NO126325B - - Google Patents
Download PDFInfo
- Publication number
- NO126325B NO126325B NO436869A NO436869A NO126325B NO 126325 B NO126325 B NO 126325B NO 436869 A NO436869 A NO 436869A NO 436869 A NO436869 A NO 436869A NO 126325 B NO126325 B NO 126325B
- Authority
- NO
- Norway
- Prior art keywords
- parts
- benzodiazepine
- phenyl
- mixture
- chloro
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 150000001204 N-oxides Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 132
- 239000000203 mixture Substances 0.000 description 125
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 111
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- 239000002904 solvent Substances 0.000 description 67
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- 239000000047 product Substances 0.000 description 58
- 239000013078 crystal Substances 0.000 description 57
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 54
- 238000001953 recrystallisation Methods 0.000 description 49
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 44
- 238000002844 melting Methods 0.000 description 43
- 230000008018 melting Effects 0.000 description 43
- 239000000243 solution Substances 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 34
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 34
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 229920006395 saturated elastomer Polymers 0.000 description 27
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 26
- 229910052938 sodium sulfate Inorganic materials 0.000 description 26
- 235000011152 sodium sulphate Nutrition 0.000 description 26
- 238000000921 elemental analysis Methods 0.000 description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 229940049706 benzodiazepine Drugs 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 238000001704 evaporation Methods 0.000 description 23
- 230000008020 evaporation Effects 0.000 description 22
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 22
- 235000017557 sodium bicarbonate Nutrition 0.000 description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 19
- 239000007864 aqueous solution Substances 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 239000000725 suspension Substances 0.000 description 16
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 16
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 15
- 238000004458 analytical method Methods 0.000 description 15
- 238000000354 decomposition reaction Methods 0.000 description 15
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 15
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 15
- GWSXDWFXNVOIIC-UHFFFAOYSA-N (7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound N=1CC(NN)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 GWSXDWFXNVOIIC-UHFFFAOYSA-N 0.000 description 12
- 150000001557 benzodiazepines Chemical class 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 12
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 10
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 9
- HDQYKTQKHDIKRF-UHFFFAOYSA-N 1,2-benzodiazepin-2-ylhydrazine Chemical class NNN1C=CC=C2C=CC=CC2=N1 HDQYKTQKHDIKRF-UHFFFAOYSA-N 0.000 description 9
