NO149102C - Analogifremgangsmaate for fremstilling av terapeutisk aktive trans-4-fenyl-1,2,3,4-tetrahydro-1-naftalenamin-derivater - Google Patents
Analogifremgangsmaate for fremstilling av terapeutisk aktive trans-4-fenyl-1,2,3,4-tetrahydro-1-naftalenamin-derivaterInfo
- Publication number
- NO149102C NO149102C NO803259A NO803259A NO149102C NO 149102 C NO149102 C NO 149102C NO 803259 A NO803259 A NO 803259A NO 803259 A NO803259 A NO 803259A NO 149102 C NO149102 C NO 149102C
- Authority
- NO
- Norway
- Prior art keywords
- tetrahydro
- naphthalene
- phenyl
- preparation
- amine derivatives
- Prior art date
Links
- IWNWWVPLTTUPBQ-XJKSGUPXSA-N (1r,4s)-4-phenyl-1,2,3,4-tetrahydronaphthalen-1-amine Chemical class C1([C@@H]2CC[C@H](C3=CC=CC=C32)N)=CC=CC=C1 IWNWWVPLTTUPBQ-XJKSGUPXSA-N 0.000 title 1
- 230000001225 therapeutic effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/04—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups
- C07C209/14—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups
- C07C209/16—Preparation of compounds containing amino groups bound to a carbon skeleton by substitution of functional groups by amino groups by substitution of hydroxy groups or of etherified or esterified hydroxy groups with formation of amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/21—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/30—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the six-membered aromatic ring being part of a condensed ring system formed by two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/43—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/687—Unsaturated compounds containing a keto groups being part of a ring containing halogen
- C07C49/697—Unsaturated compounds containing a keto groups being part of a ring containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/753—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups
- C07C49/755—Unsaturated compounds containing a keto groups being part of a ring containing ether groups, groups, groups, or groups a keto group being part of a condensed ring system with two or three rings, at least one ring being a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/52—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen
- C07C57/58—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings
- C07C57/60—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing halogen containing six-membered aromatic rings having unsaturation outside the rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9023779A | 1979-11-01 | 1979-11-01 | |
| US06/184,447 US4556676A (en) | 1979-11-01 | 1980-09-05 | Antidepressant derivatives of trans-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NO803259L NO803259L (no) | 1981-05-04 |
| NO149102B NO149102B (no) | 1983-11-07 |
| NO149102C true NO149102C (no) | 1984-02-15 |
Family
ID=26782055
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO803259A NO149102C (no) | 1979-11-01 | 1980-10-31 | Analogifremgangsmaate for fremstilling av terapeutisk aktive trans-4-fenyl-1,2,3,4-tetrahydro-1-naftalenamin-derivater |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4556676A (pt) |
| EP (1) | EP0028901B1 (pt) |
| KR (1) | KR840002021B1 (pt) |
| AR (2) | AR225196A1 (pt) |
| AT (1) | ATE2667T1 (pt) |
| AU (1) | AU517842B2 (pt) |
| CA (1) | CA1130816A (pt) |
| DE (1) | DE3062226D1 (pt) |
| DK (1) | DK149308C (pt) |
| ES (2) | ES496441A0 (pt) |
| FI (1) | FI68807C (pt) |
| GR (1) | GR70782B (pt) |
| IE (1) | IE50396B1 (pt) |
| IL (1) | IL61376A (pt) |
| NO (1) | NO149102C (pt) |
| PH (1) | PH15468A (pt) |
| PT (1) | PT72005B (pt) |
| YU (2) | YU41744B (pt) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8004002L (sv) * | 1980-05-29 | 1981-11-30 | Arvidsson Folke Lars Erik | Terapeutiskt anvendbara tetralinderivat |
