NO754232L - - Google Patents
Info
- Publication number
- NO754232L NO754232L NO754232A NO754232A NO754232L NO 754232 L NO754232 L NO 754232L NO 754232 A NO754232 A NO 754232A NO 754232 A NO754232 A NO 754232A NO 754232 L NO754232 L NO 754232L
- Authority
- NO
- Norway
- Prior art keywords
- acid
- phenylacetylamino
- penicillanic acid
- optionally substituted
- general formula
- Prior art date
Links
- -1 D-2-(4-amidinophenoxyacetylamino)-2-phenylacetylamino Chemical group 0.000 claims description 57
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 34
- 239000002253 acid Substances 0.000 claims description 31
- 229930182555 Penicillin Natural products 0.000 claims description 24
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 150000007513 acids Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 150000002960 penicillins Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims description 4
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims description 4
- 208000035143 Bacterial infection Diseases 0.000 claims description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical class C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 208000022362 bacterial infectious disease Diseases 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000006239 protecting group Chemical group 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims 2
- 239000000969 carrier Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 47
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 238000000354 decomposition reaction Methods 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 13
- 150000001875 compounds Chemical class 0.000 description 13
- 229940049954 penicillin Drugs 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- 125000004432 carbon atom Chemical group C* 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 238000003776 cleavage reaction Methods 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 230000007017 scission Effects 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 150000001805 chlorine compounds Chemical class 0.000 description 5
- 125000004185 ester group Chemical group 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229960003424 phenylacetic acid Drugs 0.000 description 3
- 239000003279 phenylacetic acid Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- SKTXIJCKKRYTIS-UHFFFAOYSA-N 2-(3-carbamimidoylphenoxy)acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)C1=CC=CC(OCC(Cl)=O)=C1 SKTXIJCKKRYTIS-UHFFFAOYSA-N 0.000 description 2
- WMWWJPMQQUPEKK-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-methoxyphenoxy)acetyl chloride;hydrochloride Chemical compound Cl.COC1=CC(C(N)=N)=CC=C1OCC(Cl)=O WMWWJPMQQUPEKK-UHFFFAOYSA-N 0.000 description 2
- QBZZTMUDXDARTD-UHFFFAOYSA-N 2-(4-carbamimidoylphenoxy)acetic acid Chemical compound NC(=N)C1=CC=C(OCC(O)=O)C=C1 QBZZTMUDXDARTD-UHFFFAOYSA-N 0.000 description 2
- SXKAOFCKWNAYJV-UHFFFAOYSA-N 2-(4-carbamimidoylphenoxy)acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)C1=CC=C(OCC(Cl)=O)C=C1 SXKAOFCKWNAYJV-UHFFFAOYSA-N 0.000 description 2
- YNFFJMSEXROLQH-UHFFFAOYSA-N 2-(4-carbamimidoylphenyl)acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)C1=CC=C(CC(Cl)=O)C=C1 YNFFJMSEXROLQH-UHFFFAOYSA-N 0.000 description 2
- GZPUQDYHAXAELN-UHFFFAOYSA-N 2-(5-carbamimidoylthiophen-2-yl)acetyl chloride;hydrochloride Chemical compound Cl.NC(=N)C1=CC=C(CC(Cl)=O)S1 GZPUQDYHAXAELN-UHFFFAOYSA-N 0.000 description 2
- TVCRPVALIUAPDA-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenoxy]acetyl chloride;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)Cl)=CC=C1N1C=NCC1 TVCRPVALIUAPDA-UHFFFAOYSA-N 0.000 description 2
- WTWUBAYBORQHCK-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenyl]acetyl chloride;hydrochloride Chemical compound Cl.C1=CC(CC(=O)Cl)=CC=C1N1C=NCC1 WTWUBAYBORQHCK-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical class O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003797 solvolysis reaction Methods 0.000 description 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- KPWDGTGXUYRARH-UHFFFAOYSA-N 2,2,2-trichloroethanol Chemical compound OCC(Cl)(Cl)Cl KPWDGTGXUYRARH-UHFFFAOYSA-N 0.000 description 1
