NO119317B - - Google Patents
Download PDFInfo
- Publication number
- NO119317B NO119317B NO165017A NO16501766A NO119317B NO 119317 B NO119317 B NO 119317B NO 165017 A NO165017 A NO 165017A NO 16501766 A NO16501766 A NO 16501766A NO 119317 B NO119317 B NO 119317B
- Authority
- NO
- Norway
- Prior art keywords
- general formula
- compound
- group
- denotes
- methyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 71
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 13
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- 229910052740 iodine Inorganic materials 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 8
- 239000011630 iodine Substances 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 6
- 125000004442 acylamino group Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- LQZMLBORDGWNPD-UHFFFAOYSA-N N-iodosuccinimide Chemical compound IN1C(=O)CCC1=O LQZMLBORDGWNPD-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 150000007529 inorganic bases Chemical class 0.000 claims description 4
- 230000026045 iodination Effects 0.000 claims description 4
- 238000006192 iodination reaction Methods 0.000 claims description 4
- 150000007530 organic bases Chemical class 0.000 claims description 4
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- CEBJKFDZYQKLBO-UHFFFAOYSA-N O=C(O)C1=C(I)C(CNC(=O)C)=C(I)C(NC(=O)C)=C1I.[K].C1(=CC=C(C=C1)S(=O)(=O)O)C Chemical compound O=C(O)C1=C(I)C(CNC(=O)C)=C(I)C(NC(=O)C)=C1I.[K].C1(=CC=C(C=C1)S(=O)(=O)O)C CEBJKFDZYQKLBO-UHFFFAOYSA-N 0.000 claims description 2
- 238000000297 Sandmeyer reaction Methods 0.000 claims description 2
- 239000003377 acid catalyst Substances 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 230000009615 deamination Effects 0.000 claims description 2
- 238000006481 deamination reaction Methods 0.000 claims description 2
- 239000012954 diazonium Substances 0.000 claims description 2
- 238000006193 diazotization reaction Methods 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical group [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 claims description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 230000032050 esterification Effects 0.000 claims description 2
- 238000005886 esterification reaction Methods 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- UULXSTDDDXOTIY-UHFFFAOYSA-N n-iodoacetamide Chemical compound CC(=O)NI UULXSTDDDXOTIY-UHFFFAOYSA-N 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 238000007127 saponification reaction Methods 0.000 claims description 2
- 229910052727 yttrium Inorganic materials 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000003529 anticholesteremic agent Substances 0.000 claims 1
- 229940127226 anticholesterol agent Drugs 0.000 claims 1
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 101
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 44
- 239000000243 solution Substances 0.000 description 39
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 38
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- -1 alkyl radical Chemical class 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000002844 melting Methods 0.000 description 21
- 230000008018 melting Effects 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- 238000001953 recrystallisation Methods 0.000 description 17
- 238000001816 cooling Methods 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- 239000000203 mixture Substances 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 239000012362 glacial acetic acid Substances 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 241000700159 Rattus Species 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 229940091173 hydantoin Drugs 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 229940034208 thyroxine Drugs 0.000 description 8