| US4866208A (en) * | 1981-12-21 | 1989-09-12 | The Dow Chemical Company | Meta-phenylene diamine derivatives |
| US4777288A (en) * | 1987-06-11 | 1988-10-11 | Pfizer Inc. | Process for preparing a 4,4-diphenylbutanoic acid derivative |
| US4839104A (en) * | 1987-06-11 | 1989-06-13 | Pfizer, Inc. | Process for preparing sertraline intermediates |
| FR2623802B1 (fr) * | 1987-11-26 | 1990-05-04 | Lucien Laboratoires | Derives d'amino-4 trifluoromethyl-1 tetralines. leur preparation et leur application en therapeutique |
| FR2642065B1 (fr) * | 1989-01-24 | 1991-05-24 | Lipha | Derives d'acides benzocycloalcenyl dihydroxy alcanoiques, procede de preparation et medicaments les contenant |
| FR2665443B1 (fr) * | 1990-08-03 | 1992-11-06 | Lucien Laboratoires | Derives d'amino-4-methyl-1-tetralines, leur preparation et leur application en therapeutique. |
| US5082970A (en) * | 1991-03-06 | 1992-01-21 | Pfizer Inc. | Process for recycling amine isomer |
| GB9114948D0 (en) * | 1991-07-11 | 1991-08-28 | Pfizer Ltd | Process for preparing sertraline intermediates |
| US5196607A (en) * | 1992-02-14 | 1993-03-23 | Pfizer Inc. | Process for preparing ketone enantiomer |
| US5248699A (en) * | 1992-08-13 | 1993-09-28 | Pfizer Inc. | Sertraline polymorph |
| US5466880A (en) * | 1992-09-15 | 1995-11-14 | Pfizer Inc. | Process for preparing ketone enantiomer |
| EP0697894A4 (en) * | 1993-03-31 | 1996-05-01 | Univ Pennsylvania | DOPAMINE D-3 AND SEROTONIN (5-HT 1A) RECEPTOR LIGANDS AND IMAGING AGENTS |
| CA2176500C (en) * | 1993-11-30 | 1999-09-28 | George J. Quallich | Process for preparing a chiral tetralone |
| US6410794B1 (en) | 1994-12-16 | 2002-06-25 | Uop Llc | Process for preparation of pharmaceutically desired chiral tetralone from tetralones |
| US6455736B1 (en) | 1994-12-16 | 2002-09-24 | Uop Llc | Process for preparation of pharmaceutically desired sertraline and sertraline analogs |
| HU222341B1 (hu) * | 1996-12-18 | 2003-06-28 | Richter Gedeon Vegyészeti Gyár Rt. | Eljárás sertralin előállítására és az eljárásban alkalmazott intermedier |
| IN182588B (pt) | 1998-05-12 | 1999-05-08 | Sun Pharmaceutical Ind Ltd | |
| IN187170B (pt) | 2000-01-04 | 2002-02-23 | Sun Pharmaceutical Ind Ltd | |
| DE10006411C2 (de) * | 2000-02-14 | 2002-03-07 | Huf Huelsbeck & Fuerst Gmbh | Elektronischer Zündanlaßschalter für Kraftfahrzeuge und Reserveschlüssel zur Betätigung desselben |
| DE10041478A1 (de) | 2000-08-24 | 2002-03-14 | Sanol Arznei Schwarz Gmbh | Neue pharmazeutische Zusammensetzung |
| US6482440B2 (en) | 2000-09-21 | 2002-11-19 | Phase 2 Discovery, Inc. | Long acting antidepressant microparticles |
| US6723878B2 (en) | 2001-06-15 | 2004-04-20 | Orion Corporation Fermion | Method for preparing sertraline |
| US8134029B2 (en) | 2002-09-16 | 2012-03-13 | Sunovion Pharmaceuticals Inc. | Treatment of CNS disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine |
| EP1542961B1 (en) * | 2002-09-16 | 2013-09-11 | Sepracor, Inc. | Trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine for use in treatment of cns disorders |
| CN100584818C (zh) * | 2002-09-16 | 2010-01-27 | 塞普拉科公司 | 用反式4-(3,4-二氯苯基)-1,2,3,4-四氢-1-萘胺及其甲酰胺治疗cns病症 |
| WO2004024130A2 (en) * | 2002-09-16 | 2004-03-25 | Sepracor, Inc. | TREATMENT OF CNS DISORDERS WITH trans 4-(3,4-DICHLOROPHENYL)-1,2,3,4-TETRAHYDRO-N-METHYL-1-NAPTHALENAMINE |
| DE10334187A1 (de) * | 2003-07-26 | 2005-03-03 | Schwarz Pharma Ag | Substituierte 2-Aminotetraline zur Behandlung von Depressionen |
| DE10334188B4 (de) * | 2003-07-26 | 2007-07-05 | Schwarz Pharma Ag | Verwendung von Rotigotin zur Behandlung von Depressionen |