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- PCLBHTMBKWZBMN-UHFFFAOYSA-N 2-(3-carbamimidoylphenoxy)acetic acid Chemical compound NC(=N)C1=CC=CC(OCC(O)=O)=C1 PCLBHTMBKWZBMN-UHFFFAOYSA-N 0.000 description 1
- MWIPDJHYYHFSNJ-UHFFFAOYSA-N 2-(4-carbamimidoyl-2-methoxyphenoxy)acetic acid Chemical compound COC1=CC(C(N)=N)=CC=C1OCC(O)=O MWIPDJHYYHFSNJ-UHFFFAOYSA-N 0.000 description 1
- OWSCIEGKZZWERR-UHFFFAOYSA-N 2-(4-carbamimidoylphenoxy)-2-methylpropanoic acid Chemical compound OC(=O)C(C)(C)OC1=CC=C(C(N)=N)C=C1 OWSCIEGKZZWERR-UHFFFAOYSA-N 0.000 description 1
- SSGFEOFDJDCDCI-UHFFFAOYSA-N 2-(4-carbamimidoylphenyl)acetic acid Chemical compound NC(=N)C1=CC=C(CC(O)=O)C=C1 SSGFEOFDJDCDCI-UHFFFAOYSA-N 0.000 description 1
- CMNPVJVDAYRJPR-UHFFFAOYSA-N 2-(5-aminothiophen-2-yl)acetic acid Chemical compound NC1=CC=C(CC(O)=O)S1 CMNPVJVDAYRJPR-UHFFFAOYSA-N 0.000 description 1
- IUTYLYUOMDPVTG-UHFFFAOYSA-N 2-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenoxy]acetic acid;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)O)=CC=C1C1=NCCCN1 IUTYLYUOMDPVTG-UHFFFAOYSA-N 0.000 description 1
- YUMCZDXYOSTBRW-UHFFFAOYSA-N 2-[4-(3-azabicyclo[3.3.1]nonane-3-carboximidoyl)phenoxy]acetyl chloride;hydrochloride Chemical compound Cl.C1=CC(OCC(=O)Cl)=CC=C1C(=N)N1CC(C2)CCCC2C1 YUMCZDXYOSTBRW-UHFFFAOYSA-N 0.000 description 1
- MSGJFROSWKWZLL-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1N1C=NCC1 MSGJFROSWKWZLL-UHFFFAOYSA-N 0.000 description 1
- OWNQOPFMLVOZCP-UHFFFAOYSA-N 2-[4-(4,5-dihydroimidazol-1-yl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1N1C=NCC1 OWNQOPFMLVOZCP-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- JKTYGPATCNUWKN-UHFFFAOYSA-N 4-nitrobenzyl alcohol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1 JKTYGPATCNUWKN-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229930186147 Cephalosporin Chemical class 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000000233 Melia azedarach Species 0.000 description 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 150000001555 benzenes Chemical group 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 description 1
- 229960003669 carbenicillin Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- GCFAUZGWPDYAJN-UHFFFAOYSA-N cyclohexyl 3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1C=CC(=O)OC1CCCCC1 GCFAUZGWPDYAJN-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000005328 phosphinyl group Chemical group [PH2](=O)* 0.000 description 1
- 125000000382 plumbyl group Chemical group [H][Pb]([H])([H])* 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742458973 DE2458973A1 (de) | 1974-12-13 | 1974-12-13 | Acylaminopenicillansaeuren und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO754232L true NO754232L (show.php) | 1976-06-15 |
Family
ID=5933310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO754232A NO754232L (show.php) | 1974-12-13 | 1975-12-12 |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4018933A (show.php) |
| JP (1) | JPS5182295A (show.php) |
| BE (1) | BE836636A (show.php) |
| DE (1) | DE2458973A1 (show.php) |
| DK (1) | DK567375A (show.php) |
| ES (1) | ES443288A1 (show.php) |
| FI (1) | FI753496A7 (show.php) |
| FR (1) | FR2293930A1 (show.php) |
| IL (1) | IL48618A0 (show.php) |
| LU (1) | LU73998A1 (show.php) |
| NL (1) | NL7514267A (show.php) |
| NO (1) | NO754232L (show.php) |
| SE (1) | SE7514094L (show.php) |
| ZA (1) | ZA757771B (show.php) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW542822B (en) * | 1997-01-17 | 2003-07-21 | Ajinomoto Kk | Benzamidine derivatives |
| US6291514B1 (en) | 1998-02-09 | 2001-09-18 | 3-Dimensional Pharmaceuticals, Inc. | Heteroaryl amidines, methylamidines and guanidines, preparation thereof, and use thereof as protease inhibitors |