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- IEGKHNXXLDCDTE-UHFFFAOYSA-N 1,2-benzodiazepin-2-amine Chemical compound NN1C=CC=C2C=CC=CC2=N1 IEGKHNXXLDCDTE-UHFFFAOYSA-N 0.000 description 8
- QQUIWIVTEWQHKA-UHFFFAOYSA-N 3h-1,4-benzodiazepine Chemical compound C1=NCC=NC2=CC=CC=C21 QQUIWIVTEWQHKA-UHFFFAOYSA-N 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 238000005245 sintering Methods 0.000 description 6
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 5
- 150000001735 carboxylic acids Chemical class 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 125000004430 oxygen atom Chemical group O* 0.000 description 5
- 229920000137 polyphosphoric acid Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- -1 N-oxide carboxylic acids Chemical class 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 150000001409 amidines Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical compound N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- JHUJQKISBNFOSL-UHFFFAOYSA-N [5-phenyl-7-(trifluoromethyl)-3h-1,4-benzodiazepin-2-yl]hydrazine Chemical compound N=1CC(NN)=NC2=CC=C(C(F)(F)F)C=C2C=1C1=CC=CC=C1 JHUJQKISBNFOSL-UHFFFAOYSA-N 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- QUXOOPXHOIPUOJ-UHFFFAOYSA-N n'-(7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)-2-phenylacetohydrazide Chemical compound C12=CC(Cl)=CC=C2N=C(NNC(=O)CC=2C=CC=CC=2)CN=C1C1=CC=CC=C1 QUXOOPXHOIPUOJ-UHFFFAOYSA-N 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- WULCMEBFNHGYFB-UHFFFAOYSA-N (5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound N=1CC(NN)=NC2=CC=CC=C2C=1C1=CC=CC=C1 WULCMEBFNHGYFB-UHFFFAOYSA-N 0.000 description 2
- ZGBRDDCNIPCLMZ-UHFFFAOYSA-N (7-nitro-5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound N=1CC(NN)=NC2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1 ZGBRDDCNIPCLMZ-UHFFFAOYSA-N 0.000 description 2
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 2
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 2
- YZPNFYQRPJKWFJ-UHFFFAOYSA-N 2-methyl-1h-imidazol-1-ium;chloride Chemical compound Cl.CC1=NC=CN1 YZPNFYQRPJKWFJ-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- UMBZDAJGYNJMGS-UHFFFAOYSA-N 7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-amine Chemical compound N=1CC(N)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 UMBZDAJGYNJMGS-UHFFFAOYSA-N 0.000 description 2
- OKSINCZQDWSATA-UHFFFAOYSA-N 7-nitro-5-phenyl-3h-1,4-benzodiazepin-2-amine Chemical compound N=1CC(N)=NC2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1 OKSINCZQDWSATA-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CWFCXHIENFOUBG-UHFFFAOYSA-N [7-chloro-3-(2-methylpropyl)-5-phenyl-3h-1,4-benzodiazepin-2-yl]hydrazine Chemical compound C12=CC(Cl)=CC=C2N=C(NN)C(CC(C)C)N=C1C1=CC=CC=C1 CWFCXHIENFOUBG-UHFFFAOYSA-N 0.000 description 2
- GQZZWGZHSUQJNS-UHFFFAOYSA-N [7-chloro-5-(4-methoxyphenyl)-3h-1,4-benzodiazepin-2-yl]hydrazine Chemical compound C1=CC(OC)=CC=C1C1=NCC(NN)=NC2=CC=C(Cl)C=C12 GQZZWGZHSUQJNS-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000005187 foaming Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000002463 imidates Chemical class 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- KQQZXSHUXDNCNR-UHFFFAOYSA-N n'-(7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)benzohydrazide Chemical compound C12=CC(Cl)=CC=C2N=C(NNC(=O)C=2C=CC=CC=2)CN=C1C1=CC=CC=C1 KQQZXSHUXDNCNR-UHFFFAOYSA-N 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N propionic acid ethyl ester Natural products CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- PFSDGBIQNXXNAL-UHFFFAOYSA-N (7-methoxy-5-phenyl-1h-1,3-benzodiazepin-2-yl)hydrazine Chemical compound C12=CC(OC)=CC=C2N=C(NN)NC=C1C1=CC=CC=C1 PFSDGBIQNXXNAL-UHFFFAOYSA-N 0.000 description 1
