NO744183L - - Google Patents
Info
- Publication number
- NO744183L NO744183L NO744183A NO744183A NO744183L NO 744183 L NO744183 L NO 744183L NO 744183 A NO744183 A NO 744183A NO 744183 A NO744183 A NO 744183A NO 744183 L NO744183 L NO 744183L
- Authority
- NO
- Norway
- Prior art keywords
- group
- formula
- compound
- carbon
- carbon atoms
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 66
- 238000000034 method Methods 0.000 claims description 37
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 150000001721 carbon Chemical group 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- 150000002367 halogens Chemical group 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 5
- 239000000460 chlorine Chemical group 0.000 claims description 5
- 230000018044 dehydration Effects 0.000 claims description 5
- 238000006297 dehydration reaction Methods 0.000 claims description 5
- 238000007363 ring formation reaction Methods 0.000 claims description 5
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 claims description 4
- 230000003647 oxidation Effects 0.000 claims description 4
- 238000007254 oxidation reaction Methods 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 claims description 3
- 239000002841 Lewis acid Substances 0.000 claims description 3
- 150000001555 benzenes Chemical group 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- TWLCEYWYILDCDA-UHFFFAOYSA-N chromium(6+) oxygen(2-) pyridine Chemical compound [O-2].[O-2].[O-2].[Cr+6].C1=CC=NC=C1.C1=CC=NC=C1 TWLCEYWYILDCDA-UHFFFAOYSA-N 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000007517 lewis acids Chemical class 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 2
- 229930192474 thiophene Natural products 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 125000001153 fluoro group Chemical group F* 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 239000002798 polar solvent Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 21
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- 239000003921 oil Substances 0.000 description 16
- 235000019198 oils Nutrition 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 12
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 230000015572 biosynthetic process Effects 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- 238000006722 reduction reaction Methods 0.000 description 8
- -1 6-oxo-6-phenylhexanoyl chloride 6-oxo-6-phenylhexanoic acid Chemical compound 0.000 description 7
- 235000019441 ethanol Nutrition 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000010410 layer Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000012746 preparative thin layer chromatography Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- MJGQUEBIGYOQBC-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)C1=C(CCC1)[C-]1C=CC=C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C1=CC=CC=C1)(=O)C1=C(CCC1)[C-]1C=CC=C1.[CH-]1C=CC=C1.[Fe+2] MJGQUEBIGYOQBC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 208000015710 Iron-Deficiency Anemia Diseases 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- BTPWONHWCUOTNL-UHFFFAOYSA-N O1C(=CC=C1)C(=O)CCCCC(=O)Cl Chemical compound O1C(=CC=C1)C(=O)CCCCC(=O)Cl BTPWONHWCUOTNL-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- OAJKPMPDNHQJSO-UHFFFAOYSA-N [C-]1(C=CC=C1)C(=O)C1=C(CCC1)C1=CC=CC=C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound [C-]1(C=CC=C1)C(=O)C1=C(CCC1)C1=CC=CC=C1.[CH-]1C=CC=C1.[Fe+2] OAJKPMPDNHQJSO-UHFFFAOYSA-N 0.000 description 2