| US20060014838A1 (en) * | 2004-07-14 | 2006-01-19 | Sudhakar Valluri | Process for converting trans-sertraline to cis-sertraline |
| WO2007006003A2 (en) | 2005-07-06 | 2007-01-11 | Sepracor Inc. | Combinations of eszopiclone and trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-n-methyl-1-napthalenamine or trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-napthalenamine, and methods of treatment of menopause and mood, anxiety, and cognitive disorders |
| PT2816024T (pt) | 2006-03-31 | 2017-10-20 | Sunovion Pharmaceuticals Inc | Aminas quirais |
| EP2043745A2 (en) * | 2006-05-31 | 2009-04-08 | SEPRACOR Inc | Treatment of pain disorders with trans 4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-1-naphthalenamine and its formamide |
| US20100279990A1 (en) * | 2006-06-13 | 2010-11-04 | Ramot At Tel-Aviv University Ltd. | Antiproliferative compounds, compositions and methods of use |
| EP1987815A1 (en) * | 2007-05-04 | 2008-11-05 | Schwarz Pharma Ag | Oronasopharyngeally deliverable pharmaceutical compositions of dopamine agonists for the prevention and/or treatment of restless limb disorders |
| US20100081713A1 (en) * | 2008-03-19 | 2010-04-01 | CombinatoRx, (Singapore) Pte. Ltd. | Compositions and methods for treating viral infections |
| JP2017515858A (ja) * | 2014-05-13 | 2017-06-15 | サノビオン ファーマシューティカルズ インクSunovion Pharmaceuticals Inc. | Adhdの治療のためのダソトラリンに関する方法および組成物 |
| CN106660937A (zh) * | 2014-05-13 | 2017-05-10 | 赛诺维信制药公司 | 用于治疗adhd的达斯曲林(dasotraline)剂量和方法 |
| WO2016046669A2 (en) * | 2014-09-27 | 2016-03-31 | Mohan M Alapati | Compositions and methods for the treatment of depression and neurological diseases |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB793853A (en) * | 1954-09-15 | 1958-04-23 | Schering Ag | Manufacture of new 3-amino-indanes |
| DE1098511B (de) * | 1959-11-21 | 1961-02-02 | Schering Ag | Verfahren zur Abtrennung von analgetisch wirksamen d-1-Phenyl-3-dimethylaminoindan |
| US3704323A (en) * | 1969-12-23 | 1972-11-28 | Squibb & Sons Inc | Indane derivatives |
| GB1420472A (en) * | 1972-09-27 | 1976-01-07 | Pfizer | Aminophenyltetralin compounds |
| US4029731A (en) * | 1974-11-06 | 1977-06-14 | Pfizer Inc. | Aminophenyltetralin compounds |
| US4045488A (en) * | 1974-11-06 | 1977-08-30 | Pfizer Inc. | Aminophenyltetralin compounds |
-
1980
- 1980-09-05 US US06/184,447 patent/US4556676A/en not_active Expired - Lifetime
- 1980-10-28 EP EP80303810A patent/EP0028901B1/en not_active Expired
- 1980-10-28 AT AT80303810T patent/ATE2667T1/de not_active IP Right Cessation
- 1980-10-28 DE DE8080303810T patent/DE3062226D1/de not_active Expired
- 1980-10-29 PH PH24786A patent/PH15468A/en unknown
- 1980-10-30 YU YU2774/80A patent/YU41744B/xx unknown
- 1980-10-30 CA CA363,571A patent/CA1130816A/en not_active Expired
- 1980-10-30 IL IL61376A patent/IL61376A/xx unknown
- 1980-10-30 FI FI803399A patent/FI68807C/fi not_active IP Right Cessation
- 1980-10-30 GR GR63248A patent/GR70782B/el unknown
- 1980-10-30 AR AR283061A patent/AR225196A1/es active
- 1980-10-31 NO NO803259A patent/NO149102C/no unknown
- 1980-10-31 AU AU63898/80A patent/AU517842B2/en not_active Expired
- 1980-10-31 PT PT72005A patent/PT72005B/pt unknown
- 1980-10-31 KR KR1019800004175A patent/KR840002021B1/ko not_active Expired
- 1980-10-31 ES ES496441A patent/ES496441A0/es active Granted
- 1980-10-31 DK DK462480A patent/DK149308C/da not_active IP Right Cessation
- 1980-10-31 IE IE2260/80A patent/IE50396B1/en not_active IP Right Cessation
-
1981
- 1981-10-06 AR AR286998A patent/AR229106A1/es active
- 1981-11-05 ES ES506893A patent/ES506893A0/es active Granted
-
1983
- 1983-01-07 YU YU33/83A patent/YU42066B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| KR830004201A (ko) | 1983-07-06 |
| YU277480A (en) | 1983-09-30 |
