NO178373C - Fremgangsmåte ved fremstilling av terapeutisk aktive ergolinderivater - Google Patents
Fremgangsmåte ved fremstilling av terapeutisk aktive ergolinderivaterInfo
- Publication number
- NO178373C NO178373C NO913647A NO913647A NO178373C NO 178373 C NO178373 C NO 178373C NO 913647 A NO913647 A NO 913647A NO 913647 A NO913647 A NO 913647A NO 178373 C NO178373 C NO 178373C
- Authority
- NO
- Norway
- Prior art keywords
- pct
- represents hydrogen
- alkyl
- image
- compounds
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 5
- 229910052739 hydrogen Inorganic materials 0.000 abstract 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 3
- 150000001875 compounds Chemical class 0.000 abstract 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 150000002431 hydrogen Chemical group 0.000 abstract 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- 230000000561 anti-psychotic effect Effects 0.000 abstract 1
- 239000000939 antiparkinson agent Substances 0.000 abstract 1
- 229940125688 antiparkinson agent Drugs 0.000 abstract 1
- 239000000164 antipsychotic agent Substances 0.000 abstract 1
- 239000002249 anxiolytic agent Substances 0.000 abstract 1
- 230000000949 anxiolytic effect Effects 0.000 abstract 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 1
- 229910052794 bromium Inorganic materials 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 239000000460 chlorine Chemical group 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 238000007363 ring formation reaction Methods 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB909001774A GB9001774D0 (en) | 1990-01-25 | 1990-01-25 | Process for preparing ergoline derivatives |
| GB909025849A GB9025849D0 (en) | 1990-11-28 | 1990-11-28 | Process for preparing ergoline derivatives |
| PCT/EP1991/000104 WO1991011447A1 (en) | 1990-01-25 | 1991-01-21 | Process for preparing ergoline derivatives |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| NO913647L NO913647L (no) | 1991-09-16 |
| NO913647D0 NO913647D0 (no) | 1991-09-16 |
| NO178373B NO178373B (no) | 1995-12-04 |
| NO178373C true NO178373C (no) | 1996-03-13 |
Family
ID=26296553
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO913647A NO178373C (no) | 1990-01-25 | 1991-09-16 | Fremgangsmåte ved fremstilling av terapeutisk aktive ergolinderivater |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US5210194A (no) |
| EP (1) | EP0464178B1 (no) |
| JP (1) | JPH04504582A (no) |
| KR (1) | KR920701205A (no) |
| AT (1) | ATE131167T1 (no) |
| AU (1) | AU644625B2 (no) |
| CA (1) | CA2049053A1 (no) |
| DE (1) | DE69115138T2 (no) |
| DK (1) | DK0464178T3 (no) |
| ES (1) | ES2083564T3 (no) |
| FI (1) | FI96113C (no) |
| GR (1) | GR3019125T3 (no) |
| HU (1) | HU208971B (no) |
| IE (1) | IE72142B1 (no) |
| IL (1) | IL96996A (no) |
| MY (1) | MY106383A (no) |
| NO (1) | NO178373C (no) |
| NZ (1) | NZ236852A (no) |
| PT (1) | PT96557B (no) |
| RU (1) | RU2074857C1 (no) |
| WO (1) | WO1991011447A1 (no) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4033496A1 (de) * | 1990-10-20 | 1992-04-23 | Sandoz Ag | Neue ergolinderivate, ihre herstellung und verwendung |
| ES2162856T3 (es) * | 1992-12-24 | 2002-01-16 | Pharmacia & Upjohn Spa | Derivados de ergolina serotoninergicos. |