- WWJKDSGHTQERLE-UHFFFAOYSA-N [C-]1(C=CC=C1)C1=C(CCC1)C(C1=CC=C(C=C1)Cl)=O.[CH-]1C=CC=C1.[Fe+2] Chemical compound [C-]1(C=CC=C1)C1=C(CCC1)C(C1=CC=C(C=C1)Cl)=O.[CH-]1C=CC=C1.[Fe+2] WWJKDSGHTQERLE-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- YZINMEUAGZYDMW-UHFFFAOYSA-N cyclopenta-1,3-diene (2-cyclopenta-1,4-dien-1-ylcyclopentyl)-phenylmethanol iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.OC(C1CCCC1[c-]1cccc1)c1ccccc1 YZINMEUAGZYDMW-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 1
- WTAIFOPOCXTVCX-UHFFFAOYSA-N 6-(4-chlorophenyl)-6-oxohexanoic acid Chemical compound OC(=O)CCCCC(=O)C1=CC=C(Cl)C=C1 WTAIFOPOCXTVCX-UHFFFAOYSA-N 0.000 description 1
- AJHIHROSGVZPED-UHFFFAOYSA-N 6-(furan-2-yl)-6-oxohexanoic acid Chemical compound O1C(=CC=C1)C(=O)CCCCC(=O)O AJHIHROSGVZPED-UHFFFAOYSA-N 0.000 description 1
- PKUNCVJBJZMYLD-UHFFFAOYSA-N 6-oxo-6-phenylhexanoyl chloride Chemical compound ClC(=O)CCCCC(=O)C1=CC=CC=C1 PKUNCVJBJZMYLD-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WIDIPFRWZINVHO-UHFFFAOYSA-N C(C1=CC=CC=C1)C1C(CCC1)[C-]1C=CC=C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound C(C1=CC=CC=C1)C1C(CCC1)[C-]1C=CC=C1.[CH-]1C=CC=C1.[Fe+2] WIDIPFRWZINVHO-UHFFFAOYSA-N 0.000 description 1
- JZPVXCAAQYPLQN-UHFFFAOYSA-N CC=1C=C(C(=O)CCCCC(=O)[C-]2C=CC=C2)C=CC1.[CH-]1C=CC=C1.[Fe+2] Chemical compound CC=1C=C(C(=O)CCCCC(=O)[C-]2C=CC=C2)C=CC1.[CH-]1C=CC=C1.[Fe+2] JZPVXCAAQYPLQN-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VTTFMPBABASBLE-UHFFFAOYSA-N ClC1=C(CCC1)C(=O)[C-]1C=CC=C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound ClC1=C(CCC1)C(=O)[C-]1C=CC=C1.[CH-]1C=CC=C1.[Fe+2] VTTFMPBABASBLE-UHFFFAOYSA-N 0.000 description 1
- 238000006214 Clemmensen reduction reaction Methods 0.000 description 1
- ZZZCUOFIHGPKAK-UHFFFAOYSA-N D-erythro-ascorbic acid Natural products OCC1OC(=O)C(O)=C1O ZZZCUOFIHGPKAK-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 102000008857 Ferritin Human genes 0.000 description 1
- 238000008416 Ferritin Methods 0.000 description 1
- 108050000784 Ferritin Proteins 0.000 description 1
- 229910001268 Ferrocerium Inorganic materials 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 102000001554 Hemoglobins Human genes 0.000 description 1
- 108010054147 Hemoglobins Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010022971 Iron Deficiencies Diseases 0.000 description 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 description 1
- HRULXOGAPUEJFM-UHFFFAOYSA-N O=C(CCCCCC(=O)[C-]1C=CC=C1)C1=CC=CC=C1.[CH-]1C=CC=C1.[Fe+2] Chemical compound O=C(CCCCCC(=O)[C-]1C=CC=C1)C1=CC=CC=C1.[CH-]1C=CC=C1.[Fe+2] HRULXOGAPUEJFM-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229930003779 Vitamin B12 Natural products 0.000 description 1
- 229930003268 Vitamin C Natural products 0.000 description 1