| PH15468A (en) | 1983-01-24 |
| DE3062226D1 (en) | 1983-04-07 |
| IL61376A (en) | 1983-10-31 |
| FI68807C (fi) | 1985-11-11 |
| AR229106A1 (es) | 1983-06-15 |
| ATE2667T1 (de) | 1983-03-15 |
| DK149308B (da) | 1986-04-28 |
| PT72005A (en) | 1980-11-01 |
| YU41744B (en) | 1987-12-31 |
| NO803259L (no) | 1981-05-04 |
| DK462480A (da) | 1981-05-02 |
| AU517842B2 (en) | 1981-08-27 |
| DK149308C (da) | 1986-12-08 |
| CA1130816A (en) | 1982-08-31 |
| FI68807B (fi) | 1985-07-31 |
| PT72005B (en) | 1981-08-31 |
| ES8207120A1 (es) | 1982-09-01 |
| KR840002021B1 (ko) | 1984-11-05 |
| IL61376A0 (en) | 1980-12-31 |
| EP0028901B1 (en) | 1983-03-02 |
| YU42066B (en) | 1988-04-30 |
| US4556676A (en) | 1985-12-03 |
| ES8201948A1 (es) | 1982-01-16 |
| NO149102B (no) | 1983-11-07 |
| ES506893A0 (es) | 1982-09-01 |
| FI803399L (fi) | 1981-05-02 |
| EP0028901A1 (en) | 1981-05-20 |
| AU6389880A (en) | 1981-05-07 |
| IE802260L (en) | 1981-05-01 |
| AR225196A1 (es) | 1982-02-26 |
| ES496441A0 (es) | 1982-01-16 |
| GR70782B (pt) | 1983-03-23 |
| IE50396B1 (en) | 1986-04-16 |
| YU3383A (en) | 1983-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO149102C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive trans-4-fenyl-1,2,3,4-tetrahydro-1-naftalenamin-derivater | |
| NO152215C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 4,5-diaryl-2-nitroimidazoler | |
| NO151321C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive karbostyrilderivater | |
| NO152899C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive glycerolderivater. | |
| NO151463C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive kinazolinderivater | |
| NO158099C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive karbostyrilderivater. | |
| NO157817C (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive glycinamidderivater. | |
| NO156752C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 3-(1-piperidinylalkyl)-4hpyrido(1,2-a)pyrimidin-4-0n derivater | |
| NO156864C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive piperinderivater. | |
| NO152129C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive omega-cyan-1, omega-difenyl-azaalkanderivater | |
| NO156787C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive kinolonderivater. | |
| NO153569C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive merkaptoacetyl-prolin-derivater. | |
| NO150360C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive merkaptoacyldipeptider | |
| NO153496C (no) | Analogifremgangsmaate for fremstilling av fysiologisk aktive indolizin-derivater. | |
| NO152414C (no) | Analogifremgangsmaate for fremstilling av terapeutisk virksomme 2,6-dialkoksybenzamider | |
| NO154054C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive hydroksypyrimidinderivater. | |
| NO160079C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive cefem-derivater. | |
| NO158739C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive 2-piperazinopyrimidinderivater. | |
| NO155289C (no) | Analogifremgangsmaate for fremstilling av terapeutisk virksomme 4,5-umettede prostansyrederivater. | |
| NO160511C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive fenyl-cyklo-butanderivater. | |
| NO160512C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive karbostyrilderivater. | |
| NO168478C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive vinylthioacetamido-oxacefalosporinderivater. | |
| NO150158C (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 6,7-dimetoksyquinazolinderivater | |
| NO154052C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive kinolon-derivater. | |
| NO154795C (no) | Analogifremgangsmaate ved fremstilling av terapeutisk virksomme 1,2,4-oxadiazolin-5-on-derivater. |