NO134157B - - Google Patents
Download PDFInfo
- Publication number
- NO134157B NO134157B NO16769367A NO16769367A NO134157B NO 134157 B NO134157 B NO 134157B NO 16769367 A NO16769367 A NO 16769367A NO 16769367 A NO16769367 A NO 16769367A NO 134157 B NO134157 B NO 134157B
- Authority
- NO
- Norway
- Prior art keywords
- aza
- mixture
- acid
- phenethyl
- dibenzo
- Prior art date
Links
- -1 substituents halogen Chemical class 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000007858 starting material Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 150000003222 pyridines Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 62
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 38
- 239000000243 solution Substances 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 26
- 238000000034 method Methods 0.000 description 26
- 150000002576 ketones Chemical class 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 21
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- 238000010438 heat treatment Methods 0.000 description 18
- 239000000543 intermediate Substances 0.000 description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 229920000137 polyphosphoric acid Polymers 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- 150000001204 N-oxides Chemical class 0.000 description 10
- 150000002596 lactones Chemical class 0.000 description 10
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 10
- 238000007363 ring formation reaction Methods 0.000 description 10
- FIBVUGPJCPOSJB-UHFFFAOYSA-N 2-(2-phenylethyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=C1CCC1=CC=CC=C1 FIBVUGPJCPOSJB-UHFFFAOYSA-N 0.000 description 8
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- 238000006356 dehydrogenation reaction Methods 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 8
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical class OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- JENIILKCEYGCJV-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-2-carbonitrile Chemical compound N#CC1=NC=CC=C1CCC1=CC=CC=C1 JENIILKCEYGCJV-UHFFFAOYSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- HMWBPQZTSAICMS-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC=C1CCC1=CC=CC=C1 HMWBPQZTSAICMS-UHFFFAOYSA-N 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- LDPMSPVUGCVFHB-UHFFFAOYSA-N 2-(2-phenylethenyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=C1C=CC1=CC=CC=C1 LDPMSPVUGCVFHB-UHFFFAOYSA-N 0.000 description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 150000003997 cyclic ketones Chemical class 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- DXKCYWXEHAMAQW-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine Chemical compound C=1C=CC=CC=1CCC1=CC=CN=C1 DXKCYWXEHAMAQW-UHFFFAOYSA-N 0.000 description 4
- DJJPOVQKVDBHFG-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC=CC=C1CCC1=CC=CC=C1 DJJPOVQKVDBHFG-UHFFFAOYSA-N 0.000 description 4
- OXIDANFQRMCKEW-UHFFFAOYSA-N 4-(2-phenylethyl)pyridine-3-carboxylic acid Chemical class OC(=O)C1=CN=CC=C1CCC1=CC=CC=C1 OXIDANFQRMCKEW-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- ZDXGKCWPISPQIQ-UHFFFAOYSA-N ethyl 4-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=CC=C1C ZDXGKCWPISPQIQ-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 239000011664 nicotinic acid Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- QSVZFWGNHWNVDJ-UHFFFAOYSA-N 3-(2-phenylethyl)pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC=C1CCC1=CC=CC=C1 QSVZFWGNHWNVDJ-UHFFFAOYSA-N 0.000 description 3
- AWLFVFGRSPUANH-UHFFFAOYSA-N 4-methyl-3-(2-phenylethyl)pyridine Chemical compound CC1=CC=NC=C1CCC1=CC=CC=C1 AWLFVFGRSPUANH-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XBLVHTDFJBKJLG-UHFFFAOYSA-N Ethyl nicotinate Chemical compound CCOC(=O)C1=CC=CN=C1 XBLVHTDFJBKJLG-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 3
- LOBURDZWGMSKIG-UHFFFAOYSA-N benzo[1,2]cyclohepta[3,4-a]pyridin-11-one Chemical compound C1=CC2=CN=CC=C2C(=O)C2=CC=CC=C21 LOBURDZWGMSKIG-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- QFWPJPIVLCBXFJ-UHFFFAOYSA-N glymidine Chemical compound N1=CC(OCCOC)=CN=C1NS(=O)(=O)C1=CC=CC=C1 QFWPJPIVLCBXFJ-UHFFFAOYSA-N 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000011630 iodine Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 235000001968 nicotinic acid Nutrition 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- DWQYMLYCTCRYHL-UHFFFAOYSA-N 1-(4-methylpyridin-3-yl)-2-phenylethanone Chemical compound CC1=CC=NC=C1C(=O)CC1=CC=CC=C1 DWQYMLYCTCRYHL-UHFFFAOYSA-N 0.000 description 2
