NO124687B - - Google Patents
Download PDFInfo
- Publication number
- NO124687B NO124687B NO164964A NO16496466A NO124687B NO 124687 B NO124687 B NO 124687B NO 164964 A NO164964 A NO 164964A NO 16496466 A NO16496466 A NO 16496466A NO 124687 B NO124687 B NO 124687B
- Authority
- NO
- Norway
- Prior art keywords
- group
- formula
- carbon atoms
- compound
- alkyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 9
- -1 chloroformate ester Chemical class 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 231100000252 nontoxic Toxicity 0.000 claims description 7
- 230000003000 nontoxic effect Effects 0.000 claims description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 6
- 239000012458 free base Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 claims description 4
- 229910000102 alkali metal hydride Inorganic materials 0.000 claims description 4
- 150000008046 alkali metal hydrides Chemical class 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000003386 piperidinyl group Chemical group 0.000 claims description 2
- ZEEBGORNQSEQBE-UHFFFAOYSA-N [2-(3-phenylphenoxy)-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound C1(=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F)C1=CC=CC=C1 ZEEBGORNQSEQBE-UHFFFAOYSA-N 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 9
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- VNAFWALXWOAPCK-UHFFFAOYSA-N 1-phenyl-2,3-dihydro-1h-indene Chemical compound C1CC2=CC=CC=C2C1C1=CC=CC=C1 VNAFWALXWOAPCK-UHFFFAOYSA-N 0.000 description 3
- PFBLYDIOJAYTTH-UHFFFAOYSA-N 3,3-dimethyl-1-phenyl-1,2-dihydroindene Chemical compound C12=CC=CC=C2C(C)(C)CC1C1=CC=CC=C1 PFBLYDIOJAYTTH-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- ZMLUHYJUTIZTOJ-UHFFFAOYSA-N 2-dimethylamino-2-methyl-1-chloro-ethane Natural products ClCC(C)N(C)C ZMLUHYJUTIZTOJ-UHFFFAOYSA-N 0.000 description 2
- LXQPBMQYAQDCCG-UHFFFAOYSA-N CN(CCCC1(CCC2=CC=CC=C12)C1=CC(=CC=C1)C(F)(F)F)C Chemical compound CN(CCCC1(CCC2=CC=CC=C12)C1=CC(=CC=C1)C(F)(F)F)C LXQPBMQYAQDCCG-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CGALIQZAWQCSKZ-UHFFFAOYSA-N N,N-dimethyl-3-(1-phenyl-2,3-dihydroinden-1-yl)propan-1-amine Chemical compound CN(CCCC1(CCC2=CC=CC=C12)C1=CC=CC=C1)C CGALIQZAWQCSKZ-UHFFFAOYSA-N 0.000 description 2
- UCTWMZQNUQWSLP-UHFFFAOYSA-N adrenaline Chemical compound CNCC(O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 1
- DSMRTLVQRZJEDV-UHFFFAOYSA-N 1-(4-chlorophenyl)-3,3-dimethyl-1,2-dihydroindene Chemical compound CC1(CC(C2=CC=CC=C12)C1=CC=C(C=C1)Cl)C DSMRTLVQRZJEDV-UHFFFAOYSA-N 0.000 description 1
- YSPDISPRPJFBCV-UHFFFAOYSA-N 1-phenyl-1,2,3,4-tetrahydronaphthalene Chemical compound C12=CC=CC=C2CCCC1C1=CC=CC=C1 YSPDISPRPJFBCV-UHFFFAOYSA-N 0.000 description 1
- RRHNMFYHZDMVFN-UHFFFAOYSA-N 3-(3,3-dimethyl-1-phenyl-2h-inden-1-yl)-n,n-dimethylpropan-1-amine Chemical compound C1C(C)(C)C2=CC=CC=C2C1(CCCN(C)C)C1=CC=CC=C1 RRHNMFYHZDMVFN-UHFFFAOYSA-N 0.000 description 1
- QLHYVFSGYNVMPW-UHFFFAOYSA-N 3-chloro-n-methylpropan-1-amine Chemical compound CNCCCCl QLHYVFSGYNVMPW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000001078 anti-cholinergic effect Effects 0.000 description 1
- 230000000891 anti-reserpine Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 1
- 229940075557 diethylene glycol monoethyl ether Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002468 indanes Chemical class 0.000 description 1
- 150000002469 indenes Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- YDTRMVVEPYEADI-UHFFFAOYSA-N n,n-dimethyl-3-(1-phenyl-3,4-dihydro-2h-naphthalen-1-yl)propan-1-amine Chemical compound C1CCC2=CC=CC=C2C1(CCCN(C)C)C1=CC=CC=C1 YDTRMVVEPYEADI-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 125000005329 tetralinyl group Chemical class C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 229940124549 vasodilator Drugs 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
- C07D295/027—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring
- C07D295/03—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements containing only one hetero ring with the ring nitrogen atoms directly attached to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB41849/65A GB1139135A (en) | 1965-10-01 | 1965-10-01 | Aminoalkyl-substituted indanes and pharmaceutical compositions containing them |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO124687B true NO124687B (enExample) | 1972-05-23 |
Family
ID=10421631
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164964A NO124687B (enExample) | 1965-10-01 | 1966-09-30 |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US3505404A (enExample) |
| AT (1) | AT272329B (enExample) |
| BE (1) | BE687628A (enExample) |
| CA (1) | CA921472A (enExample) |
| CH (1) | CH483389A (enExample) |
| DE (1) | DE1568929C3 (enExample) |
