
| CN108822002A (zh) | 一种超声辅助合成n-芳基磺酰胺的方法 | |
| US4177274A (en) | Substituted imidazo [1,2-a] pyridines | |
| Tominaga et al. | A new synthesis of imidazo [1, 2‐a] pyridine and imidazo [2, 1‐a] isoquinoline derivatives | |
| Tominaga et al. | Synthesis of 2‐methylthioindolizine‐3‐carbonitriles using nitro ketene dithioacetal | |
| Bhuiyan et al. | Fused pyrimidines. Part III: synthesis and antimicrobial activity of some furopyrimidines and imidazopyrazolopyrimidine | |
| US4622326A (en) | 6H-isoxazolo(5,4-d)pyrazolo(3,4-b)pyridines, and their use as antihypertensive and analgesic agents | |
| US4237300A (en) | Certain 6-substituted-2-pyridinamines | |
| Proudfoot et al. | A novel Smiles rearrangement gives access to the A-ring pyridine isomers of the nevirapine ring system | |
| Vasilevsky et al. | Unmasking of aminoanthroquinone moiety through a ring opening in the presence of copper salts and a subsequent cross-coupling/recyclization cascade | |
| US4882338A (en) | Substituted isoquinoline derivatives and anti-ulcer agents | |
| US5739340A (en) | Indolizine derivatives with pharmaceutical activity | |
| US5028710A (en) | Process for the preparation of derivatives of sulfonyl indolizine and their use as synthetic intermediates | |
| US4549019A (en) | Pyrimidinecarbamate derivatives as intermediates | |
| CN116253697B (zh) | 一种二氯萘醌和甲胺类化合物为原料合成醌并噻唑类化合物的方法 | |
| IL159792A (en) | History of variolins and pharmaceutical preparations containing them |