NO130397B - - Google Patents
Download PDFInfo
- Publication number
- NO130397B NO130397B NO01022/69A NO102269A NO130397B NO 130397 B NO130397 B NO 130397B NO 01022/69 A NO01022/69 A NO 01022/69A NO 102269 A NO102269 A NO 102269A NO 130397 B NO130397 B NO 130397B
- Authority
- NO
- Norway
- Prior art keywords
- product
- reaction
- reaction mixture
- diamine
- yield
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 34
- 239000011541 reaction mixture Substances 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 235000011007 phosphoric acid Nutrition 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 15
- 150000004985 diamines Chemical class 0.000 claims description 11
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 150000001412 amines Chemical class 0.000 claims description 6
- 229910052717 sulfur Inorganic materials 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- NDKJATAIMQKTPM-UHFFFAOYSA-N 2,3-dimethylbenzenethiol Chemical compound CC1=CC=CC(S)=C1C NDKJATAIMQKTPM-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000003464 sulfur compounds Chemical class 0.000 claims description 3
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical group CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000006839 xylylene group Chemical group 0.000 claims description 2
- 239000000047 product Substances 0.000 description 34
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 238000002474 experimental method Methods 0.000 description 21
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 16
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 13
- 239000002904 solvent Substances 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- -1 diamine compound Chemical class 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- WNYIBZHOMJZDKN-UHFFFAOYSA-N n-(2-acetamidoethyl)acetamide Chemical compound CC(=O)NCCNC(C)=O WNYIBZHOMJZDKN-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229950000688 phenothiazine Drugs 0.000 description 3
- 230000007306 turnover Effects 0.000 description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 238000010923 batch production Methods 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- KVEDKKLZCJBVNP-UHFFFAOYSA-N n-(4-acetamidophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(NC(C)=O)C=C1 KVEDKKLZCJBVNP-UHFFFAOYSA-N 0.000 description 2
- 150000002927 oxygen compounds Chemical class 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- JTPNRXUCIXHOKM-UHFFFAOYSA-N 1-chloronaphthalene Chemical class C1=CC=C2C(Cl)=CC=CC2=C1 JTPNRXUCIXHOKM-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWWVAXIEGOYWEE-UHFFFAOYSA-N Isophenergan Chemical compound C1=CC=C2N(CC(C)N(C)C)C3=CC=CC=C3SC2=C1 PWWVAXIEGOYWEE-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003990 capacitor Substances 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- IFQUWYZCAGRUJN-UHFFFAOYSA-N ethylenediaminediacetic acid Chemical compound OC(=O)CNCCNCC(O)=O IFQUWYZCAGRUJN-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- RTWNYYOXLSILQN-UHFFFAOYSA-N methanediamine Chemical compound NCN RTWNYYOXLSILQN-UHFFFAOYSA-N 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- RRSCVDMNAXVDSV-UHFFFAOYSA-N n-(acetamidomethyl)acetamide Chemical compound CC(=O)NCNC(C)=O RRSCVDMNAXVDSV-UHFFFAOYSA-N 0.000 description 1
- HRSYISMFWLVXAQ-UHFFFAOYSA-N n-[2-(diacetylamino)ethyl]acetamide Chemical compound CC(=O)NCCN(C(C)=O)C(C)=O HRSYISMFWLVXAQ-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical class [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 238000009489 vacuum treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/90—Carboxylic acid amides having nitrogen atoms of carboxamide groups further acylated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71259768A | 1968-03-13 | 1968-03-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO130397B true NO130397B (de) | 1974-08-26 |
Family
ID=24862797
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO01022/69A NO130397B (de) | 1968-03-13 | 1969-03-12 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3539629A (de) |
| BE (1) | BE729185A (de) |
| CH (1) | CH509269A (de) |
| DE (1) | DE1910300A1 (de) |
| ES (1) | ES364754A1 (de) |
| FR (1) | FR2003753A1 (de) |
| GB (1) | GB1216294A (de) |
| NL (1) | NL146487B (de) |
| NO (1) | NO130397B (de) |
| SE (1) | SE363626B (de) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3888894A (en) * | 1972-10-02 | 1975-06-10 | Sun Research Development | Tertiary diamides |