| UY34585A (es) * | 2012-01-24 | 2013-09-02 | Aicuris Gmbh & Co Kg | Compuestos b-lactámicos sustituidos con amidina, su preparación y uso |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE756747A (fr) * | 1969-09-27 | 1971-03-29 | Hoechst Ag | Acides acylamino-penicillaniques doues de proprietes anti- bacterienne |
| BE794886A (fr) * | 1972-02-22 | 1973-08-02 | Pfizer | Acides 6-(alpha-(omega-guanidinoalcanoylamino)acylamino)-penicillaniques |
| US3935189A (en) * | 1973-05-04 | 1976-01-27 | Beecham Group Limited | Penicillins |
-
1974
- 1974-12-13 DE DE19742458973 patent/DE2458973A1/de active Pending
-
1975
- 1975-12-06 ES ES443288A patent/ES443288A1/es not_active Expired
- 1975-12-08 NL NL7514267A patent/NL7514267A/xx not_active Application Discontinuation
- 1975-12-08 IL IL48618A patent/IL48618A0/xx unknown
- 1975-12-11 FI FI753496A patent/FI753496A7/fi not_active Application Discontinuation
- 1975-12-11 LU LU73998A patent/LU73998A1/xx unknown
- 1975-12-11 US US05/639,807 patent/US4018933A/en not_active Expired - Lifetime
- 1975-12-12 NO NO754232A patent/NO754232L/no unknown
- 1975-12-12 SE SE7514094A patent/SE7514094L/xx not_active Application Discontinuation
- 1975-12-12 DK DK567375A patent/DK567375A/da unknown
- 1975-12-12 ZA ZA757771A patent/ZA757771B/xx unknown
- 1975-12-13 JP JP50147945A patent/JPS5182295A/ja active Pending
- 1975-12-15 FR FR7538376A patent/FR2293930A1/fr active Granted
- 1975-12-15 BE BE162740A patent/BE836636A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE836636A (fr) | 1976-06-15 |
| NL7514267A (nl) | 1976-06-15 |
| DK567375A (da) | 1976-06-14 |
| FI753496A7 (show.php) | 1976-06-14 |
| FR2293930A1 (fr) | 1976-07-09 |
| LU73998A1 (show.php) | 1976-11-11 |
| SE7514094L (sv) | 1976-06-14 |
| IL48618A0 (en) | 1976-02-29 |
| FR2293930B1 (show.php) | 1978-07-28 |
| US4018933A (en) | 1977-04-19 |
| ES443288A1 (es) | 1977-04-16 |
| ZA757771B (en) | 1976-11-24 |
| DE2458973A1 (de) | 1976-06-16 |
| JPS5182295A (show.php) | 1976-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI63760C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara penicilliner | |
| FI66389B (fi) | Foerfarande foer framstaellning av 7beta-amino-2- eller -3-cefem-3-ol-4-karboxylsyrafoereningar | |
| NO144169B (no) | Analogifremgangsmaate for fremstilling av terapeutisk anvendelig 6-(d(-)-alfa-aminofenylacetamido)penicillansyreftalidester | |
| JPS63152387A (ja) | 7−アシルアミノ−3−ビニル セファロスポラン酸誘導体 | |
| DE2347533A1 (de) | Neue derivate der penam-3-carbonsaeure und cephem-4-carbonsaeure und verfahren zu ihrer herstellung | |
| SE445644B (sv) | 7beta-amino-3-cefem-3-amino-4-karbonsyra-foreningar som mellanprodukter for framstellning av 7beta-amino-3-cefem-3-ol-4-karbonsyra-foreningar | |
| NO780074L (no) | Fremgangsmaate ved fremstilling av derivater av 7-acylamido-3-cefem-4-karboksylsyre | |
| NO754232L (show.php) | ||
| US4322347A (en) | 2-Carbamoyloxymethyl-penicillin derivatives | |
| EP0003115A1 (en) | Penicillins, per se and for use as antibacterially active antibiotics and their production | |
| US4081545A (en) | Penicillins | |
| US4310459A (en) | Process for producing carbamoyl substituted penams and carbamoyl substituted cephams from penicillin sulfoxide esters | |
| IE41899B1 (en) | 7 -methoxycephalosporins | |
| US4035502A (en) | Acylaminopenicillanic acids and process for preparing them | |
| AU617783B2 (en) | 6-Substituted acrylamido penicillanic and derivatives, preparation and use | |
| US4219477A (en) | Penicillin derivatives | |
| US4374982A (en) | Cepham compounds | |
| JPS61243088A (ja) | ヘテロシクリル−ペネム化合物 | |
| US4518773A (en) | "3-Carbamoyloxy cephalosporins" | |
| US3932391A (en) | Cephalosporin isocyanates | |
| US4426520A (en) | 3-Carbamoyloxy-cepham-4-carboxylic acid derivatives | |
| US4185015A (en) | Methoxymethyl 6-[D-2,2-dimethyl-4-(4-hydroxyphenyl)-5-oxo-1-imidazolyl]penicillanate | |
| CA1164860A (en) | Cephalosporins, processes for their preparation and pharmaceutical compositions containing them | |
| US3996216A (en) | 3-Heterothio derivatives of (formylamino)acetylamino-7-alpha-methoxy cephalosporins | |
| US3994889A (en) | 3-Heterothio derivatives of (α-thiocarbonylaminol)-7α-methoxy-cephalosporins |