- POHMYKULDYBSMB-UHFFFAOYSA-N (7-methoxy-5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound C12=CC(OC)=CC=C2N=C(NN)CN=C1C1=CC=CC=C1 POHMYKULDYBSMB-UHFFFAOYSA-N 0.000 description 1
- WCMAUNJFJLYSRI-UHFFFAOYSA-N (7-methyl-5-phenyl-3h-1,4-benzodiazepin-2-yl)hydrazine Chemical compound C12=CC(C)=CC=C2N=C(NN)CN=C1C1=CC=CC=C1 WCMAUNJFJLYSRI-UHFFFAOYSA-N 0.000 description 1
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 description 1
- FWEBLHYEGFAQCZ-UHFFFAOYSA-N 2-[(2-aminophenyl)methylideneamino]-2-phenylacetonitrile Chemical class NC1=C(C=NC(C#N)C2=CC=CC=C2)C=CC=C1 FWEBLHYEGFAQCZ-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- DBFLXAXACNTBEP-UHFFFAOYSA-N 5-phenyl-3h-1,4-benzodiazepine Chemical compound N=1CC=NC2=CC=CC=C2C=1C1=CC=CC=C1 DBFLXAXACNTBEP-UHFFFAOYSA-N 0.000 description 1
- GAISEDVHTOHOCO-UHFFFAOYSA-N 5-phenyl-7-(trifluoromethyl)-3h-1,4-benzodiazepin-2-amine Chemical compound N=1CC(N)=NC2=CC=C(C(F)(F)F)C=C2C=1C1=CC=CC=C1 GAISEDVHTOHOCO-UHFFFAOYSA-N 0.000 description 1
- YOHJKBKLWJAEHF-UHFFFAOYSA-N 7-chloro-2-methylsulfanyl-5-phenyl-3h-1,4-benzodiazepine Chemical compound N=1CC(SC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 YOHJKBKLWJAEHF-UHFFFAOYSA-N 0.000 description 1
- QXNZVHPJLBVBBO-UHFFFAOYSA-N 7-chloro-3-(2-methylpropyl)-2-methylsulfanyl-5-phenyl-3h-1,4-benzodiazepine Chemical compound N=1C(CC(C)C)C(SC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 QXNZVHPJLBVBBO-UHFFFAOYSA-N 0.000 description 1
- YMFQQGSCYMGATB-UHFFFAOYSA-N 7-chloro-3-(2-methylpropyl)-5-phenyl-3h-1,4-benzodiazepin-2-amine Chemical compound C12=CC(Cl)=CC=C2N=C(N)C(CC(C)C)N=C1C1=CC=CC=C1 YMFQQGSCYMGATB-UHFFFAOYSA-N 0.000 description 1
- FZKNTBXBZONMAY-UHFFFAOYSA-N 7-chloro-5-(4-methoxyphenyl)-3h-1,4-benzodiazepin-2-amine Chemical compound C1=CC(OC)=CC=C1C1=NCC(N)=NC2=CC=C(Cl)C=C12 FZKNTBXBZONMAY-UHFFFAOYSA-N 0.000 description 1
- ULILTJWAJZIROM-UHFFFAOYSA-N 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepine-2-thione Chemical compound C12=CC(Cl)=CC=C2NC(=S)CN=C1C1=CC=CC=C1 ULILTJWAJZIROM-UHFFFAOYSA-N 0.000 description 1
- TVPIWCSCVOUSLA-UHFFFAOYSA-N 7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-amine;dihydrochloride Chemical compound Cl.Cl.N=1CC(N)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 TVPIWCSCVOUSLA-UHFFFAOYSA-N 0.000 description 1
- CKLBCCMYEQGUCZ-UHFFFAOYSA-N 7-methyl-5-phenyl-3h-1,4-benzodiazepin-2-amine Chemical compound C12=CC(C)=CC=C2N=C(N)CN=C1C1=CC=CC=C1 CKLBCCMYEQGUCZ-UHFFFAOYSA-N 0.000 description 1
- KJPSCZRQFVSAFQ-UHFFFAOYSA-N 8-chloro-1,6-diphenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C=1C(Cl)=CC=C(N23)C=1C(C=1C=CC=CC=1)=NCC3=NN=C2C1=CC=CC=C1 KJPSCZRQFVSAFQ-UHFFFAOYSA-N 0.000 description 1