- BIWRNFCIZARBLQ-UHFFFAOYSA-N [C-]1(C=CC=C1)C1=C(CCC1)C(C1=C(C=CC=C1)F)=O.[CH-]1C=CC=C1.[Fe+2] Chemical compound [C-]1(C=CC=C1)C1=C(CCC1)C(C1=C(C=CC=C1)F)=O.[CH-]1C=CC=C1.[Fe+2] BIWRNFCIZARBLQ-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 208000007502 anemia Diseases 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 239000003173 antianemic agent Substances 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- UKXSKSHDVLQNKG-UHFFFAOYSA-N benzilic acid Chemical compound C=1C=CC=CC=1C(O)(C(=O)O)C1=CC=CC=C1 UKXSKSHDVLQNKG-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 235000008429 bread Nutrition 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- FDJOLVPMNUYSCM-WZHZPDAFSA-L cobalt(3+);[(2r,3s,4r,5s)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2r)-1-[3-[(1r,2r,3r,4z,7s,9z,12s,13s,14z,17s,18s,19r)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2 Chemical compound [Co+3].N#[C-].N([C@@H]([C@]1(C)[N-]\C([C@H]([C@@]1(CC(N)=O)C)CCC(N)=O)=C(\C)/C1=N/C([C@H]([C@@]1(CC(N)=O)C)CCC(N)=O)=C\C1=N\C([C@H](C1(C)C)CCC(N)=O)=C/1C)[C@@H]2CC(N)=O)=C\1[C@]2(C)CCC(=O)NC[C@@H](C)OP([O-])(=O)O[C@H]1[C@@H](O)[C@@H](N2C3=CC(C)=C(C)C=C3N=C2)O[C@@H]1CO FDJOLVPMNUYSCM-WZHZPDAFSA-L 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- QUKVKKHJFMLKQQ-UHFFFAOYSA-N cyclopenta-1,3-diene (2-cyclopenta-2,4-dien-1-ylcyclohex-2-en-1-yl)-phenylmethanone iron(2+) Chemical compound [Fe++].c1cc[cH-]c1.O=C(C1CCCC=C1[c-]1cccc1)c1ccccc1 QUKVKKHJFMLKQQ-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019152 folic acid Nutrition 0.000 description 1
- 229960000304 folic acid Drugs 0.000 description 1
- 239000011724 folic acid Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229940127234 oral contraceptive Drugs 0.000 description 1
- 239000003539 oral contraceptive agent Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000000039 preparative column chromatography Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 235000019163 vitamin B12 Nutrition 0.000 description 1
- 239000011715 vitamin B12 Substances 0.000 description 1
- 235000019154 vitamin C Nutrition 0.000 description 1
- 239000011718 vitamin C Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F17/00—Metallocenes
- C07F17/02—Metallocenes of metals of Groups 8, 9 or 10 of the Periodic Table
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5400273A GB1476300A (en) | 1973-11-21 | 1973-11-21 | Substituted ferrocene compounds and processes for their production |
| GB3160974 | 1974-07-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO744183L true NO744183L (ca) | 1975-06-16 |
Family
ID=26260996
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO744183A NO744183L (ca) | 1973-11-21 | 1974-11-20 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3960911A (ca) |
| JP (1) | JPS5093951A (ca) |
| AT (1) | AT331260B (ca) |
| CA (1) | CA1032549A (ca) |
| DD (1) | DD116837A5 (ca) |
| DE (1) | DE2453977A1 (ca) |
| DK (1) | DK137277B (ca) |
| ES (1) | ES432100A1 (ca) |
| FI (1) | FI330774A7 (ca) |
| FR (1) | FR2251317B1 (ca) |
| IE (1) | IE40260B1 (ca) |
| IL (1) | IL46027A (ca) |
| NL (1) | NL7415174A (ca) |
| NO (1) | NO744183L (ca) |
| SE (1) | SE7414596L (ca) |
