NO761723L - - Google Patents
Info
- Publication number
- NO761723L NO761723L NO761723A NO761723A NO761723L NO 761723 L NO761723 L NO 761723L NO 761723 A NO761723 A NO 761723A NO 761723 A NO761723 A NO 761723A NO 761723 L NO761723 L NO 761723L
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- amino
- approx
- compound
- isoxazolyl
- Prior art date
Links
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 40
- -1 alkali metal alkoxide Chemical class 0.000 claims description 22
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 16
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- 239000012442 inert solvent Substances 0.000 claims description 8
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- GLZCLFVIDYFHHM-UHFFFAOYSA-N methyl 2-[[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfamoyl]benzoate Chemical compound COC(=O)C1=CC=CC=C1S(=O)(=O)NCC(=O)NC1=NOC(C)=C1 GLZCLFVIDYFHHM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 4
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002260 anti-inflammatory agent Substances 0.000 description 6
- 229940121363 anti-inflammatory agent Drugs 0.000 description 5
- 230000020477 pH reduction Effects 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229940081974 saccharin Drugs 0.000 description 4
- 235000019204 saccharin Nutrition 0.000 description 4
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 4
- LYVNILGFDIBBTE-UHFFFAOYSA-N 2-(benzenesulfonamido)acetamide Chemical class NC(=O)CNS(=O)(=O)C1=CC=CC=C1 LYVNILGFDIBBTE-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 150000004681 metal hydrides Chemical group 0.000 description 3
- JQVPAYCOPULQCA-UHFFFAOYSA-N 5-methyl-3h-1,2-oxazol-2-amine Chemical compound CC1=CCN(N)O1 JQVPAYCOPULQCA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 239000012431 aqueous reaction media Substances 0.000 description 2
- 206010003246 arthritis Diseases 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052987 metal hydride Inorganic materials 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- OCEZJTJAJHRHDA-UHFFFAOYSA-N n-(5-methyl-1,2-oxazol-3-yl)-2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)acetamide Chemical compound O1C(C)=CC(NC(=O)CN2S(C3=CC=CC=C3C2=O)(=O)=O)=N1 OCEZJTJAJHRHDA-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical class C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- HGMYJKFAFPLSIH-UHFFFAOYSA-N 1-(2h-1,2-benzothiazin-3-yl)propan-2-one Chemical compound C1=CC=C2SNC(CC(=O)C)=CC2=C1 HGMYJKFAFPLSIH-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- MDGONKGLMIHIIR-UHFFFAOYSA-N 4-hydroxy-2h-1,2-benzothiazine-3-carboxamide Chemical class C1=CC=C2SNC(C(=O)N)=C(O)C2=C1 MDGONKGLMIHIIR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 206010006811 Bursitis Diseases 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 206010036030 Polyarthritis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- QUELJKILFWPZSF-UHFFFAOYSA-N ethyl 2-(2-oxopropylsulfamoyl)benzoate Chemical compound CCOC(=O)C1=CC=CC=C1S(=O)(=O)NCC(C)=O QUELJKILFWPZSF-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- YYUAYBYLJSNDCX-UHFFFAOYSA-N isoxicam Chemical compound OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC=1C=C(C)ON=1 YYUAYBYLJSNDCX-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012022 methylating agents Substances 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- 150000007978 oxazole derivatives Chemical class 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 208000030428 polyarticular arthritis Diseases 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- AYGJDUHQRFKLBG-UHFFFAOYSA-M sodium;1,1-dioxo-1,2-benzothiazol-3-olate;dihydrate Chemical compound O.O.[Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 AYGJDUHQRFKLBG-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/577,567 US3987038A (en) | 1975-05-21 | 1975-05-21 | Process for the preparation of {1-[5-(4-hydroxy-2H-1,2-benzothiazin-3-yl)-1,2,4-oxadiazol-3-yl]methyl}ethanone S,S-dioxide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO761723L true NO761723L (show.php) | 1976-11-23 |