| US3886212A (en) * | 1973-02-19 | 1975-05-27 | Wacker Chemie Gmbh | Process for preparing N,N,N{40 ,N{40 -tetraacetyl compounds |
| US4144225A (en) * | 1975-08-18 | 1979-03-13 | Kanebo, Ltd. | Novel aromatic diamine compounds and flame-resistant polyamide compositions containing said compounds |
| DE2960395D1 (en) * | 1978-04-14 | 1981-09-17 | Hoechst Ag | Process for preparing n,n,n',n'-tetra-acetylethylene diamine |
| DE2828765A1 (de) * | 1978-06-30 | 1980-01-10 | Hoechst Ag | Verfahren zur herstellung von n,n'-diacetylethylendiamin |
| US4676915A (en) * | 1985-03-27 | 1987-06-30 | Colgate-Palmolive Company | Antistatic composition and detergent compositions containing antistatic components |
| DK156052C (da) * | 1987-02-11 | 1989-11-06 | Cheminova As | Fremgangsmaade til fremstilling af n,n,n',n'-tetraacetylethylendiamin |
| WO2013171492A1 (en) | 2012-05-18 | 2013-11-21 | Warwick International Group Limited | Activation of peroxygen bleach |
| WO2019204184A1 (en) * | 2018-04-16 | 2019-10-24 | Dow Global Technologies Llc | Tetraacetyldiamine and triacetyldiamine derivatives useful as bleach activators |
| FR3109355B3 (fr) | 2020-04-15 | 2022-03-25 | Psa Automobiles Sa | Traverse supérieure de bloc avant pour véhicule automobile |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES257803A1 (es) * | 1959-06-06 | 1960-11-01 | Konink Ind Mij Voorheen Noury | Un procedimiento para preparar un agente de lavado y o de blanqueo |
-
1968
- 1968-03-13 US US712597A patent/US3539629A/en not_active Expired - Lifetime
-
1969
- 1969-02-27 FR FR6905227A patent/FR2003753A1/fr not_active Withdrawn
- 1969-02-28 BE BE729185D patent/BE729185A/xx unknown
- 1969-02-28 DE DE19691910300 patent/DE1910300A1/de not_active Withdrawn
- 1969-03-11 CH CH365769A patent/CH509269A/de not_active IP Right Cessation
- 1969-03-11 GB GB02809/69A patent/GB1216294A/en not_active Expired
- 1969-03-12 NL NL696903845A patent/NL146487B/xx unknown
- 1969-03-12 NO NO01022/69A patent/NO130397B/no unknown
- 1969-03-13 SE SE03502/69A patent/SE363626B/xx unknown
- 1969-03-13 ES ES364754A patent/ES364754A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1910300A1 (de) | 1969-09-18 |
| NL6903845A (de) | 1969-09-16 |
| ES364754A1 (es) | 1971-01-01 |
| GB1216294A (en) | 1970-12-16 |
| SE363626B (de) | 1974-01-28 |
| BE729185A (de) | 1969-08-01 |
| NL146487B (nl) | 1975-07-15 |
| CH509269A (de) | 1971-06-30 |
| FR2003753A1 (de) | 1969-11-14 |
| US3539629A (en) | 1970-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO130397B (de) | ||
| SU608476A3 (ru) | Способ получени 5-или-6замещенных бензоксазолкарбоновых кислот | |
| SK280544B6 (sk) | Spôsob prípravy kreatínu alebo monohydrátu kreatín | |
| NO314257B1 (no) | Fremgangsmåte ved fremstilling av en halogen-substituert aromatisk syre | |
| US20040171872A1 (en) | Purification of 2-nitro-4-methylsuphonyblenzoic acid | |
| US3824286A (en) | Preparation of polyacetylalkylene diamines | |
| JPS6233223B2 (de) | ||
| US4317916A (en) | Process for producing N-substituted-N-acetyl-2,6-dialkyl-anilines | |
| US5756757A (en) | Process for the preparation of 3-hydroxy-N-benzimidazolon-5-yl-2-naphthamide in the high purity required of azo pigments | |
| CN109836344B (zh) | 一种有机溶剂生产甘氨酸的方法 | |
| RU2323207C1 (ru) | Способ получения хлорзамещенных аминоанилидов ароматических карбоновых кислот | |
| US4332727A (en) | Preparation of 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-3-indolylacetoxyacetic acid | |
| US4454345A (en) | Process for preparing 2,5-dichloro-3-nitrobenzoic acid | |
| SU368231A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ АЦЕТАТОВ ВТОРИЧНЫХ а-ОКСИАЛКИЛПЕРЕКИСЕЙ | |
| EP0190524B1 (de) | Industrielles Verfahren zur Synthese von N-[(1'-allyl-2'-pyrrolidinyl)methyl]-2-methoxy-4,5-azimidobenzamid | |
| US3176024A (en) | Preparation of chloro-phthalanes | |
| US3427306A (en) | Process for the manufacture of n-(5 - nitro - 2 - furfuryliden) - 1 - amino-hydantoin | |
| SU457698A1 (ru) | Способ получени производных индолил-2-уксусной кислоты | |
| SU1761741A1 (ru) | Способ получени @ -хлораллилового спирта | |
| RU2234492C1 (ru) | Способ получения 2,3,4-триметоксибензальдегида | |
| SU429585A3 (ru) | СПОСОБ ПОЛУЧЕНИЯ ЗАМЕЩЕННОГО а-НАФТОКСИАЦЕТАМИДА | |
| SU1077883A1 (ru) | Способ получени @ -хлорэтилсульфохлорида | |
| SU468913A1 (ru) | Способ выделени комплексонов | |
| SU389085A1 (ru) | ::;С&:СО;ОЗНАЯ ., ,- -:,vv:--( •( -••f">&f"r'~',i!iQ | |
| FR2519977A1 (fr) | Procede de preparation de chloroacetanilides substitues |