| GB9407637D0 (en) | 1994-04-18 | 1994-06-08 | Erba Carlo Spa | Serotoninergic abeo-ergoline derivatives |
| GB9603226D0 (en) * | 1996-02-15 | 1996-04-17 | Pharmacia Spa | Heterocyclyl-ergoline derivatives |
| US6060483A (en) * | 1996-06-27 | 2000-05-09 | Pharmacia & Upjohn S.P.A. | Antineurodegenerative ergoline derivatives |
| CN1514843A (zh) | 2001-06-08 | 2004-07-21 | �о���Ӧ�ÿ�ѧЭ��ɷ�����˾ | 生长激素释放抑制因子-多巴胺嵌合类似物 |
| TWI523863B (zh) | 2012-11-01 | 2016-03-01 | 艾普森藥品公司 | 體抑素-多巴胺嵌合體類似物 |
| EP2914276A4 (en) | 2012-11-01 | 2016-07-13 | Ipsen Pharma Sas | SOMATOSTATIN ANALOGA AND DIMERE OUT |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3763161A (en) * | 1970-07-13 | 1973-10-02 | Du Pont | Tetrasubstituted dicyanopyrazines and related compounds |
| JPS58172012A (ja) * | 1982-04-01 | 1983-10-08 | Clarion Co Ltd | 同一放送識別受信機 |
| PH21123A (en) * | 1983-04-28 | 1987-07-27 | Erba Farmitalia | Ergoline derivatives |
| US4806538A (en) * | 1984-11-02 | 1989-02-21 | Fujisawa Pharmaceutical Co., Ltd. | Piperazine compound as PAF-antagonist |
| GB8501078D0 (en) * | 1985-01-16 | 1985-02-20 | Erba Farmitalia | Piperazin-1-yl-ergo-line derivatives |
| DE3517247A1 (de) * | 1985-05-13 | 1986-11-13 | Gerhard Prof. Dr.-Ing. 8012 Ottobrunn Flachenecker | Antennendiversity-empfangsanlage zur elimination von empfangsstoerungen |
| US4871736A (en) * | 1986-11-25 | 1989-10-03 | The Ohio State University | Stereoisomeric tricyclic bis(dioxopiperazines) and pharmaceutical compositions |
| US4733402A (en) * | 1987-04-23 | 1988-03-22 | Signatron, Inc. | Adaptive filter equalizer systems |
| DE3814899A1 (de) * | 1988-05-03 | 1989-11-16 | Hirschmann Richard Gmbh Co | Empfangsverfahren und empfangs-antennensystem fuer mobilen empfang |
| NO175659C (no) * | 1988-07-06 | 1994-11-09 | Sumitomo Electric Industries | Kommunikasjonssystem med multippelmottagning og mottagerapparat for diversitetssignaler |
| DE3926336C2 (de) * | 1989-08-09 | 2001-03-29 | Heinz Lindenmeier | Antennendiversity-Empfangsanlage zur Elimination von Empfangsstörungen beim mobilen Empfang von Fernsehsignalen |
-
1991
- 1991-01-21 ES ES91902706T patent/ES2083564T3/es not_active Expired - Lifetime
- 1991-01-21 KR KR1019910701178A patent/KR920701205A/ko not_active Abandoned
- 1991-01-21 WO PCT/EP1991/000104 patent/WO1991011447A1/en not_active Ceased
- 1991-01-21 CA CA002049053A patent/CA2049053A1/en not_active Abandoned
- 1991-01-21 US US07/761,977 patent/US5210194A/en not_active Expired - Fee Related
- 1991-01-21 HU HU913121A patent/HU208971B/hu not_active IP Right Cessation
- 1991-01-21 RU SU915001733A patent/RU2074857C1/ru active
- 1991-01-21 AU AU70788/91A patent/AU644625B2/en not_active Ceased
- 1991-01-21 DK DK91902706.0T patent/DK0464178T3/da active
- 1991-01-21 AT AT91902706T patent/ATE131167T1/de not_active IP Right Cessation
- 1991-01-21 JP JP3503074A patent/JPH04504582A/ja active Pending
- 1991-01-21 EP EP91902706A patent/EP0464178B1/en not_active Expired - Lifetime
- 1991-01-21 DE DE69115138T patent/DE69115138T2/de not_active Expired - Fee Related
- 1991-01-22 MY MYPI91000103A patent/MY106383A/en unknown
- 1991-01-22 NZ NZ236852A patent/NZ236852A/en unknown
- 1991-01-22 IL IL9699691A patent/IL96996A/en not_active IP Right Cessation
- 1991-01-23 PT PT96557A patent/PT96557B/pt not_active IP Right Cessation