Family
ID=24309278
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO761723A NO761723L (show.php) | 1975-05-21 | 1976-05-20 |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US3987038A (show.php) |
| JP (3) | JPS51143681A (show.php) |
| AU (1) | AU507857B2 (show.php) |
| BE (1) | BE842080A (show.php) |
| CA (1) | CA1080708A (show.php) |
| DE (1) | DE2618978A1 (show.php) |
| DK (1) | DK219776A (show.php) |
| ES (1) | ES448087A1 (show.php) |
| FI (1) | FI761432A7 (show.php) |
| FR (2) | FR2313386A1 (show.php) |
| GB (1) | GB1492716A (show.php) |
| IE (1) | IE43101B1 (show.php) |
| IN (1) | IN143852B (show.php) |
| LU (1) | LU74935A1 (show.php) |
| MX (1) | MX3020E (show.php) |
| NL (1) | NL7605165A (show.php) |
| NO (1) | NO761723L (show.php) |
| SE (1) | SE7605751L (show.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4376204A (en) * | 1981-10-05 | 1983-03-08 | Pfizer Inc. | 3-Hydroxy 2-methyl benzisothiazolines as intermediates in production of piroxicam |
| JPS5869255A (ja) * | 1981-10-21 | 1983-04-25 | Matsushita Electric Ind Co Ltd | フタロシアニン誘導体 |
| JPS5930874A (ja) * | 1982-08-12 | 1984-02-18 | Taoka Chem Co Ltd | 水性インク |
| DE3311165A1 (de) * | 1983-03-26 | 1984-09-27 | Gödecke AG, 1000 Berlin | Feinkristallines isoxicam |
| JPS61238785A (ja) * | 1985-04-16 | 1986-10-24 | Taito Pfizer Kk | 1、2―ベンゾチアジン類 |
| ATE345045T1 (de) * | 1992-09-16 | 2006-12-15 | Triosyn Holding Inc | Desinfizierendes jod-harz, verfahren zu seiner herstellung und verwendung in textilen kombinationen |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3787324A (en) * | 1971-03-01 | 1974-01-22 | Warner Lambert Co | 4-hydroxy-3-(3-isoxazolocarbamyl)-2h-1,2-benzothiazine 1,dioxides and process for their production |
| US3868367A (en) * | 1974-04-11 | 1975-02-25 | Warner Lambert Co | 4-Hydroxy-3-(5-isoxazolylcarbamoyl)-2H-1,2-benzothiazine 1,1-dioxides |
| US3954786A (en) * | 1974-04-19 | 1976-05-04 | Pfizer Inc. | Isoxazole intermediate compounds |
-
1975
- 1975-05-21 US US05/577,567 patent/US3987038A/en not_active Expired - Lifetime
-
1976
- 1976-02-10 US US05/657,007 patent/US4076722A/en not_active Expired - Lifetime
- 1976-03-30 IN IN547/CAL/1976A patent/IN143852B/en unknown
- 1976-04-28 GB GB17244/76A patent/GB1492716A/en not_active Expired
- 1976-04-29 DE DE19762618978 patent/DE2618978A1/de active Pending
- 1976-05-04 IE IE946/76A patent/IE43101B1/en unknown
- 1976-05-06 FR FR7613522A patent/FR2313386A1/fr active Granted
- 1976-05-10 MX MX000221U patent/MX3020E/es unknown
- 1976-05-12 LU LU74935A patent/LU74935A1/xx unknown
- 1976-05-14 NL NL7605165A patent/NL7605165A/xx not_active Application Discontinuation
- 1976-05-19 DK DK219776A patent/DK219776A/da unknown
- 1976-05-20 JP JP51058500A patent/JPS51143681A/ja active Granted
- 1976-05-20 NO NO761723A patent/NO761723L/no unknown
- 1976-05-20 CA CA252,911A patent/CA1080708A/en not_active Expired
- 1976-05-20 SE SE7605751A patent/SE7605751L/xx unknown
- 1976-05-20 FI FI761432A patent/FI761432A7/fi not_active Application Discontinuation
- 1976-05-20 ES ES448087A patent/ES448087A1/es not_active Expired
- 1976-05-20 AU AU14128/76A patent/AU507857B2/en not_active Expired