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 7
- 125000004494 ethyl ester group Chemical group 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 230000004060 metabolic process Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- CQRBELJPAZUIIW-KRWDZBQOSA-N (2S)-2-amino-2-[[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]methyl]butanoic acid Chemical compound C(C)[C@](N)(CC1=CC(=C(C(=C1)I)OC1=CC=C(C=C1)O)I)C(=O)O CQRBELJPAZUIIW-KRWDZBQOSA-N 0.000 description 3
- HUSVOOUYGVGJGG-INIZCTEOSA-N (2s)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid Chemical compound IC1=CC(C[C@@](N)(C)C(O)=O)=CC(I)=C1OC1=CC=C(O)C=C1 HUSVOOUYGVGJGG-INIZCTEOSA-N 0.000 description 3
- OCAZOCCWHWCEPV-KRWDZBQOSA-N (2s)-2-formamido-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid Chemical compound IC1=CC(C[C@](C)(NC=O)C(O)=O)=CC(I)=C1OC1=CC=C(O)C=C1 OCAZOCCWHWCEPV-KRWDZBQOSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- XUIIKFGFIJCVMT-LBPRGKRZSA-N L-thyroxine Chemical compound IC1=CC(C[C@H]([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-LBPRGKRZSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229950008325 levothyroxine Drugs 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 239000005495 thyroid hormone Substances 0.000 description 3
- 229940036555 thyroid hormone Drugs 0.000 description 3
- 229940035722 triiodothyronine Drugs 0.000 description 3
- 239000000052 vinegar Substances 0.000 description 3
- 235000021419 vinegar Nutrition 0.000 description 3
- MQBNQPWBYRKFKN-INIZCTEOSA-N (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]-2-methylpropanoic acid Chemical compound IC=1C=C(C[C@](N)(C(=O)O)C)C=C(C=1OC1=CC(=C(C=C1)O)I)I MQBNQPWBYRKFKN-INIZCTEOSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 206010003211 Arteriosclerosis coronary artery Diseases 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 208000011775 arteriosclerosis disease Diseases 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- RRKTZKIUPZVBMF-IBTVXLQLSA-N brucine Chemical compound O([C@@H]1[C@H]([C@H]2C3)[C@@H]4N(C(C1)=O)C=1C=C(C(=CC=11)OC)OC)CC=C2CN2[C@@H]3[C@]41CC2 RRKTZKIUPZVBMF-IBTVXLQLSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 229960004424 carbon dioxide Drugs 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 2
- 235000010262 sodium metabisulphite Nutrition 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 210000001685 thyroid gland Anatomy 0.000 description 2
- XUIIKFGFIJCVMT-UHFFFAOYSA-N thyroxine-binding globulin Natural products IC1=CC(CC([NH3+])C([O-])=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-UHFFFAOYSA-N 0.000 description 2
- SROIPITXZMZRRB-HNNXBMFYSA-N (2S)-3-[4-(4-hydroxyphenoxy)phenyl]-2-(methylamino)propanoic acid Chemical compound C1=CC(C[C@H](NC)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 SROIPITXZMZRRB-HNNXBMFYSA-N 0.000 description 1
- JFAXJRJMFOACBO-UHFFFAOYSA-N (4-hydroxyphenyl) benzoate Chemical compound C1=CC(O)=CC=C1OC(=O)C1=CC=CC=C1 JFAXJRJMFOACBO-UHFFFAOYSA-N 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- JAJIUWBRJAQOHS-UHFFFAOYSA-N 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol Chemical compound C=1C=C(O)C=CC=1CC1(C)OCCO1 JAJIUWBRJAQOHS-UHFFFAOYSA-N 0.000 description 1
- VWMVAQHMFFZQGD-UHFFFAOYSA-N 4-hydroxyphenylacetone Chemical compound CC(=O)CC1=CC=C(O)C=C1 VWMVAQHMFFZQGD-UHFFFAOYSA-N 0.000 description 1
- HRAXGVJSADRJIA-UHFFFAOYSA-N 5-ethyl-5-[(4-hydroxy-3,5-dinitrophenyl)methyl]imidazolidine-2,4-dione Chemical compound C=1C([N+]([O-])=O)=C(O)C([N+]([O-])=O)=CC=1CC1(CC)NC(=O)NC1=O HRAXGVJSADRJIA-UHFFFAOYSA-N 0.000 description 1
