NO743556L - - Google Patents
Info
- Publication number
- NO743556L NO743556L NO743556A NO743556A NO743556L NO 743556 L NO743556 L NO 743556L NO 743556 A NO743556 A NO 743556A NO 743556 A NO743556 A NO 743556A NO 743556 L NO743556 L NO 743556L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- compounds
- acid
- benzo
- stands
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 39
- 238000000034 method Methods 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 230000037396 body weight Effects 0.000 description 5
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- KWWCXEXKKYYNRF-UHFFFAOYSA-N 4-methoxy-4-oxobutanoic acid;hydrochloride Chemical compound Cl.COC(=O)CCC(O)=O KWWCXEXKKYYNRF-UHFFFAOYSA-N 0.000 description 3
- 239000002841 Lewis acid Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 150000007517 lewis acids Chemical class 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000001741 anti-phlogistic effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 229940014800 succinic anhydride Drugs 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- 150000003577 thiophenes Chemical class 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 208000009386 Experimental Arthritis Diseases 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000002579 anti-swelling effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- -1 ester halides Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- VANNPISTIUFMLH-UHFFFAOYSA-N glutaric anhydride Chemical compound O=C1CCCC(=O)O1 VANNPISTIUFMLH-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/78—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems condensed with rings other than six-membered or with ring systems containing such rings
- C07D333/80—Seven-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1439673A CH581130A5 (ref) | 1973-10-10 | 1973-10-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO743556L true NO743556L (ref) | 1975-05-05 |
Family
ID=4400474
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO743556A NO743556L (ref) | 1973-10-10 | 1974-10-01 |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5082052A (ref) |
| AT (1) | AT352107B (ref) |
| AU (1) | AU498690B2 (ref) |
| BE (1) | BE820943A (ref) |
| CA (1) | CA1038876A (ref) |
| DD (1) | DD113910A5 (ref) |
| DE (1) | DE2441592A1 (ref) |
| DK (1) | DK135809B (ref) |
| ES (2) | ES430790A1 (ref) |
| FI (1) | FI286574A7 (ref) |
| FR (1) | FR2247226B1 (ref) |
| GB (2) | GB1489784A (ref) |
| HU (1) | HU170505B (ref) |
| IE (1) | IE41615B1 (ref) |
| IL (1) | IL45814A (ref) |
| NL (1) | NL7413107A (ref) |
| NO (1) | NO743556L (ref) |
| PH (1) | PH10997A (ref) |
| SE (1) | SE392272B (ref) |
| SU (1) | SU548210A3 (ref) |
| ZA (1) | ZA746444B (ref) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE7801074L (sv) * | 1977-02-08 | 1978-08-09 | Sandoz Ag | Organiska foreningar, deras framstellning och anvendning |
| CN102471326B (zh) * | 2009-07-28 | 2015-04-29 | 日本脏器制药株式会社 | 硫杂苯并薁丙酸衍生物的制备方法 |
-
1974
- 1974-08-30 DE DE2441592A patent/DE2441592A1/de not_active Withdrawn
- 1974-09-30 SE SE7412312A patent/SE392272B/xx unknown
- 1974-10-01 FI FI2865/74A patent/FI286574A7/fi unknown
- 1974-10-01 DK DK516174AA patent/DK135809B/da unknown
- 1974-10-01 NO NO743556A patent/NO743556L/no unknown
- 1974-10-03 PH PH16387A patent/PH10997A/en unknown
- 1974-10-04 NL NL7413107A patent/NL7413107A/xx not_active Application Discontinuation
- 1974-10-08 ES ES430790A patent/ES430790A1/es not_active Expired
- 1974-10-08 IE IE2090/74A patent/IE41615B1/en unknown
- 1974-10-08 DD DD181560A patent/DD113910A5/xx unknown
- 1974-10-08 HU HUSA2699A patent/HU170505B/hu unknown
- 1974-10-09 ZA ZA00746444A patent/ZA746444B/xx unknown
- 1974-10-09 JP JP49115668A patent/JPS5082052A/ja active Pending
- 1974-10-09 AU AU74141/74A patent/AU498690B2/en not_active Expired
- 1974-10-09 SU SU2065450A patent/SU548210A3/ru active
- 1974-10-09 IL IL45814A patent/IL45814A/xx unknown