- 1991-01-24 IE IE24491A patent/IE72142B1/en not_active IP Right Cessation
- 1991-09-16 NO NO913647A patent/NO178373C/no unknown
- 1991-09-23 FI FI914458A patent/FI96113C/fi not_active IP Right Cessation
-
1996
- 1996-02-28 GR GR960400549T patent/GR3019125T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI96113C (fi) | 1996-05-10 |
| WO1991011447A1 (en) | 1991-08-08 |
| DE69115138D1 (de) | 1996-01-18 |
| DE69115138T2 (de) | 1996-05-09 |
| GR3019125T3 (en) | 1996-05-31 |
| AU644625B2 (en) | 1993-12-16 |
| MY106383A (en) | 1995-05-30 |
| ATE131167T1 (de) | 1995-12-15 |
| IE910244A1 (en) | 1991-07-31 |
| ES2083564T3 (es) | 1996-04-16 |
| NO913647L (no) | 1991-09-16 |
| JPH04504582A (ja) | 1992-08-13 |
| NO913647D0 (no) | 1991-09-16 |
| EP0464178B1 (en) | 1995-12-06 |
| KR920701205A (ko) | 1992-08-11 |
| FI914458A0 (fi) | 1991-09-23 |
| HU208971B (en) | 1994-02-28 |
| HUT58092A (en) | 1992-01-28 |
| EP0464178A1 (en) | 1992-01-08 |
| DK0464178T3 (da) | 1996-01-02 |
| FI96113B (fi) | 1996-01-31 |
| IL96996A0 (en) | 1992-03-29 |
| IL96996A (en) | 1994-11-28 |
| AU7078891A (en) | 1991-08-21 |
| IE72142B1 (en) | 1997-03-26 |
| NZ236852A (en) | 1992-05-26 |
| PT96557A (pt) | 1991-10-15 |
| PT96557B (pt) | 1998-07-31 |
| CA2049053A1 (en) | 1991-07-26 |
| NO178373B (no) | 1995-12-04 |
| RU2074857C1 (ru) | 1997-03-10 |
| US5210194A (en) | 1993-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO851349L (no) | Fremgangsmaate ved fremstilling av optisk aktive alfa-arylalkansyrer. | |
| DK170188A (da) | Carbinolderivater | |
| KR950700278A (ko) | 벤조사이클로헵텐, 벤조옥세핀 및 벤조티에핀(benzocycloheptenes, benzoxepines and benzothiepines) | |
| AU3415599A (en) | Benzoheterocyclic distamycin derivatives, process for preparing them, and their use as antitumor agents | |
| NO178373C (no) | Fremgangsmåte ved fremstilling av terapeutisk aktive ergolinderivater | |
| NO864516D0 (no) | Fremgangsmaate for fremstilling av alkyl-beta-carboliner. | |
| PT81004A (en) | Process for preparing tricyclic oxindole useful as antiinflammatory agents | |
| DE69229057D1 (de) | 1-(arylalkyl-aminoalkyl) imidazolderivate, herstellungs verfahren und verwendung als therapeutische mittel | |
| DK0689534T3 (da) | Amidderivater som 5-HT1A-ligander | |
| NO950360L (no) | Nytt legemiddel som inneholder 3-fenylsulfonyl-3,7-diazabisyklo[3,3,1Ånonan-forbindelser | |
| NO923004L (no) | 6-oxo-azepinoindolforbindelser, saavel som fremgangsmaater og mellomprodukter for fremstilling av disse, og legemidler inneholdende disse forbindelser | |
| DK16980A (da) | Fremgangsmaade til fremstilling af derivater af pyrido og imidazopyridoindoler | |
| PT85822A (pt) | Process for preparing indolo-pyrazino-benzodiazepine derivatives | |
| ATE207460T1 (de) | Benzocycloalken-verbindungen mit bindungsaffinität an den melatonin-rezeptor, ihre herstellung und verwendung | |
| GB2017080A (en) | Benzothiazepines | |
| ES8105003A1 (es) | Procedimiento para preparar piridopirimidinas | |
| DK0513285T3 (da) | Imidazol-2-yl-derivater af substituerede bicycliske forbindelser og fremsgangsmåde til fremstilling deraf | |
| DE69501810D1 (de) | Verwendung von 5-Thia-1,4-Diazabicyclo [4.2.0] Octane-3,8-dioxo Verbindungen in der Antitumor-Therapie | |
| FI931580L (fi) | Menetelmä terapeuttisesti aktiivisten tetratsolijohdannaisten valmistamiseksi |