- IWGAWBQHEVRJFX-UHFFFAOYSA-N 5-ethyl-5-[(4-methoxyphenyl)methyl]imidazolidine-2,4-dione Chemical compound C=1C=C(OC)C=CC=1CC1(CC)NC(=O)NC1=O IWGAWBQHEVRJFX-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- NJFVQDWCZGWPFD-DEOSSOPVSA-N C[C@](CC(C=C1I)=CC(I)=C1OC(C=C1)=CC=C1O)(C(O)=O)NC(OCC1=CC=CC=C1)=O Chemical compound C[C@](CC(C=C1I)=CC(I)=C1OC(C=C1)=CC=C1O)(C(O)=O)NC(OCC1=CC=CC=C1)=O NJFVQDWCZGWPFD-DEOSSOPVSA-N 0.000 description 1
- PJGWWRWMEXHESD-DEOSSOPVSA-N C[C@](CC(C=C1I)=CC(I)=C1OC(C=C1)=CC=C1O)(C(OC)=O)NC(C1=CC=CC=C1)=O Chemical compound C[C@](CC(C=C1I)=CC(I)=C1OC(C=C1)=CC=C1O)(C(OC)=O)NC(C1=CC=CC=C1)=O PJGWWRWMEXHESD-DEOSSOPVSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KKCIOUWDFWQUBT-AWEZNQCLSA-N L-thyronine Chemical class C1=CC(C[C@H](N)C(O)=O)=CC=C1OC1=CC=C(O)C=C1 KKCIOUWDFWQUBT-AWEZNQCLSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- CDXSJGDDABYYJV-UHFFFAOYSA-N acetic acid;ethanol Chemical compound CCO.CC(O)=O CDXSJGDDABYYJV-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000651 anti-goitrogenic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- YDSNSDXMWRVLLI-UHFFFAOYSA-M bis(4-methoxyphenyl)iodanium;bromide Chemical compound [Br-].C1=CC(OC)=CC=C1[I+]C1=CC=C(OC)C=C1 YDSNSDXMWRVLLI-UHFFFAOYSA-M 0.000 description 1
- RRKTZKIUPZVBMF-UHFFFAOYSA-N brucine Natural products C1=2C=C(OC)C(OC)=CC=2N(C(C2)=O)C3C(C4C5)C2OCC=C4CN2C5C31CC2 RRKTZKIUPZVBMF-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- XGWOHCOSKBDDCN-HNNXBMFYSA-N ethyl (2s)-3-[4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-2-(methylamino)propanoate Chemical compound IC1=CC(C[C@@H](C(=O)OCC)NC)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XGWOHCOSKBDDCN-HNNXBMFYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 230000037323 metabolic rate Effects 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- ZEMGGZBWXRYJHK-UHFFFAOYSA-N thiouracil Chemical compound O=C1C=CNC(=S)N1 ZEMGGZBWXRYJHK-UHFFFAOYSA-N 0.000 description 1
- 229950000329 thiouracil Drugs 0.000 description 1
- 230000000929 thyromimetic effect Effects 0.000 description 1
- 230000001897 thyrotoxic effect Effects 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/72—Two oxygen atoms, e.g. hydantoin
- C07D233/76—Two oxygen atoms, e.g. hydantoin with substituted hydrocarbon radicals attached to the third ring carbon atom
- C07D233/78—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC0037070 | 1965-10-07 | ||
| DE19651493567 DE1493567C3 (de) | 1965-10-07 | 1965-10-07 | Ester von alpha-Alkylthyroxinderivaten und Verfahren zu ihrer Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119317B true NO119317B (member.php) | 1970-05-04 |
Family
ID=31947311
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO165017A NO119317B (member.php) | 1965-10-07 | 1966-10-05 |
Country Status (15)
| Country | Link |
|---|---|
| AT (5) | AT282081B (member.php) |
| BE (1) | BE687980A (member.php) |
| BR (1) | BR6683492D0 (member.php) |
| CH (1) | CH471064A (member.php) |
| DK (1) | DK127383B (member.php) |
| FI (1) | FI45188C (member.php) |
| FR (1) | FR1496285A (member.php) |
| GB (1) | GB1112874A (member.php) |
| IL (1) | IL26568A (member.php) |
| NL (1) | NL147133B (member.php) |
| NO (1) | NO119317B (member.php) |
| OA (1) | OA02150A (member.php) |
| SE (1) | SE345259B (member.php) |
| SU (1) | SU374817A3 (member.php) |
| YU (1) | YU34028B (member.php) |
-
1966
- 1966-09-22 FI FI662493A patent/FI45188C/fi active
- 1966-09-23 IL IL26568A patent/IL26568A/xx unknown
- 1966-09-26 AT AT01111/68A patent/AT282081B/de active
- 1966-09-26 AT AT01113/68A patent/AT277481B/de active
- 1966-09-26 AT AT901566A patent/AT270090B/de active
- 1966-09-26 AT AT108968A patent/AT275750B/de active
- 1966-09-29 GB GB43633/66A patent/GB1112874A/en not_active Expired
- 1966-10-03 YU YU1863/66A patent/YU34028B/xx unknown