- CMYYGJIURHQLIG-UHFFFAOYSA-N 8-chloro-6-(4-methoxyphenyl)-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C1=CC(OC)=CC=C1C1=NCC2=NN=CN2C2=CC=C(Cl)C=C12 CMYYGJIURHQLIG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 206010021118 Hypotonia Diseases 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- CDCHDCWJMGXXRH-UHFFFAOYSA-N estazolam Chemical compound C=1C(Cl)=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1 CDCHDCWJMGXXRH-UHFFFAOYSA-N 0.000 description 1
- MODZVIMSNXSQIH-UHFFFAOYSA-N ethyl benzenecarboximidate;hydron;chloride Chemical compound Cl.CCOC(=N)C1=CC=CC=C1 MODZVIMSNXSQIH-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000012768 molten material Substances 0.000 description 1
- 230000036640 muscle relaxation Effects 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- RIYMFZCORTVORQ-UHFFFAOYSA-N n'-(7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)acetohydrazide Chemical compound N=1CC(NNC(=O)C)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 RIYMFZCORTVORQ-UHFFFAOYSA-N 0.000 description 1
- BAHBJBUUVMGWBD-UHFFFAOYSA-N n'-(7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)propanehydrazide Chemical compound N=1CC(NNC(=O)CC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 BAHBJBUUVMGWBD-UHFFFAOYSA-N 0.000 description 1
- GRAZLATXVZRMNL-UHFFFAOYSA-N n'-[(7-chloro-5-phenyl-3h-1,4-benzodiazepin-2-yl)amino]ethanimidamide Chemical compound N=1CC(NN=C(N)C)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 GRAZLATXVZRMNL-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/20—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO423471A NO133895C (ja) | 1968-11-05 | 1971-11-16 |
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8081368 | 1968-11-05 | ||
| JP9292968A JPS4843754B1 (ja) | 1968-12-17 | 1968-12-17 | |
| JP9293168 | 1968-12-17 | ||
| JP9293068 | 1968-12-17 | ||
| JP9292868 | 1968-12-17 | ||
| JP9518768A JPS4916436B1 (ja) | 1968-12-25 | 1968-12-25 | |
| JP1070269A JPS4920596B1 (ja) | 1969-02-13 | 1969-02-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126325B true NO126325B (ja) | 1973-01-22 |
Family
ID=27563558
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO436869A NO126325B (ja) | 1968-11-05 | 1969-11-04 |
Country Status (8)
| Country | Link |
|---|---|
| CH (1) | CH532065A (ja) |
| DK (1) | DK145577C (ja) |
| FI (1) | FI50981C (ja) |
| MY (1) | MY7600024A (ja) |
| NL (1) | NL157601C (ja) |
| NO (1) | NO126325B (ja) |
| PH (1) | PH9315A (ja) |
| YU (1) | YU36178B (ja) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE758921A (fr) * | 1969-11-15 | 1971-04-16 | Takeda Chemical Industries Ltd | Derives de benzodiazepine |
| BE759099A (fr) * | 1969-11-18 | 1971-04-30 | Takeda Chemical Industries Ltd | Procede de fabrication de composes heterocycliques |
| JPS494470B1 (ja) * | 1970-08-26 | 1974-02-01 | ||
| JPS4932874B1 (ja) * | 1970-12-11 | 1974-09-03 | ||
| US4250094A (en) * | 1971-04-28 | 1981-02-10 | The Upjohn Company | 1-(Aminoalkyl) substituted-6-phenyl-4H-s-triazolo[4,3-a][1,4]benzodiazepines |
| US4141902A (en) * | 1971-04-28 | 1979-02-27 | The Upjohn Company | 1-Halomethyl-6-phenyl-4H-s-[4,3-a][1,4]benzodiazepines |
| US4902794A (en) * | 1971-04-28 | 1990-02-20 | The Upjohn Company | Triazolo-benzodiazepines |
| US3856802A (en) * | 1971-05-10 | 1974-12-24 | Upjohn Co | 1,6-DISUBSTITUTED-4H-5-{8 4,3-a{9 BENZODIAZEPINES |