- 1974-10-09 CA CA211,060A patent/CA1038876A/en not_active Expired
- 1974-10-09 AT AT810174A patent/AT352107B/de not_active IP Right Cessation
- 1974-10-10 BE BE149425A patent/BE820943A/xx unknown
- 1974-10-10 FR FR7434103A patent/FR2247226B1/fr not_active Expired
- 1974-10-10 GB GB22272/77A patent/GB1489784A/en not_active Expired
- 1974-10-10 GB GB43893/74A patent/GB1489783A/en not_active Expired
-
1976
- 1976-07-01 ES ES449429A patent/ES449429A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT352107B (de) | 1979-09-10 |
| ZA746444B (en) | 1976-05-26 |
| DK135809B (da) | 1977-06-27 |
| IE41615B1 (en) | 1980-02-13 |
| ES449429A1 (es) | 1977-12-01 |
| DK516174A (ref) | 1975-06-09 |
| SU548210A3 (ru) | 1977-02-25 |
| ATA810174A (de) | 1979-02-15 |
| BE820943A (fr) | 1975-04-10 |
| GB1489783A (en) | 1977-10-26 |
| ES430790A1 (es) | 1977-04-16 |
| FR2247226A1 (ref) | 1975-05-09 |
| DK135809C (ref) | 1977-11-28 |
| CA1038876A (en) | 1978-09-19 |
| PH10997A (en) | 1977-10-20 |
| DD113910A5 (ref) | 1975-07-05 |
| IL45814A0 (en) | 1974-12-31 |
| JPS5082052A (ref) | 1975-07-03 |
| IL45814A (en) | 1978-06-15 |
| GB1489784A (en) | 1977-10-26 |
| DE2441592A1 (de) | 1975-04-17 |
| FR2247226B1 (ref) | 1978-07-28 |
| HU170505B (ref) | 1977-06-28 |
| SE392272B (sv) | 1977-03-21 |
| AU498690B2 (en) | 1979-03-22 |
| AU7414174A (en) | 1976-04-15 |
| FI286574A7 (ref) | 1975-04-11 |
| IE41615L (en) | 1975-04-10 |
| NL7413107A (nl) | 1975-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU198030B (en) | Process for production of derivatives of benzotiasole and benzotiophen and medical preparatives containing these compounds as active substance | |
| US2996503A (en) | Derivatives of heterocyclic compounds | |
| NO743186L (ref) | ||
| SU873887A3 (ru) | Способ получени производных имидазо/2,1-в/тиазолина или имидазо /2,1-в/тиазина или их кислотно-аддитивных солей,в виде смеси изомеров или отдельных изомеров | |
| NO834637L (no) | Fremgangsmaate ved fremstilling av nye tieno(2,3-6)-pyrrolderivater | |
| US4247706A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| IE61006B1 (en) | New tricyclic amines derived from 2,3,5,6,7,8-hexahydronaphto (2,3-b) furan and from 2,3,6,7,8,9-hexahydro-5H-benzocyclohepta (2,3-b) furan, the processes for preparing them and the pharmaceutical compositions which contain them | |
| US4544655A (en) | Antiinflammatory, analgesic, and antirheumatic 4-hydroxy-2-methyl-n-(2-pyridyl)-6-trifluoromethyl-2H-thieno[2,3-e]-1,2-thiazine-3-carboxamide 1,1-dioxide, corresponding compositions, and 3-carboxylic acid lower alkyl ester intermediates | |
| NO743556L (ref) | ||
| CS214806B2 (en) | Method of making the derivatives of the auron | |
| US4052412A (en) | Benzo cycloheptathiophene carboxylic acid derivatives | |
| PT89268B (pt) | Processo para a preparacao de acidos oxoftalazinil-aceticos heterociclicos | |
| US4137323A (en) | Organic compounds | |
| US3892774A (en) | Cyclo pentathiophene derivatives | |
| US3047580A (en) | 10-(omega-amino alkyl)-10-hydroxythiaxanthenes | |
| JPH0256478A (ja) | 2,3,4,5―テトラヒドロ―1―ベンズオキセピン―3,5―ジオン誘導体及びその製法 | |
| NO121896B (ref) | ||
| DK159110B (da) | 4h-benzo(4,5)cyclohepta(1,2-b)thiophenderivater, fremgangsmaade til fremstilling deraf samt farmaceutiske praeparater indeholdende derivaterne | |
| US3865843A (en) | 4-Oxo-4H-benzo{8 4.5{9 cyclohepta{8 1,2-b{9 thiophene derivatives | |
| US3651051A (en) | Benzo(b)benzofurano(2 3-e)oxepines | |
| CA1276158C (en) | 4h-benzo[4,5]cyclohepta[1,2-b]thiophene derivatives | |
| NO122754B (ref) | ||
| DE1770722A1 (de) | 1,4,9,10-Tetra-benzo[5,6]cyclohepta[1,2-d]4-one und Verfahren zu ihrer Herstellung | |
| IE43539B1 (en) | 2-(2'-aryl-6-chromonyl) propionic acids, and an analgesic and anti-inflammatory derivatives thereof | |
| NO851385L (no) | Substituerte benzodioksolderivater, fremgangsmaater til fremstilling derav og tilsvarende farmasoeytiske preparater |