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 2
- GVEQCFMNUYFHOE-UHFFFAOYSA-N 2-phenyl-1-pyridin-3-ylethanone Chemical compound C=1C=CN=CC=1C(=O)CC1=CC=CC=C1 GVEQCFMNUYFHOE-UHFFFAOYSA-N 0.000 description 2
- OTJNZCAGDNFIMV-UHFFFAOYSA-N 4-(2-phenylethenyl)pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC=C1C=CC1=CC=CC=C1 OTJNZCAGDNFIMV-UHFFFAOYSA-N 0.000 description 2
- FBZVBNFRUXEOHE-UHFFFAOYSA-N 5,6-dihydrobenzo[1,2]cyclohepta[3,4-a]pyridin-11-one Chemical compound C1CC2=CN=CC=C2C(=O)C2=CC=CC=C21 FBZVBNFRUXEOHE-UHFFFAOYSA-N 0.000 description 2
- PDPKDRIXAIQZAV-UHFFFAOYSA-N 5,6-dihydrobenzo[1,2]cyclohepta[3,4-b]pyridin-11-one Chemical compound C1CC2=CC=CN=C2C(=O)C2=CC=CC=C21 PDPKDRIXAIQZAV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- HOCIEUJADYTZNL-UHFFFAOYSA-N benzo[1,2]cyclohepta[3,4-b]pyridin-11-one Chemical compound C1=CC2=NC=CC=C2C(=O)C2=CC=CC=C21 HOCIEUJADYTZNL-UHFFFAOYSA-N 0.000 description 2
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- YNBADRVTZLEFNH-UHFFFAOYSA-N methyl nicotinate Chemical compound COC(=O)C1=CC=CN=C1 YNBADRVTZLEFNH-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229960001238 methylnicotinate Drugs 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Natural products OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QPDZAAFAAADIRA-UHFFFAOYSA-N 1-oxido-3-(2-phenylethyl)pyridin-1-ium Chemical compound [O-][N+]1=CC=CC(CCC=2C=CC=CC=2)=C1 QPDZAAFAAADIRA-UHFFFAOYSA-N 0.000 description 1
- NIJWAAUHTPDGOM-UHFFFAOYSA-N 2-(2-phenylethyl)pyridine Chemical compound C=1C=CC=CC=1CCC1=CC=CC=N1 NIJWAAUHTPDGOM-UHFFFAOYSA-N 0.000 description 1
- LGJWRMLKCCVIBL-UHFFFAOYSA-N 2-bromo-3-(2-phenylethyl)pyridine Chemical compound BrC1=NC=CC=C1CCC1=CC=CC=C1 LGJWRMLKCCVIBL-UHFFFAOYSA-N 0.000 description 1
- WMKYKQWKLILFBM-UHFFFAOYSA-N 2h-pyridine-1-carboxylic acid Chemical class OC(=O)N1CC=CC=C1 WMKYKQWKLILFBM-UHFFFAOYSA-N 0.000 description 1
- SWHRHZCHAQSEHY-UHFFFAOYSA-N 3-(2-phenylethenyl)pyridine-2-carboxylic acid Chemical compound OC(=O)C1=NC=CC=C1C=CC1=CC=CC=C1 SWHRHZCHAQSEHY-UHFFFAOYSA-N 0.000 description 1
- AGIAYOIJHFTOSV-UHFFFAOYSA-N 3-(2-phenylethyl)-1h-pyridin-2-one Chemical compound O=C1NC=CC=C1CCC1=CC=CC=C1 AGIAYOIJHFTOSV-UHFFFAOYSA-N 0.000 description 1
- KERIVOPTFMHQMZ-UHFFFAOYSA-N 3-(2-phenylethyl)pyridin-4-amine hydrochloride Chemical compound Cl.C1(=CC=CC=C1)CCC=1C=NC=CC1N KERIVOPTFMHQMZ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MRHMJGLJPOGNFH-UHFFFAOYSA-N 3-oxo-2-phenyl-3-pyridin-3-ylpropanenitrile Chemical compound C=1C=CN=CC=1C(=O)C(C#N)C1=CC=CC=C1 MRHMJGLJPOGNFH-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- PSHZPPBCBVTVAC-UHFFFAOYSA-N 5,6-dihydrobenzo[1,2]cyclohepta[3,4-a]pyridin-11-one Chemical compound C1CC2=CC=NC=C2C(=O)C2=CC=CC=C21 PSHZPPBCBVTVAC-UHFFFAOYSA-N 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- VSXAGIHWDDTIQP-UHFFFAOYSA-N 6,11-dihydro-5h-benzo[1,2]cyclohepta[3,4-b]pyridine Chemical compound C1CC2=CC=CN=C2CC2=CC=CC=C12 VSXAGIHWDDTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 101000856746 Bos taurus Cytochrome c oxidase subunit 7A1, mitochondrial Proteins 0.000 description 1
- 241000282461 Canis lupus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000006898 Intramolecular Friedel-Crafts reaction Methods 0.000 description 1
- 101100062121 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) cyc-1 gene Proteins 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 description 1
- RMPCPFLMKUEWKH-UHFFFAOYSA-N [3-(2-phenylethyl)pyridin-2-yl] acetate Chemical compound C(C)(=O)OC1=NC=CC=C1CCC1=CC=CC=C1 RMPCPFLMKUEWKH-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000007605 air drying Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 229930007927 cymene Natural products 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- 150000008508 dibenzocycloheptenes Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- SWGLFOANRWDGLW-UHFFFAOYSA-N ethyl 4-(2-phenylethenyl)pyridine-3-carboxylate Chemical compound CCOC(=O)C1=CN=CC=C1C=CC1=CC=CC=C1 SWGLFOANRWDGLW-UHFFFAOYSA-N 0.000 description 1