| US3870793A (en) * | 1971-08-09 | 1975-03-11 | Upjohn Co | Animal feed and process |
| DE2356369C2 (de) * | 1972-11-24 | 1984-08-23 | The Upjohn Co., Kalamazoo, Mich. | Pharmazeutisches Präparat, enthaltend eine oder mehrere Benzodiazepinverbindungen |
| US3864328A (en) * | 1973-10-19 | 1975-02-04 | Hoffmann La Roche | 2-hydrazino benzodiazepine derivatives |
| JPS5747916B2 (ja) | 1974-05-13 | 1982-10-13 | ||
| US4018788A (en) * | 1975-06-16 | 1977-04-19 | The Upjohn Company | 6-(O-Halophenyl)-1-methyl-4H-s-triazolo[4,3-a][1,4]-benzodiazepine |
-
1969
- 1969-10-31 FI FI313769A patent/FI50981C/fi active
- 1969-10-31 PH PH10872*UA patent/PH9315A/en unknown
- 1969-11-03 NL NL6916543A patent/NL157601C/xx not_active IP Right Cessation
- 1969-11-04 NO NO436869A patent/NO126325B/no unknown
- 1969-11-04 YU YU275369A patent/YU36178B/xx unknown
- 1969-11-05 CH CH1645469A patent/CH532065A/de not_active IP Right Cessation
- 1969-11-05 DK DK583669A patent/DK145577C/da active
-
1976
- 1976-12-30 MY MY7600024A patent/MY7600024A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL157601C (nl) | 1982-04-16 |
| NL157601B (nl) | 1978-08-15 |
| YU275369A (en) | 1981-06-30 |
| CH532065A (de) | 1972-12-31 |
| FI50981B (ja) | 1976-05-31 |
| MY7600024A (en) | 1976-12-31 |
| FI50981C (fi) | 1976-09-10 |
| PH9315A (en) | 1975-08-22 |
| DK145577C (da) | 1983-05-16 |
| DK145577B (da) | 1982-12-13 |
| YU36178B (en) | 1982-02-25 |
| NL6916543A (ja) | 1970-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1252462A (en) | Imidazodiazepine derivatives | |
| US3405122A (en) | Novel 3h-1, 4-benzodiazepin-2-(1h)-ones | |
| NO126325B (ja) | ||
| DE2540522A1 (de) | Diazepin-derivate | |
| MEGURO et al. | Heterocycles. VI. Syntheses of 4H-s-triazolo [4, 3-a][1, 4] benzodiazepines, novel tricyclic psychosedatives | |
| SE437029B (sv) | Analogiforfarande for framstellning av derivat av imidazo/1,5-a//1,4/bensodiazepin | |
| US3818003A (en) | Tricyclic benzodiazepines | |
| NO126085B (ja) | ||
| US3709899A (en) | 6-phenyl-4h-s-triazolo(4,3-a)(1,4)benzodiazepines and their production | |
| JPS5833234B2 (ja) | チエノトリアゾロジアゼピンユウドウタイ ノ セイゾウホウ | |
| MEGURO et al. | Heterocycles. V. Syntheses and Structures of 7-Chloro-2-hydrazino-5-phenyl-3H-1, 4-benzodiazepines and Some Isomeric 1, 4, 5-Benzotriazocines | |
| US3557095A (en) | Pyrazolodiazepinone compounds | |
| Garcia et al. | Synthesis of polycyclic fused [1, 2-a] pyrroles | |
| CA1327571C (en) | Imidazodiazepine derivatives | |
| CA1083146A (en) | Process for the preparation of new benzodiazepine derivatives | |
| US3751426A (en) | 1-substituted-6-phenyl-4h-s-triazolo(4,3-a)(1,6)benzodiazepine compounds | |
| US4141902A (en) | 1-Halomethyl-6-phenyl-4H-s-[4,3-a][1,4]benzodiazepines | |
| US3523947A (en) | 1-cyclic amidine-5-aryl-1,4-benzodiazepine and process | |
| US4116956A (en) | Benzodiazepine derivatives | |
| FI63405B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara imdazo(1,5-a)(1,4)diazepin-foereningar | |
| US4016165A (en) | Triazino benzodiazepines | |
| MXPA97003288A (en) | Oxazolil- and tiazolil imidazo-benzo- and tienodiazepinas and its use as a medicamen | |
| US3850951A (en) | Triazolobenzodiazepine 5n-oxide derivatives | |
| JPS5839682A (ja) | ベンズアゼピン類 | |
| US3741957A (en) | 2-acyl hydrazino benzodiazepines |