- 1976-05-21 BE BE167217A patent/BE842080A/xx unknown
- 1976-09-16 FR FR7627802A patent/FR2313371A1/fr not_active Withdrawn
-
1978
- 1978-02-28 JP JP2275778A patent/JPS53121759A/ja active Granted
-
1979
- 1979-08-02 JP JP9908479A patent/JPS5533472A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS53121759A (en) | 1978-10-24 |
| FI761432A7 (show.php) | 1976-11-22 |
| IE43101B1 (en) | 1980-12-17 |
| US4076722A (en) | 1978-02-28 |
| FR2313371A1 (fr) | 1976-12-31 |
| IN143852B (show.php) | 1978-02-11 |
| JPS5331873B2 (show.php) | 1978-09-05 |
| AU1412876A (en) | 1977-11-24 |
| IE43101L (en) | 1976-11-21 |
| DK219776A (da) | 1976-11-22 |
| ES448087A1 (es) | 1977-07-01 |
| GB1492716A (en) | 1977-11-23 |
| JPS51143681A (en) | 1976-12-10 |
| NL7605165A (nl) | 1976-11-23 |
| FR2313386B1 (show.php) | 1980-02-08 |
| CA1080708A (en) | 1980-07-01 |
| FR2313386A1 (fr) | 1976-12-31 |
| LU74935A1 (show.php) | 1977-01-17 |
| DE2618978A1 (de) | 1976-12-02 |
| BE842080A (fr) | 1976-09-16 |
| JPS5442980B2 (show.php) | 1979-12-17 |
| SE7605751L (sv) | 1976-11-22 |
| US3987038A (en) | 1976-10-19 |
| MX3020E (es) | 1980-02-13 |
| AU507857B2 (en) | 1980-02-28 |
| JPS5533472A (en) | 1980-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3822258A (en) | 4-hydroxy-3-(3-isoxazolylcarbamoyl)-2h-1,2-benzothiazine 1,1-dioxides and process for their production | |
| JP2001506271A (ja) | Xa因子阻害剤としての酸素またはイオウを含む複素環式芳香族化合物 | |
| NO864474L (no) | Nye 4-benzyl-1-(2h)-ftalazinon-derivater. | |
| HUT54360A (en) | Process for producing new naphthylalkyl-3h-1,2,3,5-oxathiadiazole-2-oxide derivatives and medical compositions comprising such compounds | |
| NO164349B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive n-(piperidinyl-alkyl)-karboksamider og deres salter. | |
| NO153530B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive substituerte heterocykliske benzamider. | |
| US4490527A (en) | Benzo-fused heterocyclic anti-ulcer agents | |
| CA1137497A (en) | Mercaptoacyldihydropyrazole carboxylic acid derivatives | |
| NO761723L (show.php) | ||
| US4018762A (en) | Process for the preparation of 4-hydroxy-3-(5-methyl-3-isoxazolylcarbamoyl)-2-methyl-2H-1,2-benzothiazine 1,1-dioxide | |
| US2929819A (en) | New oxazoles | |
| CA1217187A (en) | Thiazine derivatives | |
| NO832146L (no) | Fremgangsmaate ved fremstilling av oxazoleddiksyrederivater | |
| US3960881A (en) | Method for preparing 4-carboxythiazolidine-2-thione | |
| DK165179B (da) | N-chlorsulfonyl-3-acyl-2-oxindol-1-carboxamid-forbindelser | |
| CA1229599A (en) | 4-hydroxy-n-¬5-¬(substituted hetero)methyl|-3- isoxazolyl|-2h-1,2-benzothiazine-3-carboxamide, 1, 1-dioxide and 4-hydroxy-2-methyl-n-¬5- ¬(substituted hetero)methyl|-3-isoxazolyl|-2h-1, 2-benzothiazine-3-carboxamide, 1,1-dioxide | |
| US4374255A (en) | Process for producing substituted pyrroles | |
| US4175085A (en) | Thienothiazine derivatives | |
| US4207317A (en) | 1-Aryl-4-carbamoyl-pyrazolin-5-ones | |
| GB1561521A (en) | 3,4 - dihydro - 3 - oxo - 4-carbamoyl - 2h - thieno (2,3 - e) - 1 - 2-thiazine 1,1 - dioxide derivatives | |
| HU196794B (en) | Process for producing new benzamide derivatives | |
| US4041042A (en) | Intermediate composition | |
| HU198915B (en) | Process for producing new 2-thiazolidinone derivatives and pharmaceutical compositions containing them | |
| Carrington | 132. Thiohydantoins. Part II. Conversion of 5: 5-disubstituted 2: 4-dithiohydantoins into the corresponding monothiohydantoins | |
| DK153786B (da) | Analogifremgangsmaade til fremstilling af 3-cyan-n-(n,n-dimethylaminopropyl)-iminodibenzyl eller syreadditionssalte deraf |