| ZM (1) | ZM16774A1 (ca) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2702628A1 (de) * | 1977-01-22 | 1978-07-27 | Bayer Ag | Duengemittel zur versorgung von pflanzen mit eisen |
| DE2543999B2 (de) * | 1975-10-02 | 1980-02-07 | Bayer Ag, 5090 Leverkusen | Düngemittel zur Versorgung von Pflanzen mit Eisen |
| DE2623487A1 (de) * | 1976-05-26 | 1977-12-15 | Hoechst Ag | Ferrocenderivate und verfahren zu ihrer herstellung |
| DE2623486C2 (de) * | 1976-05-26 | 1982-12-30 | Hoechst Ag, 6000 Frankfurt | 3.5.5-Trimethylhexanoyl-ferrocen, Verfahren zu seiner Herstellung und pharmazeutische Präparate |
| DE2711546A1 (de) | 1977-03-17 | 1978-09-21 | Bayer Ag | Insektizide und akarizide mittel |
| DE2815930A1 (de) * | 1978-04-13 | 1979-10-18 | Bayer Ag | Duengemittel zur versorgung von pflanzen mit eisen |
| DE3404443A1 (de) * | 1984-02-08 | 1985-08-08 | Hartmut Prof. Dr. 1000 Berlin Köpf | Metallicenium-salze und deren verwendung als cytostatica bei der krebsbekaempfung |
| DE3765524D1 (de) * | 1986-11-10 | 1990-11-15 | Ciba Geigy Ag | Verbessertes verfahren zur herstellung von metallorganischen verbindungen. |
| US5135619A (en) * | 1988-10-01 | 1992-08-04 | Idemitsu Kosan Co., Inc. | Process for producing organic thin films |
| US5015748A (en) * | 1988-10-01 | 1991-05-14 | Idemitsu Kosan Co., Ltd. | Novel ferrocene derivatives, surfactants containing same and a process for producing organic thin films |
| US5135637A (en) * | 1989-03-24 | 1992-08-04 | Idemitsu Kosan Co., Ltd. | Eerrocene derivatives, surfactants containing same and process for producing organic thin films |
| JPH02250892A (ja) * | 1989-03-24 | 1990-10-08 | Idemitsu Kosan Co Ltd | 新規フェロセン誘導体,それを含有する界面活性剤及び有機薄膜の製造方法 |
| EP0424547B1 (en) * | 1989-05-12 | 1998-08-19 | Idemitsu Kosan Company Limited | Method of producing ferrocenoyl derivative |
| US5075471A (en) * | 1990-10-09 | 1991-12-24 | Rohm And Haas Company | Insecticidal ferrocenoyl acylhydrazines |
| FR2721028B1 (fr) * | 1994-06-14 | 1996-07-12 | Poudres & Explosifs Ste Nale | Procédé de synthèse d'halogénoalkylferrocènes. |
| US5863911A (en) * | 1994-10-12 | 1999-01-26 | Modelisation Et Mise Au Point De Molecules Medicinales | Diarylethylene metallocene derivatives, their processes of preparation and pharmaceutical compositions containing said derivatives |
| US6667050B1 (en) | 1999-04-06 | 2003-12-23 | Galen (Chemicals) Limited | Chewable oral contraceptive |
| WO2003032895A2 (en) * | 2001-10-17 | 2003-04-24 | Notox Ltd. | Methods and pharmaceutical compositions for stimulating the immune system and/or treating cancer |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2831879A (en) * | 1953-10-27 | 1958-04-22 | Du Pont | Chemical product and process |
| US3711280A (en) * | 1971-02-17 | 1973-01-16 | Eastman Kodak Co | Metallocene photoconductors used in electrophotography |
-
1974
- 1974-11-11 IL IL46027A patent/IL46027A/en unknown
- 1974-11-11 US US05/522,591 patent/US3960911A/en not_active Expired - Lifetime
- 1974-11-14 FI FI3307/74A patent/FI330774A7/fi unknown
- 1974-11-14 DE DE19742453977 patent/DE2453977A1/de active Pending
- 1974-11-18 AT AT922274A patent/AT331260B/de not_active IP Right Cessation