| FI (1) | FI48457C (enExample) |
| FR (2) | FR6227M (enExample) |
| GB (1) | GB1139135A (enExample) |
| NO (1) | NO124687B (enExample) |
| SE (1) | SE350484B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE371190B (enExample) * | 1972-03-24 | 1974-11-11 | Kabi Ab | |
| US3931196A (en) * | 1972-02-28 | 1976-01-06 | Monash University | Phosphinolines and phosphindolines |
| FR2201882B1 (enExample) * | 1972-07-20 | 1975-10-31 | Logeais Labor Jacques | |
| JPS5623982B2 (enExample) * | 1972-12-07 | 1981-06-03 | ||
| US4192888A (en) * | 1978-04-10 | 1980-03-11 | Smithkline Corporation | Pharmaceutical compositions and method of inhibiting phenylethanolamine N-methyltransferase |
| FR2593501B1 (fr) * | 1986-01-29 | 1988-05-06 | Panmedica Sa | Nouveaux derives bis (r-oxyimino)-5,7 dihydro-6,7 (5h) dibenzo (a,c) cycloheptene, leurs procedes de preparation et leur application comme medicaments |
| DE68906340T2 (de) * | 1988-09-19 | 1993-08-12 | Akzo Nv | Tetrahydronaphthalin und indan-derivate. |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2798888A (en) * | 1952-08-12 | 1957-07-09 | Ciba Pharm Prod Inc | Indene and indane compounds and their production |
| NL282517A (enExample) * | 1961-08-31 | |||
| BE667486A (enExample) * | 1964-07-27 |
-
1965
- 1965-10-01 GB GB41849/65A patent/GB1139135A/en not_active Expired
-
1966
- 1966-09-19 DE DE1568929A patent/DE1568929C3/de not_active Expired
- 1966-09-19 US US580206A patent/US3505404A/en not_active Expired - Lifetime
- 1966-09-21 CA CA970930A patent/CA921472A/en not_active Expired
- 1966-09-22 AT AT891266A patent/AT272329B/de active
- 1966-09-23 CH CH1371966A patent/CH483389A/de not_active IP Right Cessation
- 1966-09-29 FR FR78112A patent/FR6227M/fr not_active Expired
- 1966-09-30 FI FI662575A patent/FI48457C/fi active
- 1966-09-30 NO NO164964A patent/NO124687B/no unknown
- 1966-09-30 BE BE687628D patent/BE687628A/xx unknown
- 1966-10-03 SE SE13276/66A patent/SE350484B/xx unknown
- 1966-12-20 FR FR88171A patent/FR1506708A/fr not_active Expired
-
1970
- 1970-01-14 US US2928A patent/US3621101A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1568929B2 (de) | 1974-07-04 |
| BE687628A (enExample) | 1967-03-01 |
| US3621101A (en) | 1971-11-16 |
| GB1139135A (en) | 1969-01-08 |
| FR6227M (enExample) | 1968-08-05 |
| AT272329B (de) | 1969-07-10 |
| CA921472A (en) | 1973-02-20 |
| CH483389A (de) | 1969-12-31 |
| US3505404A (en) | 1970-04-07 |
| DE1568929C3 (de) | 1975-03-20 |
| SE350484B (enExample) | 1972-10-30 |
| FI48457C (fi) | 1974-10-10 |
| FI48457B (enExample) | 1974-07-01 |
| FR1506708A (fr) | 1967-12-22 |
| DE1568929A1 (de) | 1970-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU764610A3 (ru) | Способ получени производных 2-ароил-3-фенилбензотиофенов или их солей | |
| US5708020A (en) | Arylalkyl(thio)amides | |
| KR100428238B1 (ko) | 약리학적 활성 물질의 제조 방법 | |
| Boekelheide et al. | Reissert Compounds. Further Alkylation Studies and a Novel Rearrangement1 | |
| NO118710B (enExample) | ||
| GB2124210A (en) | Indoles | |
| NO162176B (no) | Middel for bekjempelse av plantesykdommer og anvendelse derav. | |
| SU508199A3 (ru) | Способ получени производных морфолина | |
| SU633471A3 (ru) | Способ получени замещенных трихлорацетамидинов или их солей | |
| NZ219068A (en) | Dihydrobenzofuran- and chromancarboxamide derivatives and neuroleptic compositions | |
| NO142865B (no) | Analogifremgangsmaate ved fremstilling av nye terapeutisk aktive karbazoler | |
| IE47518B1 (en) | Indolo (2,3-a) quinolizidines,preparation and therapeutic use | |
| NO153530B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive substituerte heterocykliske benzamider. | |
| NO124687B (enExample) | ||
| US5401855A (en) | 4-hydroxyphenylthio derivatives, their preparation and their use for the preparation of aminoalkoxyphenylsulphonyl derivatives | |
| US2852520A (en) | Trialkoxybenzoyloxyalkyl derivatives related to norharman | |
| US2554737A (en) | Basically substituted tetrahydroquinoline derivatives | |
| SK282234B6 (sk) | Spôsob výroby n-metyl-3-(1-metyl-4-piperidinyl)-1h-indol-5-etánsulfónamidu a medziprodukt | |
| RU2044737C1 (ru) | Производные 2,3-дигидропирано[2,3-b]пиридина или их соли, способ их получения 2-аминометил-2,3-дигидропирано(2,3-b)пиридина в качестве исходного вещества для получения производных 2,3-дигидропирано[2,3-b]пиридина и способ его получения | |
| NO164964B (no) | Fremgangsmaate for fremstilling av lignocelluloseholdige stoepte sammensatte eller kompositt-produkter. | |
| BARKENBUS et al. | The Beckmann Rearrangement of Some Heterocyclic Ketoximes | |
| Zee et al. | A new process for the synthesis of fentanyl | |
| KR890001241B1 (ko) | 4-아세틸 이소퀴놀리논 화합물의 제조방법 | |
| NO134767B (enExample) | ||
| NO115019B (enExample) |