- 1966-10-04 OA OA52616A patent/OA02150A/xx unknown
- 1966-10-05 SU SU1105855A patent/SU374817A3/ru active
- 1966-10-05 CH CH1433666A patent/CH471064A/de not_active IP Right Cessation
- 1966-10-05 NO NO165017A patent/NO119317B/no unknown
- 1966-10-06 SE SE13497/66A patent/SE345259B/xx unknown
- 1966-10-06 DK DK518966AA patent/DK127383B/da unknown
- 1966-10-07 NL NL666614150A patent/NL147133B/xx unknown
- 1966-10-07 BR BR183492/66A patent/BR6683492D0/pt unknown
- 1966-10-07 BE BE687980D patent/BE687980A/xx unknown
- 1966-10-07 FR FR79226A patent/FR1496285A/fr not_active Expired
-
1968
- 1968-09-26 AT AT111268A patent/AT287927B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL6614150A (member.php) | 1967-04-10 |
| BE687980A (member.php) | 1967-04-07 |
| AT275750B (de) | 1969-11-10 |
| GB1112874A (en) | 1968-05-08 |
| AT277481B (de) | 1969-12-29 |
| AT282081B (de) | 1970-06-10 |
| NL147133B (nl) | 1975-09-15 |
| IL26568A (en) | 1971-02-25 |
| YU186366A (en) | 1978-05-15 |
| AT270090B (de) | 1969-04-10 |
| YU34028B (en) | 1978-10-31 |
| FI45188B (member.php) | 1971-12-31 |
| OA02150A (fr) | 1970-05-05 |
| AT287927B (de) | 1971-02-10 |
| BR6683492D0 (pt) | 1973-12-04 |
| DK127383B (da) | 1973-10-29 |
| FR1496285A (fr) | 1967-09-29 |
| CH471064A (de) | 1969-04-15 |
| FI45188C (fi) | 1972-04-10 |
| SU374817A3 (member.php) | 1973-03-20 |
| SE345259B (member.php) | 1972-05-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO165017B (no) | Fremgangsmaate for stoeping av en isolerende kappe paa en elektrisk isolator. | |
| Davidson et al. | The structure of Meldrum's supposed β-lactonic acid | |
| CS204959B2 (en) | Herbicide means and method of making the active component | |
| US4110470A (en) | Pharmaceutical composition comprising d,l-α-methyl-thyroxine ethyl ester and the salts thereof and the control of cholesterol and triglyceride blood level therewith | |
| US4350822A (en) | Antilipidemicpara-[aryl(alkyl or alkenyl)amino]benzoic acid derivatives | |
| NO157364B (no) | Vekstfremmende forstoff. | |
| US3864385A (en) | New 5-Aminoisophthalic Acid Derivatives, Salts And Esters Thereof And Methods For Their Preparation | |
| US3410891A (en) | Novel thyronine derivatives | |
| NO148673B (no) | Analogifremgangsmaate ved fremstilling av farmakologisk virksomme tiofenderivater | |
| FR2540109A1 (fr) | Imino-2 pyrrolidines, leur procede de preparation et leurs applications en therapeutique | |
| Linstead et al. | 650. Anodic syntheses. Part II. Synthesis of (±)-tuberculostearic acid | |
| US3585214A (en) | Hydroxyl derivatives of coumarine and processes for the preparation thereof | |
| DK147197B (da) | Analogifremgangsmaade til fremstilling af 2-hydrazonopropionsyrederivater | |
| NO119317B (member.php) | ||
| US3132176A (en) | Preparation of o, o-dialkanoyl derivatives of d, l-alpha-alkyl-beta-3, 4-dihydroxyphenylalanine by preferential acylation | |
| US3979402A (en) | Thiazole derivatives | |
| US2524838A (en) | Esters of pyridyl-3-carbinol | |
| US2695902A (en) | 2-methyl-3-(beta-chloroethyl)-4, 6-dichloro pyridine and method of making same | |
| JPH0314818B2 (member.php) | ||
| US3641097A (en) | Preparation of phenylalanine derivatives and novel intermediates | |
| US3890304A (en) | 7{60 -carbam oyl-17-hydroxy-3-oxo-17{60 -pregn-4-ene-21-carboxylic acid {65 -lactone and related compounds | |
| NO138978B (no) | Fremgangsmaate og apparat til strukturbehandling av kjoett, blandinger av kjoett og/eller kjoettavfall eller innmat og/eller ikke-kjoettstoffer | |
| Laliberte et al. | IMPROVED SYNTHESIS OF N-ALKYL-ASPARTIC ACIDS | |
| ITMI981997A1 (it) | Processo per la produzione di ormoni tiroidei | |
| KR950011412B1 (ko) | 신규한 이소퀴놀린 화합물(들)과 이들을 함유하는 약제학적 조성물 및 그들의 제조방법 |