- 1974-11-19 IE IE2380/74A patent/IE40260B1/en unknown
- 1974-11-19 DD DD182456A patent/DD116837A5/xx unknown
- 1974-11-20 DK DK603474AA patent/DK137277B/da unknown
- 1974-11-20 ZM ZM167/74A patent/ZM16774A1/xx unknown
- 1974-11-20 SE SE7414596A patent/SE7414596L/xx unknown
- 1974-11-20 ES ES432100A patent/ES432100A1/es not_active Expired
- 1974-11-20 NO NO744183A patent/NO744183L/no unknown
- 1974-11-20 FR FR7438083A patent/FR2251317B1/fr not_active Expired
- 1974-11-21 JP JP49133225A patent/JPS5093951A/ja active Pending
- 1974-11-21 CA CA214,322A patent/CA1032549A/en not_active Expired
- 1974-11-21 NL NL7415174A patent/NL7415174A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| FI330774A7 (ca) | 1975-05-22 |
| US3960911A (en) | 1976-06-01 |
| ATA922274A (de) | 1975-11-15 |
| NL7415174A (nl) | 1975-05-23 |
| DD116837A5 (ca) | 1975-12-12 |
| ES432100A1 (es) | 1977-06-16 |
| SE7414596L (ca) | 1975-05-22 |
| AU7553074A (en) | 1976-05-20 |
| DK137277B (da) | 1978-02-13 |
| IL46027A (en) | 1977-06-30 |
| IE40260B1 (en) | 1979-04-25 |
| FR2251317A1 (ca) | 1975-06-13 |
| DK137277C (ca) | 1978-07-17 |
| IE40260L (en) | 1975-05-21 |
| JPS5093951A (ca) | 1975-07-26 |
| FR2251317B1 (ca) | 1978-07-21 |
| CA1032549A (en) | 1978-06-06 |
| IL46027A0 (en) | 1975-02-10 |
| AT331260B (de) | 1976-08-10 |
| ZM16774A1 (en) | 1975-07-21 |
| DE2453977A1 (de) | 1975-05-28 |
| DK603474A (ca) | 1975-08-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO744183L (ca) | ||
| KR0126300B1 (ko) | 레티노이드 수용체(rar)에 결합하는 헤테로고리 탄산유도체 | |
| DE60316542T2 (de) | 7-azaindole als inhibitoren c-jun n-terminaler kinasen zur behandlung neurodegenerativer störungen | |
| US5051412A (en) | Pharmaceutically active 3-(1,2,5,6-tetrahydropyridyl)-pyrrolopyridines | |
| WO2002042299A1 (de) | Neue lactam-substituierte pyrazolopyridinderivate | |
| DE19846514A1 (de) | Neue Heterocyclyl-methyl-substituierte Pyrazole | |
| DD206376A5 (de) | Verfahren zur herstellung von benzofuranonen | |
| DE2257310A1 (de) | 3-substituierte alkenylenamine | |
| EP0078241A2 (de) | Furane | |
| GB1586655A (en) | Pyrido-indole transquilising agents | |
| NO831678L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive pyrazolopyridin-derivater. | |
| US3966783A (en) | Compounds | |
| JPH05117273A (ja) | 医薬化合物 | |
| DE2337068A1 (de) | 1-benzylindenylsaeuren | |
| US4038413A (en) | Treating iron deficiency anaemia | |
| DE3300522C2 (ca) | ||
| NO760116L (ca) | ||
| JP2815150B2 (ja) | 置換されたジベンゾシクロヘプテンイミン | |
| Castle et al. | The synthesis of possible degradation products of nicotine | |
| SU982544A3 (ru) | Способ получени 5,8-дигидро-5-этил-8-оксофуро (3,2в)-1,8-нафтиридин-7-карбоновой кислоты или ее соли | |
| Floyd et al. | Prostaglandins and congeners. 22. Synthesis of 11-substituted derivatives of 11-deoxyprostaglandins E1 and E2. Potential bronchodilators | |
| JPS6040423B2 (ja) | ユーフエニル―2,3,4,5―テトラヒドロ―1h―3―ベンズアゼピン類 | |
| US4061752A (en) | 6-Piperazino-11-methylene-dibenzazepines[b,e] | |
| US3894005A (en) | Hydrazones of pyrazolo{8 3,4-b{9 pyridines | |
| EP1474390B1 (en) | Indole derivatives substituted with long-chain alcohols and medicaments containing them |