- 229940064982 ethylnicotinate Drugs 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- HFPZCAJZSCWRBC-UHFFFAOYSA-N p-cymene Chemical compound CC(C)C1=CC=C(C)C=C1 HFPZCAJZSCWRBC-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000012144 step-by-step procedure Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Landscapes
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
NO16769367A NO134157C (en:Method) | 1963-04-24 | 1967-04-12 |
Applications Claiming Priority (7)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US27523763A | 1963-04-24 | 1963-04-24 | |
US330263A US3326924A (en) | 1963-04-24 | 1963-12-13 | Novel aza-dibenzo[a, d]-cycloheptene derivatives |
US330244A US3366635A (en) | 1963-04-24 | 1963-12-13 | Aza-5h-dibenzo-[a,d]-(cycloheptenes and cycloheptene-5-ones) and the corresponding 10, 11-dihydro derivatives thereof |
NO152953A NO120935B (en:Method) | 1963-04-24 | 1964-04-23 | |
US42010164A | 1964-12-21 | 1964-12-21 | |
US580169A US3357986A (en) | 1963-04-24 | 1966-09-19 | 1, 2, 3 or 4, aza,-[5-piperdyl or hydrocarbyl amino]-10, 11 dihydro-5h-dibenzo-[a, d]-cycloheptene |
NO16769367A NO134157C (en:Method) | 1963-04-24 | 1967-04-12 |
Publications (2)
Publication Number | Publication Date |
---|---|
NO134157B true NO134157B (en:Method) | 1976-05-18 |
NO134157C NO134157C (en:Method) | 1976-08-25 |
Family
ID=27567207
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO16769367A NO134157C (en:Method) | 1963-04-24 | 1967-04-12 |
Country Status (1)
Country | Link |
---|---|
NO (1) | NO134157C (en:Method) |
-
1967
- 1967-04-12 NO NO16769367A patent/NO134157C/no unknown
Also Published As
Publication number | Publication date |
---|---|
NO134157C (en:Method) | 1976-08-25 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO167693B (no) | System for syklisk avbrytelse av driften av en anordning mellom en foerste tilstand og en andre tilstand. | |
NO120935B (en:Method) | ||
NO845228L (no) | Kinolinforbindelser. | |
NO136150B (no) | Analogifremgangsm}te til fremstilling av terapeutisk aktive pyridyl- eller piperidinsubstituerte 1,4-dihydro-4-okso-3-kinolinkarboksylsyre-estere. | |
EP0311010B1 (en) | Alpha,Alpha-disubstituted aromatics and heteroaromatics as cognition enhancers | |
US3484445A (en) | Derivatives of chromone-2-carboxylic acid | |
US3717647A (en) | Alpha-nicotinoyl phenylacetonitriles | |
Villani et al. | Benzopyranopyridine derivatives. 1. Aminoalkyl derivatives of the azaxanthenes as bronchodilating agents | |
Haas et al. | The synthesis of pyridine derivatives from 3‐formylchromone | |
Calhoun et al. | Synthesis and antiinflammatory activity of certain 5, 6, 7, 8-tetrahydroquinolines and related compounds | |
NO840557L (no) | Kinolonkarboksylsyrer, fremgangsmaate til deres fremstilling samt antibakterielle midler som inneholder disse | |
DK169104B1 (da) | Analogifremgangsmåde til fremstilling af N-substituerede 2-pyridylindoler eller salte deraf | |
US3419565A (en) | Aza-dibenzocycloheptenes | |
Dalton et al. | Synthesis of pyridocarbazoles for anti-tumour studies | |
Brown | Syntheses and decarboxylation of the isomeric nitropyridinecarboxylic acids | |
AU654140B2 (en) | N-benzyl indoles, processes for their preparation or pharmaceutical compositions containing them | |
NO134157B (en:Method) | ||
NO144110B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 5:6-benzo-4-pyron-derivater | |
JPWO2003002539A1 (ja) | ジベンゾシクロヘプテン化合物 | |
Carabateas et al. | 1‐Ethyl‐1, 4‐dihydro‐4‐oxo‐7‐(pyridinyl)‐3‐quinolinecarboxylic acids. I. Synthesis of 3‐and 4‐(3‐aminophenyl) pyridine intermediates | |
US3301863A (en) | Amino derivatives of phenethylpyridines | |
EP1064265B1 (en) | Synthesis of 3-amino-2-chloro-4-methylpyridine from malononitrile and acetone | |
NO157578B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive imidazo(1,2-a)kinolinderivater | |
NO161067B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive (1h-tetrazol-5-yl)-tetrazol(1,5-a)-kinoliner og (1h-tetrazol-5-yl)-tetrazol(1,5-a)(1,8)naftyridiner. | |
AT256107B (de) | Verfahren zur Herstellung von neuen Aza-dibenzo-cycloheptenderivaten |